diff --git a/rbo-base.owl b/rbo-base.owl index 8fe9d40..2b2379d 100644 --- a/rbo-base.owl +++ b/rbo-base.owl @@ -12,12 +12,12 @@ xmlns:terms="http://purl.org/dc/terms/" xmlns:oboInOwl="http://www.geneontology.org/formats/oboInOwl#"> - + RBO is an ontology for the effects of radiation on biota in terrestrial and space environments. Radiation Biology Ontology - 2023-06-15 + 2023-09-05 @@ -164,6 +164,12 @@ + + + + + + @@ -511,6 +517,12 @@ + + + + + + @@ -761,11 +773,10 @@ - mixed radiation The samples were exposed to a mixed radiation field consisting of several ions at different energies. The process of exposing the same sample to more than one type and/or energy of radiation, in sequence or simultaneously. - mixed field|mixed radiation - mixed radiation field + mixed field|mixed radiation field + mixed radiation @@ -1287,6 +1298,7 @@ A study of the impact of radiation on the composition of or processes within the natural or anthropogenic environment. environmental study + A owl:deprecated @@ -1631,7 +1643,7 @@ - + charged particle Charged particles with kinetic energy imparted by natural or artificial means (such as by a particle accelerator) charged particle @@ -1872,10 +1884,10 @@ - Unplanned exposure to naturally occurring radiation (NORM) of any type in any environment . + Exposure to naturally occurring radiation (NORM) of any type in any environment . 0000-0002-5111-7263 Environmental irradiation - Naturally occurring radiation exposure (NORM) + Exposure to naturally ocurring radioactive material @@ -1957,6 +1969,7 @@ Incidental exposure to naturally occurring radiation in a natural or anthropogenic environment, such as geographical areas with high background levels of radiation or specific locations such as Uranium mines. 0000-0002-5111-7263 Unplanned naturally occurring radiation exposure + TRUE @@ -1978,7 +1991,7 @@ Studies relating to human society and the interrelation of social and educational factors with individual thought and behaviour including mental illness. 0000-0002-5111-7263 - Social and psychosocial studies + Social and psychosocial study @@ -2068,7 +2081,7 @@ Studies of the presence of radiation of any type in the natural or anthropogenic environment and its impact on animals, plants, and microorganisms. This includes studies measuring nuclide transfer in the environment, and interaction with meteorological phenomena. This excludes occupational exposure and the human working environment. 0000-0002-5111-7263 - Environmental studies + Environmental study @@ -2626,7 +2639,7 @@ Study of radiation levels and effects in the natural environment. 0000-0002-5111-7263 - Natural environment studies + Natural environment study @@ -2857,7 +2870,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or regulation of the nuclear industries. 0000-0002-5111-7263 - Attitudinal studies nuclear industry risk perception + Attitudinal study of nuclear industry risk perception @@ -2868,7 +2881,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ecological integrity towards natural or anthropogenic ionising radiation in the environment. 0000-0002-5111-7263 - Attitudinal studies towards ionising radiation in the environment + Attitudinal study towards ionising radiation in the environment @@ -2879,7 +2892,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ecological integrity towards natural or anthropogenic non-ionising radiation in the natural environment. 0000-0002-5111-7263 - Attitudinal studies towards non-ionising radiation in the environment + Attitudinal study towards non-ionising radiation in the environment @@ -2890,7 +2903,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety and efficacy in a clinical context where radiation is used for diagnostic or therapeutic procedures.. 0000-0002-5111-7263 - Attitudinal studies towards medical radiation procedures + Attitudinal study towards medical radiation procedures @@ -2901,7 +2914,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety towards natural or anthropogenic non-ionising radiation in the occupational environment. 0000-0002-5111-7263 - Attitudinal studies towards radiation in the occupational environment + Attitudinal study towards radiation in the occupational environment @@ -3180,7 +3193,7 @@ Unplanned irradiation that is non-anthropogenic in origin - Unplanned non-anthropogenic irradiation + Unplanned naturally occurring radiation exposure @@ -3404,7 +3417,7 @@ sham irradiation - A protocol in which a sample is kept under conditions identical to irradiated samples, without exposure + Sham irradiation refers to a procedure in which participants or subjects in an experiment are exposed to simulated radiation, mimicking precisely the conditions of actual irradiation. The purpose of using sham irradiation is to create a control group that experiences the non-specific effects of the experimental setup, while excluding the specific effects associated with radiation exposure. Jack Miller sham sham irradiation @@ -3664,10 +3677,11 @@ HZE - Fully ionized atomic nuclei with 2 or more protons and energies in excess of tens of MeV per nucleon + Fully ionized atomic nucleus with 2 or more protons and energies in excess of tens of MeV per nucleon Jack Miller HZE - highly charged energetic nuclei + highly charged energetic nuclei + highly charged energetic nucleus @@ -4059,7 +4073,13 @@ - + + + + + + + The path of a particle in matter, delineated by sites where the particle deposits energy. particle track @@ -4127,6 +4147,95 @@ + + + + + Sham irradiation in which an identical irradiation protocol (with the exception of the administration of the radiation exposure) is not followed in every respect. + Use approximate sham irradiation when at least one aspect of the irradiation (with the exception of the administration of the radiation exposure) is not followed precisely. For example, Not placing an organism or sample in a beam line for the same length of time as the irradiated organism(s) or sample(s) were left in the beam. + approximate sham irradiation + + + + + + + + + Experimental internal radiation exposure of rodents to radon gas through inhalation. + Exposure to an inhaled, ingested, injected or implanted source of radiation of any origin as part of a planned or accidental process. + internal radiation exposure + + + + + + + + + Mice exposed to external radiation from a Sr source. + Exposure to an external source of radiation of any origin or type. + https://orcid.org/0000-0002-5111-7263 + external radiation exposure + + + + + + + + + Sham irradiation in which an identical irradiation protocol is followed in every respect, with the exception of the administration of the radiation exposure. + Use complete sham irradiation when all steps of an irradiation protocol are followed for sham control group (with the exception of administration of the radiation exposure). + complete sham irradiation + + + + + + + + + + Planned exposure of an entity to radiation of any type, for example as part of a medical or experimental procedure with the intention of exposing the entity to radiation energy internally by the ingestion, inhalation or implantation of a source of radiation. + https://orcid.org/0000-0002-5111-7263 + Research subjects participating in a clinical trial using an internally implanted radiation source have an internal experimental radiation exposure + internal experimental radiation exposure + + + + + + + + + The direct or indirect transfer of energy from radiation to a medium through ionisation or excitation of the atoms of the medium. + energy deposition event + + + + + + + + + + + + + + + track formation + + + + + + + + + + diff --git a/rbo-full.owl b/rbo-full.owl index 42a9b75..eedd2e5 100644 --- a/rbo-full.owl +++ b/rbo-full.owl @@ -32,11 +32,11 @@ xmlns:ncbitaxon="http://purl.obolibrary.org/obo/ncbitaxon#" xmlns:oboInOwl1="oboInOwl:"> - + RBO is an ontology for the effects of radiation on biota in terrestrial and space environments. Radiation Biology Ontology - 2023-06-15 + 2023-09-05 @@ -1407,7 +1407,9 @@ We also have the outstanding issue of how to aim different definitions to differ - + + has_alternative_id + @@ -1446,13 +1448,17 @@ We also have the outstanding issue of how to aim different definitions to differ - + + has_obo_namespace + - + + has_related_synonym + @@ -1476,7 +1482,9 @@ We also have the outstanding issue of how to aim different definitions to differ - + + in_subset + @@ -8738,6 +8746,34 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + An atom of an element that exhibits properties that are between those of metals and nonmetals, or that has a mixture of them. The term generally includes boron, silicon, germanium, arsenic, antimony, and tellurium, while carbon, aluminium, selenium, polonium, and astatine are less commonly included. + Wikipedia:Metalloid + chebi_ontology + metalloid + metalloids + CHEBI:137980 + + metalloid atom + + + + + metalloid + ChEBI + + + + + metalloids + ChEBI + + + + @@ -8952,10 +8988,8 @@ For example, A and B may be gene products and binding of B by A positively regul - - The general name for the hydrogen nucleus, to be used without regard to the hydrogen nuclear mass (either for hydrogen in its natural abundance or where it is not desired to distinguish between the isotopes). +1 H @@ -9024,6 +9058,131 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + A trace radioisotope of argon with atomic mass of 38.964313 and a half-life of 269 years. + 0 + [39Ar] + InChI=1S/Ar/i1-1 + XKRFYHLGVUSROY-BJUDXGSMSA-N + 38.964 + 38.96431 + [Ar] + CAS:25729-41-3 + PMID:16429279 + PMID:17781454 + PMID:17791262 + PMID:28017500 + PMID:28755564 + PMID:30487580 + chebi_ontology + (39)18Ar + (39)Ar + (39)Ar radioisotope + Ar-39 + Ar-39 radioisotope + argon 39 + argon, isotope of mass 39 + argon-39 + CHEBI:155827 + + argon-39 atom + + + + + CAS:25729-41-3 + ChemIDplus + + + + + PMID:16429279 + Europe PMC + + + + + PMID:17781454 + Europe PMC + + + + + PMID:17791262 + Europe PMC + + + + + PMID:28017500 + Europe PMC + + + + + PMID:28755564 + Europe PMC + + + + + PMID:30487580 + Europe PMC + + + + + (39)18Ar + ChEBI + + + + + (39)Ar + ChemIDplus + + + + + (39)Ar radioisotope + ChEBI + + + + + Ar-39 + ChEBI + + + + + Ar-39 radioisotope + ChEBI + + + + + argon 39 + ChEBI + + + + + argon, isotope of mass 39 + ChemIDplus + + + + + argon-39 + ChEBI + + + + @@ -9106,7 +9265,7 @@ For example, A and B may be gene products and binding of B by A positively regul polynucleotides - ChEBI + ChEBI @@ -9748,6 +9907,1288 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + A minor stable isotope of calcium with relative atomic mass 42.95877 and 0.135 atom percent natural abundance. + 0 + [43Ca] + InChI=1S/Ca/i1+3 + OYPRJOBELJOOCE-AKLPVKDBSA-N + 42.959 + 42.95877 + [43Ca] + CAS:14333-06-3 + PMID:11859764 + PMID:19117733 + PMID:20463996 + PMID:20574585 + PMID:23163540 + PMID:23398971 + PMID:24874995 + PMID:25306191 + PMID:29770988 + PMID:6548252 + ((43)Ca)calcium + chebi_ontology + (43)20Ca + (43)Ca + (43)calcium + Ca-43 + calcium, isotope of mass 43 + calcium-43 + calcium-43 isotope + CHEBI:176566 + + calcium-43 atom + + + + + CAS:14333-06-3 + ChemIDplus + + + + + PMID:11859764 + Europe PMC + + + + + PMID:19117733 + Europe PMC + + + + + PMID:20463996 + Europe PMC + + + + + PMID:20574585 + Europe PMC + + + + + PMID:23163540 + Europe PMC + + + + + PMID:23398971 + Europe PMC + + + + + PMID:24874995 + Europe PMC + + + + + PMID:25306191 + Europe PMC + + + + + PMID:29770988 + Europe PMC + + + + + PMID:6548252 + Europe PMC + + + + + ((43)Ca)calcium + IUPAC + + + + + + (43)20Ca + ChEBI + + + + + (43)Ca + ChemIDplus + + + + + (43)calcium + ChEBI + + + + + Ca-43 + ChEBI + + + + + calcium, isotope of mass 43 + ChemIDplus + + + + + calcium-43 + ChemIDplus + + + + + calcium-43 isotope + ChEBI + + + + + + + + + A stable isotope of molybdenum with relative atomic mass 97.90541, 24.29 atom percent natural abundance and nuclear spin 0. + 0 + [98Mo] + InChI=1S/Mo/i1+2 + ZOKXTWBITQBERF-NJFSPNSNSA-N + 97.905 + 97.90541 + [98Mo] + CAS:14392-20-2 + PMID:19720541 + PMID:22796396 + PMID:22970917 + PMID:24593536 + PMID:25087173 + PMID:25168118 + PMID:25880611 + PMID:26397967 + PMID:26808401 + ((98)Mo)molybdenum + chebi_ontology + (98)42Mo + (98)Mo + Mo-98 + molybdenum, isotope of mass 98 + molybdenum-98 + CHEBI:176570 + + molybdenum-98 atom + + + + + CAS:14392-20-2 + ChemIDplus + + + + + PMID:19720541 + Europe PMC + + + + + PMID:22796396 + Europe PMC + + + + + PMID:22970917 + Europe PMC + + + + + PMID:24593536 + Europe PMC + + + + + PMID:25087173 + SUBMITTER + + + + + PMID:25168118 + Europe PMC + + + + + PMID:25880611 + Europe PMC + + + + + PMID:26397967 + Europe PMC + + + + + PMID:26808401 + Europe PMC + + + + + ((98)Mo)molybdenum + IUPAC + + + + + + (98)42Mo + ChEBI + + + + + (98)Mo + ChemIDplus + + + + + Mo-98 + ChEBI + + + + + molybdenum, isotope of mass 98 + ChemIDplus + + + + + molybdenum-98 + ChemIDplus + + + + + + + + + A major stable isotope of strontium with relative atomic mass 87.90561 and 82.58 atom percent natural abundance. + 0 + [88Sr] + InChI=1S/Sr/i1+0 + CIOAGBVUUVVLOB-IGMARMGPSA-N + 87.906 + 87.90561 + [88Sr] + CAS:14119-10-9 + PMID:11893161 + PMID:27829691 + PMID:32350478 + PMID:33328666 + PMID:33834832 + PMID:6337617 + ((88)Sr)strontium + chebi_ontology + (88)38Sr + (88)Sr + (88)strontium + Sr-88 + strontium, isotope of mass 88 + strontium-88 + strontium-88 isotope + CHEBI:176571 + + strontium-88 atom + + + + + CAS:14119-10-9 + ChemIDplus + + + + + PMID:11893161 + Europe PMC + + + + + PMID:27829691 + Europe PMC + + + + + PMID:32350478 + Europe PMC + + + + + PMID:33328666 + Europe PMC + + + + + PMID:33834832 + Europe PMC + + + + + PMID:6337617 + SUBMITTER + + + + + ((88)Sr)strontium + IUPAC + + + + + + (88)38Sr + ChEBI + + + + + (88)Sr + ChemIDplus + + + + + (88)strontium + ChEBI + + + + + Sr-88 + ChEBI + + + + + strontium, isotope of mass 88 + ChemIDplus + + + + + strontium-88 + ChemIDplus + + + + + strontium-88 isotope + ChEBI + + + + + + + + + A stable isotope of rubidium with relative atomic mass 84.91179, 72.17 atom percent natural abundance and nuclear spin 5/2. + 0 + [85Rb] + InChI=1S/Rb/i1+0 + IGLNJRXAVVLDKE-IGMARMGPSA-N + 84.912 + 84.91179 + [85Rb] + CAS:13982-12-2 + PMID:18026483 + PMID:18033464 + PMID:18291893 + PMID:18382518 + PMID:19855587 + PMID:25087142 + PMID:32909800 + PMID:33709729 + PMID:34170158 + ((85)Rb)rubidium + chebi_ontology + (85)37Rb + (85)Rb + Rb-85 + rubidium, isotope of mass 85 + rubidium-85 + CHEBI:176572 + + rubidium-85 atom + + + + + CAS:13982-12-2 + ChemIDplus + + + + + PMID:18026483 + Europe PMC + + + + + PMID:18033464 + Europe PMC + + + + + PMID:18291893 + Europe PMC + + + + + PMID:18382518 + Europe PMC + + + + + PMID:19855587 + Europe PMC + + + + + PMID:25087142 + SUBMITTER + + + + + PMID:32909800 + Europe PMC + + + + + PMID:33709729 + Europe PMC + + + + + PMID:34170158 + Europe PMC + + + + + ((85)Rb)rubidium + IUPAC + + + + + + (85)37Rb + ChEBI + + + + + (85)Rb + ChemIDplus + + + + + Rb-85 + ChEBI + + + + + rubidium, isotope of mass 85 + ChemIDplus + + + + + rubidium-85 + ChemIDplus + + + + + + + + + A stable isotope of selenium with relative atomic mass 81.91670, 8.82 atom percent natural abundance and nuclear spin 0. + 0 + [82Se] + InChI=1S/Se/i1+3 + BUGBHKTXTAQXES-AKLPVKDBSA-N + 81.917 + 81.91670 + [82Se] + CAS:14687-58-2 + Chemspider:4892236 + PMID:16028633 + PMID:18781022 + PMID:21139275 + PMID:22258472 + PMID:23575454 + PMID:29932707 + PMID:30881205 + PMID:31386478 + PMID:31951429 + PMID:33576665 + PMID:6337549 + ((82)Se)selenium + chebi_ontology + (82)34Se + (82)Se + Se-82 + selenium, isotope of mass 82 + selenium-82 + CHEBI:176573 + + selenium-82 atom + + + + + CAS:14687-58-2 + ChemIDplus + + + + + PMID:16028633 + Europe PMC + + + + + PMID:18781022 + Europe PMC + + + + + PMID:21139275 + Europe PMC + + + + + PMID:22258472 + Europe PMC + + + + + PMID:23575454 + Europe PMC + + + + + PMID:29932707 + Europe PMC + + + + + PMID:30881205 + Europe PMC + + + + + PMID:31386478 + Europe PMC + + + + + PMID:31951429 + Europe PMC + + + + + PMID:33576665 + Europe PMC + + + + + PMID:6337549 + SUBMITTER + + + + + ((82)Se)selenium + IUPAC + + + + + + (82)34Se + ChEBI + + + + + (82)Se + ChemIDplus + + + + + Se-82 + ChEBI + + + + + selenium, isotope of mass 82 + ChemIDplus + + + + + selenium-82 + ChemIDplus + + + + + + + + + A stable isotope of zinc with relative atomic mass 65.92603, 27.7 atom percent natural abundance and nuclear spin 0. + 0 + [66Zn] + InChI=1S/Zn/i1+1 + HCHKCACWOHOZIP-OUBTZVSYSA-N + 65.926 + 65.92603 + [66Zn] + CAS:14378-33-7 + PMID:12447866 + PMID:19836537 + PMID:20155761 + PMID:21047059 + PMID:24196216 + PMID:26065372 + PMID:26808401 + PMID:27189145 + PMID:27306032 + ((66)Zn)zinc + chebi_ontology + (66)30Zn + (66)Zn + Zn-66 + zinc, isotope of mass 66 + zinc-66 + CHEBI:176574 + + zinc-66 atom + + + + + CAS:14378-33-7 + ChemIDplus + + + + + PMID:12447866 + SUBMITTER + + + + + PMID:19836537 + Europe PMC + + + + + PMID:20155761 + Europe PMC + + + + + PMID:21047059 + Europe PMC + + + + + PMID:24196216 + Europe PMC + + + + + PMID:26065372 + Europe PMC + + + + + PMID:26808401 + Europe PMC + + + + + PMID:27189145 + Europe PMC + + + + + PMID:27306032 + Europe PMC + + + + + ((66)Zn)zinc + IUPAC + + + + + + (66)30Zn + ChEBI + + + + + (66)Zn + ChemIDplus + + + + + Zn-66 + ChemIDplus + + + + + zinc, isotope of mass 66 + ChemIDplus + + + + + zinc-66 + ChemIDplus + + + + + + + + + A stable isotope of nickel with relative atomic mass 59.93079, 26.223 atom percent natural abundance and nuclear spin 0. + 0 + [60Ni] + InChI=1S/Ni/i1+1 + PXHVJJICTQNCMI-OUBTZVSYSA-N + 59.931 + 59.93079 + [60Ni] + CAS:13981-80-1 + PMID:15308160 + PMID:22583786 + PMID:23149182 + PMID:25126912 + PMID:25700212 + PMID:26709546 + PMID:29376683 + ((60)Ni)nickel + chebi_ontology + (60)Ni + Ni-60 + nickel, isotope of mass 60 + nickel-60 + CHEBI:176575 + + nickel-60 atom + + + + + CAS:13981-80-1 + ChemIDplus + + + + + PMID:15308160 + Europe PMC + + + + + PMID:22583786 + Europe PMC + + + + + PMID:23149182 + Europe PMC + + + + + PMID:25126912 + Europe PMC + + + + + PMID:25700212 + Europe PMC + + + + + PMID:26709546 + Europe PMC + + + + + PMID:29376683 + Europe PMC + + + + + ((60)Ni)nickel + IUPAC + + + + + + (60)Ni + ChEBI + + + + + Ni-60 + ChEBI + + + + + nickel, isotope of mass 60 + ChemIDplus + + + + + nickel-60 + ChemIDplus + + + + + + + + + A stable isotope of cobalt with relative atomic mass 58.93319, 100 atom percent natural abundance and nuclear spin 7/2. + 0 + [59Co] + InChI=1S/Co/i1+0 + GUTLYIVDDKVIGB-IGMARMGPSA-N + 58.933 + 58.93319 + [59Co] + PMID:10617436 + PMID:10940985 + PMID:11421673 + PMID:11528329 + PMID:12943912 + PMID:19150229 + PMID:19421527 + PMID:25069794 + PMID:25169133 + PMID:26066447 + PMID:26641288 + PMID:27355901 + PMID:30137661 + PMID:31367328 + PMID:32478347 + ((59)Co)cobalt + chebi_ontology + (59)27Co + (59)Co + Co-59 + cobalt, isotope of mass 59 + cobalt-(59)Co + cobalt-59 + CHEBI:176578 + + cobalt-59 atom + + + + + PMID:10617436 + Europe PMC + + + + + PMID:10940985 + Europe PMC + + + + + PMID:11421673 + Europe PMC + + + + + PMID:11528329 + SUBMITTER + + + + + PMID:12943912 + Europe PMC + + + + + PMID:19150229 + Europe PMC + + + + + PMID:19421527 + Europe PMC + + + + + PMID:25069794 + Europe PMC + + + + + PMID:25169133 + Europe PMC + + + + + PMID:26066447 + Europe PMC + + + + + PMID:26641288 + Europe PMC + + + + + PMID:27355901 + Europe PMC + + + + + PMID:30137661 + Europe PMC + + + + + PMID:31367328 + Europe PMC + + + + + PMID:32478347 + Europe PMC + + + + + ((59)Co)cobalt + IUPAC + + + + + + (59)27Co + ChEBI + + + + + (59)Co + ChEBI + + + + + Co-59 + ChEBI + + + + + cobalt, isotope of mass 59 + ChEBI + + + + + cobalt-(59)Co + ChEBI + + + + + cobalt-59 + ChEBI + + + + + + + + + A stable isotope of manganese with relative atomic mass 54.93804, 100 atom percent natural abundance and nuclear spin 5/2. + 0 + [55Mn] + InChI=1S/Mn/i1+0 + PWHULOQIROXLJO-IGMARMGPSA-N + 54.938 + 54.93804 + [55Mn] + PMID:20645339 + PMID:21058720 + PMID:21341708 + PMID:24993844 + PMID:25179135 + PMID:25891681 + ((55)Mn)manganese + chebi_ontology + (55)25Mn + (55)Mn + Mn-55 + manganese, isotope of mass 55 + manganese-55 + CHEBI:176583 + + manganese-55 atom + + + + + PMID:20645339 + Europe PMC + + + + + PMID:21058720 + Europe PMC + + + + + PMID:21341708 + Europe PMC + + + + + PMID:24993844 + Europe PMC + + + + + PMID:25179135 + Europe PMC + + + + + PMID:25891681 + Europe PMC + + + + + ((55)Mn)manganese + IUPAC + + + + + + (55)25Mn + ChEBI + + + + + (55)Mn + ChEBI + + + + + Mn-55 + ChEBI + + + + + manganese, isotope of mass 55 + ChEBI + + + + + manganese-55 + ChEBI + + + + + + + + + A stable isotope of arsenic with relative atomic mass 74.921596, 100 atom percent natural abundance and nuclear spin 3/2. + 0 + [75As] + InChI=1S/As/i1+0 + RQNWIZPPADIBDY-IGMARMGPSA-N + 74.922 + 74.92159 + [75As] + ((75)As)arsenic + chebi_ontology + (75)33As + (75)As + As-75 + arsenic, isotope of mass 75 + arsenic-75 + CHEBI:176584 + + arsenic-75 atom + + + + + ((75)As)arsenic + IUPAC + + + + + + (75)33As + ChEBI + + + + + (75)As + ChEBI + + + + + As-75 + ChEBI + + + + + arsenic, isotope of mass 75 + ChEBI + + + + + arsenic-75 + ChEBI + + + + @@ -9818,8 +11259,122 @@ For example, A and B may be gene products and binding of B by A positively regul - iron atom + An iron group element atom that has atomic number 26. + 0 + Fe + InChI=1S/Fe + XEEYBQQBJWHFJM-UHFFFAOYSA-N + 55.84500 + 55.93494 + [Fe] + CHEBI:13322 + CHEBI:24872 + CHEBI:5974 + CAS:7439-89-6 + DrugBank:DB01592 + HMDB:HMDB0015531 + KEGG:C00023 + Reaxys:4122945 + WebElements:Fe + iron + chebi_ontology + 26Fe + Eisen + Fe + Iron + fer + ferrum + hierro + iron + CHEBI:18248 + + iron atom + + + + CAS:7439-89-6 + ChemIDplus + + + + + CAS:7439-89-6 + KEGG COMPOUND + + + + + CAS:7439-89-6 + NIST Chemistry WebBook + + + + + Reaxys:4122945 + Reaxys + + + + + iron + IUPAC + + + + + + 26Fe + IUPAC + + + + + Eisen + ChEBI + + + + + Fe + IUPAC + + + + + Fe + UniProt + + + + + Iron + KEGG_COMPOUND + + + + + fer + ChEBI + + + + + ferrum + IUPAC + + + + + hierro + ChEBI + + + + + iron + ChEBI + @@ -9850,6 +11405,729 @@ For example, A and B may be gene products and binding of B by A positively regul nucleobases + ChEBI + + + + + + + + + 0 + Mn + InChI=1S/Mn + PWHULOQIROXLJO-UHFFFAOYSA-N + 54.93805 + 54.93804 + [Mn] + CHEBI:13382 + CHEBI:25153 + CHEBI:6681 + CAS:7439-96-5 + KEGG:C00034 + WebElements:Mn + manganese + chebi_ontology + 25Mn + Mangan + Manganese + Mn + manganese + manganeso + manganum + CHEBI:18291 + + manganese atom + + + + + CAS:7439-96-5 + ChemIDplus + + + + + CAS:7439-96-5 + KEGG COMPOUND + + + + + manganese + IUPAC + + + + + + 25Mn + IUPAC + + + + + Mangan + NIST_Chemistry_WebBook + + + + + Manganese + KEGG_COMPOUND + + + + + Mn + IUPAC + + + + + Mn + UniProt + + + + + manganese + ChEBI + + + + + manganeso + ChEBI + + + + + manganum + ChEBI + + + + + + + + + A carbon group element atom with a symbol Fl and atomic number 114. + 0 + Fl + InChI=1S/Fl + WIHJCBVMYKIGOT-UHFFFAOYSA-N + 289.000 + 289.00000 + [Fl] + PMID:16833611 + PMID:17919027 + PMID:19905506 + PMID:20379506 + PMID:20867370 + PMID:23787759 + PMID:24456007 + PMID:29711350 + PMID:36092655 + Wikipedia:Flerovium + chebi_ontology + 114Fl + 114Uuq + E114 + Fl + Uuq + eka-lead + element 114 + ununquadium + CHEBI:194531 + + flerovium atom + + + + + PMID:16833611 + Europe PMC + + + + + PMID:17919027 + Europe PMC + + + + + PMID:19905506 + Europe PMC + + + + + PMID:20379506 + Europe PMC + + + + + PMID:20867370 + Europe PMC + + + + + PMID:23787759 + Europe PMC + + + + + PMID:24456007 + Europe PMC + + + + + PMID:29711350 + Europe PMC + + + + + PMID:36092655 + Europe PMC + + + + + 114Fl + ChEBI + + + + + 114Uuq + ChEBI + + + + + E114 + ChEBI + + + + + Fl + ChEBI + + + + + Uuq + ChEBI + + + + + eka-lead + ChEBI + + + + + element 114 + ChEBI + + + + + ununquadium + ChEBI + + + + + + + + + A boron group element atom with a symbol Nh and atomic number 113. + 0 + Nh + InChI=1S/Nh + KUGNSLWRKGRKGS-UHFFFAOYSA-N + 286.000 + 286.00000 + [Nh] + PMID:19049424 + PMID:34142795 + PMID:34917588 + PMID:36149319 + PMID:9913354 + Wikipedia:Nihonium + chebi_ontology + 113Nh + E113 + Nh + Uut + eka-thallium + element 113 + ununtrium + CHEBI:194533 + + nihonium atom + + + + + PMID:19049424 + Europe PMC + + + + + PMID:34142795 + Europe PMC + + + + + PMID:34917588 + Europe PMC + + + + + PMID:36149319 + Europe PMC + + + + + PMID:9913354 + Europe PMC + + + + + 113Nh + ChEBI + + + + + E113 + ChEBI + + + + + Nh + ChEBI + + + + + Uut + ChEBI + + + + + eka-thallium + ChEBI + + + + + element 113 + ChEBI + + + + + ununtrium + ChEBI + + + + + + + + + A pnictogen atom with a symbol Mc and atomic number 115. + 0 + Mc + InChI=1S/Mc + QDXZEHQJHSHEQF-UHFFFAOYSA-N + 289.000 + 289.00000 + [Mc] + PMID:24074079 + PMID:34142795 + Wikipedia:Moscovium + chebi_ontology + 115Mc + E115 + Mc + Uup + eka-bismuth + element 115 + ununpentium + CHEBI:194535 + + moscovium atom + + + + + PMID:24074079 + Europe PMC + + + + + PMID:34142795 + Europe PMC + + + + + 115Mc + ChEBI + + + + + E115 + ChEBI + + + + + Mc + ChEBI + + + + + Uup + ChEBI + + + + + eka-bismuth + ChEBI + + + + + element 115 + ChEBI + + + + + ununpentium + ChEBI + + + + + + + + + A chalcogen atom with a symbol Lv and atomic number 116. + 0 + Lv + InChI=1S/Lv + ONFASNXETZOODS-UHFFFAOYSA-N + 293.000 + 293.00000 + [Lv] + PMID:17381195 + PMID:27554416 + Wikipedia:Livermorium + chebi_ontology + 116Lv + E116 + Lv + Uuh + eka-polonium + element 116 + ununhexium + CHEBI:194537 + + livermorium atom + + + + + PMID:17381195 + Europe PMC + + + + + PMID:27554416 + Europe PMC + + + + + 116Lv + ChEBI + + + + + E116 + ChEBI + + + + + Lv + ChEBI + + + + + Uuh + ChEBI + + + + + eka-polonium + ChEBI + + + + + element 116 + ChEBI + + + + + ununhexium + ChEBI + + + + + + + + + A halogen atom with a symbol Ts and atomic number 117. + 0 + Ts + InChI=1S/Ts + INMSAURDCVBGHH-UHFFFAOYSA-N + 293.000 + 293.00000 + [Ts] + PMID:16483205 + PMID:19367904 + PMID:20395479 + PMID:23090670 + Wikipedia:Tennessine + chebi_ontology + 117Ts + E117 + Ts + Uus + eka-astatine + element 117 + ununseptium + CHEBI:194539 + + tennessine atom + + + + + PMID:16483205 + Europe PMC + + + + + PMID:19367904 + Europe PMC + + + + + PMID:20395479 + Europe PMC + + + + + PMID:23090670 + Europe PMC + + + + + 117Ts + ChEBI + + + + + E117 + ChEBI + + + + + Ts + ChEBI + + + + + Uus + ChEBI + + + + + eka-astatine + ChEBI + + + + + element 117 + ChEBI + + + + + ununseptium + ChEBI + + + + + + + + + + A p-block element atom with a symbol Og and atomic number 118. + 0 + InChI=1S/Og + GOANEQIZDYDFCO-UHFFFAOYSA-N + 294.000 + 294.00000 + [Og] + PMID:10062781 + PMID:11486061 + PMID:19045133 + PMID:23913741 + PMID:36859080 + Wikipedia:Oganesson + chebi_ontology + 118Og + E118 + Og + Uuo + eka-emanation + eka-radon + element 118 + ununoctium + CHEBI:194541 + + oganesson atom + + + + + PMID:10062781 + Europe PMC + + + + + PMID:11486061 + Europe PMC + + + + + PMID:19045133 + Europe PMC + + + + + PMID:23913741 + Europe PMC + + + + + PMID:36859080 + Europe PMC + + + + + 118Og + ChEBI + + + + + E118 + ChEBI + + + + + Og + ChEBI + + + + + Uuo + ChEBI + + + + + eka-emanation + ChEBI + + + + + eka-radon + ChEBI + + + + + element 118 + ChEBI + + + + + ununoctium ChEBI @@ -9904,14 +12182,159 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + + + alkaline earth metals + chebi_ontology + Erdalkalimetall + Erdalkalimetalle + alkaline earth metal + alkaline-earth metal + alkaline-earth metals + metal alcalino-terreux + metal alcalinoterreo + metales alcalinoterreos + metaux alcalino-terreux + CHEBI:22313 + + alkaline earth metal atom + + + + + alkaline earth metals + IUPAC + + + + + + Erdalkalimetall + ChEBI + + + + + Erdalkalimetalle + ChEBI + + + + + alkaline earth metal + ChEBI + + + + + alkaline-earth metal + ChEBI + + + + + alkaline-earth metals + ChEBI + + + + + metal alcalino-terreux + ChEBI + + + + + metal alcalinoterreo + ChEBI + + + + + metales alcalinoterreos + ChEBI + + + + + metaux alcalino-terreux + ChEBI + + + + - alkali metal atom + alkali metals + chebi_ontology + Alkalimetall + Alkalimetalle + alkali metal + metal alcalin + metal alcalino + metales alcalinos + metaux alcalins + CHEBI:22314 + + alkali metal atom + + + + alkali metals + IUPAC + + + + + + Alkalimetall + ChEBI + + + + + Alkalimetalle + ChEBI + + + + + alkali metal + ChEBI + + + + + metal alcalin + ChEBI + + + + + metal alcalino + ChEBI + + + + + metales alcalinos + ChEBI + + + + + metaux alcalins + ChEBI + @@ -9929,53 +12352,53 @@ For example, A and B may be gene products and binding of B by A positively regul - A monoatomic or polyatomic species having one or more elementary charges of the electron. - Anion - anion - chebi_ontology - Anionen - aniones - anions - CHEBI:22563 + A monoatomic or polyatomic species having one or more elementary charges of the electron. + Anion + anion + chebi_ontology + Anionen + aniones + anions + CHEBI:22563 - anion + anion - Anion - ChEBI + Anion + ChEBI - anion - ChEBI + anion + ChEBI - anion - IUPAC + anion + IUPAC - Anionen - ChEBI + Anionen + ChEBI - aniones - ChEBI + aniones + ChEBI - anions - IUPAC + anions + IUPAC @@ -10060,6 +12483,251 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + 0 + Br + InChI=1S/Br + WKBOTKDWSSQWDR-UHFFFAOYSA-N + 79.90400 + 78.91834 + [Br] + WebElements:Br + bromine + chebi_ontology + 35Br + Br + Brom + brome + bromine + bromo + bromum + CHEBI:22927 + + bromine atom + + + + + bromine + IUPAC + + + + + + 35Br + IUPAC + + + + + Br + ChEBI + + + + + Brom + ChEBI + + + + + brome + ChEBI + + + + + bromine + ChEBI + + + + + bromo + ChEBI + + + + + bromum + ChEBI + + + + + + + + + 0 + Cd + InChI=1S/Cd + BDOSMKKIYDKNTQ-UHFFFAOYSA-N + 112.41100 + 113.90336 + [Cd] + CAS:7440-43-9 + KEGG:C01413 + WebElements:Cd + cadmium + chebi_ontology + 48Cd + Cd + Kadmium + cadmio + cadmium + CHEBI:22977 + + cadmium atom + + + + + CAS:7440-43-9 + ChemIDplus + + + + + CAS:7440-43-9 + KEGG COMPOUND + + + + + CAS:7440-43-9 + NIST Chemistry WebBook + + + + + cadmium + IUPAC + + + + + + 48Cd + IUPAC + + + + + Cd + IUPAC + + + + + Kadmium + NIST_Chemistry_WebBook + + + + + cadmio + ChEBI + + + + + cadmium + ChEBI + + + + + + + + + 0 + Ca + InChI=1S/Ca + OYPRJOBELJOOCE-UHFFFAOYSA-N + 40.07800 + 39.96259 + [Ca] + CAS:7440-70-2 + DrugBank:DB01373 + KEGG:C00076 + WebElements:Ca + calcium + chebi_ontology + 20Ca + Ca + Calcium + Kalzium + calcio + calcium + CHEBI:22984 + + calcium atom + + + + + CAS:7440-70-2 + ChemIDplus + + + + + calcium + IUPAC + + + + + + 20Ca + IUPAC + + + + + Ca + IUPAC + + + + + Ca + UniProt + + + + + Calcium + KEGG_COMPOUND + + + + + Kalzium + ChEBI + + + + + calcio + ChEBI + + + + + calcium + ChEBI + + + + @@ -10206,6 +12874,83 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + 0 + Cl + InChI=1S/Cl + ZAMOUSCENKQFHK-UHFFFAOYSA-N + 35.45270 + 34.96885 + [Cl] + WebElements:Cl + chlorine + chebi_ontology + 17Cl + Chlor + Cl + chlore + chlorine + chlorum + cloro + CHEBI:23116 + + chlorine atom + + + + + chlorine + IUPAC + + + + + + 17Cl + IUPAC + + + + + Chlor + ChEBI + + + + + Cl + IUPAC + + + + + chlore + ChEBI + + + + + chlorine + ChEBI + + + + + chlorum + ChEBI + + + + + cloro + ChEBI + + + + @@ -10249,16 +12994,16 @@ For example, A and B may be gene products and binding of B by A positively regul Any constitutionally or isotopically distinct atom, molecule, ion, ion pair, radical, radical ion, complex, conformer etc., identifiable as a separately distinguishable entity. - molecular entity - chebi_ontology - entidad molecular - entidades moleculares - entite moleculaire - molecular entities - molekulare Entitaet - CHEBI:23367 + molecular entity + chebi_ontology + entidad molecular + entidades moleculares + entite moleculaire + molecular entities + molekulare Entitaet + CHEBI:23367 - molecular entity + molecular entity @@ -10269,39 +13014,39 @@ For example, A and B may be gene products and binding of B by A positively regul - molecular entity - IUPAC + molecular entity + IUPAC - entidad molecular - IUPAC + entidad molecular + IUPAC - entidades moleculares - IUPAC + entidades moleculares + IUPAC - entite moleculaire - IUPAC + entite moleculaire + IUPAC - molecular entities - IUPAC + molecular entities + IUPAC - molekulare Entitaet - ChEBI + molekulare Entitaet + ChEBI @@ -10311,18 +13056,8 @@ For example, A and B may be gene products and binding of B by A positively regul - chebi_ontology - monoatomic cations - CHEBI:23906 - - monoatomic cation + monoatomic cation - - - - monoatomic cations - ChEBI - @@ -10383,29 +13118,106 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + 0 + F + InChI=1S/F + YCKRFDGAMUMZLT-UHFFFAOYSA-N + 18.99840 + 18.99840 + [F] + CAS:7782-41-4 + WebElements:F + fluorine + chebi_ontology + 9F + F + Fluor + fluor + fluorine + fluorum + CHEBI:24061 + + fluorine atom + + + + + CAS:7782-41-4 + ChemIDplus + + + + + fluorine + IUPAC + + + + + + 9F + IUPAC + + + + + F + IUPAC + + + + + Fluor + ChemIDplus + + + + + fluor + ChEBI + + + + + fluorine + ChEBI + + + + + fluorum + ChEBI + + + + - A chemical entity is a physical entity of interest in chemistry including molecular entities, parts thereof, and chemical substances. + A chemical entity is a physical entity of interest in chemistry including molecular entities, parts thereof, and chemical substances. A drug, solvent, chemical, etc., with a property that can be measured such as concentration. A molecular entity consisting of two or more chemical elements. James Malone Tomasz Adamusiak true chemical compound - chemical entity + chemical entity heteroatomic molecular entities heteroatomic molecular entity - chebi_ontology - CHEBI:24431 + chebi_ontology + CHEBI:24431 - chemical entity + chemical entity - chemical entity + chemical entity UniProt @@ -10504,6 +13316,84 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + + halogen + halogens + chebi_ontology + Halogene + group 17 elements + group VII elements + halogene + halogenes + halogeno + halogenos + CHEBI:24473 + + halogen + + + + + halogen + IUPAC + + + + + + halogens + IUPAC + + + + + + Halogene + ChEBI + + + + + group 17 elements + ChEBI + + + + + group VII elements + ChEBI + + + + + halogene + ChEBI + + + + + halogenes + ChEBI + + + + + halogeno + ChEBI + + + + + halogenos + ChEBI + + + + @@ -10522,13 +13412,13 @@ For example, A and B may be gene products and binding of B by A positively regul organic heterocycle - ChEBI + ChEBI organic heterocyclic compounds - ChEBI + ChEBI @@ -10714,17 +13604,17 @@ For example, A and B may be gene products and binding of B by A positively regul - chebi_ontology - inorganic anions - CHEBI:24834 + chebi_ontology + inorganic anions + CHEBI:24834 - inorganic anion + inorganic anion - inorganic anions - ChEBI + inorganic anions + ChEBI @@ -10733,46 +13623,46 @@ For example, A and B may be gene products and binding of B by A positively regul - A molecular entity that contains no carbon. - chebi_ontology - anorganische Verbindungen - inorganic compounds - inorganic entity - inorganic molecular entities - inorganics - CHEBI:24835 + A molecular entity that contains no carbon. + chebi_ontology + anorganische Verbindungen + inorganic compounds + inorganic entity + inorganic molecular entities + inorganics + CHEBI:24835 - inorganic molecular entity + inorganic molecular entity - anorganische Verbindungen - ChEBI + anorganische Verbindungen + ChEBI - inorganic compounds - ChEBI + inorganic compounds + ChEBI - inorganic entity - ChEBI + inorganic entity + ChEBI - inorganic molecular entities - ChEBI + inorganic molecular entities + ChEBI - inorganics - ChEBI + inorganics + ChEBI @@ -10787,6 +13677,98 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + Chemical element with atomic number 53. + 0 + I + InChI=1S/I + ZCYVEMRRCGMTRW-UHFFFAOYSA-N + 126.90447 + 126.90447 + [I] + WebElements:I + iodine + chebi_ontology + 53I + I + Iod + J + Jod + iode + iodine + iodium + yodo + CHEBI:24859 + + iodine atom + + + + + iodine + IUPAC + + + + + + 53I + IUPAC + + + + + I + ChEBI + + + + + Iod + ChEBI + + + + + J + ChEBI + + + + + Jod + ChEBI + + + + + iode + ChEBI + + + + + iodine + ChEBI + + + + + iodium + ChEBI + + + + + yodo + ChEBI + + + + @@ -10813,18 +13795,8 @@ For example, A and B may be gene products and binding of B by A positively regul - chebi_ontology - monoatomic ions - CHEBI:24867 - - monoatomic ion + monoatomic ion - - - - monoatomic ions - ChEBI - @@ -10841,53 +13813,53 @@ For example, A and B may be gene products and binding of B by A positively regul - A molecular entity having a net electric charge. - Ion - ion - chebi_ontology - Ionen - iones - ions - CHEBI:24870 + A molecular entity having a net electric charge. + Ion + ion + chebi_ontology + Ionen + iones + ions + CHEBI:24870 - ion + ion - Ion - ChEBI + Ion + ChEBI - ion - ChEBI + ion + ChEBI - ion - IUPAC + ion + IUPAC - Ionen - ChEBI + Ionen + ChEBI - iones - ChEBI + iones + ChEBI - ions - ChEBI + ions + ChEBI @@ -10901,163 +13873,412 @@ For example, A and B may be gene products and binding of B by A positively regul - - - - - linear tetrapyrrole - - - - - + - - - Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. - CHEBI:26619 - CHEBI:35220 - metabolite + + + + 0 + Pb + InChI=1S/Pb + WABPQHHGFIMREM-UHFFFAOYSA-N + 207.20000 + 207.97665 + [Pb] + KEGG:C06696 + WebElements:Pb + lead chebi_ontology - metabolites - primary metabolites - secondary metabolites - CHEBI:25212 + 82Pb + Blei + Pb + lead + plomb + plomo + plumbum + CHEBI:25016 - metabolite + lead atom - + - metabolite + lead IUPAC - + - metabolites + 82Pb + IUPAC + + + + + Blei ChEBI - + - primary metabolites + Pb + IUPAC + + + + + lead ChEBI - + - secondary metabolites + plomb ChEBI + + + + plomo + ChEBI + + + + + plumbum + IUPAC + - - - - - - metal cation - - - - - + - - - - elemental molecule + + + linear tetrapyrrole - + - - - Any polyatomic entity that is an electrically neutral entity consisting of more than one atom. - molecule + + + 0 + Mg + InChI=1S/Mg + FYYHWMGAXLPEAU-UHFFFAOYSA-N + 24.30500 + 23.98504 + [Mg] + CAS:7439-95-4 + DrugBank:DB01378 + Gmelin:16207 + KEGG:C00305 + WebElements:Mg + magnesium chebi_ontology - Molekuel - molecula - molecules - neutral molecular compounds - CHEBI:25367 + 12Mg + Magnesium + Mg + magnesio + magnesium + CHEBI:25107 - molecule + magnesium atom - + + + CAS:7439-95-4 + ChemIDplus + + + + + Gmelin:16207 + Gmelin + + + - molecule + magnesium IUPAC + - + - Molekuel + 12Mg + IUPAC + + + + + Magnesium ChEBI - + - molecula + Mg IUPAC - + - molecules - IUPAC + Mg + UniProt - + - neutral molecular compounds - IUPAC + magnesio + ChEBI + + + + + magnesium + ChEBI - + - - - +1 - 0.00000 - [*+] + + + 0 + Hg + InChI=1S/Hg + QSHDDOUJBYECFT-UHFFFAOYSA-N + 200.59000 + 201.97064 + [Hg] + CAS:7439-97-6 + WebElements:Hg + mercury chebi_ontology - monoatomic monocations - monovalent inorganic cations - CHEBI:25414 + 80Hg + Hg + Quecksilber + azogue + hydrargyrum + liquid silver + mercure + mercurio + mercury + quicksilver + CHEBI:25195 - monoatomic monocation + mercury atom - + - monoatomic monocations - ChEBI + Hg + IUPAC + + + + + Quecksilber + ChemIDplus - + - monovalent inorganic cations + azogue ChEBI - - - - - - - - - - + + + + hydrargyrum + IUPAC + + + + + liquid silver + ChemIDplus + + + + + mercure + ChemIDplus + + + + + mercurio + ChEBI + + + + + mercury + ChEBI + + + + + quicksilver + ChemIDplus + + + + + CAS:7439-97-6 + ChemIDplus + + + + + mercury + IUPAC + + + + + + 80Hg + IUPAC + + + + + + + + + Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. + CHEBI:26619 + CHEBI:35220 + metabolite + chebi_ontology + metabolites + primary metabolites + secondary metabolites + CHEBI:25212 + + metabolite + + + + + metabolite + IUPAC + + + + + + metabolites + ChEBI + + + + + primary metabolites + ChEBI + + + + + secondary metabolites + ChEBI + + + + + + + + + + metal cation + + + + + + + + + + elemental molecule + + + + + + + + + Any polyatomic entity that is an electrically neutral entity consisting of more than one atom. + molecule + chebi_ontology + Molekuel + molecula + molecules + neutral molecular compounds + CHEBI:25367 + + molecule + + + + + molecule + IUPAC + + + + + Molekuel + ChEBI + + + + + molecula + IUPAC + + + + + molecules + IUPAC + + + + + neutral molecular compounds + IUPAC + + + + + + + + + monoatomic monocation + + + + + + + + + + + @@ -11399,12 +14620,167 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + 0 + K + InChI=1S/K + ZLMJMSJWJFRBEC-UHFFFAOYSA-N + 39.09830 + 38.96371 + [K] + CAS:7440-09-7 + DrugBank:DB01345 + KEGG:C00238 + WebElements:K + potassium + chebi_ontology + 19K + K + Kalium + kalium + potasio + potassium + CHEBI:26216 + + potassium atom + + + + + CAS:7440-09-7 + ChemIDplus + + + + + potassium + IUPAC + + + + + + 19K + IUPAC + + + + + K + IUPAC + + + + + Kalium + ChemIDplus + + + + + kalium + IUPAC + + + + + potasio + ChEBI + + + + + potassium + ChEBI + + + + - sodium atom + 0 + Na + InChI=1S/Na + KEAYESYHFKHZAL-UHFFFAOYSA-N + 22.98977 + 22.98977 + [Na] + CAS:7440-23-5 + Gmelin:16221 + KEGG:C01330 + WebElements:Na + sodium + chebi_ontology + 11Na + Na + Natrium + natrium + sodio + sodium + CHEBI:26708 + + sodium atom + + + + CAS:7440-23-5 + ChemIDplus + + + + + Gmelin:16221 + Gmelin + + + + + sodium + IUPAC + + + + + + 11Na + IUPAC + + + + + Na + IUPAC + + + + + Natrium + ChemIDplus + + + + + natrium + IUPAC + + + + + sodio + ChemIDplus + + + + + sodium + ChEBI + @@ -11473,8 +14849,118 @@ For example, A and B may be gene products and binding of B by A positively regul - sulfur atom + 0 + S + InChI=1S/S + NINIDFKCEFEMDL-UHFFFAOYSA-N + 32.06600 + 31.97207 + [S] + CAS:7704-34-9 + KEGG:C00087 + KEGG:D06527 + PPDB:605 + WebElements:S + sulfur + chebi_ontology + 16S + Elemental sulfur + S + Schwefel + azufre + soufre + sulfur + sulphur + theion + CHEBI:26833 + + sulfur atom + + + + CAS:7704-34-9 + ChemIDplus + + + + + CAS:7704-34-9 + NIST Chemistry WebBook + + + + + sulfur + IUPAC + + + + + + 16S + IUPAC + + + + + Elemental sulfur + KEGG_COMPOUND + + + + + S + IUPAC + + + + + S + KEGG_COMPOUND + + + + + Schwefel + ChEBI + + + + + azufre + ChEBI + + + + + soufre + ChEBI + + + + + sulfur + ChEBI + + + + + sulfur + UniProt + + + + + sulphur + ChEBI + + + + + theion + IUPAC + @@ -11503,12 +14989,186 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + + 0 + Sn + InChI=1S/Sn + ATJFFYVFTNAWJD-UHFFFAOYSA-N + 118.71000 + 119.90220 + [Sn] + CAS:7440-31-5 + UM-BBD_compID:c0585 + WebElements:Sn + tin + chebi_ontology + 50Sn + Sn + Zinn + estano + etain + stannum + tin + CHEBI:27007 + + tin atom + + + + + CAS:7440-31-5 + ChemIDplus + + + + + UM-BBD_compID:c0585 + UM-BBD + + + + + tin + IUPAC + + + + + + 50Sn + IUPAC + + + + + Sn + IUPAC + + + + + Zinn + ChemIDplus + + + + + estano + ChEBI + + + + + etain + ChEBI + + + + + stannum + IUPAC + + + + + tin + ChEBI + + + + - transition element atom + An element whose atom has an incomplete d sub-shell, or which can give rise to cations with an incomplete d sub-shell. + transition element + chebi_ontology + Uebergangselement + Uebergangsmetalle + metal de transicion + metal de transition + metales de transicion + metaux de transition + transition element + transition elements + transition metal + transition metals + CHEBI:27081 + + transition element atom + + + + transition element + IUPAC + + + + + + Uebergangselement + ChEBI + + + + + Uebergangsmetalle + ChEBI + + + + + metal de transicion + ChEBI + + + + + metal de transition + ChEBI + + + + + metales de transicion + ChEBI + + + + + metaux de transition + ChEBI + + + + + transition element + ChEBI + + + + + transition elements + ChEBI + + + + + transition metal + ChEBI + + + + + transition metals + ChEBI + @@ -11546,6 +15206,182 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + 0 + U + InChI=1S/U + JFALSRSLKYAFGM-UHFFFAOYSA-N + 238.02890 + 238.05079 + [U] + CAS:7440-61-1 + WebElements:U + uranium + chebi_ontology + 92U + U + Uran + uranio + uranium + CHEBI:27214 + + uranium atom + + + + + CAS:7440-61-1 + ChemIDplus + + + + + uranium + IUPAC + + + + + + 92U + IUPAC + + + + + U + IUPAC + + + + + Uran + ChEBI + + + + + uranio + ChEBI + + + + + uranium + ChEBI + + + + + + + + + 0 + Zn + InChI=1S/Zn + HCHKCACWOHOZIP-UHFFFAOYSA-N + 65.39000 + 63.92914 + [Zn] + CAS:7440-66-6 + Gmelin:16321 + KEGG:C00038 + PDBeChem:ZN + WebElements:Zn + zinc + chebi_ontology + 30Zn + Zink + Zn + Zn(II) + Zn2+ + cinc + zinc + zincum + CHEBI:27363 + + zinc atom + + + + + CAS:7440-66-6 + ChemIDplus + + + + + CAS:7440-66-6 + KEGG COMPOUND + + + + + Gmelin:16321 + Gmelin + + + + + zinc + IUPAC + + + + + + 30Zn + IUPAC + + + + + Zink + ChEBI + + + + + Zn + IUPAC + + + + + Zn(II) + KEGG_COMPOUND + + + + + Zn2+ + KEGG_COMPOUND + + + + + cinc + ChEBI + + + + + zinc + ChEBI + + + + + zincum + ChEBI + + + + @@ -11603,6 +15439,388 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + + + 0 + B + InChI=1S/B + ZOXJGFHDIHLPTG-UHFFFAOYSA-N + 10.81100 + 11.00930 + [B] + CHEBI:22915 + CHEBI:3152 + CAS:7440-42-8 + KEGG:C06266 + WebElements:B + boron + chebi_ontology + 5B + B + Bor + Boron + boracium + bore + boro + boron + CHEBI:27560 + + boron atom + + + + + CAS:7440-42-8 + ChemIDplus + + + + + CAS:7440-42-8 + KEGG COMPOUND + + + + + boron + IUPAC + + + + + + 5B + IUPAC + + + + + B + KEGG_COMPOUND + + + + + Bor + ChEBI + + + + + Boron + KEGG_COMPOUND + + + + + boracium + ChEBI + + + + + bore + ChEBI + + + + + boro + ChEBI + + + + + boron + ChEBI + + + + + + + + + + 0 + As + InChI=1S/As + RQNWIZPPADIBDY-UHFFFAOYSA-N + 74.92160 + 74.92159 + [As] + CHEBI:22630 + CHEBI:2845 + CAS:7440-38-2 + KEGG:C06269 + WebElements:As + arsenic + chebi_ontology + 33As + Arsen + Arsenic + As + arsenic + arsenico + arsenicum + CHEBI:27563 + + arsenic atom + + + + + CAS:7440-38-2 + ChemIDplus + + + + + CAS:7440-38-2 + KEGG COMPOUND + + + + + arsenic + IUPAC + + + + + + 33As + IUPAC + + + + + Arsen + ChemIDplus + + + + + Arsenic + KEGG_COMPOUND + + + + + As + KEGG_COMPOUND + + + + + arsenic + ChEBI + + + + + arsenico + ChEBI + + + + + arsenicum + ChEBI + + + + + + + + + + 0 + Se + InChI=1S/Se + BUGBHKTXTAQXES-UHFFFAOYSA-N + 78.96000 + 79.91652 + [Se] + CHEBI:26627 + CHEBI:9091 + CAS:7782-49-2 + DrugBank:DB11135 + FooDB:FDB013400 + HMDB:HMDB0001349 + KEGG:C01529 + WebElements:Se + Wikipedia:Selenium + selenium + chebi_ontology + 34Se + Se + Selen + Selenium + selenio + selenium + CHEBI:27568 + + selenium atom + + + + + CAS:7782-49-2 + ChemIDplus + + + + + CAS:7782-49-2 + NIST Chemistry WebBook + + + + + selenium + IUPAC + + + + + + 34Se + IUPAC + + + + + Se + IUPAC + + + + + Selen + ChemIDplus + + + + + Selenium + KEGG_COMPOUND + + + + + selenio + ChEBI + + + + + selenium + ChEBI + + + + + + + + + + + 0 + Si + InChI=1S/Si + XUIMIQQOPSSXEZ-UHFFFAOYSA-N + 28.08550 + 27.97693 + [Si] + CHEBI:26676 + CHEBI:9140 + CAS:7440-21-3 + KEGG:C06263 + WebElements:Si + silicon + chebi_ontology + 14Si + Si + Silicon + Silizium + silicio + silicium + silicon + CHEBI:27573 + + silicon atom + + + + + CAS:7440-21-3 + ChemIDplus + + + + + silicon + IUPAC + + + + + + 14Si + IUPAC + + + + + Si + IUPAC + + + + + Si + KEGG_COMPOUND + + + + + Silicon + KEGG_COMPOUND + + + + + Silizium + ChEBI + + + + + silicio + ChEBI + + + + + silicium + ChEBI + + + + + silicon + ChEBI + + + + @@ -11716,4908 +15934,16939 @@ For example, A and B may be gene products and binding of B by A positively regul - + - - - - - - - - - - - - - - - - - A one-carbon compound that is ammonia in which one of the hydrogens is replaced by a carboxy group. Although carbamic acid derivatives are common, carbamic acid itself has never been synthesised. + + + + A cobalt group element atom that has atomic number 27. 0 - CH3NO2 - InChI=1S/CH3NO2/c2-1(3)4/h2H2,(H,3,4) - KXDHJXZQYSOELW-UHFFFAOYSA-N - 61.04006 - 61.01638 - NC(O)=O - CHEBI:22504 - CHEBI:23002 - CHEBI:3386 - CHEBI:44573 - Beilstein:1734754 - CAS:463-77-4 - DrugBank:DB04261 - Gmelin:130345 - KEGG:C01563 - PDBeChem:OUT - Wikipedia:Carbamic_acid - CARBAMIC ACID - Carbamic acid - carbamic acid + Co + InChI=1S/Co + GUTLYIVDDKVIGB-UHFFFAOYSA-N + 58.93320 + 58.93319 + [Co] + CHEBI:23335 + CHEBI:3788 + CAS:7440-48-4 + KEGG:C00175 + KEGG:C19171 + PDBeChem:3CO + WebElements:Co + cobalt chebi_ontology - Aminoameisensaeure - Aminoformic acid - Carbamate - Carbamidsaeure - CHEBI:28616 + 27Co + Co + Cobalt + Kobalt + cobalt + cobalto + cobaltum + CHEBI:27638 - carbamic acid + cobalt atom - - - Beilstein:1734754 - Beilstein - - - + - CAS:463-77-4 + CAS:7440-48-4 ChemIDplus - + - CAS:463-77-4 + CAS:7440-48-4 KEGG COMPOUND - + - Gmelin:130345 - Gmelin + CAS:7440-48-4 + NIST Chemistry WebBook - + - CARBAMIC ACID - PDBeChem + cobalt + IUPAC + - - - Carbamic acid - KEGG_COMPOUND + + + 27Co + IUPAC - - - carbamic acid + + + Co IUPAC - - + - Aminoameisensaeure - ChEBI + Co + UniProt - + - Aminoformic acid + Cobalt KEGG_COMPOUND - + - Carbamate - KEGG_COMPOUND + Kobalt + NIST_Chemistry_WebBook - + - Carbamidsaeure + cobalt + ChEBI + + + + + cobalto + ChEBI + + + + + cobaltum ChEBI - + - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - An onium cation obtained by protonation of ammonia. - +1 - H4N - InChI=1S/H3N/h1H3/p+1 - QGZKDVFQNNGYKY-UHFFFAOYSA-O - 18.03850 - 18.03383 - [H][N+]([H])([H])[H] - CHEBI:22534 - CHEBI:49783 - CHEBI:7435 - CAS:14798-03-9 - Gmelin:84 - KEGG:C01342 - MetaCyc:AMMONIUM - MolBase:929 - PDBeChem:NH4 - PMID:11319011 - PMID:11341317 - PMID:12096804 - PMID:14512268 - PMID:14879753 - PMID:16345391 - PMID:16903292 - PMID:17392693 - PMID:18515490 - PMID:19199063 - PMID:19596600 - PMID:19682559 - PMID:19716251 - PMID:21993530 - PMID:22265469 - PMID:22524020 - PMID:22562341 - PMID:22631217 - Reaxys:16093784 - Wikipedia:Ammonium - ammonium - azanium + + + 0 + V + InChI=1S/V + LEONUFNNVUYDNQ-UHFFFAOYSA-N + 50.94150 + 50.94396 + [V] + CHEBI:27274 + CHEBI:9930 + CAS:7440-62-2 + KEGG:C06267 + WebElements:V + vanadium chebi_ontology - Ammonium(1+) - NH4(+) - NH4+ - [NH4](+) - ammonium cation - ammonium ion - CHEBI:28938 + 23V + V + Vanadium + vanadio + vanadium + CHEBI:27698 - ammonium + vanadium atom - + - CAS:14798-03-9 + CAS:7440-62-2 ChemIDplus - - - CAS:14798-03-9 - NIST Chemistry WebBook - - - - - Gmelin:84 - Gmelin - - - - - PMID:11319011 - Europe PMC - - - - - PMID:11341317 - Europe PMC - - - - - PMID:12096804 - Europe PMC - - - - - PMID:14512268 - Europe PMC - - - - - PMID:14879753 - Europe PMC - - - - - PMID:16345391 - Europe PMC - - - + - PMID:16903292 - Europe PMC + CAS:7440-62-2 + KEGG COMPOUND - + - PMID:17392693 - Europe PMC + CAS:7440-62-2 + NIST Chemistry WebBook - - - PMID:18515490 - Europe PMC + + + vanadium + IUPAC + - - - PMID:19199063 - Europe PMC + + + 23V + IUPAC - - - PMID:19596600 - Europe PMC + + + V + IUPAC - - - PMID:19682559 - Europe PMC + + + V + KEGG_COMPOUND - - - PMID:19716251 - Europe PMC + + + Vanadium + KEGG_COMPOUND - - - PMID:21993530 - Europe PMC + + + vanadio + ChEBI - - - PMID:22265469 - Europe PMC + + + vanadium + ChEBI + + + + + + + + 0 + W + InChI=1S/W + WFKWXMTUELFFGS-UHFFFAOYSA-N + 183.84000 + 183.95093 + [W] + CHEBI:27170 + CHEBI:9779 + CAS:7440-33-7 + Gmelin:16317 + KEGG:C00753 + PDBeChem:W + WebElements:W + Tungsten + tungsten + wolfram + chebi_ontology + 74W + W + Wolfram + tungsten atom + tungstene + tungsteno + volframio + wolframio + wolframium + CHEBI:27998 + + tungsten + - + - PMID:22524020 - Europe PMC + CAS:7440-33-7 + ChemIDplus - + - PMID:22562341 - Europe PMC + CAS:7440-33-7 + KEGG COMPOUND - + - PMID:22631217 - Europe PMC + CAS:7440-33-7 + NIST Chemistry WebBook - + - Reaxys:16093784 - Reaxys + Gmelin:16317 + Gmelin - + - ammonium - ChEBI + Tungsten + KEGG_COMPOUND - + - ammonium + tungsten IUPAC - + - azanium + wolfram IUPAC - + - Ammonium(1+) - ChemIDplus + 74W + IUPAC - + - NH4(+) + W IUPAC - + - NH4(+) + W UniProt - + - NH4+ - KEGG_COMPOUND + Wolfram + NIST_Chemistry_WebBook - + - [NH4](+) + tungsten atom + ChEBI + + + + + tungstene + ChEBI + + + + + tungsteno + ChEBI + + + + + volframio + ChEBI + + + + + wolframio + ChEBI + + + + + wolframium + ChEBI + + + + + + + + + + A chromium group element atom that has atomic number 24. + 0 + Cr + InChI=1S/Cr + VYZAMTAEIAYCRO-UHFFFAOYSA-N + 51.99610 + 51.94051 + [Cr] + CHEBI:23235 + CHEBI:3678 + CAS:7440-47-3 + KEGG:C06268 + WebElements:Cr + chromium + chebi_ontology + 24Cr + Chrom + Chromium + Cr + chrome + chromium + cromo + CHEBI:28073 + + chromium atom + + + + + CAS:7440-47-3 + ChemIDplus + + + + + CAS:7440-47-3 + KEGG COMPOUND + + + + + chromium + IUPAC + + + + + + 24Cr + IUPAC + + + + + Chrom + ChemIDplus + + + + + Chromium + KEGG_COMPOUND + + + + + Cr + IUPAC + + + + + Cr + KEGG_COMPOUND + + + + + chrome + ChEBI + + + + + chromium + ChEBI + + + + + cromo + ChEBI + + + + + + + + + + Chemical element (nickel group element atom) with atomic number 28. + 0 + Ni + InChI=1S/Ni + PXHVJJICTQNCMI-UHFFFAOYSA-N + 58.69340 + 57.93534 + [Ni] + CHEBI:25515 + CHEBI:7552 + CAS:7440-02-0 + Gmelin:16229 + KEGG:C00291 + PMID:12756270 + PMID:14634084 + PMID:14734778 + PMID:15165199 + PMID:19828094 + PMID:20477134 + PMID:22762130 + PMID:23142754 + PMID:23317102 + PMID:23692032 + PMID:23692035 + PMID:23723488 + PMID:23834453 + PMID:23857010 + PMID:23895079 + PMID:23909687 + PMID:9060994 + PMID:9886425 + Reaxys:4122946 + WebElements:Ni + Wikipedia:Nickel + nickel + chebi_ontology + 28Ni + Ni + Nickel + Raney alloy + niccolum + nickel + niquel + CHEBI:28112 + + nickel atom + + + + + CAS:7440-02-0 + ChemIDplus + + + + + CAS:7440-02-0 + KEGG COMPOUND + + + + + CAS:7440-02-0 + NIST Chemistry WebBook + + + + + Gmelin:16229 + Gmelin + + + + + PMID:12756270 + Europe PMC + + + + + PMID:14634084 + Europe PMC + + + + + PMID:14734778 + Europe PMC + + + + + PMID:15165199 + Europe PMC + + + + + PMID:19828094 + Europe PMC + + + + + PMID:20477134 + Europe PMC + + + + + PMID:22762130 + Europe PMC + + + + + PMID:23142754 + Europe PMC + + + + + PMID:23317102 + Europe PMC + + + + + PMID:23692032 + Europe PMC + + + + + PMID:23692035 + Europe PMC + + + + + PMID:23723488 + Europe PMC + + + + + PMID:23834453 + Europe PMC + + + + + PMID:23857010 + Europe PMC + + + + + PMID:23895079 + Europe PMC + + + + + PMID:23909687 + Europe PMC + + + + + PMID:9060994 + Europe PMC + + + + + PMID:9886425 + Europe PMC + + + + + Reaxys:4122946 + Reaxys + + + + + nickel + IUPAC + + + + + + 28Ni + IUPAC + + + + + Ni + IUPAC + + + + + Ni + UniProt + + + + + Nickel + ChEBI + + + + + Raney alloy + ChemIDplus + + + + + niccolum + ChEBI + + + + + nickel + ChEBI + + + + + niquel + ChEBI + + + + + + + + + + + + + + + + + + + + + + + A one-carbon compound that is ammonia in which one of the hydrogens is replaced by a carboxy group. Although carbamic acid derivatives are common, carbamic acid itself has never been synthesised. + 0 + CH3NO2 + InChI=1S/CH3NO2/c2-1(3)4/h2H2,(H,3,4) + KXDHJXZQYSOELW-UHFFFAOYSA-N + 61.04006 + 61.01638 + NC(O)=O + CHEBI:22504 + CHEBI:23002 + CHEBI:3386 + CHEBI:44573 + Beilstein:1734754 + CAS:463-77-4 + DrugBank:DB04261 + Gmelin:130345 + KEGG:C01563 + PDBeChem:OUT + Wikipedia:Carbamic_acid + CARBAMIC ACID + Carbamic acid + carbamic acid + chebi_ontology + Aminoameisensaeure + Aminoformic acid + Carbamate + Carbamidsaeure + CHEBI:28616 + + carbamic acid + + + + + Beilstein:1734754 + Beilstein + + + + + CAS:463-77-4 + ChemIDplus + + + + + CAS:463-77-4 + KEGG COMPOUND + + + + + Gmelin:130345 + Gmelin + + + + + CARBAMIC ACID + PDBeChem + + + + + Carbamic acid + KEGG_COMPOUND + + + + + carbamic acid + IUPAC + + + + + + Aminoameisensaeure + ChEBI + + + + + Aminoformic acid + KEGG_COMPOUND + + + + + Carbamate + KEGG_COMPOUND + + + + + Carbamidsaeure + ChEBI + + + + + + + + + + 0 + P + InChI=1S/P + OAICVXFJPJFONN-UHFFFAOYSA-N + 30.97376 + 30.97376 + [P] + CHEBI:26080 + CHEBI:8168 + CAS:7723-14-0 + Gmelin:16235 + KEGG:C06262 + WebElements:P + phosphorus + chebi_ontology + 15P + P + Phosphor + Phosphorus + fosforo + phosphore + phosphorus + CHEBI:28659 + + phosphorus atom + + + + + CAS:7723-14-0 + ChemIDplus + + + + + CAS:7723-14-0 + KEGG COMPOUND + + + + + Gmelin:16235 + Gmelin + + + + + phosphorus + IUPAC + + + + + + 15P + IUPAC + + + + + P + IUPAC + + + + + P + KEGG_COMPOUND + + + + + Phosphor + ChEBI + + + + + Phosphorus + KEGG_COMPOUND + + + + + fosforo + ChEBI + + + + + phosphore + ChEBI + + + + + phosphorus + ChEBI + + + + + + + + + 0 + Mo + InChI=1S/Mo + ZOKXTWBITQBERF-UHFFFAOYSA-N + 95.94000 + 97.90541 + [Mo] + CHEBI:25369 + CHEBI:49750 + CHEBI:6968 + CAS:7439-98-7 + Gmelin:16205 + KEGG:C00150 + WebElements:Mo + molybdenum + chebi_ontology + 42Mo + Mo + Molybdaen + Molybdenum + molibdeno + molybdene + molybdenum + CHEBI:28685 + + molybdenum atom + + + + + CAS:7439-98-7 + ChemIDplus + + + + + CAS:7439-98-7 + KEGG COMPOUND + + + + + CAS:7439-98-7 + NIST Chemistry WebBook + + + + + Gmelin:16205 + Gmelin + + + + + molybdenum + IUPAC + + + + + + 42Mo + IUPAC + + + + + Mo + IUPAC + + + + + Mo + UniProt + + + + + Molybdaen + ChEBI + + + + + Molybdenum + KEGG_COMPOUND + + + + + molibdeno + ChEBI + + + + + molybdene + ChEBI + + + + + molybdenum + ChEBI + + + + + + + + + + 0 + Cu + InChI=1S/Cu + RYGMFSIKBFXOCR-UHFFFAOYSA-N + 63.54600 + 62.92960 + [Cu] + CHEBI:23376 + CHEBI:3874 + CAS:7440-50-8 + Gmelin:16269 + KEGG:C00070 + WebElements:Cu + copper + chebi_ontology + 29Cu + Copper + Cu + Kupfer + cobre + copper + cuivre + cuprum + CHEBI:28694 + + copper atom + + + + + CAS:7440-50-8 + ChemIDplus + + + + + CAS:7440-50-8 + KEGG COMPOUND + + + + + Gmelin:16269 + Gmelin + + + + + copper + IUPAC + + + + + + 29Cu + IUPAC + + + + + Copper + KEGG_COMPOUND + + + + + Cu + ChEBI + + + + + Cu + IUPAC + + + + + Kupfer + ChEBI + + + + + cobre + ChEBI + + + + + copper + ChEBI + + + + + cuivre + ChEBI + + + + + cuprum + IUPAC + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + An onium cation obtained by protonation of ammonia. + +1 + H4N + InChI=1S/H3N/h1H3/p+1 + QGZKDVFQNNGYKY-UHFFFAOYSA-O + 18.03850 + 18.03383 + [H][N+]([H])([H])[H] + CHEBI:22534 + CHEBI:49783 + CHEBI:7435 + CAS:14798-03-9 + Gmelin:84 + KEGG:C01342 + MetaCyc:AMMONIUM + MolBase:929 + PDBeChem:NH4 + PMID:11319011 + PMID:11341317 + PMID:12096804 + PMID:14512268 + PMID:14879753 + PMID:16345391 + PMID:16903292 + PMID:17392693 + PMID:18515490 + PMID:19199063 + PMID:19596600 + PMID:19682559 + PMID:19716251 + PMID:21993530 + PMID:22265469 + PMID:22524020 + PMID:22562341 + PMID:22631217 + Reaxys:16093784 + Wikipedia:Ammonium + ammonium + azanium + chebi_ontology + Ammonium(1+) + NH4(+) + NH4+ + [NH4](+) + ammonium cation + ammonium ion + CHEBI:28938 + + ammonium + + + + + CAS:14798-03-9 + ChemIDplus + + + + + CAS:14798-03-9 + NIST Chemistry WebBook + + + + + Gmelin:84 + Gmelin + + + + + PMID:11319011 + Europe PMC + + + + + PMID:11341317 + Europe PMC + + + + + PMID:12096804 + Europe PMC + + + + + PMID:14512268 + Europe PMC + + + + + PMID:14879753 + Europe PMC + + + + + PMID:16345391 + Europe PMC + + + + + PMID:16903292 + Europe PMC + + + + + PMID:17392693 + Europe PMC + + + + + PMID:18515490 + Europe PMC + + + + + PMID:19199063 + Europe PMC + + + + + PMID:19596600 + Europe PMC + + + + + PMID:19682559 + Europe PMC + + + + + PMID:19716251 + Europe PMC + + + + + PMID:21993530 + Europe PMC + + + + + PMID:22265469 + Europe PMC + + + + + PMID:22524020 + Europe PMC + + + + + PMID:22562341 + Europe PMC + + + + + PMID:22631217 + Europe PMC + + + + + Reaxys:16093784 + Reaxys + + + + + ammonium + ChEBI + + + + + ammonium + IUPAC + + + + + + azanium + IUPAC + + + + + + Ammonium(1+) + ChemIDplus + + + + + NH4(+) + IUPAC + + + + + NH4(+) + UniProt + + + + + NH4+ + KEGG_COMPOUND + + + + + [NH4](+) MolBase - + + + ammonium cation + ChemIDplus + + + + + ammonium ion + PDBeChem + + + + + + + + + + 0 + Al + InChI=1S/Al + XAGFODPZIPBFFR-UHFFFAOYSA-N + 26.98154 + 26.98154 + [Al] + CHEBI:22471 + CHEBI:2616 + CAS:7429-90-5 + DrugBank:DB01370 + Gmelin:16248 + KEGG:C06264 + WebElements:Al + aluminium + chebi_ontology + 13Al + Al + Aluminium + aluminio + aluminium + aluminum + CHEBI:28984 + + aluminium atom + + + + + CAS:7429-90-5 + ChemIDplus + + + + + CAS:7429-90-5 + KEGG COMPOUND + + + + + Gmelin:16248 + Gmelin + + + + + aluminium + IUPAC + + + + + + 13Al + IUPAC + + + + + Al + IUPAC + + + + + Al + KEGG_COMPOUND + + + + + Aluminium + ChEBI + + + + + Aluminium + KEGG_COMPOUND + + + + + aluminio + ChEBI + + + + + aluminium + ChEBI + + + + + aluminum + NIST_Chemistry_WebBook + + + + + + + + + + + + + + + + The conjugate base formed when the carboxy group of a carboxylic acid is deprotonated. + -1 + CO2R + 44.00950 + 43.98983 + [O-]C([*])=O + CHEBI:13626 + CHEBI:13945 + CHEBI:23026 + CHEBI:58657 + chebi_ontology + a carboxylate + carboxylic acid anions + carboxylic anions + CHEBI:29067 + + carboxylic acid anion + + + + + a carboxylate + UniProt + + + + + carboxylic acid anions + ChEBI + + + + + carboxylic anions + ChEBI + + + + + + + + + + + + sodium(1+) + + + + + + + + + The stable isotope of hydrogen with relative atomic mass 1.007825 and a natural abundance of 99.9885 atom percent (from Greek pirhoomegatauomicronsigma, first). + 0 + [1H] + InChI=1S/H/i1+0 + YZCKVEUIGOORGS-IGMARMGPSA-N + 1.008 + 1.00783 + [1H] + protium + chebi_ontology + (1)1H + (1)H + hydrogen-1 + protio + protium + CHEBI:29236 + + protium atom + + + + + protium + IUPAC + + + + + + (1)1H + IUPAC + + + + + (1)H + IUPAC + + + + + hydrogen-1 + ChEBI + + + + + protio + ChEBI + + + + + protium + ChEBI + + + + + + + + + The stable isotope of hydrogen with relative atomic mass 2.014102 and a natural abundance of 0.0115 atom percent (from Greek deltaepsilonupsilontauepsilonrhoomicronnu, second). + 0 + D + InChI=1S/H2/h1H/i1+1 + UFHFLCQGNIYNRP-OUBTZVSYSA-N + 2.014 + 2.01410 + [2H] + deuterium + chebi_ontology + (2)1H + (2)H + D + Deuterium + deuterio + deuterium + heavy hydrogen + hidrogeno pesado + hydrogen-2 + schwerer Wasserstoff + CHEBI:29237 + + deuterium atom + + + + + deuterium + IUPAC + + + + + + (2)1H + IUPAC + + + + + (2)H + IUPAC + + + + + D + IUPAC + + + + + Deuterium + ChEBI + + + + + deuterio + ChEBI + + + + + deuterium + ChEBI + + + + + heavy hydrogen + ChEBI + + + + + hidrogeno pesado + ChEBI + + + + + hydrogen-2 + ChEBI + + + + + schwerer Wasserstoff + ChEBI + + + + + + + + + The radioactive isotope of hydrogen with relative atomic mass 3.016049 and half-life of 12.33 years (from Greek taurhoiotatauomicronsigma, third). + 0 + T + InChI=1S/H2/h1H/i1+2 + UFHFLCQGNIYNRP-NJFSPNSNSA-N + 3.016 + 3.01605 + [3H] + tritium + chebi_ontology + (3)1H + (3)H + T + hydrogen-3 + tritio + tritium + ueberschwerer Wasserstoff + CHEBI:29238 + + tritium atom + + + + + tritium + IUPAC + + + + + + (3)1H + IUPAC + + + + + (3)H + IUPAC + + + + + T + IUPAC + + + + + hydrogen-3 + ChEBI + + + + + tritio + ChEBI + + + + + tritium + ChEBI + + + + + ueberschwerer Wasserstoff + ChEBI + + + + + + + + + 0 + Au + InChI=1S/Au + PCHJSUWPFVWCPO-UHFFFAOYSA-N + 196.96655 + 196.96657 + [Au] + CAS:7440-57-5 + WebElements:Au + gold + chebi_ontology + 79Au + Au + Gold + aurum + gold + or + oro + CHEBI:29287 + + gold atom + + + + + CAS:7440-57-5 + ChemIDplus + + + + + gold + IUPAC + + + + + + 79Au + IUPAC + + + + + Au + IUPAC + + + + + Gold + ChEBI + + + + + aurum + IUPAC + + + + + gold + ChEBI + + + + + or + ChEBI + + + + + oro + ChEBI + + + + + + + + + + + + + + + + + + + + + + -1 + H2N + InChI=1S/H2N/h1H2/q-1 + HYGWNUKOUCZBND-UHFFFAOYSA-N + 16.02262 + 16.01927 + [H][N-][H] + amide + azanide + dihydridonitrate(1-) + chebi_ontology + NH2(-) + CHEBI:29337 + + azanide + + + + + amide + IUPAC + + + + + + azanide + IUPAC + + + + + + dihydridonitrate(1-) + IUPAC + + + + + + NH2(-) + IUPAC + + + + + + + + + + + + + + + + A divalent inorganic anion resulting from the removal of two protons from ammonia. + -2 + HN + InChI=1S/HN/h1H/q-2 + DZQYTNGKSBCIOE-UHFFFAOYSA-N + 15.01468 + 15.01200 + [N--][H] + azanediide + hydridonitrate(2-) + chebi_ontology + NH(2-) + imide + CHEBI:29340 + + hydridonitrate(2-) + + + + + azanediide + IUPAC + + + + + + hydridonitrate(2-) + IUPAC + + + + + + NH(2-) + IUPAC + + + + + imide + IUPAC + + + + + + + + + 0 + Li + InChI=1S/Li + WHXSMMKQMYFTQS-UHFFFAOYSA-N + 6.94100 + 7.01600 + [Li] + CAS:7439-93-2 + WebElements:Li + lithium + chebi_ontology + 3Li + Li + Lithium + lithium + litio + CHEBI:30145 + + lithium atom + + + + + CAS:7439-93-2 + NIST Chemistry WebBook + + + + + lithium + IUPAC + + + + + + 3Li + IUPAC + + + + + Li + IUPAC + + + + + Lithium + ChEBI + + + + + lithium + ChEBI + + + + + litio + ChEBI + + + + + + + + + Particle of zero charge, zero rest mass, spin quantum number 1, energy hnu and momentum hnu/c (h is the Planck constant, nu the frequency of radiation and c the speed of light), carrier of electromagnetic force. + 0 + 0.0 + 0.0 + * + CHEBI:10581 + CHEBI:14383 + KEGG:C00205 + photon + chebi_ontology + Lichtquant + Light + foton + gamma + hnu + light quantum + CHEBI:30212 + + photon + + + + + photon + IUPAC + + + + + + Lichtquant + ChEBI + + + + + Light + KEGG_COMPOUND + + + + + foton + ChEBI + + + + + gamma + IUPAC + + + + + hnu + IUPAC + + + + + hnu + UniProt + + + + + light quantum + ChEBI + + + + + + + + + + Nucleus of the (4)He atom. + +2 + [4He] + InChI=1S/He/q+2/i1+0 + LBDSXVIYZYSRII-IGMARMGPSA-N + 4.002 + 4.00151 + [4He++] + Gmelin:53474 + alpha-particle + helium-4(2+) + chebi_ontology + (4)He(2+) + alpha + CHEBI:30216 + + alpha-particle + + + + + Gmelin:53474 + Gmelin + + + + + alpha-particle + IUPAC + + + + + alpha-particle + IUPAC + + + + + + helium-4(2+) + IUPAC + + + + + + (4)He(2+) + IUPAC + + + + + alpha + IUPAC + + + + + + + + + + 0 + He + InChI=1S/He + SWQJXJOGLNCZEY-UHFFFAOYSA-N + 4.00260 + 4.00260 + [He] + CAS:7440-59-7 + Drug_Central:4262 + Gmelin:16294 + WebElements:He + helium + chebi_ontology + 2He + He + Helium + helio + helium + CHEBI:30217 + + helium atom + + + + + CAS:7440-59-7 + NIST Chemistry WebBook + + + + + Drug_Central:4262 + DrugCentral + + + + + Gmelin:16294 + Gmelin + + + + + helium + IUPAC + + + + + + 2He + IUPAC + + + + + He + IUPAC + + + + + Helium + ChEBI + + + + + helio + ChEBI + + + + + helium + ChEBI + + + + + + + + + The stable isotope of helium with relative atomic mass 3.016029. The least abundant (0.000137 atom percent) isotope of naturally occurring helium. + 0 + [3He] + InChI=1S/He/i1-1 + SWQJXJOGLNCZEY-BJUDXGSMSA-N + 3.016 + 3.01603 + [3He] + CAS:14762-55-1 + Gmelin:14208 + helium-3 + chebi_ontology + (3)2He + (3)He + (3He)helium + helium, isotope of mass 3 + helium-3 + CHEBI:30218 + + helium-3 atom + + + + + CAS:14762-55-1 + ChemIDplus + + + + + Gmelin:14208 + Gmelin + + + + + helium-3 + IUPAC + + + + + + (3)2He + IUPAC + + + + + (3)He + IUPAC + + + + + (3He)helium + ChemIDplus + + + + + helium, isotope of mass 3 + ChemIDplus + + + + + helium-3 + ChEBI + + + + + + + + + The stable isotope of helium with relative atomic mass 4.002603. The most abundant (99.99 atom percent) isotope of naturally occurring helium. + 0 + [4He] + InChI=1S/He/i1+0 + SWQJXJOGLNCZEY-IGMARMGPSA-N + 4.003 + 4.00260 + [4He] + Gmelin:14207 + helium-4 + chebi_ontology + (4)2He + (4)He + helium-4 + CHEBI:30219 + + helium-4 atom + + + + + Gmelin:14207 + Gmelin + + + + + helium-4 + IUPAC + + + + + + (4)2He + IUPAC + + + + + (4)He + IUPAC + + + + + helium-4 + ChEBI + + + + + + + + + Nuclear particle of zero charge, spin 1/2 and rest mass of 1.008664904(14) u. + 0 + 1.008664904 + neutron + chebi_ontology + (1)0n + n + CHEBI:30222 + + neutron + + + + + neutron + ChEBI + + + + + neutron + IUPAC + + + + + + (1)0n + ChEBI + + + + + n + IUPAC + + + + + + + + + 0 + At + InChI=1S/At + RYXHOMYVWAEKHL-UHFFFAOYSA-N + 210.00000 + 210.00000 + [At] + CAS:7440-68-8 + Gmelin:40440 + WebElements:At + astatine + chebi_ontology + 85At + Astat + At + astate + astatine + astato + CHEBI:30415 + + astatine atom + + + + + CAS:7440-68-8 + ChemIDplus + + + + + CAS:7440-68-8 + NIST Chemistry WebBook + + + + + Gmelin:40440 + Gmelin + + + + + astatine + IUPAC + + + + + + 85At + IUPAC + + + + + Astat + ChEBI + + + + + At + IUPAC + + + + + astate + ChEBI + + + + + astatine + ChEBI + + + + + astato + ChEBI + + + + + + + + + A metallic element first identified and named from the brilliant indigo (Latin indicum) blue line in its flame spectrum. + 0 + In + InChI=1S/In + APFVFJFRJDLVQX-UHFFFAOYSA-N + 114.81800 + 114.90388 + [In] + CAS:7440-74-6 + Gmelin:16297 + WebElements:In + indium + chebi_ontology + 49In + In + Indium + indio + indium + CHEBI:30430 + + indium atom + + + + + CAS:7440-74-6 + ChemIDplus + + + + + CAS:7440-74-6 + NIST Chemistry WebBook + + + + + Gmelin:16297 + Gmelin + + + + + indium + IUPAC + + + + + + 49In + IUPAC + + + + + In + IUPAC + + + + + Indium + ChEBI + + + + + indio + ChEBI + + + + + indium + ChEBI + + + + + + + + + A metallic element first identified and named from the brilliant green line in its flame spectrum (from Greek thetaalphalambdalambdaomicronsigma, a green shoot). + 0 + Tl + InChI=1S/Tl + BKVIYDNLLOSFOA-UHFFFAOYSA-N + 204.38330 + 204.97443 + [Tl] + CAS:7440-28-0 + Gmelin:16308 + WebElements:Tl + thallium + chebi_ontology + 81Tl + Tl + talio + CHEBI:30440 + + thallium + + + + + CAS:7440-28-0 + ChemIDplus + + + + + CAS:7440-28-0 + NIST Chemistry WebBook + + + + + Gmelin:16308 + Gmelin + + + + + thallium + IUPAC + + + + + + 81Tl + IUPAC + + + + + Tl + IUPAC + + + + + talio + ChEBI + + + + + + + + + + + 0 + Ge + InChI=1S/Ge + GNPVGFCGXDBREM-UHFFFAOYSA-N + 72.61000 + 73.92118 + [Ge] + CAS:7440-56-4 + WebElements:Ge + germanium + chebi_ontology + 32Ge + Ge + germanio + germanium + CHEBI:30441 + + germanium atom + + + + + CAS:7440-56-4 + ChemIDplus + + + + + CAS:7440-56-4 + NIST Chemistry WebBook + + + + + germanium + IUPAC + + + + + + 32Ge + IUPAC + + + + + Ge + IUPAC + + + + + germanio + ChEBI + + + + + germanium + ChEBI + + + + + + + + + + 0 + Te + InChI=1S/Te + PORWMNRCUJJQNO-UHFFFAOYSA-N + 127.60000 + 129.90622 + [Te] + CAS:13494-80-9 + Gmelin:16309 + WebElements:Te + tellurium + chebi_ontology + 52Te + Te + Tellur + tellure + tellurium + teluro + CHEBI:30452 + + tellurium atom + + + + + CAS:13494-80-9 + ChemIDplus + + + + + CAS:13494-80-9 + NIST Chemistry WebBook + + + + + Gmelin:16309 + Gmelin + + + + + tellurium + IUPAC + + + + + + 52Te + IUPAC + + + + + Te + IUPAC + + + + + Tellur + ChEBI + + + + + tellure + ChEBI + + + + + tellurium + ChEBI + + + + + teluro + ChEBI + + + + + + + + + + Alkaline earth metal atom with atomic number 4. + 0 + Be + InChI=1S/Be + ATBAMAFKBVZNFJ-UHFFFAOYSA-N + 9.01218 + 9.01218 + [Be] + CAS:7440-41-7 + Gmelin:16265 + PMID:10858219 + PMID:11897645 + PMID:14643414 + PMID:16951350 + PMID:18250483 + PMID:18768897 + PMID:24912188 + Reaxys:14617151 + WebElements:Be + beryllium + chebi_ontology + 4Be + Be + Beryllium + berilio + beryllium + CHEBI:30501 + + beryllium atom + + + + + CAS:7440-41-7 + ChemIDplus + + + + + CAS:7440-41-7 + NIST Chemistry WebBook + + + + + Gmelin:16265 + Gmelin + + + + + PMID:10858219 + Europe PMC + + + + + PMID:11897645 + Europe PMC + + + + + PMID:14643414 + Europe PMC + + + + + PMID:16951350 + Europe PMC + + + + + PMID:18250483 + Europe PMC + + + + + PMID:18768897 + Europe PMC + + + + + PMID:24912188 + Europe PMC + + + + + Reaxys:14617151 + Reaxys + + + + + beryllium + IUPAC + + + + + + 4Be + IUPAC + + + + + Be + IUPAC + + + + + Beryllium + ChEBI + + + + + berilio + ChEBI + + + + + beryllium + ChEBI + + + + + + + + + 0 + Ag + InChI=1S/Ag + BQCADISMDOOEFD-UHFFFAOYSA-N + 107.86820 + 106.90509 + [Ag] + CAS:7440-22-4 + WebElements:Ag + silver + chebi_ontology + 47Ag + Ag + Silber + argent + argentum + plata + silver + CHEBI:30512 + + silver atom + + + + + CAS:7440-22-4 + ChemIDplus + + + + + silver + IUPAC + + + + + + 47Ag + IUPAC + + + + + Ag + IUPAC + + + + + Silber + ChemIDplus + + + + + argent + ChEBI + + + + + argentum + IUPAC + + + + + plata + ChEBI + + + + + silver + ChEBI + + + + + + + + + + 0 + Sb + InChI=1S/Sb + WATWJIUSRGPENY-UHFFFAOYSA-N + 121.76000 + 120.90381 + [Sb] + WebElements:Sb + antimony + chebi_ontology + 51Sb + Antimon + Sb + antimoine + antimonio + antimony + stibium + CHEBI:30513 + + antimony atom + + + + + antimony + IUPAC + + + + + + 51Sb + IUPAC + + + + + Antimon + ChEBI + + + + + Sb + IUPAC + + + + + antimoine + ChEBI + + + + + antimonio + ChEBI + + + + + antimony + ChEBI + + + + + stibium + IUPAC + + + + + + + + + 0 + Cs + InChI=1S/Cs + TVFDJXOCXUVLDH-UHFFFAOYSA-N + 132.90545 + 132.90545 + [Cs] + WebElements:Cs + caesium + chebi_ontology + 55Cs + Caesium + Cs + Zaesium + caesium + cesio + cesium + CHEBI:30514 + + caesium atom + + + + + caesium + IUPAC + + + + + + 55Cs + IUPAC + + + + + Caesium + ChEBI + + + + + Cs + IUPAC + + + + + Zaesium + ChEBI + + + + + caesium + ChEBI + + + + + cesio + ChEBI + + + + + cesium + ChEBI + + + + + cesium + IUPAC + + + + + + + + + + 0 + Ru + InChI=1S/Ru + KJTLSVCANCCWHF-UHFFFAOYSA-N + 101.07000 + 101.90434 + [Ru] + CAS:7440-18-8 + WebElements:Ru + ruthenium + chebi_ontology + 44Ru + Ru + Ruthenium + rutenio + ruthenium + CHEBI:30682 + + ruthenium atom + + + + + CAS:7440-18-8 + ChemIDplus + + + + + CAS:7440-18-8 + NIST Chemistry WebBook + + + + + ruthenium + IUPAC + + + + + + 44Ru + IUPAC + + + + + Ru + IUPAC + + + + + Ruthenium + ChEBI + + + + + rutenio + ChEBI + + + + + ruthenium + ChEBI + + + + + + + + + + 0 + Os + InChI=1S/Os + SYQBFIAQOQZEGI-UHFFFAOYSA-N + 190.23000 + 191.96148 + [Os] + CAS:7440-04-2 + Gmelin:16234 + WebElements:Os + osmium + chebi_ontology + 76Os + Os + osmio + osmium + CHEBI:30687 + + osmium atom + + + + + CAS:7440-04-2 + ChemIDplus + + + + + CAS:7440-04-2 + NIST Chemistry WebBook + + + + + Gmelin:16234 + Gmelin + + + + + osmium + IUPAC + + + + + + 76Os + IUPAC + + + + + Os + IUPAC + + + + + osmio + ChEBI + + + + + osmium + ChEBI + + + + + + + + + 0 + Ba + InChI=1S/Ba + DSAJWYNOEDNPEQ-UHFFFAOYSA-N + 137.32700 + 137.90525 + [Ba] + WebElements:Ba + barium + chebi_ontology + 56Ba + Ba + Barium + bario + barium + baryum + CHEBI:32594 + + barium atom + + + + + barium + IUPAC + + + + + + 56Ba + IUPAC + + + + + Ba + IUPAC + + + + + Barium + ChEBI + + + + + bario + ChEBI + + + + + barium + ChEBI + + + + + baryum + ChEBI + + + + + + + + + An amide is a derivative of an oxoacid RkE(=O)l(OH)m (l =/= 0) in which an acidic hydroxy group has been replaced by an amino or substituted amino group. + CHEBI:22473 + CHEBI:2633 + KEGG:C00241 + Amide + amides + chebi_ontology + CHEBI:32988 + + amide + + + + + Amide + KEGG_COMPOUND + + + + + amides + IUPAC + + + + + + + + + + + 0 + Eu + InChI=1S/Eu + OGPBJKLSAFTDLK-UHFFFAOYSA-N + 151.96400 + 152.92124 + [Eu] + CAS:7440-53-1 + Gmelin:16279 + WebElements:Eu + europium + chebi_ontology + 63Eu + Eu + europio + europium + CHEBI:32999 + + europium atom + + + + + CAS:7440-53-1 + ChemIDplus + + + + + Gmelin:16279 + Gmelin + + + + + europium + IUPAC + + + + + + 63Eu + IUPAC + + + + + Eu + IUPAC + + + + + europio + ChEBI + + + + + europium + ChEBI + + + + + + + + + + Intended use of the molecular entity or part thereof by humans. + chebi_ontology + CHEBI:33232 + + application + + + + + + + + + A particle not known to have substructure. + elementary particle + chebi_ontology + elementary particles + CHEBI:33233 + + fundamental particle + + + + + elementary particle + IUPAC + + + + + + elementary particles + ChEBI + + + + + + + + + monoatomic entity + + + + + + + + + oxoacid derivative + + + + + + + + + + chebi_ontology + inorganic hydrides + CHEBI:33242 + + inorganic hydride + + + + + inorganic hydrides + ChEBI + + + + + + + + + Any substituent group which does not contain carbon. + chebi_ontology + inorganic groups + CHEBI:33246 + + inorganic group + + + + + inorganic groups + ChEBI + + + + + + + + + + + + + + + + Any substituent group or skeleton containing carbon. + chebi_ontology + organic groups + CHEBI:33247 + + organic group + + + + + organic groups + ChEBI + + + + + + + + + Any organic substituent group, regardless of functional type, having one free valence at a carbon atom. + organyl group + organyl groups + chebi_ontology + groupe organyle + grupo organilo + grupos organilo + CHEBI:33249 + + organyl group + + + + + organyl group + IUPAC + + + + + + organyl groups + IUPAC + + + + + + groupe organyle + IUPAC + + + + + grupo organilo + IUPAC + + + + + grupos organilo + IUPAC + + + + + + + + + + + + + + + + atom + A chemical entity constituting the smallest component of an element having the chemical properties of the element. + + CHEBI:22671 + CHEBI:23907 + MeSH:D004602 + NCIt:C1940 + NCIt:C48792 + SNOMEDCT:290004009 + atom + atome + atomo + atoms + atomus + elements + chebi_ontology + atome + atomo + atoms + atomus + element + elements + CHEBI:33250 + + atom + element + uncharged atom + + + + + atom + IUPAC + + + + + + atome + IUPAC + + + + + atomo + IUPAC + + + + + atoms + ChEBI + + + + + atomus + ChEBI + + + + + element + ChEBI + + + + + elements + ChEBI + + + + + + + + + 0 + H + InChI=1S/H + YZCKVEUIGOORGS-UHFFFAOYSA-N + 1.00794 + 1.00783 + [H] + chebi_ontology + atomic hydrogen + CHEBI:33251 + + monoatomic hydrogen + + + + + atomic hydrogen + ChEBI + + + + + + + + + + + + + + + + + + + + + A nucleus is the positively charged central portion of an atom, excluding the orbital electrons. + nucleus + chebi_ontology + Atomkern + Kern + noyau + noyau atomique + nuclei + nucleo + nucleo atomico + nucleus atomi + CHEBI:33252 + + Some people may be uncomfortable calling every proton an atomic nucleus + This is equivalent to CHEBI:33252 + atomic nucleus + atomic nucleus + + + + + nucleus + IUPAC + + + + + + Atomkern + ChEBI + + + + + Kern + ChEBI + + + + + noyau + IUPAC + + + + + noyau atomique + ChEBI + + + + + nuclei + ChEBI + + + + + nucleo + IUPAC + + + + + nucleo atomico + ChEBI + + + + + nucleus atomi + ChEBI + + + + + + + + + + Heavy nuclear particle: proton or neutron. + nucleon + chebi_ontology + Nukleon + Nukleonen + nucleons + CHEBI:33253 + + nucleon + + + + + nucleon + IUPAC + + + + + nucleon + IUPAC + + + + + + Nukleon + ChEBI + + + + + Nukleonen + ChEBI + + + + + nucleons + ChEBI + + + + + + + + + A derivative of an oxoacid RkE(=O)l(OH)m (l =/= 0) in which an acidic hydroxy group has been replaced by an amino or substituted amino group. + primary amide + primary amides + chebi_ontology + CHEBI:33256 + + primary amide + + + + + primary amide + IUPAC + + + + + primary amides + IUPAC + + + + + + + + + + elemental molecular entity + + + + + + + + + chebi_ontology + CHEBI:33260 + + elemental hydrogen + + + + + + + + + + + elemental oxygen + + + + + + + + + diatomic oxygen + + + + + + + + + diatomic nitrogen + + + + + + + + + + elemental nitrogen + + + + + + + + + + An anion consisting of more than one atom. + chebi_ontology + polyatomic anions + CHEBI:33273 + + polyatomic anion + + + + + polyatomic anions + ChEBI + + + + + + + + + A nutrient is a food component that an organism uses to survive and grow. + chebi_ontology + nutrients + CHEBI:33284 + + nutrient + + + + + nutrients + ChEBI + + + + + + + + + A heteroorganic entity is an organic molecular entity in which carbon atoms or organic groups are bonded directly to one or more heteroatoms. + chebi_ontology + heteroorganic entities + organoelement compounds + CHEBI:33285 + + heteroorganic entity + + + + + heteroorganic entities + ChEBI + + + + + organoelement compounds + ChEBI + + + + + + + + + fuel + + + + + + + + + + + + + + + alkali metal molecular entity + + + + + + + + + Any p-block element atom that is in group 15 of the periodic table: nitrogen, phosphorus, arsenic, antimony and bismuth. + pnictogens + chebi_ontology + group 15 elements + group V elements + nitrogenoideos + nitrogenoides + pnictogene + pnictogenes + CHEBI:33300 + + pnictogen + + + + + pnictogens + IUPAC + + + + + + group 15 elements + ChEBI + + + + + group V elements + ChEBI + + + + + nitrogenoideos + ChEBI + + + + + nitrogenoides + ChEBI + + + + + pnictogene + ChEBI + + + + + pnictogenes + ChEBI + + + + + + + + + + 0 + Bi + InChI=1S/Bi + JCXGWMGPZLAOME-UHFFFAOYSA-N + 208.98038 + 208.98040 + [Bi] + CAS:7440-69-9 + WebElements:Bi + bismuth + chebi_ontology + 83Bi + Bi + Bismut + Wismut + bismuth + bismuto + CHEBI:33301 + + bismuth atom + + + + + CAS:7440-69-9 + ChemIDplus + + + + + bismuth + IUPAC + + + + + + 83Bi + IUPAC + + + + + Bi + IUPAC + + + + + Bismut + ChEBI + + + + + Wismut + ChEBI + + + + + bismuth + ChEBI + + + + + bismuto + ChEBI + + + + + + + + + + + + + + + A p-block molecular entity containing any pnictogen. + pnictogen molecular entity + chebi_ontology + pnictogen molecular entities + CHEBI:33302 + + pnictogen molecular entity + + + + + pnictogen molecular entity + ChEBI + + + + + pnictogen molecular entities + ChEBI + + + + + + + + + Any p-block element belonging to the group 16 family of the periodic table. + PMID:17084588 + chalcogen + chalcogens + chebi_ontology + Chalkogen + Chalkogene + anfigeno + anfigenos + calcogeno + calcogenos + chalcogene + chalcogenes + group 16 elements + group VI elements + CHEBI:33303 + + chalcogen + + + + + PMID:17084588 + Europe PMC + + + + + PMID:17084588 + Europe PMC + + + + + chalcogen + IUPAC + + + + + + chalcogens + IUPAC + + + + + + Chalkogen + ChEBI + + + + + Chalkogene + ChEBI + + + + + anfigeno + ChEBI + + + + + anfigenos + ChEBI + + + + + calcogeno + ChEBI + + + + + calcogenos + ChEBI + + + + + chalcogene + ChEBI + + + + + chalcogenes + ChEBI + + + + + group 16 elements + ChEBI + + + + + group VI elements + ChEBI + + + + + + + + + + + + + + + Any p-block molecular entity containing a chalcogen. + chalcogen molecular entity + chebi_ontology + chalcogen compounds + chalcogen molecular entities + CHEBI:33304 + + chalcogen molecular entity + + + + + chalcogen molecular entity + ChEBI + + + + + chalcogen compounds + ChEBI + + + + + chalcogen molecular entities + ChEBI + + + + + + + + + group 14 elements + chebi_ontology + carbon group element + carbon group elements + carbonoides + cristallogene + cristallogenes + group IV elements + CHEBI:33306 + + carbon group element atom + + + + + group 14 elements + IUPAC + + + + + + carbon group element + ChEBI + + + + + carbon group elements + ChEBI + + + + + carbonoides + ChEBI + + + + + cristallogene + ChEBI + + + + + cristallogenes + ChEBI + + + + + group IV elements + ChEBI + + + + + + + + + + + noble gas + noble gases + chebi_ontology + Edelgas + Edelgase + gas noble + gases nobles + gaz noble + gaz nobles + group 18 elements + group VIII elements + inert gases + noble gas + rare gases + CHEBI:33309 + + noble gas atom + + + + + noble gas + IUPAC + + + + + + noble gases + IUPAC + + + + + + Edelgas + ChEBI + + + + + Edelgase + ChEBI + + + + + gas noble + ChEBI + + + + + gases nobles + ChEBI + + + + + gaz noble + ChEBI + + + + + gaz nobles + ChEBI + + + + + group 18 elements + IUPAC + + + + + group VIII elements + ChEBI + + + + + inert gases + ChEBI + + + + + noble gas + ChEBI + + + + + rare gases + ChEBI + + + + + + + + + + 0 + Ne + InChI=1S/Ne + GKAOGPIIYCISHV-UHFFFAOYSA-N + 20.17970 + 19.99244 + [Ne] + CAS:7440-01-9 + WebElements:Ne + neon + chebi_ontology + 10Ne + Ne + Neon + neon + CHEBI:33310 + + neon atom + + + + + CAS:7440-01-9 + ChemIDplus + + + + + neon + IUPAC + + + + + + 10Ne + IUPAC + + + + + Ne + ChEBI + + + + + Neon + ChEBI + + + + + neon + ChEBI + + + + + + + + + + A radioactive metallic element discovered in 1898 by Marie Sklodowska Curie and named after her home country, Poland (Latin Polonia). + 0 + Po + InChI=1S/Po + HZEBHPIOVYHPMT-UHFFFAOYSA-N + 209.00000 + 209.00000 + [Po] + CAS:7440-08-6 + Gmelin:40435 + WebElements:Po + polonium + chebi_ontology + 84Po + Po + polonio + polonium + CHEBI:33313 + + polonium atom + + + + + CAS:7440-08-6 + ChemIDplus + + + + + CAS:7440-08-6 + NIST Chemistry WebBook + + + + + Gmelin:40435 + Gmelin + + + + + polonium + IUPAC + + + + + + 84Po + IUPAC + + + + + Po + IUPAC + + + + + polonio + ChEBI + + + + + polonium + ChEBI + + + + + + + + + + 0 + Rn + InChI=1S/Rn + SYUHGPGVQRZVTB-UHFFFAOYSA-N + 222.00000 + 222.00000 + [Rn] + CAS:10043-92-2 + Gmelin:16242 + WebElements:Rn + radon + chebi_ontology + 86Rn + Rn + niton + radium emanation + radon + CHEBI:33314 + + radon atom + + + + + CAS:10043-92-2 + ChemIDplus + + + + + CAS:10043-92-2 + NIST Chemistry WebBook + + + + + Gmelin:16242 + Gmelin + + + + + radon + IUPAC + + + + + + 86Rn + IUPAC + + + + + Rn + IUPAC + + + + + niton + ChemIDplus + + + + + radium emanation + ChemIDplus + + + + + radon + ChEBI + + + + + + + + + 0 + He + 4.003 + 4.00260 + chebi_ontology + elemental helium + CHEBI:33315 + + monoatomic helium + + + + + elemental helium + ChEBI + + + + + + + + + +2 + He + InChI=1S/He/q+2 + LBDSXVIYZYSRII-UHFFFAOYSA-N + 4.00260 + 4.00151 + [He++] + helium(2+) + chebi_ontology + He(2+) + CHEBI:33316 + + helium(2+) + + + + + helium(2+) + IUPAC + + + + + + He(2+) + IUPAC + + + + + + + + + group 13 elements + chebi_ontology + Element der Borgruppe + boron group element + boron group elements + group III elements + CHEBI:33317 + + boron group element atom + + + + + group 13 elements + IUPAC + + + + + + Element der Borgruppe + ChEBI + + + + + boron group element + ChEBI + + + + + boron group elements + ChEBI + + + + + group III elements + ChEBI + + + + + + + + + An atom belonging to one of the main groups (found in the s- and p- blocks) of the periodic table. + main group elements + chebi_ontology + Hauptgruppenelement + Hauptgruppenelemente + main group element + CHEBI:33318 + + main group element atom + + + + + main group elements + IUPAC + + + + + + Hauptgruppenelement + ChEBI + + + + + Hauptgruppenelemente + ChEBI + + + + + main group element + ChEBI + + + + + + + + + lanthanoids + chebi_ontology + Lanthanoid + Lanthanoide + Lanthanoidengruppe + Lanthanoidenreiche + Ln + lanthanide + lanthanides + lanthanoid + CHEBI:33319 + + lanthanoid atom + + + + + lanthanoids + IUPAC + + + + + + Lanthanoid + ChEBI + + + + + Lanthanoide + ChEBI + + + + + Lanthanoidengruppe + ChEBI + + + + + Lanthanoidenreiche + ChEBI + + + + + Ln + ChEBI + + + + + lanthanide + ChEBI + + + + + lanthanides + ChEBI + + + + + lanthanoid + ChEBI + + + + + + + + + actinoids + chebi_ontology + Actinoid + Actinoide + Actinoidenelemente + Actinoidengruppe + Aktinoide + Aktinoidenelemente + An + actinide + actinides + actinoid + CHEBI:33320 + + actinoid atom + + + + + actinoids + IUPAC + + + + + + Actinoid + ChEBI + + + + + Actinoide + ChEBI + + + + + Actinoidenelemente + ChEBI + + + + + Actinoidengruppe + ChEBI + + + + + Aktinoide + ChEBI + + + + + Aktinoidenelemente + ChEBI + + + + + An + ChEBI + + + + + actinide + ChEBI + + + + + actinides + ChEBI + + + + + actinoid + ChEBI + + + + + + + + + rare earth metals + chebi_ontology + rare earth metal + CHEBI:33321 + + rare earth metal atom + + + + + rare earth metals + IUPAC + + + + + + rare earth metal + ChEBI + + + + + + + + + 0 + Rb + InChI=1S/Rb + IGLNJRXAVVLDKE-UHFFFAOYSA-N + 85.46780 + 84.91179 + [Rb] + CAS:7440-17-7 + DrugBank:DB06749 + Gmelin:16244 + WebElements:Rb + rubidium + chebi_ontology + 37Rb + Rb + rubidio + rubidium + CHEBI:33322 + + rubidium atom + + + + + CAS:7440-17-7 + ChemIDplus + + + + + CAS:7440-17-7 + NIST Chemistry WebBook + + + + + Gmelin:16244 + Gmelin + + + + + rubidium + IUPAC + + + + + + 37Rb + IUPAC + + + + + Rb + IUPAC + + + + + rubidio + ChEBI + + + + + rubidium + ChEBI + + + + + + + + + 0 + Fr + InChI=1S/Fr + KLMCZVJOEAUDNE-UHFFFAOYSA-N + 223.00000 + 223.00000 + [Fr] + CAS:7440-73-5 + Gmelin:40458 + WebElements:Fr + francium + chebi_ontology + 87Fr + Fr + Franzium + francio + francium + CHEBI:33323 + + francium atom + + + + + CAS:7440-73-5 + ChemIDplus + + + + + CAS:7440-73-5 + NIST Chemistry WebBook + + + + + Gmelin:40458 + Gmelin + + + + + francium + IUPAC + + + + + + 87Fr + IUPAC + + + + + Fr + IUPAC + + + + + Franzium + ChEBI + + + + + francio + ChEBI + + + + + francium + ChEBI + + + + + + + + + 0 + Sr + InChI=1S/Sr + CIOAGBVUUVVLOB-UHFFFAOYSA-N + 87.62000 + 87.90561 + [Sr] + CAS:7440-24-6 + WebElements:Sr + strontium + chebi_ontology + 38Sr + Sr + estroncio + strontium + CHEBI:33324 + + strontium atom + + + + + CAS:7440-24-6 + ChemIDplus + + + + + CAS:7440-24-6 + NIST Chemistry WebBook + + + + + strontium + IUPAC + + + + + + 38Sr + IUPAC + + + + + Sr + IUPAC + + + + + estroncio + ChEBI + + + + + strontium + ChEBI + + + + + + + + + 0 + Ra + InChI=1S/Ra + HCWPIIXVSYCSAN-UHFFFAOYSA-N + 226.00000 + 226.00000 + [Ra] + CAS:7440-14-4 + WebElements:Ra + radium + chebi_ontology + 88Ra + Ra + radio + radium + CHEBI:33325 + + radium atom + + + + + CAS:7440-14-4 + ChemIDplus + + + + + CAS:7440-14-4 + NIST Chemistry WebBook + + + + + radium + IUPAC + + + + + + 88Ra + IUPAC + + + + + Ra + IUPAC + + + + + radio + ChEBI + + + + + radium + ChEBI + + + + + + + + + + + 0 + Sc + InChI=1S/Sc + SIXSYDAISGFNSX-UHFFFAOYSA-N + 44.95591 + 44.95591 + [Sc] + CAS:7440-20-2 + WebElements:Sc + scandium + chebi_ontology + 21Sc + Sc + Skandium + escandio + scandium + CHEBI:33330 + + scandium atom + + + + + CAS:7440-20-2 + ChemIDplus + + + + + CAS:7440-20-2 + NIST Chemistry WebBook + + + + + scandium + IUPAC + + + + + + 21Sc + IUPAC + + + + + Sc + IUPAC + + + + + Skandium + ChEBI + + + + + escandio + ChEBI + + + + + scandium + ChEBI + + + + + + + + + + + 0 + Y + InChI=1S/Y + VWQVUPCCIRVNHF-UHFFFAOYSA-N + 88.90585 + 88.90584 + [Y] + CAS:7440-65-5 + Gmelin:16319 + WebElements:Y + yttrium + chebi_ontology + 39Y + Y + ytrio + yttrium + CHEBI:33331 + + yttrium atom + + + + + CAS:7440-65-5 + ChemIDplus + + + + + CAS:7440-65-5 + NIST Chemistry WebBook + + + + + Gmelin:16319 + Gmelin + + + + + yttrium + IUPAC + + + + + + 39Y + IUPAC + + + + + Y + ChEBI + + + + + ytrio + ChEBI + + + + + yttrium + ChEBI + + + + + + + + + group 3 elements + chebi_ontology + scandium group element + scandium group elements + CHEBI:33335 + + scandium group element atom + + + + + group 3 elements + IUPAC + + + + + + scandium group element + ChEBI + + + + + scandium group elements + ChEBI + + + + + + + + + + + 0 + La + InChI=1S/La + FZLIPJUXYLNCLC-UHFFFAOYSA-N + 138.90550 + 138.90636 + [La] + CAS:7439-91-0 + Gmelin:16203 + WebElements:La + lanthanum + chebi_ontology + 57La + La + Lanthan + lantano + lanthane + lanthanum + CHEBI:33336 + + lanthanum atom + + + + + CAS:7439-91-0 + ChemIDplus + + + + + CAS:7439-91-0 + NIST Chemistry WebBook + + + + + Gmelin:16203 + Gmelin + + + + + lanthanum + IUPAC + + + + + + 57La + IUPAC + + + + + La + ChEBI + + + + + Lanthan + ChEBI + + + + + lantano + ChEBI + + + + + lanthane + ChEBI + + + + + lanthanum + ChEBI + + + + + + + + + + 0 + Ac + InChI=1S/Ac + QQINRWTZWGJFDB-UHFFFAOYSA-N + 227.00000 + 227.00000 + [Ac] + CAS:7440-34-8 + WebElements:Ac + actinium + chebi_ontology + 89Ac + Ac + Aktinium + actinio + actinium + CHEBI:33337 + + actinium atom + + + + + CAS:7440-34-8 + ChemIDplus + + + + + CAS:7440-34-8 + NIST Chemistry WebBook + + + + + actinium + IUPAC + + + + + + 89Ac + IUPAC + + + + + Ac + IUPAC + + + + + Aktinium + ChEBI + + + + + actinio + ChEBI + + + + + actinium + ChEBI + + + + + + + + + group 12 elements + chebi_ontology + zinc group element + zinc group elements + CHEBI:33340 + + zinc group element atom + + + + + group 12 elements + IUPAC + + + + + + zinc group element + ChEBI + + + + + zinc group elements + ChEBI + + + + + + + + + 0 + Ti + InChI=1S/Ti + RTAQQCXQSZGOHL-UHFFFAOYSA-N + 47.86700 + 47.94794 + [Ti] + CAS:7440-32-6 + WebElements:Ti + titanium + chebi_ontology + 22Ti + Ti + Titan + titane + titanio + titanium + CHEBI:33341 + + titanium atom + + + + + CAS:7440-32-6 + ChemIDplus + + + + + CAS:7440-32-6 + NIST Chemistry WebBook + + + + + titanium + IUPAC + + + + + + 22Ti + IUPAC + + + + + Ti + IUPAC + + + + + Titan + ChEBI + + + + + titane + ChEBI + + + + + titanio + ChEBI + + + + + titanium + ChEBI + + + + + + + + + 0 + Zr + InChI=1S/Zr + QCWXUUIWCKQGHC-UHFFFAOYSA-N + 91.22400 + 89.90470 + [Zr] + CAS:7440-67-7 + WebElements:Zr + zirconium + chebi_ontology + 40Zr + Zirkonium + Zr + circonio + zirconio + zirconium + CHEBI:33342 + + zirconium atom + + + + + CAS:7440-67-7 + ChemIDplus + + + + + CAS:7440-67-7 + NIST Chemistry WebBook + + + + + zirconium + IUPAC + + + + + + 40Zr + IUPAC + + + + + Zirkonium + ChEBI + + + + + Zr + IUPAC + + + + + circonio + ChEBI + + + + + zirconio + ChEBI + + + + + zirconium + ChEBI + + + + + + + + + 0 + Hf + InChI=1S/Hf + VBJZVLUMGGDVMO-UHFFFAOYSA-N + 178.49000 + 179.94656 + [Hf] + CAS:7440-58-6 + WebElements:Hf + hafnium + chebi_ontology + 72Hf + Hf + hafnio + hafnium + CHEBI:33343 + + hafnium atom + + + + + CAS:7440-58-6 + ChemIDplus + + + + + CAS:7440-58-6 + NIST Chemistry WebBook + + + + + hafnium + IUPAC + + + + + + 72Hf + IUPAC + + + + + Hf + IUPAC + + + + + hafnio + ChEBI + + + + + hafnium + ChEBI + + + + + + + + + 0 + Nb + InChI=1S/Nb + GUCVJGMIXFAOAE-UHFFFAOYSA-N + 92.90638 + 92.90637 + [Nb] + CAS:7440-03-1 + WebElements:Nb + niobium + chebi_ontology + 41Nb + Nb + Niob + columbio + columbium + niobio + niobium + CHEBI:33344 + + niobium atom + + + + + CAS:7440-03-1 + ChemIDplus + + + + + CAS:7440-03-1 + NIST Chemistry WebBook + + + + + niobium + IUPAC + + + + + + 41Nb + IUPAC + + + + + Nb + IUPAC + + + + + Niob + ChEBI + + + + + columbio + ChEBI + + + + + columbium + NIST_Chemistry_WebBook + + + + + niobio + ChEBI + + + + + niobium + ChEBI + + + + + + + + + group 4 elements + chebi_ontology + titanium group element + titanium group elements + CHEBI:33345 + + titanium group element atom + + + + + group 4 elements + IUPAC + + + + + + titanium group element + ChEBI + + + + + titanium group elements + ChEBI + + + + + + + + + 0 + Rf + InChI=1S/Rf + YGPLJIIQQIDVFJ-UHFFFAOYSA-N + 261.00000 + 267.00000 + [Rf] + WebElements:Rf + rutherfordium + chebi_ontology + 104Rf + Ku + Rf + Unq + kurchatovium + rutherfordio + rutherfordium + unnilquadium + CHEBI:33346 + + rutherfordium atom + + + + + rutherfordium + IUPAC + + + + + + 104Rf + IUPAC + + + + + Ku + ChEBI + + + + + Rf + IUPAC + + + + + Unq + IUPAC + + + + + kurchatovium + ChEBI + + + + + rutherfordio + ChEBI + + + + + rutherfordium + ChEBI + + + + + unnilquadium + IUPAC + + + + + + + + + group 5 elements + chebi_ontology + vanadium group element + vanadium group elements + CHEBI:33347 + + vanadium group element atom + + + + + group 5 elements + IUPAC + + + + + + vanadium group element + ChEBI + + + + + vanadium group elements + ChEBI + + + + + + + + + 0 + Ta + InChI=1S/Ta + GUVRBAGPIYLISA-UHFFFAOYSA-N + 180.94790 + 180.94800 + [Ta] + CAS:7440-25-7 + WebElements:Ta + tantalum + chebi_ontology + 73Ta + Ta + Tantal + tantale + tantalo + tantalum + CHEBI:33348 + + tantalum atom + + + + + CAS:7440-25-7 + ChemIDplus + + + + + CAS:7440-25-7 + NIST Chemistry WebBook + + + + + tantalum + IUPAC + + + + + + 73Ta + IUPAC + + + + + Ta + IUPAC + + + + + Tantal + ChEBI + + + + + tantale + ChEBI + + + + + tantalo + ChEBI + + + + + tantalum + ChEBI + + + + + + + + + 0 + Db + 262.00000 + 270.00000 + [Db] + WebElements:Db + dubnium + chebi_ontology + 105Db + Db + Ha + Ns + Unp + dubnio + dubnium + hahnium + nielsbohrium + unnilpentium + CHEBI:33349 + + dubnium atom + + + + + dubnium + IUPAC + + + + + + 105Db + IUPAC + + + + + Db + IUPAC + + + + + Ha + ChEBI + + + + + Ns + ChEBI + + + + + Unp + IUPAC + + + + + dubnio + ChEBI + + + + + dubnium + ChEBI + + + + + hahnium + ChEBI + + + + + nielsbohrium + ChEBI + + + + + unnilpentium + IUPAC + + + + + + + + + group 6 elements + chebi_ontology + chromium group element + chromium group elements + CHEBI:33350 + + chromium group element atom + + + + + group 6 elements + IUPAC + + + + + + chromium group element + ChEBI + + + + + chromium group elements + ChEBI + + + + + + + + + 0 + Sg + 263.00000 + 271.00000 + [Sg] + WebElements:Sg + seaborgium + chebi_ontology + 106Sg + Sg + Unh + seaborgio + seaborgium + unnilhexium + CHEBI:33351 + + seaborgium atom + + + + + seaborgium + IUPAC + + + + + + 106Sg + IUPAC + + + + + Sg + IUPAC + + + + + Unh + ChEBI + + + + + seaborgio + ChEBI + + + + + seaborgium + ChEBI + + + + + unnilhexium + IUPAC + + + + + + + + + group 7 elements + chebi_ontology + manganese group element + manganese group elements + CHEBI:33352 + + manganese group element atom + + + + + group 7 elements + IUPAC + + + + + + manganese group element + ChEBI + + + + + manganese group elements + ChEBI + + + + + + + + + 0 + Tc + InChI=1S/Tc + GKLVYJBZJHMRIY-UHFFFAOYSA-N + 98.00000 + 97.00000 + [Tc] + CAS:7440-26-8 + Gmelin:16310 + WebElements:Tc + technetium + chebi_ontology + 43Tc + Tc + Technetium + technetium + tecnecio + CHEBI:33353 + + technetium atom + + + + + CAS:7440-26-8 + ChemIDplus + + + + + CAS:7440-26-8 + NIST Chemistry WebBook + + + + + Gmelin:16310 + Gmelin + + + + + technetium + IUPAC + + + + + + 43Tc + IUPAC + + + + + Tc + IUPAC + + + + + Technetium + ChEBI + + + + + technetium + ChEBI + + + + + tecnecio + ChEBI + + + + + + + + + 0 + Bh + 264.00000 + 270.00000 + [Bh] + WebElements:Bh + bohrium + chebi_ontology + 107Bh + Bh + Ns + Uns + bohrio + bohrium + nielsbohrium + unnilseptium + CHEBI:33355 + + bohrium atom + + + + + bohrium + IUPAC + + + + + + 107Bh + IUPAC + + + + + Bh + IUPAC + + + + + Ns + ChEBI + + + + + Uns + IUPAC + + + + + bohrio + ChEBI + + + + + bohrium + ChEBI + + + + + nielsbohrium + ChEBI + + + + + unnilseptium + IUPAC + + + + + + + + + group 8 elements + chebi_ontology + iron group element + iron group elements + CHEBI:33356 + + iron group element atom + + + + + group 8 elements + IUPAC + + + + + + iron group element + ChEBI + + + + + iron group elements + ChEBI + + + + + + + + + 0 + Hs + 265.00000 + 277.00000 + [Hs] + WebElements:Hs + hassium + chebi_ontology + 108Hs + Ha + Hs + Uno + hahnium + hassio + hassium + unniloctium + CHEBI:33357 + + hassium atom + + + + + hassium + IUPAC + + + + + + 108Hs + IUPAC + + + + + Ha + ChEBI + + + + + Hs + IUPAC + + + + + Uno + IUPAC + + + + + hahnium + ChEBI + + + + + hassio + ChEBI + + + + + hassium + ChEBI + + + + + unniloctium + IUPAC + + + + + + + + + group 9 elements + chebi_ontology + cobalt group element + cobalt group elements + CHEBI:33358 + + cobalt group element atom + + + + + group 9 elements + IUPAC + + + + + + cobalt group element + ChEBI + + + + + cobalt group elements + ChEBI + + + + + + + + + A cobalt group element atom of atomic number 45. + 0 + Rh + InChI=1S/Rh + MHOVAHRLVXNVSD-UHFFFAOYSA-N + 102.90550 + 102.90550 + [Rh] + CAS:7440-16-6 + PMID:2936374 + WebElements:Rh + Wikipedia:Rhodium + rhodium + chebi_ontology + 45Rh + Rh + rhodium + rodio + CHEBI:33359 + + rhodium atom + + + + + CAS:7440-16-6 + ChemIDplus + + + + + CAS:7440-16-6 + NIST Chemistry WebBook + + + + + PMID:2936374 + Europe PMC + + + + + rhodium + IUPAC + + + + + + 45Rh + IUPAC + + + + + Rh + ChEBI + + + + + rhodium + ChEBI + + + + + rodio + ChEBI + + + + + + + + + 0 + Mt + 0.00000 + 0.00000 + [Mt] + WebElements:Mt + meitnerium + chebi_ontology + 109Mt + Mt + Une + meitnerio + meitnerium + unnilennium + CHEBI:33361 + + meitnerium atom + + + + + meitnerium + IUPAC + + + + + + 109Mt + IUPAC + + + + + Mt + IUPAC + + + + + Une + IUPAC + + + + + meitnerio + ChEBI + + + + + meitnerium + ChEBI + + + + + unnilennium + IUPAC + + + + + + + + + group 10 elements + chebi_ontology + nickel group element + nickel group elements + CHEBI:33362 + + nickel group element atom + + + + + group 10 elements + IUPAC + + + + + + nickel group element + ChEBI + + + + + nickel group elements + ChEBI + + + + + + + + + + + Chemical element (nickel group element atom) with atomic number 46. + 0 + Pd + InChI=1S/Pd + KDLHZDBZIXYQEI-UHFFFAOYSA-N + 106.42000 + 105.90348 + [Pd] + CAS:7440-05-3 + PMID:25097477 + Reaxys:4937491 + WebElements:Pd + Wikipedia:Palladium + palladium + chebi_ontology + 46Pd + Pd + paladio + CHEBI:33363 + + palladium + + + + + CAS:7440-05-3 + ChemIDplus + + + + + CAS:7440-05-3 + NIST Chemistry WebBook + + + + + PMID:25097477 + Europe PMC + + + + + Reaxys:4937491 + Reaxys + + + + + palladium + IUPAC + + + + + + 46Pd + IUPAC + + + + + Pd + IUPAC + + + + + paladio + ChEBI + + + + + + + + + + 0 + Pt + InChI=1S/Pt + BASFCYQUMIYNBI-UHFFFAOYSA-N + 195.078 + 194.96479 + [Pt] + CAS:7440-06-4 + WebElements:Pt + platinum + chebi_ontology + 78Pt + Platin + Pt + platine + platino + CHEBI:33364 + + platinum + + + + + CAS:7440-06-4 + ChemIDplus + + + + + CAS:7440-06-4 + NIST Chemistry WebBook + + + + + platinum + IUPAC + + + + + + 78Pt + IUPAC + + + + + Platin + ChEBI + + + + + Pt + IUPAC + + + + + platine + ChEBI + + + + + platino + ChEBI + + + + + + + + + chebi_ontology + PGM + Platinmetalle + Platinoide + platinoid + platinum group metal + platinum group metals + platinum metals + CHEBI:33365 + + platinum group metal atom + + + + + PGM + ChEBI + + + + + Platinmetalle + ChEBI + + + + + Platinoide + ChEBI + + + + + platinoid + ChEBI + + + + + platinum group metal + ChEBI + + + + + platinum group metals + ChEBI + + + + + platinum metals + ChEBI + + + + + + + + + group 11 elements + chebi_ontology + coinage metals + copper group element + copper group elements + CHEBI:33366 + + copper group element atom + + + + + group 11 elements + IUPAC + + + + + + coinage metals + ChEBI + + + + + copper group element + ChEBI + + + + + copper group elements + ChEBI + + + + + + + + + 0 + Ds + InChI=1S/Ds + NCBMSFCPDGXTHD-UHFFFAOYSA-N + 0.00000 + 0.00000 + [Ds] + WebElements:Ds + darmstadtium + chebi_ontology + 110Ds + Ds + Uun + darmstadtio + ununnilium + CHEBI:33367 + + darmstadtium + + + + + darmstadtium + IUPAC + + + + + + 110Ds + IUPAC + + + + + Ds + IUPAC + + + + + Uun + IUPAC + + + + + darmstadtio + ChEBI + + + + + ununnilium + IUPAC + + + + + + + + + A copper group element atom with atomic number 111. The the ninth member of the 6d series of transition metals, it is an extremely radioactive, synthetic element. Average mass is around 281. + 0 + Rg + InChI=1S/Rg + LJROPTGWFUZRDB-UHFFFAOYSA-N + 0.000 + 0.00000 + [Rg] + WebElements:Rg + Wikipedia:Roentgenium + roentgenium + chebi_ontology + 111Rg + Rg + Roentgenium + Uuu + roentgenio + roentgenium + unununium + CHEBI:33368 + + roentgenium atom + + + + + roentgenium + IUPAC + + + + + + 111Rg + IUPAC + + + + + Rg + IUPAC + + + + + Roentgenium + ChEBI + + + + + Uuu + ChEBI + + + + + roentgenio + ChEBI + + + + + roentgenium + ChEBI + + + + + unununium + ChEBI + + + + + + + + + + 0 + Ce + InChI=1S/Ce + GWXLDORMOJMVQZ-UHFFFAOYSA-N + 140.11600 + 139.90544 + [Ce] + CAS:7440-45-1 + Gmelin:16275 + WebElements:Ce + cerium + chebi_ontology + 58Ce + Ce + Cer + Zer + cerio + CHEBI:33369 + + cerium + + + + + CAS:7440-45-1 + ChemIDplus + + + + + CAS:7440-45-1 + NIST Chemistry WebBook + + + + + Gmelin:16275 + Gmelin + + + + + cerium + ChEBI + + + + + cerium + IUPAC + + + + + + 58Ce + IUPAC + + + + + Ce + IUPAC + + + + + Cer + ChEBI + + + + + Zer + ChEBI + + + + + cerio + ChEBI + + + + + + + + + 0 + [99Tc] + InChI=1S/Tc/i1+1 + GKLVYJBZJHMRIY-OUBTZVSYSA-N + 98.906 + 98.90625 + [99Tc] + CAS:14133-76-7 + Gmelin:41657 + technetium-99 + chebi_ontology + (99)43Tc + (99)Tc + technetium, isotope of mass 99 + CHEBI:33371 + + technetium-99 + + + + + CAS:14133-76-7 + ChemIDplus + + + + + Gmelin:41657 + Gmelin + + + + + technetium-99 + IUPAC + + + + + + (99)43Tc + IUPAC + + + + + (99)Tc + IUPAC + + + + + technetium, isotope of mass 99 + ChemIDplus + + + + + + + + + + 0 + Nd + InChI=1S/Nd + QEFYFXOXNSNQGX-UHFFFAOYSA-N + 144.24000 + 141.90773 + [Nd] + CAS:7440-00-8 + Gmelin:16212 + WebElements:Nd + neodymium + chebi_ontology + 60Nd + Nd + Neodym + neodimio + neodyme + neodymium + CHEBI:33372 + + neodymium atom + + + + + CAS:7440-00-8 + ChemIDplus + + + + + CAS:7440-00-8 + NIST Chemistry WebBook + + + + + Gmelin:16212 + Gmelin + + + + + neodymium + IUPAC + + + + + + 60Nd + IUPAC + + + + + Nd + IUPAC + + + + + Neodym + ChEBI + + + + + neodimio + ChEBI + + + + + neodyme + ChEBI + + + + + neodymium + ChEBI + + + + + + + + + + 0 + Pm + InChI=1S/Pm + VQMWBBYLQSCNPO-UHFFFAOYSA-N + 145.00000 + 145.00000 + [Pm] + CAS:7440-12-2 + Gmelin:16237 + WebElements:Pm + promethium + chebi_ontology + 61Pm + Pm + Promethium + promethium + prometio + CHEBI:33373 + + promethium atom + + + + + CAS:7440-12-2 + ChemIDplus + + + + + CAS:7440-12-2 + NIST Chemistry WebBook + + + + + Gmelin:16237 + Gmelin + + + + + promethium + IUPAC + + + + + + 61Pm + IUPAC + + + + + Pm + IUPAC + + + + + Promethium + ChEBI + + + + + promethium + ChEBI + + + + + prometio + ChEBI + + + + + + + + + + 0 + Sm + InChI=1S/Sm + KZUNJOHGWZRPMI-UHFFFAOYSA-N + 150.36000 + 151.91974 + [Sm] + CAS:7440-19-9 + Gmelin:16301 + WebElements:Sm + samarium + chebi_ontology + 62Sm + Sm + samario + samarium + CHEBI:33374 + + samarium atom + + + + + CAS:7440-19-9 + ChemIDplus + + + + + CAS:7440-19-9 + NIST Chemistry WebBook + + + + + Gmelin:16301 + Gmelin + + + + + samarium + IUPAC + + + + + + 62Sm + IUPAC + + + + + Sm + IUPAC + + + + + samario + ChEBI + + + + + samarium + ChEBI + + + + + + + + + + 0 + Gd + InChI=1S/Gd + UIWYJDYFSGRHKR-UHFFFAOYSA-N + 157.25000 + 157.92411 + [Gd] + CAS:7440-54-2 + Gmelin:16286 + WebElements:Gd + gadolinium + chebi_ontology + 64Gd + Gd + gadolinio + gadolinium + CHEBI:33375 + + gadolinium atom + + + + + CAS:7440-54-2 + ChemIDplus + + + + + CAS:7440-54-2 + NIST Chemistry WebBook + + + + + Gmelin:16286 + Gmelin + + + + + gadolinium + IUPAC + + + + + + 64Gd + IUPAC + + + + + Gd + IUPAC + + + + + gadolinio + ChEBI + + + + + gadolinium + ChEBI + + + + + + + + + + 0 + Tb + InChI=1S/Tb + GZCRRIHWUXGPOV-UHFFFAOYSA-N + 158.92534 + 158.92535 + [Tb] + CAS:7440-27-9 + Gmelin:16311 + WebElements:Tb + terbium + chebi_ontology + 65Tb + Tb + terbio + terbium + CHEBI:33376 + + terbium atom + + + + + CAS:7440-27-9 + ChemIDplus + + + + + CAS:7440-27-9 + NIST Chemistry WebBook + + + + + Gmelin:16311 + Gmelin + + + + + terbium + IUPAC + + + + + + 65Tb + IUPAC + + + + + Tb + IUPAC + + + + + terbio + ChEBI + + + + + terbium + ChEBI + + + + + + + + + + 0 + Dy + InChI=1S/Dy + KBQHZAAAGSGFKK-UHFFFAOYSA-N + 162.50000 + 163.92918 + [Dy] + CAS:7429-91-6 + Gmelin:16278 + WebElements:Dy + dysprosium + chebi_ontology + 66Dy + Dy + disprosio + dysprosium + CHEBI:33377 + + dysprosium atom + + + + + CAS:7429-91-6 + ChemIDplus + + + + + CAS:7429-91-6 + NIST Chemistry WebBook + + + + + Gmelin:16278 + Gmelin + + + + + dysprosium + IUPAC + + + + + + 66Dy + IUPAC + + + + + Dy + IUPAC + + + + + disprosio + ChEBI + + + + + dysprosium + ChEBI + + + + + + + + + + 0 + Er + InChI=1S/Er + UYAHIZSMUZPPFV-UHFFFAOYSA-N + 167.26000 + 165.93030 + [Er] + CAS:7440-52-0 + Gmelin:16280 + WebElements:Er + erbium + chebi_ontology + 68Er + Er + erbio + CHEBI:33379 + + erbium + + + + + CAS:7440-52-0 + ChemIDplus + + + + + CAS:7440-52-0 + NIST Chemistry WebBook + + + + + Gmelin:16280 + Gmelin + + + + + erbium + IUPAC + + + + + + 68Er + IUPAC + + + + + Er + IUPAC + + + + + erbio + ChEBI + + + + + + + + + + 0 + Tm + InChI=1S/Tm + FRNOGLGSGLTDKL-UHFFFAOYSA-N + 168.93421 + 168.93422 + [Tm] + CAS:7440-30-4 + Gmelin:16307 + WebElements:Tm + thulium + chebi_ontology + 69Tm + Tm + thulium + tulio + CHEBI:33380 + + thulium atom + + + + + CAS:7440-30-4 + ChemIDplus + + + + + CAS:7440-30-4 + NIST Chemistry WebBook + + + + + Gmelin:16307 + Gmelin + + + + + thulium + IUPAC + + + + + + 69Tm + IUPAC + + + + + Tm + ChEBI + + + + + thulium + ChEBI + + + + + tulio + ChEBI + + + + + + + + + + 0 + Yb + InChI=1S/Yb + NAWDYIZEMPQZHO-UHFFFAOYSA-N + 173.04000 + 173.93887 + [Yb] + CAS:7440-64-4 + Gmelin:16320 + WebElements:Yb + ytterbium + chebi_ontology + 70Yb + Yb + yterbio + CHEBI:33381 + + ytterbium + + + + + CAS:7440-64-4 + ChemIDplus + + + + + CAS:7440-64-4 + NIST Chemistry WebBook + + + + + Gmelin:16320 + Gmelin + + + + + ytterbium + IUPAC + + + + + + 70Yb + IUPAC + + + + + Yb + IUPAC + + + + + yterbio + ChEBI + + + + + + + + + + 0 + Lu + InChI=1S/Lu + OHSVLFRHMCKCQY-UHFFFAOYSA-N + 174.96700 + 174.94078 + [Lu] + CAS:7439-94-3 + Gmelin:16202 + WebElements:Lu + lutetium + chebi_ontology + 71Lu + Cassiopeium + Lu + Lutetium + cassiopium + lutecio + lutecium + lutetium + CHEBI:33382 + + lutetium atom + + + + + CAS:7439-94-3 + ChemIDplus + + + + + CAS:7439-94-3 + NIST Chemistry WebBook + + + + + Gmelin:16202 + Gmelin + + + + + lutetium + IUPAC + + + + + + 71Lu + IUPAC + + + + + Cassiopeium + ChEBI + + + + + Lu + IUPAC + + + + + Lutetium + ChEBI + + + + + cassiopium + ChEBI + + + + + lutecio + ChEBI + + + + + lutecium + ChEBI + + + + + lutetium + ChEBI + + + + + + + + + 0 + Th + InChI=1S/Th + ZSLUVFAKFWKJRC-UHFFFAOYSA-N + 232.03810 + 232.03806 + [Th] + CAS:7440-29-1 + KEGG:C19157 + WebElements:Th + thorium + chebi_ontology + 90Th + Th + torio + CHEBI:33385 + + thorium + + + + + CAS:7440-29-1 + ChemIDplus + + + + + CAS:7440-29-1 + KEGG COMPOUND + + + + + CAS:7440-29-1 + NIST Chemistry WebBook + + + + + thorium + IUPAC + + + + + + 90Th + IUPAC + + + + + Th + IUPAC + + + + + torio + ChEBI + + + + + + + + + 0 + Pa + InChI=1S/Pa + XLROVYAPLOFLNU-UHFFFAOYSA-N + 231.03588 + 231.03589 + [Pa] + CAS:7440-13-3 + WebElements:Pa + protactinium + chebi_ontology + 91Pa + Pa + brevium + protactinio + protactinium + protoactinium + CHEBI:33386 + + protactinium atom + + + + + CAS:7440-13-3 + ChemIDplus + + + + + CAS:7440-13-3 + NIST Chemistry WebBook + + + + + protactinium + IUPAC + + + + + + 91Pa + IUPAC + + + + + Pa + IUPAC + + + + + brevium + ChEBI + + + + + protactinio + ChEBI + + + + + protactinium + ChEBI + + + + + protoactinium + NIST_Chemistry_WebBook + + + + + + + + + 0 + Np + InChI=1S/Np + LFNLGNPSGWYGGD-UHFFFAOYSA-N + 237.00000 + 237.00000 + [Np] + CAS:7439-99-8 + WebElements:Np + neptunium + chebi_ontology + 93Np + Np + neptunio + neptunium + CHEBI:33387 + + neptunium atom + + + + + CAS:7439-99-8 + ChemIDplus + + + + + CAS:7439-99-8 + NIST Chemistry WebBook + + + + + neptunium + IUPAC + + + + + + 93Np + IUPAC + + + + + Np + IUPAC + + + + + neptunio + ChEBI + + + + + neptunium + ChEBI + + + + + + + + + 0 + Pu + InChI=1S/Pu + OYEHPCDNVJXUIW-UHFFFAOYSA-N + 244.00000 + 244.00000 + [Pu] + CAS:7440-07-5 + KEGG:C19159 + WebElements:Pu + plutonium + chebi_ontology + 94Pu + Pu + plutonio + plutonium + CHEBI:33388 + + plutonium atom + + + + + CAS:7440-07-5 + ChemIDplus + + + + + CAS:7440-07-5 + KEGG COMPOUND + + + + + CAS:7440-07-5 + NIST Chemistry WebBook + + + + + plutonium + IUPAC + + + + + + 94Pu + IUPAC + + + + + Pu + ChEBI + + + + + plutonio + ChEBI + + + + + plutonium + ChEBI + + + + + + + + + 0 + Am + InChI=1S/Am + LXQXZNRPTYVCNG-UHFFFAOYSA-N + 243.00000 + 243.00000 + [Am] + CAS:7440-35-9 + WebElements:Am + americium + chebi_ontology + 95Am + Am + Americium + Amerizium + americio + americium + CHEBI:33389 + + americium atom + + + + + CAS:7440-35-9 + ChemIDplus + + + + + CAS:7440-35-9 + NIST Chemistry WebBook + + + + + americium + IUPAC + + + + + + 95Am + IUPAC + + + + + Am + IUPAC + + + + + Americium + ChEBI + + + + + Amerizium + ChEBI + + + + + americio + ChEBI + + + + + americium + ChEBI + + + + + + + + + 0 + Cm + InChI=1S/Cm + NIWWFAAXEMMFMS-UHFFFAOYSA-N + 247.00000 + 247.00000 + [Cm] + CAS:7440-51-9 + WebElements:Cm + curium + chebi_ontology + 96Cm + Cm + curio + curium + CHEBI:33390 + + curium atom + + + + + CAS:7440-51-9 + ChemIDplus + + + + + CAS:7440-51-9 + NIST Chemistry WebBook + + + + + curium + IUPAC + + + + + + 96Cm + IUPAC + + + + + Cm + IUPAC + + + + + curio + ChEBI + + + + + curium + ChEBI + + + + + + + + + 0 + Bk + InChI=1S/Bk + PWVKJRSRVJTHTR-UHFFFAOYSA-N + 247.00000 + 247.00000 + [Bk] + CAS:7440-40-6 + WebElements:Bk + berkelium + chebi_ontology + 97Bk + Berkelium + Bk + berkelio + berkelium + CHEBI:33391 + + berkelium atom + + + + + CAS:7440-40-6 + ChemIDplus + + + + + CAS:7440-40-6 + NIST Chemistry WebBook + + + + + berkelium + IUPAC + + + + + + 97Bk + IUPAC + + + + + Berkelium + ChEBI + + + + + Bk + ChEBI + + + + + berkelio + ChEBI + + + + + berkelium + ChEBI + + + + + + + + + 0 + Cf + InChI=1S/Cf + HGLDOAKPQXAFKI-UHFFFAOYSA-N + 251.00000 + 251.00000 + [Cf] + CAS:7440-71-3 + WebElements:Cf + californium + chebi_ontology + 98Cf + Cf + Kalifornium + californio + californium + CHEBI:33392 + + californium atom + + + + + CAS:7440-71-3 + ChemIDplus + + + + + CAS:7440-71-3 + NIST Chemistry WebBook + + + + + californium + IUPAC + + + + + + 98Cf + ChEBI + + + + + Cf + IUPAC + + + + + Kalifornium + ChEBI + + + + + californio + ChEBI + + + + + californium + ChEBI + + + + + + + + + 0 + Es + InChI=1S/Es + CKBRQZNRCSJHFT-UHFFFAOYSA-N + 252.00000 + 252.00000 + [Es] + CAS:7429-92-7 + WebElements:Es + einsteinium + chebi_ontology + 99Es + Es + einsteinio + einsteinium + CHEBI:33393 + + einsteinium atom + + + + + CAS:7429-92-7 + ChemIDplus + + + + + CAS:7429-92-7 + NIST Chemistry WebBook + + + + + einsteinium + IUPAC + + + + + + 99Es + IUPAC + + + + + Es + IUPAC + + + + + einsteinio + ChEBI + + + + + einsteinium + ChEBI + + + + + + + + + 0 + Fm + InChI=1S/Fm + MIORUQGGZCBUGO-UHFFFAOYSA-N + 257.00000 + 257.00000 + [Fm] + CAS:7440-72-4 + WebElements:Fm + fermium + chebi_ontology + 100Fm + Fm + fermio + CHEBI:33394 + + fermium + + + + + CAS:7440-72-4 + ChemIDplus + + + + + CAS:7440-72-4 + NIST Chemistry WebBook + + + + + fermium + IUPAC + + + + + + 100Fm + IUPAC + + + + + Fm + IUPAC + + + + + fermio + ChEBI + + + + + + + + + 0 + Md + InChI=1S/Md + MQVSLOYRCXQRPM-UHFFFAOYSA-N + 258.00000 + 258.00000 + [Md] + CAS:7440-11-1 + WebElements:Md + mendelevium + chebi_ontology + 101Md + Md + Mendelevium + Unu + mendelevio + mendelevium + unnilunium + CHEBI:33395 + + mendelevium atom + + + + + CAS:7440-11-1 + ChemIDplus + + + + + CAS:7440-11-1 + NIST Chemistry WebBook + + + + + mendelevium + IUPAC + + + + + + 101Md + IUPAC + + + + + Md + IUPAC + + + + + Mendelevium + ChEBI + + + + + Unu + IUPAC + + + + + mendelevio + ChEBI + + + + + mendelevium + ChEBI + + + + + unnilunium + IUPAC + + + + + + + + + 0 + No + InChI=1S/No + ORQBXQOJMQIAOY-UHFFFAOYSA-N + 259.00000 + 259.00000 + [No] + CAS:10028-14-5 + WebElements:No + Nobelium + nobelium + chebi_ontology + 102No + No + Unb + nobelio + unnilbium + CHEBI:33396 + + nobelium + + + + + CAS:10028-14-5 + ChemIDplus + + + + + CAS:10028-14-5 + NIST Chemistry WebBook + + + + + Nobelium + ChEBI + + + + + nobelium + ChEBI + + + + + nobelium + IUPAC + + + + + + 102No + IUPAC + + + + + No + IUPAC + + + + + Unb + IUPAC + + + + + nobelio + ChEBI + + + + + unnilbium + IUPAC + + + + + + + + + + 0 + Lr + InChI=1S/Lr + CNQCVBJFEGMYDW-UHFFFAOYSA-N + 262.00000 + 262.00000 + [Lr] + CAS:22537-19-5 + WebElements:Lr + lawrencium + chebi_ontology + 103Lr + Lr + Unt + laurencio + lawrencio + lawrencium + unniltrium + CHEBI:33397 + + lawrencium atom + + + + + CAS:22537-19-5 + ChemIDplus + + + + + lawrencium + IUPAC + + + + + + 103Lr + IUPAC + + + + + Lr + IUPAC + + + + + Unt + IUPAC + + + + + laurencio + ChEBI + + + + + lawrencio + ChEBI + + + + + lawrencium + ChEBI + + + + + unniltrium + IUPAC + + + + + + + + + + sulfur oxoacid derivative + + + + + + + + + + + elemental pnictogen + + + + + + + + + 0 + [220Rn] + InChI=1S/Rn/i1-2 + SYUHGPGVQRZVTB-YPZZEJLDSA-N + 220.011 + 220.01138 + [220Rn] + CAS:22481-48-7 + Gmelin:297037 + radon-220 + chebi_ontology + (220)86Rn + (220)Rn + Tn + radon, isotope of mass 220 + radon-220 + thoron + CHEBI:33491 + + radon-220 atom + + + + + CAS:22481-48-7 + ChemIDplus + + + + + Gmelin:297037 + Gmelin + + + + + radon-220 + IUPAC + + + + + + (220)86Rn + IUPAC + + + + + (220)Rn + IUPAC + + + + + Tn + ChEBI + + + + + radon, isotope of mass 220 + ChemIDplus + + + + + radon-220 + ChEBI + + + + + thoron + ChemIDplus + + + + + + + + + 0 + [222Rn] + InChI=1S/Rn/i1+0 + SYUHGPGVQRZVTB-IGMARMGPSA-N + 222.018 + 222.01757 + [222Rn] + CAS:14859-67-7 + radon-222 + chebi_ontology + (222)86Rn + (222)Rn + radon, isotope of mass 222 + radon-222 + CHEBI:33492 + + radon-222 atom + + + + + CAS:14859-67-7 + ChemIDplus + + + + + radon-222 + IUPAC + + + + + + (222)86Rn + IUPAC + + + + + (222)Rn + IUPAC + + + + + radon, isotope of mass 222 + ChemIDplus + + + + + radon-222 + ChEBI + + + + + + + + + 0 + [219Rn] + InChI=1S/Rn/i1-3 + SYUHGPGVQRZVTB-OIOBTWANSA-N + 219.009 + 219.00947 + [219Rn] + CAS:14835-02-0 + Gmelin:297039 + radon-219 + chebi_ontology + (219)86Rn + (219)Rn + An + actinon + radon, isotope of mass 219 + radon-219 + CHEBI:33493 + + radon-219 atom + + + + + CAS:14835-02-0 + ChemIDplus + + + + + Gmelin:297039 + Gmelin + + + + + radon-219 + IUPAC + + + + + + (219)86Rn + IUPAC + + + + + (219)Rn + IUPAC + + + + + An + ChEBI + + + + + actinon + ChEBI + + + + + radon, isotope of mass 219 + ChemIDplus + + + + + radon-219 + ChEBI + + + + + + + + + transition element molecular entity + + + + + + + + + actinoid molecular entity + + + + + + + + + uranium molecular entity + + + + + + + + + alkali metal cation + + + + + + + + + A zinc group element atom with a symbol Cn and atomic number 112. All its isotopes are intensely radioactive. Prior to its discovery, it had the placeholder name ununbium (in accordance with IUPAC recommendations). Following its discovery (in Darmstadt, 1996) and subsequent confirmation, the name copernicium was adopted in 2010. + 0 + Cn + InChI=1S/Cn + NOTIIDSZELDPOP-UHFFFAOYSA-N + NaN + 0.00000 + [Cn] + Wikipedia:Copernicium + copernicium + chebi_ontology + 112Cn + 112Cp + 112Uub + Cn + Uub + ununbium + CHEBI:33517 + + copernicium atom + + + + + copernicium + IUPAC + + + + + + 112Cn + ChEBI + + + + + 112Cp + IUPAC + + + + + 112Uub + IUPAC + + + + + Cn + IUPAC + + + + + Uub + IUPAC + + + + + ununbium + ChEBI + + + + + ununbium + IUPAC + + + + + + + + + An atom of an element that exhibits typical metallic properties, being typically shiny, with high electrical and thermal conductivity. + CHEBI:25217 + CHEBI:6788 + KEGG:C00050 + PMID:21784043 + Wikipedia:Metal + chebi_ontology + elemental metal + elemental metals + metal element + metal elements + metals + CHEBI:33521 + + metal atom + + + + + PMID:21784043 + Europe PMC + + + + + elemental metal + ChEBI + + + + + elemental metals + ChEBI + + + + + metal element + ChEBI + + + + + metal elements + ChEBI + + + + + metals + ChEBI + + + + + + + + + + + + + + + An amino-acid anion obtained by deprotonation of any alpha-amino acid. + alpha-amino-acid anion + chebi_ontology + alpha-amino acid anions + alpha-amino-acid anions + CHEBI:33558 + + alpha-amino-acid anion + + + + + alpha-amino-acid anion + ChEBI + + + + + alpha-amino acid anions + ChEBI + + + + + alpha-amino-acid anions + ChEBI + + + + + + + + + chebi_ontology + s-block element + s-block elements + CHEBI:33559 + + s-block element atom + + + + + s-block element + ChEBI + + + + + s-block elements + ChEBI + + + + + + + + + Any main group element atom belonging to the p-block of the periodic table. + chebi_ontology + p-block element + p-block elements + CHEBI:33560 + + p-block element atom + + + + + p-block element + ChEBI + + + + + p-block elements + ChEBI + + + + + + + + + chebi_ontology + d-block element + d-block elements + CHEBI:33561 + + d-block element atom + + + + + d-block element + ChEBI + + + + + d-block elements + ChEBI + + + + + + + + + chebi_ontology + f-block element + f-block elements + CHEBI:33562 + + f-block element atom + + + + + f-block element + ChEBI + + + + + f-block elements + ChEBI + + + + + + + + + + + + + + + + + + + + + + + A carbon oxoacid acid carrying at least one -C(=O)OH group and having the structure RC(=O)OH, where R is any any monovalent functional group. Carboxylic acids are the most common type of organic acid. + 0 + CHO2R + 45.01740 + 44.99765 + OC([*])=O + CHEBI:13428 + CHEBI:13627 + CHEBI:23027 + PMID:17147560 + PMID:18433345 + Wikipedia:Carboxylic_acid + carboxylic acid + carboxylic acids + chebi_ontology + Carbonsaeure + Carbonsaeuren + Karbonsaeure + RC(=O)OH + acide carboxylique + acides carboxyliques + acido carboxilico + acidos carboxilicos + CHEBI:33575 + + carboxylic acid + + + + + PMID:17147560 + Europe PMC + + + + + PMID:18433345 + Europe PMC + + + + + carboxylic acid + IUPAC + + + + + + carboxylic acids + IUPAC + + + + + + Carbonsaeure + ChEBI + + + + + Carbonsaeuren + ChEBI + + + + + Karbonsaeure + ChEBI + + + + + RC(=O)OH + IUPAC + + + + + acide carboxylique + IUPAC + + + + + acides carboxyliques + IUPAC + + + + + acido carboxilico + IUPAC + + + + + acidos carboxilicos + IUPAC + + + + + + + + + + + + + + + A molecular entity containing one or more atoms from any of groups 1, 2, 13, 14, 15, 16, 17, and 18 of the periodic table. + chebi_ontology + main group compounds + main group molecular entities + CHEBI:33579 + + main group molecular entity + + + + + main group compounds + ChEBI + + + + + main group molecular entities + ChEBI + + + + + + + + + + + + + + + carbon group molecular entity + chebi_ontology + carbon group molecular entities + CHEBI:33582 + + carbon group molecular entity + + + + + carbon group molecular entity + ChEBI + + + + + carbon group molecular entities + ChEBI + + + + + + + + + + + + + + + A main group molecular entity containing one or more atoms of any noble gas. + noble gas molecular entity + chebi_ontology + noble gas compounds + noble gas molecular entities + CHEBI:33583 + + noble gas molecular entity + + + + + noble gas molecular entity + ChEBI + + + + + noble gas compounds + ChEBI + + + + + noble gas molecular entities + ChEBI + + + + + + + + + Any molecule that consists of a series of atoms joined together to form a ring. + Wikipedia:Cyclic_compound + chebi_ontology + cyclic compounds + CHEBI:33595 + + cyclic compound + + + + + cyclic compounds + ChEBI + + + + + + + + + + + + + + + chebi_ontology + hydrogen compounds + hydrogen molecular entities + CHEBI:33608 + + hydrogen molecular entity + + + + + hydrogen compounds + ChEBI + + + + + hydrogen molecular entities + ChEBI + + + + + + + + + polycyclic compound + + + + + + + + + A cyclically conjugated molecular entity with a stability (due to delocalization) significantly greater than that of a hypothetical localized structure (e.g. Kekule structure) is said to possess aromatic character. + aromatic compounds + aromatic molecular entity + chebi_ontology + aromatics + aromatische Verbindungen + CHEBI:33655 + + aromatic compound + + + + + aromatic compounds + IUPAC + + + + + + aromatic molecular entity + IUPAC + + + + + + aromatics + ChEBI + + + + + aromatische Verbindungen + ChEBI + + + + + + + + + + chebi_ontology + organic aromatic compounds + CHEBI:33659 + + organic aromatic compound + + + + + organic aromatic compounds + ChEBI + + + + + + + + + + + + + + + An s-block molecular entity is a molecular entity containing one or more atoms of an s-block element. + s-block molecular entity + chebi_ontology + s-block compounds + s-block molecular entities + CHEBI:33674 + + s-block molecular entity + + + + + s-block molecular entity + ChEBI + + + + + s-block compounds + ChEBI + + + + + s-block molecular entities + ChEBI + + + + + + + + + + + + + + + A main group molecular entity that contains one or more atoms of a p-block element. + chebi_ontology + p-block compounds + p-block molecular entities + p-block molecular entitiy + CHEBI:33675 + + p-block molecular entity + + + + + p-block compounds + ChEBI + + + + + p-block molecular entities + ChEBI + + + + + p-block molecular entitiy + ChEBI + + + + + + + + + d-block molecular entity + + + + + + + + + f-block molecular entity + + + + + + + + + + + + + + + + helium molecular entity + chebi_ontology + helium compounds + helium molecular entities + CHEBI:33679 + + helium molecular entity + + + + + helium molecular entity + ChEBI + + + + + helium compounds + ChEBI + + + + + helium molecular entities + ChEBI + + + + + + + + + chebi_ontology + CHEBI:33680 + + elemental helium + + + + + + + + + + Hydrides are chemical compounds of hydrogen with other chemical elements. + chebi_ontology + CHEBI:33692 + + hydrides + + + + + + + + + oxygen hydride + + + + + + + + + + A macromolecule formed by a living organism. + biopolymer + chebi_ontology + Biopolymere + biomacromolecules + biopolymers + CHEBI:33694 + + biomacromolecule + + + + + biopolymer + IUPAC + + + + + + Biopolymere + ChEBI + + + + + biomacromolecules + ChEBI + + + + + biopolymers + ChEBI + + + + + + + + + chebi_ontology + genetically encoded biomacromolecules + genetically encoded biopolymers + information biomacromolecules + information biopolymers + information macromolecule + information macromolecules + CHEBI:33695 + + information biomacromolecule + + + + + genetically encoded biomacromolecules + ChEBI + + + + + genetically encoded biopolymers + ChEBI + + + + + information biomacromolecules + ChEBI + + + + + information biopolymers + ChEBI + + + + + information macromolecule + ChEBI + + + + + information macromolecules + ChEBI + + + + + + + + + + + + + + + + + + + + + A macromolecule made up of nucleotide units and hydrolysable into certain pyrimidine or purine bases (usually adenine, cytosine, guanine, thymine, uracil), D-ribose or 2-deoxy-D-ribose and phosphoric acid. + nucleic acids + chebi_ontology + NA + Nukleinsaeure + Nukleinsaeuren + acide nucleique + acides nucleiques + acido nucleico + acidos nucleicos + CHEBI:33696 + + nucleic acid + + + + + nucleic acids + IUPAC + + + + + + NA + ChEBI + + + + + Nukleinsaeure + ChEBI + + + + + Nukleinsaeuren + ChEBI + + + + + acide nucleique + ChEBI + + + + + acides nucleiques + ChEBI + + + + + acido nucleico + ChEBI + + + + + acidos nucleicos + ChEBI + + + + + + + + + + + + + + + + + + + + + High molecular weight, linear polymers, composed of nucleotides containing ribose and linked by phosphodiester bonds; RNA is central to the synthesis of proteins. + CAS:63231-63-0 + ribonucleic acid + ribonucleic acids + chebi_ontology + RNA + RNS + Ribonukleinsaeure + pentosenucleic acids + ribonucleic acids + ribose nucleic acid + yeast nucleic acid + CHEBI:33697 + + ribonucleic acid + + + + + CAS:63231-63-0 + ChemIDplus + + + + + ribonucleic acid + IUPAC + + + + + ribonucleic acids + IUPAC + + + + - ammonium cation + RNA + IUPAC + + + + + RNA + UniProt + + + + + RNS + ChEBI + + + + + Ribonukleinsaeure + ChEBI + + + + + pentosenucleic acids ChemIDplus - + - ammonium ion - PDBeChem + ribonucleic acids + ChEBI + + + + + ribose nucleic acid + ChEBI + + + + + yeast nucleic acid + ChEBI - + - - - - - - - - - - The conjugate base formed when the carboxy group of a carboxylic acid is deprotonated. - -1 - CO2R - 44.00950 - 43.98983 - [O-]C([*])=O - CHEBI:13626 - CHEBI:13945 - CHEBI:23026 - CHEBI:58657 + + chebi_ontology - a carboxylate - carboxylic acid anions - carboxylic anions - CHEBI:29067 + canonical amino-acid residue + canonical amino-acid residues + common amino acid residues + proteinogenic amino-acid residues + standard amino acid residues + standard amino-acid residues + CHEBI:33700 - carboxylic acid anion + proteinogenic amino-acid residue - + - a carboxylate - UniProt + canonical amino-acid residue + ChEBI - + - carboxylic acid anions + canonical amino-acid residues ChEBI - + - carboxylic anions + common amino acid residues + ChEBI + + + + + proteinogenic amino-acid residues + ChEBI + + + + + standard amino acid residues + ChEBI + + + + + standard amino-acid residues ChEBI - - - - - - - - sodium(1+) - - - - - + - - - + + - + - - + + - -1 - H2N - InChI=1S/H2N/h1H2/q-1 - HYGWNUKOUCZBND-UHFFFAOYSA-N - 16.02262 - 16.01927 - [H][N-][H] - amide - azanide - dihydridonitrate(1-) + An amino acid in which the amino group is located on the carbon atom at the position alpha to the carboxy group. + 0 + C2H4NO2R + 74.05870 + 74.02420 + NC([*])C(O)=O + CHEBI:10208 + CHEBI:13779 + CHEBI:22442 + CHEBI:2642 + KEGG:C00045 + KEGG:C05167 + alpha-amino acid chebi_ontology - NH2(-) - CHEBI:29337 + Amino acid + Amino acids + alpha-amino acids + alpha-amino carboxylic acids + CHEBI:33704 - azanide + alpha-amino acid - + - amide + alpha-amino acid IUPAC - - - azanide - IUPAC - + + + Amino acid + KEGG_COMPOUND - - - dihydridonitrate(1-) - IUPAC - + + + Amino acids + KEGG_COMPOUND - + - NH2(-) + alpha-amino acids + ChEBI + + + + + alpha-amino acids + JCBN + + + + + alpha-amino carboxylic acids IUPAC - + - - - + + - - + + - A divalent inorganic anion resulting from the removal of two protons from ammonia. - -2 - HN - InChI=1S/HN/h1H/q-2 - DZQYTNGKSBCIOE-UHFFFAOYSA-N - 15.01468 - 15.01200 - [N--][H] - azanediide - hydridonitrate(2-) + When two or more amino acids combine to form a peptide, the elements of water are removed, and what remains of each amino acid is called an amino-acid residue. + amino acid residue + amino-acid residue + protein residue chebi_ontology - NH(2-) - imide - CHEBI:29340 + amino acid residue + amino-acid residues + CHEBI:33708 - hydridonitrate(2-) + amino-acid residue - - - azanediide - IUPAC - + + + When two or more amino acids combine to form a peptide, the elements of water are removed, and what remains of each amino acid is called an amino-acid residue. + Dummy:dummy - + - hydridonitrate(2-) + amino-acid residue IUPAC - + + + protein residue + PRO:DAN + + + - NH(2-) - IUPAC + amino acid residue + ChEBI - + - imide - IUPAC + amino-acid residues + JCBN - + - - - Particle of zero charge, zero rest mass, spin quantum number 1, energy hnu and momentum hnu/c (h is the Planck constant, nu the frequency of radiation and c the speed of light), carrier of electromagnetic force. - 0 - 0.0 - 0.0 - * - CHEBI:10581 - CHEBI:14383 - KEGG:C00205 - photon + + + + + + + + + + A carboxylic acid containing one or more amino groups. + CHEBI:13815 + CHEBI:22477 + Wikipedia:Amino_acid chebi_ontology - Lichtquant - Light - foton - gamma - hnu - light quantum - CHEBI:30212 + Aminocarbonsaeure + Aminokarbonsaeure + Aminosaeure + amino acids + CHEBI:33709 - photon + amino acid - - - photon - IUPAC - + + + Aminocarbonsaeure + ChEBI - + - Lichtquant + Aminokarbonsaeure ChEBI - + - Light - KEGG_COMPOUND + Aminosaeure + ChEBI - + - foton + amino acids ChEBI + + + + + + + + + + + + + + chebi_ontology + alpha-amino-acid residues + CHEBI:33710 + + alpha-amino-acid residue + - + - gamma - IUPAC + alpha-amino-acid residues + ChEBI + + + + + + + + + iron group molecular entity + + + + + + + + + copper group molecular entity + + + + + + + + + nickel group molecular entity + + + + + + + + + platinum molecular entity + + + + + + + + + chebi_ontology + canonical nucleoside residues + common nucleoside residues + nucleoside residue + standard nucleoside residues + CHEBI:33791 + + canonical nucleoside residue + + + + + canonical nucleoside residues + ChEBI - + - hnu - IUPAC + common nucleoside residues + CBN - + - hnu - UniProt + nucleoside residue + CBN - + - light quantum - ChEBI + standard nucleoside residues + ChEBI - + - - - - Nucleus of the (4)He atom. - +2 - [4He] - InChI=1S/He/q+2/i1+0 - LBDSXVIYZYSRII-IGMARMGPSA-N - 4.002 - 4.00151 - [4He++] - Gmelin:53474 - alpha-particle - helium-4(2+) - chebi_ontology - (4)He(2+) - alpha - CHEBI:30216 + + + chebi_ontology + N + Nuc + canonical ribonucleoside residues + common ribonucleoside residue + common ribonucleoside residues + standard ribonucleoside residues + CHEBI:33792 - alpha-particle + canonical ribonucleoside residue - - - Gmelin:53474 - Gmelin + + + N + CBN - - - alpha-particle - IUPAC + + + Nuc + CBN - - - alpha-particle - IUPAC - + + + canonical ribonucleoside residues + ChEBI - - - helium-4(2+) - IUPAC - + + + common ribonucleoside residue + CBN - + - (4)He(2+) - IUPAC + common ribonucleoside residues + CBN - + - alpha - IUPAC + standard ribonucleoside residues + ChEBI - + - - - + + + The stable isotope of oxygen with relative atomic mass 17.999160 and 0.205 atom percent natural abundance. 0 - He - InChI=1S/He - SWQJXJOGLNCZEY-UHFFFAOYSA-N - 4.00260 - 4.00260 - [He] - CAS:7440-59-7 - Drug_Central:4262 - Gmelin:16294 - WebElements:He - helium + [18O] + InChI=1S/O/i1+2 + QVGXLLKOCUKJST-NJFSPNSNSA-N + 17.999 + 17.99916 + [18O] + CAS:14797-71-8 + Gmelin:17562 + oxygen-18 chebi_ontology - 2He - He - Helium - helio - helium - CHEBI:30217 + (18)8O + (18)O + heavy oxygen + oxygen, isotope of mass 18 + oxygen-18 + schwerer Sauerstoff + CHEBI:33815 - helium atom + oxygen-18 atom - - - CAS:7440-59-7 - NIST Chemistry WebBook - - - + - Drug_Central:4262 - DrugCentral + CAS:14797-71-8 + ChemIDplus - + - Gmelin:16294 + Gmelin:17562 Gmelin - + - helium + oxygen-18 IUPAC - + - 2He + (18)8O IUPAC - + - He + (18)O IUPAC - + - Helium + heavy oxygen ChEBI - + - helio + oxygen, isotope of mass 18 + ChemIDplus + + + + + oxygen-18 ChEBI - + - helium + schwerer Sauerstoff ChEBI - + - - - Nuclear particle of zero charge, spin 1/2 and rest mass of 1.008664904(14) u. + + + The stable isotope of oxygen with relative atomic mass 15.994914. The most abundant (99.76 atom percent) isotope of naturally occurring oxygen. 0 - 1.008664904 - neutron + [16O] + InChI=1S/O/i1+0 + QVGXLLKOCUKJST-IGMARMGPSA-N + 15.995 + 15.99491 + [16O] + Gmelin:17560 + oxygen-16 chebi_ontology - (1)0n - n - CHEBI:30222 + (16)8O + (16)O + oxygen-16 + CHEBI:33818 - neutron + oxygen-16 atom - - - neutron - ChEBI + + + Gmelin:17560 + Gmelin - + - neutron + oxygen-16 IUPAC - - - (1)0n - ChEBI - - - + - n + (16)8O IUPAC - - - - - - - - +2 - 0.00000 - [*++] - CHEBI:23856 - CHEBI:4665 - KEGG:C00572 - chebi_ontology - Divalent cation - divalent inorganic cations - monoatomic dications - CHEBI:30412 - - monoatomic dication - - - - - Divalent cation - KEGG_COMPOUND - - + - divalent inorganic cations - ChEBI + (16)O + IUPAC - + - monoatomic dications + oxygen-16 ChEBI - + - - - An amide is a derivative of an oxoacid RkE(=O)l(OH)m (l =/= 0) in which an acidic hydroxy group has been replaced by an amino or substituted amino group. - CHEBI:22473 - CHEBI:2633 - KEGG:C00241 - Amide - amides + + + The stable isotope of oxygen with relative atomic mass 16.999131. The least abundant (0.038 atom percent) isotope of naturally occurring oxygen. + 0 + [17O] + InChI=1S/O/i1+1 + QVGXLLKOCUKJST-OUBTZVSYSA-N + 16.999 + 16.99913 + [17O] + CAS:13968-48-4 + Gmelin:17561 + oxygen-17 chebi_ontology - CHEBI:32988 + (17)8O + (17)O + oxygen, isotope of mass 17 + oxygen-17 + CHEBI:33819 - amide + oxygen-17 atom - - - Amide - KEGG_COMPOUND + + + CAS:13968-48-4 + ChemIDplus - + + + Gmelin:17561 + Gmelin + + + - amides + oxygen-17 IUPAC - - - - - - - - - Intended use of the molecular entity or part thereof by humans. - chebi_ontology - CHEBI:33232 - - application - - - - - - - - - A particle not known to have substructure. - elementary particle - chebi_ontology - elementary particles - CHEBI:33233 - - fundamental particle - - - - elementary particle + + + (17)8O IUPAC - - + - elementary particles - ChEBI + (17)O + IUPAC - - - - - - - - A monoatomic entity is a molecular entity consisting of a single atom. - chebi_ontology - atomic entity - monoatomic entities - CHEBI:33238 - - monoatomic entity - - + - atomic entity - ChEBI + oxygen, isotope of mass 17 + ChemIDplus - + - monoatomic entities + oxygen-17 ChEBI - - - - - oxoacid derivative - - - - - + - - - - chebi_ontology - inorganic hydrides - CHEBI:33242 + + + + Any organic molecule that consists of atoms connected in the form of a ring. + chebi_ontology + organic cyclic compounds + CHEBI:33832 - inorganic hydride + organic cyclic compound - + - inorganic hydrides - ChEBI + organic cyclic compounds + ChEBI - + - - - Any substituent group which does not contain carbon. - chebi_ontology - inorganic groups - CHEBI:33246 + + + + A heterocyclic compound formally derived from an arene by replacement of one or more methine (-C=) and/or vinylene (-CH=CH-) groups by trivalent or divalent heteroatoms, respectively, in such a way as to maintain the continuous pi-electron system characteristic of aromatic systems and a number of out-of-plane pi-electrons corresponding to the Hueckel rule (4n+2). + heteroarenes + chebi_ontology + hetarenes + CHEBI:33833 - inorganic group + heteroarene - + + + heteroarenes + IUPAC + + + + - inorganic groups - ChEBI + hetarenes + IUPAC - + - - - - - - - - - - Any substituent group or skeleton containing carbon. - chebi_ontology - organic groups - CHEBI:33247 - - organic group + + + + conjugated protein - - - - organic groups - ChEBI - - + - - - Any organic substituent group, regardless of functional type, having one free valence at a carbon atom. - organyl group - organyl groups + + + A macromolecule is a molecule of high relative molecular mass, the structure of which essentially comprises the multiple repetition of units derived, actually or conceptually, from molecules of low relative molecular mass. + Wikipedia:Macromolecule + macromolecule chebi_ontology - groupe organyle - grupo organilo - grupos organilo - CHEBI:33249 + macromolecules + polymer + polymer molecule + polymers + CHEBI:33839 - organyl group + macromolecule - + - organyl group + macromolecule IUPAC - - - organyl groups - IUPAC - + + + macromolecules + ChEBI - + - groupe organyle - IUPAC + polymer + ChEBI - + - grupo organilo + polymer molecule IUPAC - + - grupos organilo - IUPAC + polymers + ChEBI - + - - - - - - - - - - atom - A chemical entity constituting the smallest component of an element having the chemical properties of the element. - - CHEBI:22671 - CHEBI:23907 - MeSH:D004602 - NCIt:C1940 - NCIt:C48792 - SNOMEDCT:290004009 - atom - atome - atomo - atoms - atomus - elements + + + A substance used in a chemical reaction to detect, measure, examine, or produce other substances. + reagent chebi_ontology - atome - atomo - atoms - atomus - element - elements - CHEBI:33250 + reactif + reactivo + reagents + CHEBI:33893 - atom - element - uncharged atom + reagent - + - atom + reagent IUPAC - + - atome + reactif IUPAC - + - atomo + reactivo IUPAC - - - atoms - ChEBI - - - - - atomus - ChEBI - - - - - element - ChEBI - - - + - elements + reagents ChEBI - + - - - - 0 - H - InChI=1S/H - YZCKVEUIGOORGS-UHFFFAOYSA-N - 1.00794 - 1.00783 - [H] + + + Any nutrient required in large quantities by organisms throughout their life in order to orchestrate a range of physiological functions. Macronutrients are usually chemical elements (carbon, hydrogen, nitrogen, oxygen, phosphorus and sulfur) that humans consume in the largest quantities. Calcium, sodium, magnesium and potassium are sometimes included as macronutrients because they are required in relatively large quantities compared with other vitamins and minerals. chebi_ontology - atomic hydrogen - CHEBI:33251 + macronutrients + CHEBI:33937 + - monoatomic hydrogen + macronutrient - + - atomic hydrogen + macronutrients ChEBI - + - - - - - - - - - - - - - - - A nucleus is the positively charged central portion of an atom, excluding the orbital electrons. - nucleus + + + + halide salt + + + + + + + + + gold molecular entity + + + + + + + + + chebi_ontology - Atomkern - Kern - noyau - noyau atomique - nuclei - nucleo - nucleo atomico - nucleus atomi - CHEBI:33252 + nitrogen hydrides + CHEBI:35106 - Some people may be uncomfortable calling every proton an atomic nucleus - This is equivalent to CHEBI:33252 - atomic nucleus - atomic nucleus + nitrogen hydride - - - nucleus - IUPAC - - - - - - Atomkern - ChEBI - - - - - Kern - ChEBI - - - - - noyau - IUPAC - - - - - noyau atomique - ChEBI - - - - - nuclei - ChEBI - - - - - nucleo - IUPAC - - - + - nucleo atomico + nitrogen hydrides ChEBI + + + + + + + + Saturated acyclic nitrogen hydrides having the general formula NnHn+2. + chebi_ontology + azanes + CHEBI:35107 + + azane + - + - nucleus atomi + azanes ChEBI - + - - - - Heavy nuclear particle: proton or neutron. - nucleon + + + A substance that diminishes the rate of a chemical reaction. + inhibitor chebi_ontology - Nukleon - Nukleonen - nucleons - CHEBI:33253 + inhibidor + inhibiteur + inhibitors + CHEBI:35222 - nucleon + inhibitor - - - nucleon - IUPAC - - - + - nucleon + inhibitor IUPAC - + - Nukleon + inhibidor ChEBI - + - Nukleonen + inhibiteur ChEBI - + - nucleons + inhibitors ChEBI - + - - - A derivative of an oxoacid RkE(=O)l(OH)m (l =/= 0) in which an acidic hydroxy group has been replaced by an amino or substituted amino group. - primary amide - primary amides + + + fossil fuel + + + + + + + + + The zwitterionic form of an amino acid having a negatively charged carboxyl group and a positively charged amino group. + amino acid zwitterion chebi_ontology - CHEBI:33256 + CHEBI:35238 - primary amide + amino acid zwitterion - + - primary amide - IUPAC + amino acid zwitterion + ChEBI + + + + + + + + + steroid + + + + + + + + + + Any heteroorganic entity containing at least one carbon-nitrogen bond. + organonitrogen compounds + chebi_ontology + organonitrogens + CHEBI:35352 + + organonitrogen compound + - + - primary amides + organonitrogen compounds IUPAC + + + + organonitrogens + ChEBI + - + - - - A molecular entity all atoms of which have the same atomic number. + + + + An oxoanion is an anion derived from an oxoacid by loss of hydron(s) bound to oxygen. + CHEBI:33274 + CHEBI:33436 + oxoanion chebi_ontology - homoatomic entity - homoatomic molecular entities - homoatomic molecular entity - CHEBI:33259 + oxoacid anions + oxoanions + CHEBI:35406 - elemental molecular entity + oxoanion - - - homoatomic entity + + + oxoanion ChEBI - + - homoatomic molecular entities + oxoacid anions ChEBI - + - homoatomic molecular entity + oxoanions ChEBI - + - - - - + + + + alkali metal salt + + + + + + + + + chebi_ontology - CHEBI:33260 + carbon oxoacids + oxoacids of carbon + CHEBI:35605 - elemental hydrogen + carbon oxoacid + + + + carbon oxoacids + ChEBI + + + + + oxoacids of carbon + ChEBI + - + - - - - - elemental oxygen + + + + dicarboxylic acid - + - - - diatomic oxygen + + + ester - + - - - diatomic nitrogen + + + + sulfated glycosaminoglycan - + - - - - elemental nitrogen + + + + + carbohydrate sulfate - + - - - - An anion consisting of more than one atom. + + + + pnictogen hydride chebi_ontology - polyatomic anions - CHEBI:33273 + pnictogen hydrides + CHEBI:35881 - polyatomic anion + pnictogen hydride - + + + pnictogen hydride + ChEBI + + + - polyatomic anions + pnictogen hydrides ChEBI - + - - - A nutrient is a food component that an organism uses to survive and grow. - chebi_ontology - nutrients - CHEBI:33284 - - nutrient + + + cholanoid - - - - nutrients - ChEBI - - + - - - A heteroorganic entity is an organic molecular entity in which carbon atoms or organic groups are bonded directly to one or more heteroatoms. + + + + A biological macromolecule minimally consisting of one polypeptide chain synthesized at the ribosome. + CHEBI:13677 + CHEBI:14911 + proteins chebi_ontology - heteroorganic entities - organoelement compounds - CHEBI:33285 + CHEBI:36080 - heteroorganic entity + protein - - - heteroorganic entities - ChEBI - - - - - organoelement compounds - ChEBI + + + proteins + IUPAC + - + - - - fuel + + + + inorganic chloride - + - - - - - - - - - alkali metal molecular entity + + + + bile acid salt - + - - - Any p-block element atom that is in group 15 of the periodic table: nitrogen, phosphorus, arsenic, antimony and bismuth. - pnictogens - chebi_ontology - group 15 elements - group V elements - nitrogenoideos - nitrogenoides - pnictogene - pnictogenes - CHEBI:33300 + + + + Lepton is a fermion that does not experience the strong force (strong interaction). The term is derived from the Greek lambdaepsilonpitauomicronsigma (small, thin). + chebi_ontology + leptons + CHEBI:36338 - pnictogen + lepton - - - pnictogens - IUPAC - + + + leptons + ChEBI + + + + + + + + + Baryon is a fermion that does experience the strong force (strong interaction). The term is derived from the Greek betaalpharhoupsilonsigma (heavy). + chebi_ontology + baryons + CHEBI:36339 + + baryon + - + - group 15 elements - ChEBI + baryons + ChEBI + + + + + + + + Particle of half-integer spin quantum number following Fermi-Dirac statistics. Fermions are named after Enrico Fermi. + fermion + chebi_ontology + fermions + CHEBI:36340 + + fermion + - - - group V elements - ChEBI + + + fermion + IUPAC + - + - nitrogenoideos - ChEBI + fermions + ChEBI + + + + + + + + Particle of integer spin quantum number following Bose-Einstein statistics. Bosons are named after Satyendra Nath Bose. + boson + chebi_ontology + bosons + CHEBI:36341 + + boson + - - - nitrogenoides - ChEBI + + + boson + IUPAC + - + - pnictogene - ChEBI + bosons + ChEBI + + + + + + + + A particle smaller than an atom. + Wikipedia:Subatomic_particle + chebi_ontology + subatomic particles + CHEBI:36342 + + subatomic particle + subatomic particle + - + - pnictogenes - ChEBI + subatomic particles + ChEBI - + - - - - - - - - - A p-block molecular entity containing any pnictogen. - pnictogen molecular entity - chebi_ontology - pnictogen molecular entities - CHEBI:33302 + + + A subatomic particle known to have substructure (i.e. consisting of smaller particles). + chebi_ontology + composite particles + CHEBI:36343 - pnictogen molecular entity + composite particle - - - pnictogen molecular entity - ChEBI + + + composite particles + ChEBI + + + + + + + + Hadron is a subatomic particle which experiences the strong force. + chebi_ontology + hadrons + CHEBI:36344 + + hadron + - + - pnictogen molecular entities - ChEBI + hadrons + ChEBI - + - - - Any p-block element belonging to the group 16 family of the periodic table. - PMID:17084588 - chalcogen - chalcogens + + + A nucleus or any of its constituents in any of their energy states. + nuclear particle chebi_ontology - Chalkogen - Chalkogene - anfigeno - anfigenos - calcogeno - calcogenos - chalcogene - chalcogenes - group 16 elements - group VI elements - CHEBI:33303 + CHEBI:36347 - chalcogen + nuclear particle - - - PMID:17084588 - Europe PMC - - - - - PMID:17084588 - Europe PMC - - - + - chalcogen + nuclear particle IUPAC + + + + + + + The collective name for zero-spin mesons pi(+), pi(-) and pi(0). + pi meson + pion + chebi_ontology + pi-meson + CHEBI:36348 + + pi meson + + + + + pi meson + ChEBI + - + - chalcogens + pion IUPAC - - - Chalkogen - ChEBI - - - + - Chalkogene + pi-meson ChEBI + + + + + + + Elementary particle not affected by the strong force having a spin 1/2, a negative elementary charge and a rest mass of 0.113428913(17) u, or 105.658389(34) MeV. + -1 + 0.113428913 + muon + chebi_ontology + Mueon + My-Teilchen + Myon + mu(-) + negative muon + CHEBI:36356 + + muon + - - - anfigeno - ChEBI + + + muon + IUPAC + - + - anfigenos + Mueon ChEBI - + - calcogeno + My-Teilchen ChEBI - + - calcogenos + Myon ChEBI - + - chalcogene - ChEBI + mu(-) + IUPAC - + - chalcogenes + negative muon ChEBI + + + + + + + + + + + + + + Any molecular entity consisting of more than one atom. + chebi_ontology + polyatomic entities + CHEBI:36357 + + polyatomic entity + - + - group 16 elements + polyatomic entities ChEBI + + + + + + + + + An ion consisting of more than one atom. + chebi_ontology + polyatomic ions + CHEBI:36358 + + polyatomic ion + - + - group VI elements + polyatomic ions ChEBI - + - - + + + - + - Any p-block molecular entity containing a chalcogen. - chalcogen molecular entity + Any compound containing the carbonyl group, C=O. The term is commonly used in the restricted sense of aldehydes and ketones, although it actually includes carboxylic acids and derivatives. + carbonyl compounds chebi_ontology - chalcogen compounds - chalcogen molecular entities - CHEBI:33304 + CHEBI:36586 - chalcogen molecular entity + carbonyl compound - + - chalcogen molecular entity - ChEBI - - - - - chalcogen compounds - ChEBI - - - - - chalcogen molecular entities - ChEBI + carbonyl compounds + IUPAC + - + - - - group 14 elements + + + + + + + + + Organic compounds containing an oxygen atom, =O, doubly bonded to carbon or another element. + oxo compounds chebi_ontology - carbon group element - carbon group elements - carbonoides - cristallogene - cristallogenes - group IV elements - CHEBI:33306 + organic oxo compounds + CHEBI:36587 - carbon group element atom + organic oxo compound - + - group 14 elements + oxo compounds IUPAC - - - carbon group element - ChEBI - - - - - carbon group elements - ChEBI - - - - - carbonoides - ChEBI - - - + - cristallogene + organic oxo compounds ChEBI + + + + + + + + biladienes + + + + + + + + + + chalcogen hydride + + + + + + + + + argon molecular entity + + + + + + + + + + chebi_ontology + inorganic ions + CHEBI:36914 + + inorganic ion + - + - cristallogenes - ChEBI + inorganic ions + ChEBI + + + + + + + + + chebi_ontology + inorganic cations + CHEBI:36915 + + inorganic cation + - + - group IV elements - ChEBI + inorganic cations + ChEBI - + - - - - - noble gas - noble gases - chebi_ontology - Edelgas - Edelgase - gas noble - gases nobles - gaz noble - gaz nobles - group 18 elements - group VIII elements - inert gases - noble gas - rare gases - CHEBI:33309 + + + A monoatomic or polyatomic species having one or more elementary charges of the proton. + CHEBI:23058 + CHEBI:3473 + KEGG:C01373 + Cation + cation + chebi_ontology + Kation + Kationen + cationes + cations + CHEBI:36916 - noble gas atom + cation - + - noble gas - IUPAC - + Cation + KEGG_COMPOUND - + - noble gases - IUPAC - + cation + ChEBI - - - Edelgas - ChEBI + + + cation + IUPAC + - + - Edelgase - ChEBI + Kation + ChEBI - + - gas noble - ChEBI + Kationen + ChEBI - + - gases nobles - ChEBI + cationes + ChEBI - + - gaz noble - ChEBI + cations + ChEBI + + + + + + + + 0 + [14C] + InChI=1S/C/i1+2 + OKTJSMMVPCPJKN-NJFSPNSNSA-N + 14.003 + 14.00324 + [14C] + CAS:14762-75-5 + Wikipedia:Carbon-14 + carbon-14 + chebi_ontology + (14)6C + (14)C + carbon, isotope of mass 14 + carbon-14 + CHEBI:36927 + + carbon-14 atom + - - - gaz nobles - ChEBI + + + CAS:14762-75-5 + ChemIDplus - - - group 18 elements + + + carbon-14 IUPAC + - + - group VIII elements - ChEBI + (14)6C + IUPAC - + - inert gases - ChEBI + (14)C + IUPAC - + - noble gas - ChEBI + carbon, isotope of mass 14 + ChemIDplus - + - rare gases + carbon-14 ChEBI - + - - - + + 0 - He - 4.003 - 4.00260 + [13C] + InChI=1S/C/i1+1 + OKTJSMMVPCPJKN-OUBTZVSYSA-N + 13.003 + 13.00335 + [13C] + CAS:14762-74-4 + carbon-13 + carbon-13 atom chebi_ontology - elemental helium - CHEBI:33315 + (13)6C + (13)C + carbon, isotope of mass 13 + carbon-13 + CHEBI:36928 - monoatomic helium + carbon-13 atom - - - elemental helium - ChEBI + + + CAS:14762-74-4 + ChemIDplus - - - - - - - - - +2 - He - InChI=1S/He/q+2 - LBDSXVIYZYSRII-UHFFFAOYSA-N - 4.00260 - 4.00151 - [He++] - helium(2+) - chebi_ontology - He(2+) - CHEBI:33316 - - helium(2+) - - + - helium(2+) + carbon-13 IUPAC - + + + carbon-13 atom + ChemIDplus + + + - He(2+) + (13)6C + IUPAC + + + + + (13)C IUPAC + + + + carbon, isotope of mass 13 + ChemIDplus + + + + + carbon-13 + ChEBI + - + - - - An atom belonging to one of the main groups (found in the s- and p- blocks) of the periodic table. - main group elements + + + 0 + [11C] + InChI=1S/C/i1-1 + OKTJSMMVPCPJKN-BJUDXGSMSA-N + 11.011 + 11.01143 + [11C] + CAS:14333-33-6 + carbon-11 chebi_ontology - Hauptgruppenelement - Hauptgruppenelemente - main group element - CHEBI:33318 + (11)6C + (11)C + carbon, isotope of mass 11 + carbon-11 + CHEBI:36929 - main group element atom + carbon-11 atom - + + + CAS:14333-33-6 + ChemIDplus + + + - main group elements + carbon-11 IUPAC - + - Hauptgruppenelement - ChEBI + (11)6C + IUPAC - + - Hauptgruppenelemente - ChEBI + (11)C + IUPAC - + - main group element - ChEBI + carbon, isotope of mass 11 + ChemIDplus + + + + + carbon-11 + ChEBI - - - - - iron group element atom - - - - - - - - - - sulfur oxoacid derivative - - - - - - - - - - - elemental pnictogen - - - - - - - - - transition element molecular entity - - - - - - - - - actinoid molecular entity - - - - - - - - - uranium molecular entity - - - - - - - - - alkali metal cation - - - - - + - - - metal atom + + + 0 + [10C] + InChI=1S/C/i1-2 + OKTJSMMVPCPJKN-YPZZEJLDSA-N + 10.017 + 10.01685 + [10C] + CAS:15578-68-4 + carbon-10 + chebi_ontology + (10)6C + (10)C + carbon, isotope of mass 10 + carbon-10 + CHEBI:36930 + + carbon-10 atom + + + + CAS:15578-68-4 + ChemIDplus + + + + + carbon-10 + IUPAC + + + + + + (10)6C + IUPAC + + + + + (10)C + IUPAC + + + + + carbon, isotope of mass 10 + ChemIDplus + + + + + carbon-10 + ChEBI + - + - - - - - - - - - An amino-acid anion obtained by deprotonation of any alpha-amino acid. - alpha-amino-acid anion + + + 0 + [12C] + InChI=1S/C/i1+0 + OKTJSMMVPCPJKN-IGMARMGPSA-N + 12.000 + 12.00000 + [12C] + carbon-12 chebi_ontology - alpha-amino acid anions - alpha-amino-acid anions - CHEBI:33558 + (12)6C + (12)C + carbon-12 + CHEBI:36931 - alpha-amino-acid anion + carbon-12 atom - + - alpha-amino-acid anion - ChEBI + carbon-12 + IUPAC + - + - alpha-amino acid anions - ChEBI + (12)6C + IUPAC - + - alpha-amino-acid anions + (12)C + IUPAC + + + + + carbon-12 ChEBI - + - - + + + The radioactive isotope of oxygen with relative atomic mass 15.003065. The longest-lived oxygen radionuclide with half-life of 122.2 s. + 0 + [15O] + InChI=1S/O/i1-1 + QVGXLLKOCUKJST-BJUDXGSMSA-N + 15.003 + 15.00307 + [15O] + CAS:13982-43-9 + Gmelin:316575 + oxygen-15 chebi_ontology - s-block element - s-block elements - CHEBI:33559 + (15)8O + (15)O + oxygen, isotope of mass 15 + oxygen-15 + CHEBI:36932 - s-block element atom + oxygen-15 atom - + + + CAS:13982-43-9 + ChemIDplus + + + + + Gmelin:316575 + Gmelin + + + + + oxygen-15 + IUPAC + + + + - s-block element - ChEBI + (15)8O + IUPAC - + - s-block elements + (15)O + IUPAC + + + + + oxygen, isotope of mass 15 + ChemIDplus + + + + + oxygen-15 ChEBI - + - - - Any main group element atom belonging to the p-block of the periodic table. + + + 0 + [19O] + InChI=1S/O/i1+3 + QVGXLLKOCUKJST-AKLPVKDBSA-N + 19.004 + 19.00358 + [19O] + CAS:13982-18-8 + oxygen-19 chebi_ontology - p-block element - p-block elements - CHEBI:33560 + (19)8O + (19)O + oxygen-19 + CHEBI:36933 - p-block element atom + oxygen-19 atom - + + + CAS:13982-18-8 + ChemIDplus + + + + + oxygen-19 + IUPAC + + + + - p-block element - ChEBI + (19)8O + IUPAC - + - p-block elements + (19)O + IUPAC + + + + + oxygen-19 ChEBI - + - - - d-block element atom + + + The stable isotope of nitrogen with relative atomic mass 15.000109. The least abundant (0.368 atom percent) isotope of naturally occurring nitrogen. + 0 + N + 14.007 + 14.00307 + CAS:14390-96-6 + nitrogen-15 + chebi_ontology + (15)7N + (15)N + nitrogen, isotope of mass 15 + nitrogen-15 + CHEBI:36934 + + nitrogen-15 atom + + + + CAS:14390-96-6 + ChemIDplus + + + + + nitrogen-15 + IUPAC + + + + + + (15)7N + IUPAC + + + + + (15)N + IUPAC + + + + + nitrogen, isotope of mass 15 + ChemIDplus + + + + + nitrogen-15 + ChEBI + - + - - - - - - - - - - - - - - - - - A carbon oxoacid acid carrying at least one -C(=O)OH group and having the structure RC(=O)OH, where R is any any monovalent functional group. Carboxylic acids are the most common type of organic acid. + + + The radioactive isotope of nitrogen with relative atomic mass 13.0057386. The longest-lived nitrogen radionuclide with half-life of 9.965 min. 0 - CHO2R - 45.01740 - 44.99765 - OC([*])=O - CHEBI:13428 - CHEBI:13627 - CHEBI:23027 - PMID:17147560 - PMID:18433345 - Wikipedia:Carboxylic_acid - carboxylic acid - carboxylic acids + N + 14.007 + 14.00307 + CAS:13981-22-1 + nitrogen-13 chebi_ontology - Carbonsaeure - Carbonsaeuren - Karbonsaeure - RC(=O)OH - acide carboxylique - acides carboxyliques - acido carboxilico - acidos carboxilicos - CHEBI:33575 + (13)7N + (13)N + nitrogen, isotope of mass 13 + nitrogen-13 + CHEBI:36935 - carboxylic acid + nitrogen-13 atom - - - PMID:17147560 - Europe PMC - - - + - PMID:18433345 - Europe PMC + CAS:13981-22-1 + ChemIDplus - + - carboxylic acid + nitrogen-13 IUPAC - - - carboxylic acids + + + (13)7N IUPAC - - + - Carbonsaeure - ChEBI + (13)N + IUPAC - + - Carbonsaeuren - ChEBI + nitrogen, isotope of mass 13 + ChemIDplus - + - Karbonsaeure + nitrogen-13 ChEBI + + + + + + + + 0 + N + 14.007 + 14.00307 + CAS:13981-62-9 + nitrogen-16 + chebi_ontology + (16)7N + (16)N + nitrogen, isotope of mass 16 + nitrogen-16 + CHEBI:36936 + + nitrogen-16 atom + + + + + CAS:13981-62-9 + ChemIDplus + - - - RC(=O)OH + + + nitrogen-16 IUPAC + - + - acide carboxylique + (16)7N IUPAC - + - acides carboxyliques + (16)N IUPAC - + - acido carboxilico - IUPAC + nitrogen, isotope of mass 16 + ChemIDplus - + - acidos carboxilicos - IUPAC + nitrogen-16 + ChEBI - + - - - - - - - - - A molecular entity containing one or more atoms from any of groups 1, 2, 13, 14, 15, 16, 17, and 18 of the periodic table. + + + 0 + N + 14.007 + 14.00307 + CAS:14914-35-3 + nitrogen-17 chebi_ontology - main group compounds - main group molecular entities - CHEBI:33579 + (17)7N + (17)N + nitrogen-17 + CHEBI:36937 - main group molecular entity + nitrogen-17 atom - + + + CAS:14914-35-3 + ChemIDplus + + + + + nitrogen-17 + IUPAC + + + + - main group compounds + (17)7N + IUPAC + + + + + (17)N ChEBI - + - main group molecular entities + nitrogen-17 ChEBI - + - - - - - - - - - carbon group molecular entity + + + The stable isotope of nitrogen with relative atomic mass 14.003074. The most abundant (99.63 atom percent) isotope of naturally occurring nitrogen. + 0 + N + 14.007 + 14.00307 + nitrogen-14 chebi_ontology - carbon group molecular entities - CHEBI:33582 + (14)7N + (14)N + nitrogen-14 + CHEBI:36938 - carbon group molecular entity + nitrogen-14 atom - + - carbon group molecular entity - ChEBI + nitrogen-14 + IUPAC + - + - carbon group molecular entities + (14)7N + IUPAC + + + + + (14)N + IUPAC + + + + + nitrogen-14 ChEBI - + - - - - - - - - - A main group molecular entity containing one or more atoms of any noble gas. - noble gas molecular entity + + + The radioactive isotope of fluorine with relative atomic mass 18.000938. The longest-lived fluorine radionuclide with half-life of 109.77 min. + 0 + [18F] + InChI=1S/F/i1-1 + YCKRFDGAMUMZLT-BJUDXGSMSA-N + 18.001 + 18.00094 + [18F] + CAS:13981-56-1 + DrugBank:DB13134 + Wikipedia:Fluorine-18 + fluorine-18 chebi_ontology - noble gas compounds - noble gas molecular entities - CHEBI:33583 + (18)9F + (18)F + fluorine, isotope of mass 18 + fluorine-18 + CHEBI:36939 - noble gas molecular entity + fluorine-18 atom - + + + CAS:13981-56-1 + ChemIDplus + + + - noble gas molecular entity - ChEBI + fluorine-18 + IUPAC + - + - noble gas compounds - ChEBI + (18)9F + IUPAC - + - noble gas molecular entities + (18)F + IUPAC + + + + + fluorine, isotope of mass 18 + ChemIDplus + + + + + fluorine-18 ChEBI - + - - - Any molecule that consists of a series of atoms joined together to form a ring. - Wikipedia:Cyclic_compound - chebi_ontology - cyclic compounds - CHEBI:33595 + + + The stable isotope of fluorine with relative atomic mass 18.998403 and nuclear spin (1)/2. + 0 + [19F] + InChI=1S/F/i1+0 + YCKRFDGAMUMZLT-IGMARMGPSA-N + 18.998 + 18.99840 + [19F] + fluorine-19 + chebi_ontology + (19)9F + (19)F + fluorine-19 + CHEBI:36940 - cyclic compound + fluorine-19 atom - + + + fluorine-19 + IUPAC + + + + - cyclic compounds + (19)9F + IUPAC + + + + + (19)F + ChEBI + + + + + fluorine-19 ChEBI - + - - - - - - - - + + + + An organochalcogen compound is a compound containing at least one carbon-chalcogen bond. + organochalcogen compound chebi_ontology - hydrogen compounds - hydrogen molecular entities - CHEBI:33608 + organochalcogen compounds + CHEBI:36962 - hydrogen molecular entity + organochalcogen compound - - - hydrogen compounds + + + organochalcogen compound ChEBI - + - hydrogen molecular entities + organochalcogen compounds ChEBI - + - - - polycyclic compound + + + + An organochalcogen compound containing at least one carbon-oxygen bond. + PMID:17586126 + organooxygen compound + chebi_ontology + organooxygen compounds + CHEBI:36963 + + organooxygen compound + + + + PMID:17586126 + Europe PMC + + + + + organooxygen compound + ChEBI + + + + + organooxygen compounds + ChEBI + - + - - - A cyclically conjugated molecular entity with a stability (due to delocalization) significantly greater than that of a hypothetical localized structure (e.g. Kekule structure) is said to possess aromatic character. - aromatic compounds - aromatic molecular entity - chebi_ontology - aromatics - aromatische Verbindungen - CHEBI:33655 + + + The radioactive isotope of helium with relative atomic mass 6.01889 and half-life of 806.7 ms. + 0 + [6He] + InChI=1S/He/i1+2 + SWQJXJOGLNCZEY-NJFSPNSNSA-N + 6.019 + 6.01889 + [6He] + helium-6 + chebi_ontology + (6)2He + (6)He + helium-6 + CHEBI:37003 - aromatic compound + helium-6 atom - + - aromatic compounds + helium-6 IUPAC - - - aromatic molecular entity + + + (6)2He IUPAC - - + - aromatics - ChEBI + (6)He + IUPAC - + - aromatische Verbindungen + helium-6 ChEBI - + - - - - chebi_ontology - organic aromatic compounds - CHEBI:33659 + + + The radioactive isotope of helium with relative atomic mass 8.03392 and half-life of 119.0 ms. + 0 + [8He] + InChI=1S/He/i1+4 + SWQJXJOGLNCZEY-RNFDNDRNSA-N + 8.034 + 8.03392 + [8He] + helium-8 + chebi_ontology + (8)2He + (8)He + helium-8 + CHEBI:37004 - organic aromatic compound + helium-8 atom - + + + helium-8 + IUPAC + + + + - organic aromatic compounds + (8)2He + IUPAC + + + + + (8)He + IUPAC + + + + + helium-8 ChEBI - + - - + + + - - + + - An s-block molecular entity is a molecular entity containing one or more atoms of an s-block element. - s-block molecular entity + amino-acid anion chebi_ontology - s-block compounds - s-block molecular entities - CHEBI:33674 + amino acid anions + amino-acid anions + CHEBI:37022 - s-block molecular entity + amino-acid anion - + - s-block molecular entity + amino-acid anion ChEBI - + - s-block compounds + amino acid anions ChEBI - + - s-block molecular entities + amino-acid anions ChEBI - + - - - - - - - - - A main group molecular entity that contains one or more atoms of a p-block element. + + + mononuclear parent hydrides chebi_ontology - p-block compounds - p-block molecular entities - p-block molecular entitiy - CHEBI:33675 + mononuclear hydride + mononuclear hydrides + CHEBI:37176 - p-block molecular entity + mononuclear parent hydride - - - p-block compounds - ChEBI + + + mononuclear parent hydrides + IUPAC + - + - p-block molecular entities + mononuclear hydride ChEBI - + - p-block molecular entitiy - ChEBI + mononuclear hydrides + IUPAC - - - - - d-block molecular entity - - - - - + - - - f-block molecular entity + + + elemental sodium - + - - - - - - - - - - helium molecular entity + + + The radioactive isotope of polonium with relative atomic mass 209.98286 and half-life of 138.376 days; the only naturally occurring isotope of polonium. + 0 + [210Po] + InChI=1S/Po/i1+1 + HZEBHPIOVYHPMT-OUBTZVSYSA-N + 209.983 + 209.98286 + [210Po] + CAS:13981-52-7 + Gmelin:76756 + polonium-210 chebi_ontology - helium compounds - helium molecular entities - CHEBI:33679 + (210)84Po + (210)Po + polonium, isotope of mass 210 + polonium-210 + CHEBI:37340 - helium molecular entity + polonium-210 atom - + + + CAS:13981-52-7 + ChemIDplus + + + + + Gmelin:76756 + Gmelin + + + - helium molecular entity - ChEBI + polonium-210 + IUPAC + - + - helium compounds - ChEBI + (210)84Po + IUPAC - + - helium molecular entities + (210)Po + IUPAC + + + + + polonium, isotope of mass 210 + ChemIDplus + + + + + polonium-210 ChEBI - + - - + + + The radioactive isotope of polonium with relative atomic mass 210.986637 and half-life of 0.516 s. + 0 + [211Po] + InChI=1S/Po/i1+2 + HZEBHPIOVYHPMT-NJFSPNSNSA-N + 210.987 + 210.98664 + [211Po] + CAS:15735-83-8 + Gmelin:41683 + polonium-211 chebi_ontology - CHEBI:33680 + (211)84Po + (211)Po + polonium, isotope of mass 211 + polonium-211 + CHEBI:37341 - elemental helium + polonium-211 atom + + + + CAS:15735-83-8 + ChemIDplus + + + + + Gmelin:41683 + Gmelin + + + + + polonium-211 + IUPAC + + + + + + (211)84Po + IUPAC + + + + + (211)Po + IUPAC + + + + + polonium, isotope of mass 211 + ChemIDplus + + + + + polonium-211 + ChEBI + - + - - - - Hydrides are chemical compounds of hydrogen with other chemical elements. + + + The radioactive isotope of polonium with relative atomic mass 211.988852 and half-life of 0.299 mus. + 0 + [212Po] + InChI=1S/Po/i1+3 + HZEBHPIOVYHPMT-AKLPVKDBSA-N + 211.989 + 211.98885 + [212Po] + CAS:15389-34-1 + Gmelin:41677 + polonium-212 chebi_ontology - CHEBI:33692 + (212)84Po + (212)Po + polonium, isotope of mass 212 + polonium-212 + CHEBI:37342 - hydrides + polonium-212 atom + + + + CAS:15389-34-1 + ChemIDplus + + + + + Gmelin:41677 + Gmelin + + + + + polonium-212 + IUPAC + + + + + + (212)84Po + IUPAC + + + + + (212)Po + IUPAC + + + + + polonium, isotope of mass 212 + ChemIDplus + + + + + polonium-212 + ChEBI + - + - - - oxygen hydride + + + The radioactive isotope of polonium with relative atomic mass 212.9928425 and half-life of 4.2 mus. + 0 + [213Po] + InChI=1S/Po/i1+4 + HZEBHPIOVYHPMT-RNFDNDRNSA-N + 212.993 + 212.99284 + [213Po] + CAS:15756-57-7 + polonium-213 + chebi_ontology + (213)84Po + (213)Po + polonium, isotope of mass 213 + polonium-213 + CHEBI:37343 + + polonium-213 atom + + + + CAS:15756-57-7 + ChemIDplus + + + + + polonium-213 + IUPAC + + + + + + (213)84Po + IUPAC + + + + + (213)Po + IUPAC + + + + + polonium, isotope of mass 213 + ChemIDplus + + + + + polonium-213 + ChEBI + - + - - - - A macromolecule formed by a living organism. - biopolymer + + + The radioactive isotope of polonium with relative atomic mass 213.995186 and half-life of 164.3 mus. + 0 + [214Po] + InChI=1S/Po/i1+5 + HZEBHPIOVYHPMT-BKFZFHPZSA-N + 213.995 + 213.99519 + [214Po] + CAS:15735-67-8 + Gmelin:41679 + polonium-214 chebi_ontology - Biopolymere - biomacromolecules - biopolymers - CHEBI:33694 + (214)84Po + (214)Po + polonium, isotope of mass 214 + polonium-214 + CHEBI:37344 - biomacromolecule + polonium-214 atom - + + + CAS:15735-67-8 + ChemIDplus + + + + + Gmelin:41679 + Gmelin + + + - biopolymer + polonium-214 IUPAC - + - Biopolymere - ChEBI + (214)84Po + IUPAC - + - biomacromolecules - ChEBI + (214)Po + IUPAC - + - biopolymers + polonium, isotope of mass 214 + ChemIDplus + + + + + polonium-214 ChEBI - + - - + + + The radioactive isotope of polonium with relative atomic mass 214.999415 and half-life of 1.781 ms. + 0 + [215Po] + InChI=1S/Po/i1+6 + HZEBHPIOVYHPMT-LZFNBGRKSA-N + 214.999 + 214.99941 + [215Po] + CAS:15706-52-2 + Gmelin:41680 + polonium-215 chebi_ontology - genetically encoded biomacromolecules - genetically encoded biopolymers - information biomacromolecules - information biopolymers - information macromolecule - information macromolecules - CHEBI:33695 + (215)84Po + (215)Po + polonium, isotope of mass 215 + polonium-215 + CHEBI:37345 - information biomacromolecule + polonium-215 atom - - - genetically encoded biomacromolecules - ChEBI + + + CAS:15706-52-2 + ChemIDplus - - - genetically encoded biopolymers - ChEBI + + + Gmelin:41680 + Gmelin - + + + polonium-215 + IUPAC + + + + - information biomacromolecules - ChEBI + (215)84Po + IUPAC - + - information biopolymers - ChEBI + (215)Po + IUPAC - + - information macromolecule - ChEBI + polonium, isotope of mass 215 + ChemIDplus - + - information macromolecules + polonium-215 ChEBI - + - - - - - - - - - - - - - - - A macromolecule made up of nucleotide units and hydrolysable into certain pyrimidine or purine bases (usually adenine, cytosine, guanine, thymine, uracil), D-ribose or 2-deoxy-D-ribose and phosphoric acid. - nucleic acids - chebi_ontology - NA - Nukleinsaeure - Nukleinsaeuren - acide nucleique - acides nucleiques - acido nucleico - acidos nucleicos - CHEBI:33696 + + + The radioactive isotope of polonium with relative atomic mass 216.001905 and half-life of 0.145 s. + 0 + [216Po] + InChI=1S/Po/i1+7 + HZEBHPIOVYHPMT-RKEGKUSMSA-N + 216.002 + 216.00191 + [216Po] + CAS:15756-58-8 + Gmelin:41684 + polonium-216 + chebi_ontology + (216)84Po + (216)Po + polonium, isotope of mass 216 + polonium-216 + CHEBI:37346 - nucleic acid + polonium-216 atom - + + + CAS:15756-58-8 + ChemIDplus + + + + + Gmelin:41684 + Gmelin + + + - nucleic acids + polonium-216 IUPAC - + - NA - ChEBI + (216)84Po + IUPAC - + - Nukleinsaeure - ChEBI + (216)Po + IUPAC - + - Nukleinsaeuren - ChEBI + polonium, isotope of mass 216 + ChemIDplus - + - acide nucleique + polonium-216 ChEBI + + + + + + + + The radioactive isotope of polonium with relative atomic mass 217.006253 and half-life of < 10 s. + 0 + [217Po] + InChI=1S/Po/i1+8 + HZEBHPIOVYHPMT-CONNIKPHSA-N + 217.006 + 217.00625 + [217Po] + polonium-217 + chebi_ontology + (217)84Po + (217)Po + polonium-217 + CHEBI:37347 + + polonium-217 atom + - + + + polonium-217 + IUPAC + + + + - acides nucleiques - ChEBI + (217)84Po + IUPAC - + - acido nucleico - ChEBI + (217)Po + IUPAC - + - acidos nucleicos + polonium-217 ChEBI - + - - - - - - - - - - - - - - - High molecular weight, linear polymers, composed of nucleotides containing ribose and linked by phosphodiester bonds; RNA is central to the synthesis of proteins. - CAS:63231-63-0 - ribonucleic acid - ribonucleic acids - chebi_ontology - RNA - RNS - Ribonukleinsaeure - pentosenucleic acids - ribonucleic acids - ribose nucleic acid - yeast nucleic acid - CHEBI:33697 + + + The radioactive isotope of polonium with relative atomic mass 218.008966 and half-life of 3.10 min. + 0 + [218Po] + InChI=1S/Po/i1+9 + HZEBHPIOVYHPMT-KUYOKYOWSA-N + 218.009 + 218.00897 + [218Po] + CAS:15422-74-9 + Gmelin:41685 + polonium-218 + chebi_ontology + (218)84Po + (218)Po + polonium, isotope of mass 218 + polonium-218 + CHEBI:37348 - ribonucleic acid + polonium-218 atom - + - CAS:63231-63-0 + CAS:15422-74-9 ChemIDplus - - - ribonucleic acid - IUPAC + + + Gmelin:41685 + Gmelin - + - ribonucleic acids + polonium-218 IUPAC - + - RNA + (218)84Po IUPAC - + - RNA - UniProt + (218)Po + IUPAC - + - RNS - ChEBI + polonium, isotope of mass 218 + ChemIDplus - + - Ribonukleinsaeure + polonium-218 ChEBI + + + + + + + + 0 + [190Po] + InChI=1S/Po/i1-19 + HZEBHPIOVYHPMT-BTCYYSDASA-N + 189.994 + 189.99429 + [190Po] + polonium-190 + chebi_ontology + (190)84Po + (190)Po + polonium-190 + CHEBI:37350 + + polonium-190 atom + - - - pentosenucleic acids - ChemIDplus + + + polonium-190 + IUPAC + - + - ribonucleic acids - ChEBI + (190)84Po + IUPAC - + - ribose nucleic acid - ChEBI + (190)Po + IUPAC - + - yeast nucleic acid + polonium-190 ChEBI - + - - + + + 0 + [191Po] + InChI=1S/Po/i1-18 + HZEBHPIOVYHPMT-ZWLOOBQPSA-N + 190.995 + 190.99465 + [191Po] + polonium-191 chebi_ontology - canonical amino-acid residue - canonical amino-acid residues - common amino acid residues - proteinogenic amino-acid residues - standard amino acid residues - standard amino-acid residues - CHEBI:33700 + (191)84Po + (191)Po + polonium-191 + CHEBI:37351 - proteinogenic amino-acid residue + polonium-191 atom - + + + polonium-191 + IUPAC + + + + - canonical amino-acid residue - ChEBI + (191)84Po + IUPAC - + - canonical amino-acid residues - ChEBI + (191)Po + IUPAC - + - common amino acid residues + polonium-191 ChEBI + + + + + + + + 0 + [192Po] + InChI=1S/Po/i1-17 + HZEBHPIOVYHPMT-MEAORNGASA-N + 191.990 + 191.99033 + [192Po] + polonium-192 + chebi_ontology + (192)84Po + (192)Po + polonium-192 + CHEBI:37352 + + polonium-192 atom + + + + + polonium-192 + IUPAC + + - + - proteinogenic amino-acid residues - ChEBI + (192)84Po + IUPAC - + - standard amino acid residues - ChEBI + (192)Po + IUPAC - + - standard amino-acid residues + polonium-192 ChEBI - + - - - - - - - - - - - - - - - An amino acid in which the amino group is located on the carbon atom at the position alpha to the carboxy group. + + 0 - C2H4NO2R - 74.05870 - 74.02420 - NC([*])C(O)=O - CHEBI:10208 - CHEBI:13779 - CHEBI:22442 - CHEBI:2642 - KEGG:C00045 - KEGG:C05167 - alpha-amino acid + [193Po] + InChI=1S/Po/i1-16 + HZEBHPIOVYHPMT-KLOSUXQXSA-N + 192.991 + 192.99110 + [193Po] + polonium-193 chebi_ontology - Amino acid - Amino acids - alpha-amino acids - alpha-amino carboxylic acids - CHEBI:33704 + (193)84Po + (193)Po + polonium-193 + CHEBI:37353 - alpha-amino acid + polonium-193 atom - + + + polonium-193 + IUPAC + + + + - Amino acid - KEGG_COMPOUND + (193)84Po + IUPAC - + - Amino acids - KEGG_COMPOUND + (193)Po + IUPAC - + - alpha-amino acids + polonium-193 ChEBI + + + + + + + + 0 + [194Po] + InChI=1S/Po/i1-15 + HZEBHPIOVYHPMT-LPJXZZDMSA-N + 193.988 + 193.98828 + [194Po] + polonium-194 + chebi_ontology + (194)84Po + (194)Po + polonium-194 + CHEBI:37354 + + polonium-194 atom + + + + + polonium-194 + IUPAC + + - + - alpha-amino acids - JCBN + (194)84Po + IUPAC - + - alpha-amino carboxylic acids + (194)Po IUPAC - - - alpha-amino acid - IUPAC - + + + polonium-194 + ChEBI - + - - - - - - - - - When two or more amino acids combine to form a peptide, the elements of water are removed, and what remains of each amino acid is called an amino-acid residue. - amino acid residue - amino-acid residue - protein residue + + + 0 + [195Po] + InChI=1S/Po/i1-14 + HZEBHPIOVYHPMT-DWTUDRKQSA-N + 194.988 + 194.98804 + [195Po] + polonium-195 chebi_ontology - amino acid residue - amino-acid residues - CHEBI:33708 + (195)84Po + (195)Po + polonium-195 + CHEBI:37355 - amino-acid residue + polonium-195 atom - - - When two or more amino acids combine to form a peptide, the elements of water are removed, and what remains of each amino acid is called an amino-acid residue. - Dummy:dummy - - - + - amino-acid residue + polonium-195 IUPAC - - - protein residue - PRO:DAN + + + (195)84Po + IUPAC - + - amino acid residue - ChEBI + (195)Po + IUPAC - + - amino-acid residues - JCBN + polonium-195 + ChEBI - + - - - - - - - - - - A carboxylic acid containing one or more amino groups. - CHEBI:13815 - CHEBI:22477 - Wikipedia:Amino_acid + + + 0 + [196Po] + InChI=1S/Po/i1-13 + HZEBHPIOVYHPMT-QAPNMCNYSA-N + 195.985 + 195.98547 + [196Po] + polonium-196 chebi_ontology - Aminocarbonsaeure - Aminokarbonsaeure - Aminosaeure - amino acids - CHEBI:33709 + (196)84Po + (196)Po + polonium-196 + CHEBI:37356 - amino acid + polonium-196 atom - - - Aminocarbonsaeure - ChEBI + + + polonium-196 + IUPAC + - + - Aminokarbonsaeure - ChEBI + (196)84Po + IUPAC - + - Aminosaeure - ChEBI + (196)Po + IUPAC - + - amino acids + polonium-196 ChEBI - + - - - - - - - - + + + 0 + [197Po] + InChI=1S/Po/i1-12 + HZEBHPIOVYHPMT-DFNMHJECSA-N + 196.986 + 196.98557 + [197Po] + polonium-197 chebi_ontology - alpha-amino-acid residues - CHEBI:33710 + (197)84Po + (197)Po + polonium-197 + CHEBI:37357 - alpha-amino-acid residue + polonium-197 atom - + + + polonium-197 + IUPAC + + + + - alpha-amino-acid residues + (197)84Po + ChEBI + + + + + (197)Po + ChEBI + + + + + polonium-197 ChEBI - - - - - iron group molecular entity - - - - - - - - - copper group molecular entity - - - - - - - - - nickel group molecular entity - - - - - - - - - platinum molecular entity - - - - - + - - - chebi_ontology - canonical nucleoside residues - common nucleoside residues - nucleoside residue - standard nucleoside residues - CHEBI:33791 + + + 0 + [198Po] + InChI=1S/Po/i1-11 + HZEBHPIOVYHPMT-DSSHQIQSSA-N + 197.984 + 197.98402 + [198Po] + polonium-198 + chebi_ontology + (198)84Po + (198)Po + polonium-198 + CHEBI:37358 - canonical nucleoside residue + polonium-198 atom - - - canonical nucleoside residues - ChEBI + + + polonium-198 + IUPAC + - + - common nucleoside residues - CBN + (198)84Po + IUPAC - + - nucleoside residue - CBN + (198)Po + IUPAC - + - standard nucleoside residues + polonium-198 ChEBI - + - - - chebi_ontology - N - Nuc - canonical ribonucleoside residues - common ribonucleoside residue - common ribonucleoside residues - standard ribonucleoside residues - CHEBI:33792 + + + 0 + [199Po] + InChI=1S/Po/i1-10 + HZEBHPIOVYHPMT-CBESVEIWSA-N + 198.985 + 198.98504 + [199Po] + polonium-199 + chebi_ontology + (199)84Po + (199)Po + polonium-199 + CHEBI:37359 - canonical ribonucleoside residue + polonium-199 atom - + + + polonium-199 + IUPAC + + + + - N - CBN + (199)84Po + IUPAC - + - Nuc - CBN + (199)Po + IUPAC - + - canonical ribonucleoside residues + polonium-199 ChEBI + + + + + + + + 0 + [200Po] + InChI=1S/Po/i1-9 + HZEBHPIOVYHPMT-DBXDQKISSA-N + 199.982 + 199.98173 + [200Po] + polonium-200 + chebi_ontology + (200)84Po + (200)Po + polonium-200 + CHEBI:37360 + + polonium-200 atom + + + + + polonium-200 + IUPAC + + - + - common ribonucleoside residue - CBN + (200)84Po + IUPAC - + - common ribonucleoside residues - CBN + (200)Po + IUPAC - + - standard ribonucleoside residues + polonium-200 ChEBI - + - - - - Any organic molecule that consists of atoms connected in the form of a ring. - chebi_ontology - organic cyclic compounds - CHEBI:33832 + + + 0 + [201Po] + InChI=1S/Po/i1-8 + HZEBHPIOVYHPMT-QQVBLGSISA-N + 200.982 + 200.98221 + [201Po] + polonium-201 + chebi_ontology + (201)84Po + (201)Po + polonium-201 + CHEBI:37361 - organic cyclic compound + polonium-201 atom - + + + polonium-201 + IUPAC + + + + - organic cyclic compounds + (201)84Po + IUPAC + + + + + (201)Po + IUPAC + + + + + polonium-201 ChEBI - + - - - - A heterocyclic compound formally derived from an arene by replacement of one or more methine (-C=) and/or vinylene (-CH=CH-) groups by trivalent or divalent heteroatoms, respectively, in such a way as to maintain the continuous pi-electron system characteristic of aromatic systems and a number of out-of-plane pi-electrons corresponding to the Hueckel rule (4n+2). - heteroarenes - chebi_ontology - hetarenes - CHEBI:33833 + + + 0 + [202Po] + InChI=1S/Po/i1-7 + HZEBHPIOVYHPMT-NOHWODKXSA-N + 201.981 + 201.98070 + [202Po] + polonium-202 + chebi_ontology + (202)84Po + (202)Po + polonium-202 + CHEBI:37362 - heteroarene + polonium-202 atom - + - heteroarenes + polonium-202 IUPAC - + - hetarenes + (202)84Po IUPAC + + + + (202)Po + IUPAC + + + + + polonium-202 + ChEBI + - - - - - - conjugated protein - - - - - + - - - A macromolecule is a molecule of high relative molecular mass, the structure of which essentially comprises the multiple repetition of units derived, actually or conceptually, from molecules of low relative molecular mass. - Wikipedia:Macromolecule - macromolecule + + + The radioactive isotope of polonium with relative atomic mass 202.981413 and half-life of 36.7 min. + 0 + [203Po] + InChI=1S/Po/i1-6 + HZEBHPIOVYHPMT-VENIDDJXSA-N + 202.981 + 202.98141 + [203Po] + CAS:16729-74-1 + polonium-203 chebi_ontology - macromolecules - polymer - polymer molecule - polymers - CHEBI:33839 + (203)84Po + (203)Po + polonium, isotope of mass 203 + polonium-203 + CHEBI:37363 - macromolecule + polonium-203 atom - + + + CAS:16729-74-1 + ChemIDplus + + + - macromolecule + polonium-203 IUPAC - + - macromolecules - ChEBI + (203)84Po + IUPAC - + - polymer - ChEBI + (203)Po + IUPAC - + - polymer molecule - IUPAC + polonium, isotope of mass 203 + ChemIDplus - + - polymers + polonium-203 ChEBI - + - - - A substance used in a chemical reaction to detect, measure, examine, or produce other substances. - reagent + + + 0 + [204Po] + InChI=1S/Po/i1-5 + HZEBHPIOVYHPMT-FTXFMUIASA-N + 203.980 + 203.98031 + [204Po] + polonium-204 chebi_ontology - reactif - reactivo - reagents - CHEBI:33893 + (204)84Po + (204)Po + polonium-204 + CHEBI:37364 - reagent + polonium-204 atom - + - reagent + polonium-204 IUPAC - + - reactif + (204)84Po IUPAC - + - reactivo + (204)Po IUPAC - + - reagents + polonium-204 ChEBI - + - - - Any nutrient required in large quantities by organisms throughout their life in order to orchestrate a range of physiological functions. Macronutrients are usually chemical elements (carbon, hydrogen, nitrogen, oxygen, phosphorus and sulfur) that humans consume in the largest quantities. Calcium, sodium, magnesium and potassium are sometimes included as macronutrients because they are required in relatively large quantities compared with other vitamins and minerals. + + + The radioactive isotope of polonium with relative atomic mass 204.981165 and half-life of 1.66 h. + 0 + [205Po] + InChI=1S/Po/i1-4 + HZEBHPIOVYHPMT-AHCXROLUSA-N + 204.981 + 204.98117 + [205Po] + CAS:16729-76-3 + polonium-205 chebi_ontology - macronutrients - CHEBI:33937 - + (205)84Po + (205)Po + polonium, isotope of mass 205 + polonium-205 + CHEBI:37365 - macronutrient + polonium-205 atom - + + + CAS:16729-76-3 + ChemIDplus + + + + + polonium-205 + IUPAC + + + + - macronutrients + (205)84Po + IUPAC + + + + + (205)Po + IUPAC + + + + + polonium, isotope of mass 205 + ChemIDplus + + + + + polonium-205 ChEBI - - - - - - halide salt - - - - - - - - - gold molecular entity - - - + - - - - - + + + The radioactive isotope of polonium with relative atomic mass 205.98047 and half-life of 8.8 days. + 0 + [206Po] + InChI=1S/Po/i1-3 + HZEBHPIOVYHPMT-OIOBTWANSA-N + 205.980 + 205.98047 + [206Po] + polonium-206 chebi_ontology - nitrogen hydrides - CHEBI:35106 + (206)84Po + (206)Po + polonium-206 + CHEBI:37366 - nitrogen hydride + polonium-206 atom - + + + polonium-206 + IUPAC + + + + - nitrogen hydrides + (206)84Po + IUPAC + + + + + (206)Po + IUPAC + + + + + polonium-206 ChEBI - + - - - Saturated acyclic nitrogen hydrides having the general formula NnHn+2. + + + The radioactive isotope of polonium with relative atomic mass 206.981578 and half-life of 5.80 h. + 0 + [207Po] + InChI=1S/Po/i1-2 + HZEBHPIOVYHPMT-YPZZEJLDSA-N + 206.982 + 206.98158 + [207Po] + CAS:15720-45-3 + polonium-207 chebi_ontology - azanes - CHEBI:35107 + (207)84Po + (207)Po + polonium, isotope of mass 207 + polonium-207 + CHEBI:37367 - azane + polonium-207 atom - + + + CAS:15720-45-3 + ChemIDplus + + + + + polonium-207 + IUPAC + + + + - azanes + (207)84Po + IUPAC + + + + + (207)Po + IUPAC + + + + + polonium, isotope of mass 207 + ChemIDplus + + + + + polonium-207 ChEBI - + - - - A substance that diminishes the rate of a chemical reaction. - inhibitor + + + The radioactive isotope of polonium with relative atomic mass 207.98123 and half-life of 2.898 years. + 0 + [208Po] + InChI=1S/Po/i1-1 + HZEBHPIOVYHPMT-BJUDXGSMSA-N + 207.981 + 207.98123 + [208Po] + polonium-208 chebi_ontology - inhibidor - inhibiteur - inhibitors - CHEBI:35222 + (208)84Po + (208)Po + polonium-208 + CHEBI:37368 - inhibitor + polonium-208 atom - + - inhibitor + polonium-208 IUPAC - + - inhibidor - ChEBI + (208)84Po + IUPAC - + - inhibiteur - ChEBI + (208)Po + IUPAC - + - inhibitors + polonium-208 ChEBI - - - - - fossil fuel - - - - - + - - - The zwitterionic form of an amino acid having a negatively charged carboxyl group and a positively charged amino group. - amino acid zwitterion + + + The radioactive isotope of polonium with relative atomic mass 208.982404 and half-life of 102 years. + 0 + [209Po] + InChI=1S/Po/i1+0 + HZEBHPIOVYHPMT-IGMARMGPSA-N + 208.982 + 208.98242 + [209Po] + polonium-209 chebi_ontology - CHEBI:35238 + (209)84Po + (209)Po + polonium-209 + CHEBI:37369 - amino acid zwitterion + polonium-209 atom - + - amino acid zwitterion + polonium-209 + IUPAC + + + + + + (209)84Po + IUPAC + + + + + (209)Po + IUPAC + + + + + polonium-209 ChEBI - + - - - - steroid + + + mucopolysaccharide - + - - - - Any heteroorganic entity containing at least one carbon-nitrogen bond. - organonitrogen compounds + + + An acid is a molecular entity capable of donating a hydron (Bronsted acid) or capable of forming a covalent bond with an electron pair (Lewis acid). + CHEBI:13800 + CHEBI:13801 + CHEBI:22209 + CHEBI:2426 + KEGG:C00174 + Acid + acid chebi_ontology - organonitrogens - CHEBI:35352 + Saeure + Saeuren + acide + acido + acids + CHEBI:37527 - organonitrogen compound + acid - + - organonitrogen compounds + Acid + KEGG_COMPOUND + + + + + acid IUPAC - + - organonitrogens + Saeure ChEBI - - - - - - - - - An oxoanion is an anion derived from an oxoacid by loss of hydron(s) bound to oxygen. - CHEBI:33274 - CHEBI:33436 - oxoanion - chebi_ontology - oxoacid anions - oxoanions - CHEBI:35406 - - oxoanion - - - - oxoanion + + + Saeuren ChEBI - + - oxoacid anions + acide + IUPAC + + + + + acido ChEBI - + - oxoanions + acids ChEBI - - - - - - alkali metal salt - - - - - + - - - + + + A molecular entity consisting of two or more chemical elements. chebi_ontology - carbon oxoacids - oxoacids of carbon - CHEBI:35605 + chemical compound + heteroatomic molecular entities + CHEBI:37577 - carbon oxoacid + heteroatomic molecular entity - + - carbon oxoacids + chemical compound ChEBI - + - oxoacids of carbon + heteroatomic molecular entities ChEBI - + - - - - dicarboxylic acid + + + + halide - + - + + + - ester - - - - - - - - - - sulfated glycosaminoglycan - - - - - - - - - - - carbohydrate sulfate - - - - - - - - - - pnictogen hydride + + + + + + + An amide of a carboxylic acid, having the structure RC(=O)NR2. The term is used as a suffix in systematic name formation to denote the -C(=O)NH2 group including its carbon atom. + 0 + CNOR3 + 42.01680 + 41.99799 + [*]C(=O)N([*])[*] + CHEBI:35354 + CHEBI:35355 + carboxamides chebi_ontology - pnictogen hydrides - CHEBI:35881 + carboxamides + primary carboxamide + CHEBI:37622 - pnictogen hydride + carboxamide - + - pnictogen hydride + carboxamides + IUPAC + + + + + + carboxamides ChEBI - + - pnictogen hydrides + primary carboxamide ChEBI - - - - - cholanoid - - - - - + - - - - A biological macromolecule minimally consisting of one polypeptide chain synthesized at the ribosome. - CHEBI:13677 - CHEBI:14911 - proteins + + + The stable isotope of thallium with relative atomic mass 202.9723. The least abundant (29.524 atom percent) isotope of naturally occurring thallium. + 0 + [203Tl] + InChI=1S/Tl/i1-1 + BKVIYDNLLOSFOA-BJUDXGSMSA-N + 202.972 + 202.97234 + [203Tl] + CAS:14280-48-9 + thallium-203 chebi_ontology - CHEBI:36080 + (203)81Tl + (203)Tl + thallium, isotope of mass 203 + CHEBI:37802 - protein + thallium-203 - + + + CAS:14280-48-9 + ChemIDplus + + + - proteins + thallium-203 IUPAC + + + + (203)81Tl + IUPAC + + + + + (203)Tl + IUPAC + + + + + thallium, isotope of mass 203 + ChemIDplus + - - - - - - inorganic chloride - - - - - - - - - - bile acid salt - - - - - + - - - - Lepton is a fermion that does not experience the strong force (strong interaction). The term is derived from the Greek lambdaepsilonpitauomicronsigma (small, thin). + + + The stable isotope of thallium with relative atomic mass 204.9744. The most abundant (70.476 atom percent) isotope of naturally occurring thallium. + 0 + [205Tl] + InChI=1S/Tl/i1+1 + BKVIYDNLLOSFOA-OUBTZVSYSA-N + 204.974 + 204.97443 + [205Tl] + CAS:14280-49-0 + Gmelin:557319 + thallium-205 chebi_ontology - leptons - CHEBI:36338 + (205)81Tl + (205)Tl + thallium, isotope of mass 205 + CHEBI:37803 - lepton + thallium-205 - + + + CAS:14280-49-0 + ChemIDplus + + + + + Gmelin:557319 + Gmelin + + + + + thallium-205 + IUPAC + + + + - leptons - ChEBI + (205)81Tl + IUPAC + + + + + (205)Tl + IUPAC + + + + + thallium, isotope of mass 205 + ChemIDplus - + - - - - Baryon is a fermion that does experience the strong force (strong interaction). The term is derived from the Greek betaalpharhoupsilonsigma (heavy). + + + The radioactive isotope of thallium with relative atomic mass 200.9708 and half-life of 72.912 hours. + 0 + [201Tl] + InChI=1S/Tl/i1-3 + BKVIYDNLLOSFOA-OIOBTWANSA-N + 200.971 + 200.97080 + [201Tl] + CAS:15064-65-0 + thallium-201 chebi_ontology - baryons - CHEBI:36339 + (201)81Tl + (201)Tl + thallium, isotope of mass 201 + CHEBI:37804 - baryon + thallium-201 - + + + CAS:15064-65-0 + ChemIDplus + + + + + thallium-201 + IUPAC + + + + - baryons - ChEBI + (201)81Tl + IUPAC + + + + + (201)Tl + IUPAC + + + + + thallium, isotope of mass 201 + ChemIDplus - + - - - Particle of half-integer spin quantum number following Fermi-Dirac statistics. Fermions are named after Enrico Fermi. - fermion + + + The radioactive isotope of thallium with relative atomic mass 198.9698 and half-life of 7.42 hours. + 0 + [199Tl] + InChI=1S/Tl/i1-5 + BKVIYDNLLOSFOA-FTXFMUIASA-N + 198.970 + 198.96981 + [199Tl] + CAS:15064-66-1 + Gmelin:1491863 + thallium-199 chebi_ontology - fermions - CHEBI:36340 + (199)81Tl + (199)Tl + thallium, isotope of mass 199 + CHEBI:37805 - fermion + thallium-199 - + + + CAS:15064-66-1 + ChemIDplus + + + + + Gmelin:1491863 + Gmelin + + + - fermion + thallium-199 IUPAC - + - fermions - ChEBI + (199)81Tl + IUPAC + + + + + (199)Tl + IUPAC + + + + + thallium, isotope of mass 199 + ChemIDplus - + - - - Particle of integer spin quantum number following Bose-Einstein statistics. Bosons are named after Satyendra Nath Bose. - boson + + + sulfuric acid derivative + + + + + + + + + + + + + + + A carboacyl group is a group formed by loss of at least one OH from the carboxy group of a carboxylic acid. + carboacyl groups + carboxylic acyl group chebi_ontology - bosons - CHEBI:36341 + carboxylic acyl groups + CHEBI:37838 - boson + carboacyl group - + - boson + carboacyl groups IUPAC - + + + carboxylic acyl group + IUPAC + + + + - bosons - ChEBI + carboxylic acyl groups + IUPAC - + - - - A particle smaller than an atom. - Wikipedia:Subatomic_particle + + + The stable isotope of aluminium with relative atomic mass 26.98153 and nuclear spin (5)/2. + 0 + [27Al] + InChI=1S/Al/i1+0 + XAGFODPZIPBFFR-IGMARMGPSA-N + 26.982 + 26.98154 + [27Al] + aluminium-27 chebi_ontology - subatomic particles - CHEBI:36342 + (27)13Al + (27)Al + aluminium-27 + aluminum, isotope of mass 27 + aluminum-27 + CHEBI:37968 - subatomic particle - subatomic particle + aluminium-27 atom - + + + aluminium-27 + IUPAC + + + + + + (27)13Al + IUPAC + + + + + (27)Al + IUPAC + + + + + aluminium-27 + ChEBI + + + + + aluminum, isotope of mass 27 + ChEBI + + + - subatomic particles + aluminum-27 ChEBI - + - - - A subatomic particle known to have substructure (i.e. consisting of smaller particles). + + + The radioactive isotope of aluminium with relative atomic mass 25.986892 and half-life of 717,000 years. + 0 + [26Al] + InChI=1S/Al/i1-1 + XAGFODPZIPBFFR-BJUDXGSMSA-N + 25.987 + 25.98689 + [26Al] + CAS:14682-66-7 + aluminium-26 chebi_ontology - composite particles - CHEBI:36343 + (26)13Al + (26)Al + aluminium-26 + aluminum, isotope of mass 26 + aluminum-26 + CHEBI:37969 - composite particle + aluminium-26 atom - + + + CAS:14682-66-7 + ChemIDplus + + + + + aluminium-26 + IUPAC + + + + + + (26)13Al + IUPAC + + + + + (26)Al + IUPAC + + + + + aluminium-26 + ChEBI + + + + + aluminum, isotope of mass 26 + ChemIDplus + + + - composite particles - ChEBI + aluminum-26 + ChemIDplus - + - - - Hadron is a subatomic particle which experiences the strong force. + + + The radioactive isotope of aluminium with relative atomic mass 27.981910 and half-life of 2.25 min. + 0 + [28Al] + InChI=1S/Al/i1+1 + XAGFODPZIPBFFR-OUBTZVSYSA-N + 27.982 + 27.98191 + [28Al] + CAS:14999-04-3 + aluminium-28 chebi_ontology - hadrons - CHEBI:36344 + (28)13Al + (28)Al + aluminium-28 + aluminum, isotope of mass 28 + aluminum-28 + CHEBI:37970 - hadron + aluminium-28 atom - + + + CAS:14999-04-3 + ChemIDplus + + + + + aluminium-28 + IUPAC + + + + - hadrons - ChEBI + (28)13Al + IUPAC + + + + + (28)Al + IUPAC - - - - - - - - - A hadron with zero or integer spin; a strongly interacting boson. The term is derived from the Greek muepsilonsigmaomicronsigma (medium, middle). - chebi_ontology - mesons - CHEBI:36345 - - meson - - + - mesons + aluminium-28 ChEBI + + + + aluminum, isotope of mass 28 + ChemIDplus + + + + + aluminum-28 + ChemIDplus + - + - - - A nucleus or any of its constituents in any of their energy states. - nuclear particle + + + The stable isotope of phosphorus with relative atomic mass 30.973762 and nuclear spin (1)/2. + 0 + [31P] + InChI=1S/P/i1+0 + OAICVXFJPJFONN-IGMARMGPSA-N + 30.974 + 30.97376 + [31P] + phosphorus-31 chebi_ontology - CHEBI:36347 + (31)15P + (31)P + phosphorus-31 + CHEBI:37971 - nuclear particle + phosphorus-31 atom - + - nuclear particle + phosphorus-31 IUPAC - - - - - - - - The collective name for zero-spin mesons pi(+), pi(-) and pi(0). - pi meson - pion - chebi_ontology - pi-meson - CHEBI:36348 - - pi meson - - - - pi meson - ChEBI + + + (31)15P + IUPAC - - - pion + + + (31)P IUPAC - - + - pi-meson + phosphorus-31 ChEBI - + - - - Elementary particle not affected by the strong force having a spin 1/2, a negative elementary charge and a rest mass of 0.113428913(17) u, or 105.658389(34) MeV. - -1 - 0.113428913 - muon + + + The radioactive isotope of phosphorus with relative atomic mass 31.973907 and half-life of 14.26 days. + 0 + [32P] + InChI=1S/P/i1+1 + OAICVXFJPJFONN-OUBTZVSYSA-N + 31.974 + 31.97391 + [32P] + CAS:14596-37-3 + KEGG:C19162 + phosphorus-32 chebi_ontology - Mueon - My-Teilchen - Myon - mu(-) - negative muon - CHEBI:36356 + (32)15P + (32)P + Phosphorus, isotope of mass 32 + phosphorus, isotope of mass 32 + phosphorus-32 + CHEBI:37972 - muon + phosphorus-32 atom - + + + CAS:14596-37-3 + ChemIDplus + + + + + CAS:14596-37-3 + KEGG COMPOUND + + + - muon + phosphorus-32 IUPAC - + - Mueon - ChEBI + (32)15P + IUPAC - + - My-Teilchen - ChEBI + (32)P + IUPAC - + - Myon - ChEBI + Phosphorus, isotope of mass 32 + KEGG_COMPOUND - + - mu(-) - IUPAC + phosphorus, isotope of mass 32 + ChemIDplus - + - negative muon + phosphorus-32 ChEBI - + - - - - - - - - - Any molecular entity consisting of more than one atom. + + + The radioactive isotope of phosphorus with relative atomic mass 32.971725, half-life of 25.34 days and nuclear spin (1)/2. + 0 + [33P] + InChI=1S/P/i1+2 + OAICVXFJPJFONN-NJFSPNSNSA-N + 32.972 + 32.97173 + [33P] + CAS:15749-66-3 + phosphorus-33 chebi_ontology - polyatomic entities - CHEBI:36357 + (33)15P + (33)P + phosphorus, isotope of mass 33 + phosphorus-33 + CHEBI:37973 - polyatomic entity + phosphorus-33 atom - + + + CAS:15749-66-3 + ChemIDplus + + + + + phosphorus-33 + IUPAC + + + + - polyatomic entities - ChEBI + (33)15P + IUPAC - - - - - - - - - An ion consisting of more than one atom. - chebi_ontology - polyatomic ions - CHEBI:36358 - - polyatomic ion - - + - polyatomic ions + (33)P + IUPAC + + + + + phosphorus, isotope of mass 33 + ChemIDplus + + + + + phosphorus-33 ChEBI - + - - - - - - - - - - Any compound containing the carbonyl group, C=O. The term is commonly used in the restricted sense of aldehydes and ketones, although it actually includes carboxylic acids and derivatives. - carbonyl compounds + + + The stable isotope of silicon with relative atomic mass 28.9764947, 4.683 atom percent natural abundancy, and nuclear spin (1)/2. + 0 + [29Si] + InChI=1S/Si/i1+1 + XUIMIQQOPSSXEZ-OUBTZVSYSA-N + 28.976 + 28.97649 + [29Si] + silicon-29 chebi_ontology - CHEBI:36586 + (29)14Si + (29)Si + silicon-29 + CHEBI:37974 - carbonyl compound + silicon-29 atom - + - carbonyl compounds + silicon-29 IUPAC + + + + (29)14Si + IUPAC + + + + + (29)Si + IUPAC + + + + + silicon-29 + ChEBI + - + - - - - - - - - - Organic compounds containing an oxygen atom, =O, doubly bonded to carbon or another element. - oxo compounds + + + The stable isotope of silicon with relative atomic mass 27.9769265. The most abundant (92.23 atom percent) isotope of naturally occurring silicon. + 0 + [28Si] + InChI=1S/Si/i1+0 + XUIMIQQOPSSXEZ-IGMARMGPSA-N + 27.977 + 27.97693 + [28Si] + silicon-28 chebi_ontology - organic oxo compounds - CHEBI:36587 + (28)14Si + (28)Si + silicon-28 + CHEBI:37975 - organic oxo compound + silicon-28 atom - + - oxo compounds + silicon-28 IUPAC - + - organic oxo compounds - ChEBI + (28)14Si + IUPAC - - - - - - - - biladienes - - - - - - - - - - chalcogen hydride - - - - - - - - - argon molecular entity - - - - - - - - - - chebi_ontology - inorganic ions - CHEBI:36914 - - inorganic ion - - + + + (28)Si + IUPAC + + + - inorganic ions + silicon-28 ChEBI - + - - - + + + The stable isotope of silicon with relative atomic mass 29.9737702. The least abundant (3.09 atom percent) isotope of naturally occurring silicon. + 0 + [30Si] + InChI=1S/Si/i1+2 + XUIMIQQOPSSXEZ-NJFSPNSNSA-N + 29.974 + 29.97377 + [30Si] + silicon-30 chebi_ontology - inorganic cations - CHEBI:36915 + (30)14Si + (30)Si + silicon-30 + CHEBI:37976 - inorganic cation + silicon-30 atom - + + + silicon-30 + IUPAC + + + + + + (30)14Si + IUPAC + + + + + (30)Si + IUPAC + + + - inorganic cations + silicon-30 ChEBI - + - - - A monoatomic or polyatomic species having one or more elementary charges of the proton. - CHEBI:23058 - CHEBI:3473 - KEGG:C01373 - Cation - cation + + + The radioactive isotope of silicon with relative atomic mass 30.975363, half-life of 2.62 hours and nuclear spin (3)/2. + 0 + [31Si] + InChI=1S/Si/i1+3 + XUIMIQQOPSSXEZ-AKLPVKDBSA-N + 30.975 + 30.97536 + [31Si] + CAS:14276-49-4 + silicon-31 chebi_ontology - Kation - Kationen - cationes - cations - CHEBI:36916 + (31)14Si + (31)Si + silicon, isotope of mass 31 + silicon-31 + CHEBI:37977 - cation + silicon-31 atom - - - Cation - KEGG_COMPOUND - - - - - cation - ChEBI + + + CAS:14276-49-4 + ChemIDplus - + - cation + silicon-31 IUPAC - + - Kation - ChEBI + (31)14Si + IUPAC - + - Kationen - ChEBI + (31)Si + IUPAC - + - cationes - ChEBI + silicon, isotope of mass 31 + ChemIDplus - + - cations + silicon-31 ChEBI - + - - - - An organochalcogen compound is a compound containing at least one carbon-chalcogen bond. - organochalcogen compound + + + The radioactive isotope of silicon with relative atomic mass 31.974148. The longest-lived silicon radionuclide with half-life of 172 years. + 0 + [32Si] + InChI=1S/Si/i1+4 + XUIMIQQOPSSXEZ-RNFDNDRNSA-N + 31.974 + 31.97415 + [32Si] + CAS:15092-72-5 + silicon-32 chebi_ontology - organochalcogen compounds - CHEBI:36962 + (32)14Si + (32)Si + silicon, isotope of mass 32 + silicon-32 + CHEBI:37978 - organochalcogen compound + silicon-32 atom - + + + CAS:15092-72-5 + ChemIDplus + + + - organochalcogen compound - ChEBI + silicon-32 + IUPAC + - + - organochalcogen compounds + (32)14Si + IUPAC + + + + + (32)Si + IUPAC + + + + + silicon, isotope of mass 32 + ChemIDplus + + + + + silicon-32 ChEBI - + - - - - An organochalcogen compound containing at least one carbon-oxygen bond. - PMID:17586126 - organooxygen compound + + + The stable isotope of sulfur with relative atomic mass 31.972071. The most abundant (95.02 atom percent) isotope of naturally occurring sulfur. + 0 + [32S] + InChI=1S/S/i1+0 + NINIDFKCEFEMDL-IGMARMGPSA-N + 31.972 + 31.97207 + [32S] + CAS:13981-57-2 + sulfur-32 chebi_ontology - organooxygen compounds - CHEBI:36963 + (32)16S + (32)S + sulfur, isotope of mass 32 + sulfur-32 + sulphur-32 + CHEBI:37979 - organooxygen compound + sulfur-32 atom - + - PMID:17586126 - Europe PMC + CAS:13981-57-2 + ChemIDplus - + - organooxygen compound + sulfur-32 + IUPAC + + + + + + (32)16S + IUPAC + + + + + (32)S + IUPAC + + + + + sulfur, isotope of mass 32 + ChemIDplus + + + + + sulfur-32 ChEBI - + - organooxygen compounds + sulphur-32 ChEBI - + - - - - - - - - - - amino-acid anion + + + The stable isotope of sulfur with relative atomic mass 32.9714585, 0.75 atom percent natural abundance, and nuclear spin (3)/2. + 0 + [33S] + InChI=1S/S/i1+1 + NINIDFKCEFEMDL-OUBTZVSYSA-N + 32.971 + 32.97146 + [33S] + CAS:14257-58-0 + sulfur-33 chebi_ontology - amino acid anions - amino-acid anions - CHEBI:37022 + (33)16S + (33)S + sulfur, isotope of mass 33 + sulfur-33 + sulphur-33 + CHEBI:37980 - amino-acid anion + sulfur-33 atom - + + + CAS:14257-58-0 + ChemIDplus + + + - amino-acid anion - ChEBI + sulfur-33 + IUPAC + - + - amino acid anions + (33)16S + IUPAC + + + + + (33)S + IUPAC + + + + + sulfur, isotope of mass 33 + ChemIDplus + + + + + sulfur-33 ChEBI - + - amino-acid anions + sulphur-33 ChEBI - + - - - mononuclear parent hydrides + + + The stable isotope of sulfur with relative atomic mass 33.9678668 and 4.21 atom percent natural abundance. + 0 + [34S] + InChI=1S/S/i1+2 + NINIDFKCEFEMDL-NJFSPNSNSA-N + 33.968 + 33.96787 + [34S] + CAS:13965-97-4 + sulfur-34 chebi_ontology - mononuclear hydride - mononuclear hydrides - CHEBI:37176 + (34)16S + (34)S + sulfur, isotope of mass 34 + sulfur-34 + sulphur-34 + CHEBI:37981 - mononuclear parent hydride + sulfur-34 atom - + + + CAS:13965-97-4 + ChemIDplus + + + - mononuclear parent hydrides + sulfur-34 IUPAC - + - mononuclear hydride - ChEBI + (34)16S + IUPAC - + - mononuclear hydrides + (34)S IUPAC + + + + sulfur, isotope of mass 34 + ChemIDplus + + + + + sulfur-34 + ChEBI + + + + + sulphur-34 + ChEBI + - - - - - elemental sodium - - - - - - - - - mucopolysaccharide - - - - - + - - - An acid is a molecular entity capable of donating a hydron (Bronsted acid) or capable of forming a covalent bond with an electron pair (Lewis acid). - CHEBI:13800 - CHEBI:13801 - CHEBI:22209 - CHEBI:2426 - KEGG:C00174 - Acid - acid + + + The stable isotope of sulfur with relative atomic mass 35.9670809. The least abundant (0.02 atom percent) isotope of naturally occurring sulfur. + 0 + [36S] + InChI=1S/S/i1+4 + NINIDFKCEFEMDL-RNFDNDRNSA-N + 35.967 + 35.96708 + [36S] + CAS:14682-80-5 + sulfur-36 chebi_ontology - Saeure - Saeuren - acide - acido - acids - CHEBI:37527 + (36)16S + (36)S + sulfur, isotope of mass 36 + sulfur-36 + sulphur-36 + CHEBI:37982 - acid + sulfur-36 atom - - - Acid - KEGG_COMPOUND + + + CAS:14682-80-5 + ChemIDplus - + - acid + sulfur-36 IUPAC - + - Saeure - ChEBI + (36)16S + IUPAC - + - Saeuren - ChEBI + (36)S + IUPAC - + - acide - IUPAC + sulfur, isotope of mass 36 + ChemIDplus - + - acido + sulfur-36 ChEBI - + - acids + sulphur-36 ChEBI - + - - - A molecular entity consisting of two or more chemical elements. + + + The radioactive isotope of sulfur with relative atomic mass 34.9690322 and nuclear spin (3)/2. The longest-lived sulfur radionuclide with half-life of 87.5 days. + 0 + [35S] + InChI=1S/S/i1+3 + NINIDFKCEFEMDL-AKLPVKDBSA-N + 34.969 + 34.96903 + [35S] + CAS:15117-53-0 + sulfur-35 chebi_ontology - chemical compound - heteroatomic molecular entities - CHEBI:37577 + (35)16S + (35)S + sulfur, isotope of mass 35 + sulfur-35 + sulphur-35 + CHEBI:37983 - heteroatomic molecular entity + sulfur-35 atom - + + + CAS:15117-53-0 + ChemIDplus + + + + + sulfur-35 + IUPAC + + + + - chemical compound + (35)16S + IUPAC + + + + + (35)S + IUPAC + + + + + sulfur, isotope of mass 35 + ChemIDplus + + + + + sulfur-35 ChEBI - + - heteroatomic molecular entities + sulphur-35 ChEBI - - - - - - halide - - - - - + - - - - - - - - - - - An amide of a carboxylic acid, having the structure RC(=O)NR2. The term is used as a suffix in systematic name formation to denote the -C(=O)NH2 group including its carbon atom. + + + The radioactive isotope of sulfur with relative atomic mass 36.9711257 and half-life of 5.05 min. 0 - CNOR3 - 42.01680 - 41.99799 - [*]C(=O)N([*])[*] - CHEBI:35354 - CHEBI:35355 - carboxamides + [37S] + InChI=1S/S/i1+5 + NINIDFKCEFEMDL-BKFZFHPZSA-N + 36.971 + 36.97113 + [37S] + CAS:15753-06-7 + sulfur-37 chebi_ontology - carboxamides - primary carboxamide - CHEBI:37622 + (37)16S + (37)S + sulfur, isotope of mass 37 + sulfur-37 + sulphur-37 + CHEBI:37984 - carboxamide + sulfur-37 atom - + + + CAS:15753-06-7 + ChemIDplus + + + - carboxamides + sulfur-37 IUPAC - + - carboxamides + (37)16S + IUPAC + + + + + (37)S + IUPAC + + + + + sulfur, isotope of mass 37 + ChemIDplus + + + + + sulfur-37 ChEBI - + - primary carboxamide + sulphur-37 ChEBI - - - - - sulfuric acid derivative - - - - - + - - - - - - - - - A carboacyl group is a group formed by loss of at least one OH from the carboxy group of a carboxylic acid. - carboacyl groups - carboxylic acyl group + + + The radioactive isotope of sulfur with relative atomic mass 37.97116 and half-life of 170.3 min. + 0 + [38S] + InChI=1S/S/i1+6 + NINIDFKCEFEMDL-LZFNBGRKSA-N + 37.971 + 37.97116 + [38S] + CAS:15759-21-4 + sulfur-38 chebi_ontology - carboxylic acyl groups - CHEBI:37838 + (38)16S + (38)S + sulfur, isotope of mass 38 + sulfur-38 + sulphur-38 + CHEBI:37985 - carboacyl group + sulfur-38 atom - + + + CAS:15759-21-4 + ChemIDplus + + + - carboacyl groups + sulfur-38 IUPAC - - - carboxylic acyl group + + + (38)16S IUPAC - - + - carboxylic acyl groups + (38)S IUPAC + + + + sulfur, isotope of mass 38 + ChemIDplus + + + + + sulfur-38 + ChEBI + + + + + sulphur-38 + ChEBI + @@ -16647,13 +32896,13 @@ For example, A and B may be gene products and binding of B by A positively regul heterocyclic organonitrogen compounds - ChEBI + ChEBI organonitrogen heterocyclic compounds - ChEBI + ChEBI @@ -16918,168 +33167,782 @@ For example, A and B may be gene products and binding of B by A positively regul PDBeChem - + + + oxo + IUPAC + + + + + + =O + IUPAC + + + + + + + + + mineral + + + + + + + + + 0 + CHO2 + 45.01744 + 44.99765 + *C(=O)O + CHEBI:23025 + CHEBI:41420 + PDBeChem:FMT + CARBOXY GROUP + carboxy + chebi_ontology + -C(O)OH + -CO2H + -COOH + carboxyl group + CHEBI:46883 + + carboxy group + + + + + CARBOXY GROUP + PDBeChem + + + + + carboxy + IUPAC + + + + + + -C(O)OH + IUPAC + + + + + -CO2H + ChEBI + + + + + -COOH + IUPAC + + + + + carboxyl group + ChEBI + + + + + + + + + + 0 + Ar + InChI=1S/Ar + XKRFYHLGVUSROY-UHFFFAOYSA-N + 39.94800 + 39.96238 + [Ar] + CHEBI:33311 + CAS:7440-37-1 + WebElements:Ar + argon + chebi_ontology + 18Ar + Ar + argon + CHEBI:49475 + + argon atom + + + + + CAS:7440-37-1 + ChemIDplus + + + + + argon + IUPAC + + + + + + 18Ar + IUPAC + + + + + Ar + IUPAC + + + + + argon + ChEBI + + + + + + + + + A metallic element predicted as eka-aluminium by Mendeleev in 1870 and discovered by Paul-Emile Lecoq de Boisbaudran in 1875. Named in honour of France (Latin Gallia) and perhaps also from the Latin gallus cock, a translation of Lecoq. + 0 + Ga + InChI=1S/Ga + GYHNNYVSQQEPJS-UHFFFAOYSA-N + 69.72300 + 68.92557 + [Ga] + CHEBI:33326 + CHEBI:49630 + CAS:7440-55-3 + WebElements:Ga + gallium + chebi_ontology + 31Ga + Ga + galio + gallium + CHEBI:49631 + + gallium atom + + + + + CAS:7440-55-3 + ChemIDplus + + + + + CAS:7440-55-3 + NIST Chemistry WebBook + + + + + gallium + IUPAC + + + + + + 31Ga + IUPAC + + + + + Ga + IUPAC + + + + + galio + ChEBI + + + + + gallium + ChEBI + + + + + + + + + + + + + + + + + 0 + H + InChI=1S/H + YZCKVEUIGOORGS-UHFFFAOYSA-N + 1.00794 + 1.00783 + [H] + CHEBI:24634 + CHEBI:49636 + WebElements:H + hydrogen + chebi_ontology + 1H + H + Wasserstoff + hidrogeno + hydrogen + hydrogene + CHEBI:49637 + + hydrogen atom + + + + + hydrogen + IUPAC + + + + + + 1H + IUPAC + + + + + H + IUPAC + + + + + Wasserstoff + ChEBI + + + + + hidrogeno + ChEBI + + + + + hydrogen + ChEBI + + + + + hydrogene + ChEBI + + + + + + + + + + 0 + Ho + InChI=1S/Ho + KJZYNXUDTRRSPN-UHFFFAOYSA-N + 164.93032 + 164.93033 + [Ho] + CHEBI:33378 + CHEBI:49647 + CAS:7440-60-0 + Gmelin:16291 + WebElements:Ho + holmium + chebi_ontology + 67Ho + Ho + holmio + holmium + CHEBI:49648 + + holmium atom + + + + + CAS:7440-60-0 + ChemIDplus + + + + + CAS:7440-60-0 + NIST Chemistry WebBook + + + + + Gmelin:16291 + Gmelin + + + + + holmium + IUPAC + + + + + + 67Ho + IUPAC + + + + + Ho + IUPAC + + + + + holmio + ChEBI + + + + + holmium + ChEBI + + + + + + + + + + 0 + Ir + InChI=1S/Ir + GKOZUEZYRPOHIO-UHFFFAOYSA-N + 192.21700 + 192.96292 + [Ir] + CHEBI:33360 + CHEBI:49665 + CAS:7439-88-5 + WebElements:Ir + iridium + chebi_ontology + 77Ir + Ir + iridio + iridium + CHEBI:49666 + + iridium atom + + + + + CAS:7439-88-5 + ChemIDplus + + + + + CAS:7439-88-5 + NIST Chemistry WebBook + + + + + iridium + IUPAC + + + + + + 77Ir + IUPAC + + + + + Ir + IUPAC + + + + + iridio + ChEBI + + + + + iridium + ChEBI + + + + + + + + + + 0 + Kr + InChI=1S/Kr + DNNSSWSSYDEUBZ-UHFFFAOYSA-N + 83.80000 + 83.91150 + [Kr] + CHEBI:33312 + CAS:7439-90-9 + WebElements:Kr + krypton + chebi_ontology + 36Kr + Kr + cripton + kripton + krypton + CHEBI:49696 + + krypton atom + + + + + CAS:7439-90-9 + ChemIDplus + + + + + CAS:7439-90-9 + NIST Chemistry WebBook + + + + + krypton + IUPAC + + + + + + 36Kr + IUPAC + + + + + Kr + IUPAC + + + + + cripton + ChEBI + + + + + kripton + ChEBI + + + + + krypton + ChEBI + + + + + + + + + + 0 + Pr + InChI=1S/Pr + PUDIUYLPXJFUGB-UHFFFAOYSA-N + 140.90765 + 140.90766 + [Pr] + CHEBI:33370 + CHEBI:49827 + CAS:7440-10-0 + WebElements:Pr + praseodymium + chebi_ontology + 59Pr + Pr + Praseodym + praseodimio + praseodyme + praseodymium + CHEBI:49828 + + praseodymium atom + + + + + CAS:7440-10-0 + ChemIDplus + + + + + CAS:7440-10-0 + NIST Chemistry WebBook + + + - oxo + praseodymium IUPAC - + - =O + 59Pr IUPAC + + + + Pr + IUPAC + + + + + Praseodym + ChEBI + + + + + praseodimio + ChEBI + + + + + praseodyme + ChEBI + + + + + praseodymium + ChEBI + - - - - - mineral - - - - - + - - + + 0 - CHO2 - 45.01744 - 44.99765 - *C(=O)O - CHEBI:23025 - CHEBI:41420 - PDBeChem:FMT - CARBOXY GROUP - carboxy + Re + InChI=1S/Re + WUAPFZMCVAUBPE-UHFFFAOYSA-N + 186.20700 + 186.95575 + [Re] + CHEBI:33354 + CHEBI:49879 + CAS:7440-15-5 + WebElements:Re + rhenium chebi_ontology - -C(O)OH - -CO2H - -COOH - carboxyl group - CHEBI:46883 + 75Re + Re + Rhenium + renio + rhenium + CHEBI:49882 - carboxy group + rhenium atom - - - CARBOXY GROUP - PDBeChem + + + CAS:7440-15-5 + ChemIDplus - + + + CAS:7440-15-5 + NIST Chemistry WebBook + + + - carboxy + rhenium IUPAC - + - -C(O)OH + 75Re IUPAC - + - -CO2H + Re ChEBI - + - -COOH - IUPAC + Rhenium + ChEBI - + - carboxyl group + renio + ChEBI + + + + + rhenium ChEBI - + - - - - - - - - - - + + + 0 - H - InChI=1S/H - YZCKVEUIGOORGS-UHFFFAOYSA-N - 1.00794 - 1.00783 - [H] - CHEBI:24634 - CHEBI:49636 - WebElements:H - hydrogen + Xe + InChI=1S/Xe + FHNFHKCVQCLJFQ-UHFFFAOYSA-N + 131.29000 + 131.90416 + [Xe] + CHEBI:32305 + CAS:7440-63-3 + Gmelin:16318 + KEGG:C13373 + WebElements:Xe + xenon chebi_ontology - 1H - H - Wasserstoff - hidrogeno - hydrogen - hydrogene - CHEBI:49637 + 54Xe + Xe + Xenon + xenon + CHEBI:49957 - hydrogen atom + xenon atom - + + + CAS:7440-63-3 + ChemIDplus + + + + + CAS:7440-63-3 + KEGG COMPOUND + + + + + CAS:7440-63-3 + NIST Chemistry WebBook + + + + + Gmelin:16318 + Gmelin + + + - hydrogen + xenon IUPAC - + - 1H + 54Xe IUPAC - + - H + Xe IUPAC - - - Wasserstoff - ChEBI - - - + - hidrogeno + Xenon ChEBI - + - hydrogen - ChEBI + Xenon + KEGG_COMPOUND - + - hydrogene + xenon ChEBI @@ -17117,6 +33980,69 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + A synthetic radioactive isotope of chromium having a half-life of 27.7 days and decaying by electron capture with emission of gamma rays (0.32 MeV); it is used to label red blood cells for measurement of mass or volume, survival time, and sequestration studies, for the diagnosis of gastrointestinal bleeding, and to label platelets to study their survival. + 0 + [51Cr] + InChI=1S/Cr/i1-1 + VYZAMTAEIAYCRO-BJUDXGSMSA-N + 50.945 + 50.94477 + [51Cr] + CAS:14392-02-0 + chromium-51 + chebi_ontology + (51)24Cr + (51)Cr + 51Cr + Chromium, isotope of mass 51 + CHEBI:50076 + + chromium-51 + + + + + CAS:14392-02-0 + ChemIDplus + + + + + chromium-51 + IUPAC + + + + + + (51)24Cr + IUPAC + + + + + (51)Cr + IUPAC + + + + + 51Cr + ChemIDplus + + + + + Chromium, isotope of mass 51 + ChemIDplus + + + + @@ -17131,7 +34057,7 @@ For example, A and B may be gene products and binding of B by A positively regul canonical nucleotide residues - ChEBI + ChEBI @@ -17150,7 +34076,7 @@ For example, A and B may be gene products and binding of B by A positively regul canonical ribonucleotide residues - ChEBI + ChEBI @@ -17223,7 +34149,7 @@ For example, A and B may be gene products and binding of B by A positively regul nucleotide residues - ChEBI + ChEBI @@ -17242,7 +34168,7 @@ For example, A and B may be gene products and binding of B by A positively regul nucleoside residues - ChEBI + ChEBI @@ -17570,6 +34496,1029 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + The stable isotope of tin with relative atomic mass 118.903311, 8.59 atom percent natural abundance and nuclear spin (1)/2. + 0 + [119Sn] + InChI=1S/Sn/i1+0 + ATJFFYVFTNAWJD-IGMARMGPSA-N + 118.903 + 118.90331 + [119Sn] + tin-119 + chebi_ontology + (119)50Sn + (119)Sn + tin-119 + CHEBI:52230 + + tin-119 atom + + + + + tin-119 + IUPAC + + + + + + (119)50Sn + IUPAC + + + + + (119)Sn + IUPAC + + + + + tin-119 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 119.902199 and 32.58 atom percent natural abundance. + 0 + [120Sn] + InChI=1S/Sn/i1+1 + ATJFFYVFTNAWJD-OUBTZVSYSA-N + 119.902 + 119.90220 + [120Sn] + tin-120 + chebi_ontology + (120)50Sn + (120)Sn + tin-120 + CHEBI:52231 + + tin-120 atom + + + + + tin-120 + IUPAC + + + + + + (120)50Sn + IUPAC + + + + + (120)Sn + IUPAC + + + + + tin-120 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 117.901609 and 24.22 atom percent natural abundance. + 0 + [118Sn] + InChI=1S/Sn/i1-1 + ATJFFYVFTNAWJD-BJUDXGSMSA-N + 117.902 + 117.90161 + [118Sn] + tin-118 + chebi_ontology + (118)50Sn + (118)Sn + tin-118 + CHEBI:52232 + + tin-118 atom + + + + + tin-118 + IUPAC + + + + + + (118)50Sn + IUPAC + + + + + (118)Sn + IUPAC + + + + + tin-118 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 115.901747 and 14.54 atom percent natural abundance. + 0 + [116Sn] + InChI=1S/Sn/i1-3 + ATJFFYVFTNAWJD-OIOBTWANSA-N + 115.902 + 115.90174 + [116Sn] + tin-116 + chebi_ontology + (116)50Sn + (116)Sn + tin-116 + CHEBI:52233 + + tin-116 atom + + + + + tin-116 + IUPAC + + + + + + (116)50Sn + IUPAC + + + + + (116)Sn + IUPAC + + + + + tin-116 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 116.902956, 7.68 atom percent natural abundance and nuclear spin (1)/2. + 0 + [117Sn] + InChI=1S/Sn/i1-2 + ATJFFYVFTNAWJD-YPZZEJLDSA-N + 116.903 + 116.90295 + [117Sn] + tin-117 + chebi_ontology + (117)50Sn + (117)Sn + tin-117 + CHEBI:52234 + + tin-117 atom + + + + + tin-117 + IUPAC + + + + + + (117)50Sn + IUPAC + + + + + (117)Sn + IUPAC + + + + + tin-117 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 114.903348, 0.34 atom percent natural abundance and nuclear spin (1)/2. + 0 + [115Sn] + InChI=1S/Sn/i1-4 + ATJFFYVFTNAWJD-AHCXROLUSA-N + 114.903 + 114.90334 + [115Sn] + tin-115 + chebi_ontology + (115)50Sn + (115)Sn + tin-115 + CHEBI:52235 + + tin-115 atom + + + + + tin-115 + IUPAC + + + + + + (115)50Sn + IUPAC + + + + + (115)Sn + IUPAC + + + + + tin-115 + ChEBI + + + + + + + + + The stable isotope of boron with relative atomic mass 11.009306, 80.1 atom percent natural abundance and nuclear spin 3/2. + 0 + [11B] + InChI=1S/B/i1+0 + ZOXJGFHDIHLPTG-IGMARMGPSA-N + 11.009 + 11.00930 + [11B] + boron-11 + chebi_ontology + (11)5B + (11)B + CHEBI:52451 + + boron-11 atom + + + + + boron-11 + IUPAC + + + + + + (11)5B + IUPAC + + + + + (11)B + IUPAC + + + + + + + + + The stable isotope of tellurium with relative atomic mass 124.904425, 71.4 atom percent natural abundance and nuclear spin 1/2. + 0 + [125Te] + InChI=1S/Te/i1-3 + PORWMNRCUJJQNO-OIOBTWANSA-N + 124.904 + 124.90443 + [125Te] + tellurium-125 + chebi_ontology + (125)52Te + (125)Te + tellurium-125 + CHEBI:52452 + + tellurium-125 atom + + + + + tellurium-125 + IUPAC + + + + + + (125)52Te + IUPAC + + + + + (125)Te + IUPAC + + + + + tellurium-125 + ChEBI + + + + + + + + + The stable isotope of xenon with relative atomic mass 128.904780, 26.4 atom percent natural abundance and nuclear spin 1/2. + 0 + [129Xe] + InChI=1S/Xe/i1-2 + FHNFHKCVQCLJFQ-YPZZEJLDSA-N + 128.905 + 128.90478 + [129Xe] + xenon-129 + chebi_ontology + (129)54Xe + (129)Xe + xenon-129 + CHEBI:52453 + + xenon-129 atom + + + + + xenon-129 + IUPAC + + + + + + (129)54Xe + IUPAC + + + + + (129)Xe + IUPAC + + + + + xenon-129 + ChEBI + + + + + + + + + A stable isotope of selenium with relative atomic mass 76.919915, 7.60 atom percent natural abundance and nuclear spin 1/2. + 0 + [77Se] + InChI=1S/Se/i1-2 + BUGBHKTXTAQXES-YPZZEJLDSA-N + 76.920 + 76.91991 + [77Se] + Chemspider:9507361 + PMID:16158304 + PMID:23159557 + PMID:25848959 + PMID:25923042 + PMID:27129100 + PMID:30828921 + PMID:32453871 + PMID:34153173 + ((77)Se)selenium + chebi_ontology + (77)34Se + (77)Se + Se-77 + selenium, isotope of mass 77 + selenium-(77)Se + selenium-77 + CHEBI:52457 + + selenium-77 atom + + + + + PMID:16158304 + Europe PMC + + + + + PMID:23159557 + Europe PMC + + + + + PMID:25848959 + Europe PMC + + + + + PMID:25923042 + Europe PMC + + + + + PMID:27129100 + Europe PMC + + + + + PMID:30828921 + Europe PMC + + + + + PMID:32453871 + Europe PMC + + + + + PMID:34153173 + Europe PMC + + + + + ((77)Se)selenium + IUPAC + + + + + + (77)34Se + IUPAC + + + + + (77)Se + IUPAC + + + + + Se-77 + ChEBI + + + + + selenium, isotope of mass 77 + ChEBI + + + + + selenium-(77)Se + ChEBI + + + + + selenium-77 + ChEBI + + + + + + + + + The stable isotope of lithium with relative atomic mass 7.016004, 92.5 atom percent natural abundance and nuclear spin 3/2. + 0 + [7Li] + InChI=1S/Li/i1+0 + WHXSMMKQMYFTQS-IGMARMGPSA-N + 7.016 + 7.01600 + [7Li] + lithium-7 + chebi_ontology + (7)3Li + (7)Li + lithium-7 + CHEBI:52458 + + lithium-7 atom + + + + + lithium-7 + IUPAC + + + + + + (7)3Li + IUPAC + + + + + (7)Li + IUPAC + + + + + lithium-7 + ChEBI + + + + + + + + + The stable isotope of rubidium with relative atomic mass 86.909184, 27.9 atom percent natural abundance and nuclear spin 3/2. + 0 + [87Rb] + InChI=1S/Rb/i1+2 + IGLNJRXAVVLDKE-NJFSPNSNSA-N + 86.909 + 86.90918 + [87Rb] + rubidium-87 + chebi_ontology + (87)37Rb + (87)Rb + rubidium-87 + CHEBI:52459 + + rubidium-87 atom + + + + + rubidium-87 + IUPAC + + + + + + (87)37Rb + IUPAC + + + + + (87)Rb + IUPAC + + + + + rubidium-87 + ChEBI + + + + + + + + + The stable isotope of niobium with relative atomic mass 92.906378, 100 atom percent natural abundance and nuclear spin 9/2. + 0 + [93Nb] + InChI=1S/Nb/i1+0 + GUCVJGMIXFAOAE-IGMARMGPSA-N + 92.906 + 92.90637 + [93Nb] + niobium-93 + chebi_ontology + (93)41Nb + (93)Nb + niobium-93 + CHEBI:52460 + + niobium-93 atom + + + + + niobium-93 + IUPAC + + + + + + (93)41Nb + IUPAC + + + + + (93)Nb + IUPAC + + + + + niobium-93 + ChEBI + + + + + + + + + The stable isotope of niobium with relative atomic mass 182.950225, 14.3 atom percent natural abundance and nuclear spin 1/2. + 0 + [183W] + InChI=1S/W/i1-1 + WFKWXMTUELFFGS-BJUDXGSMSA-N + 182.950 + 182.95022 + [183W] + tungsten-183 + chebi_ontology + (183)74W + (183)W + CHEBI:52462 + + tungsten-183 + + + + + tungsten-183 + IUPAC + + + + + + (183)74W + IUPAC + + + + + (183)W + IUPAC + + + + + + + + + The stable isotope of cadmium with relative atomic mass 110.904182, 12.8 atom percent natural abundance and nuclear spin 1/2. + 0 + [111Cd] + InChI=1S/Cd/i1-1 + BDOSMKKIYDKNTQ-BJUDXGSMSA-N + 110.904 + 110.90418 + [111Cd] + cadmium-111 + chebi_ontology + (111)48Cd + (111)Cd + CHEBI:52619 + + cadmium-111 + + + + + cadmium-111 + IUPAC + + + + + + (111)48Cd + IUPAC + + + + + (111)Cd + IUPAC + + + + + + + + + The isotope of cadmium with relative atomic mass 112.904401, 12.2 atom percent natural abundance and nuclear spin 1/2. + 0 + [113Cd] + InChI=1S/Cd/i1+1 + BDOSMKKIYDKNTQ-OUBTZVSYSA-N + 112.904 + 112.90441 + [113Cd] + cadmium-113 + chebi_ontology + (113)48Cd + (113)Cd + CHEBI:52620 + + cadmium-113 + + + + + cadmium-113 + IUPAC + + + + + + (113)48Cd + IUPAC + + + + + (113)Cd + IUPAC + + + + + + + + + The stable isotope of lithium with relative atomic mass 6.015122, 7.5 atom percent natural abundance and nuclear spin 1. + 0 + [6Li] + InChI=1S/Li/i1-1 + WHXSMMKQMYFTQS-BJUDXGSMSA-N + 6.015 + 6.01512 + [6Li] + lithium-6 + chebi_ontology + (6)3Li + (6)Li + lithium-6 + CHEBI:52621 + + lithium-6 atom + + + + + lithium-6 + IUPAC + + + + + + (6)3Li + IUPAC + + + + + (6)Li + IUPAC + + + + + lithium-6 + ChEBI + + + + + + + + + The stable isotope of yttrium with relative atomic mass 88.905848, 100 atom percent natural abundance and nuclear spin 1/2. + 0 + [89Y] + InChI=1S/Y/i1+0 + VWQVUPCCIRVNHF-IGMARMGPSA-N + 88.906 + 88.90584 + [89Y] + yttrium-89 + chebi_ontology + (89)39Y + (89)Y + yttrium-89 + CHEBI:52622 + + yttrium-89 atom + + + + + yttrium-89 + IUPAC + + + + + + (89)39Y + IUPAC + + + + + (89)Y + IUPAC + + + + + yttrium-89 + ChEBI + + + + + + + + + The stable isotope of iron with relative atomic mass 56.935399, 2.1 atom percent natural abundance and nuclear spin 1/2. + 0 + [57Fe] + InChI=1S/Fe/i1+1 + XEEYBQQBJWHFJM-OUBTZVSYSA-N + 56.935 + 56.93539 + [57Fe] + iron-57 + chebi_ontology + (57)26Fe + (57)Fe + CHEBI:52623 + + iron-57 atom + + + + + iron-57 + IUPAC + + + + + + (57)26Fe + IUPAC + + + + + (57)Fe + IUPAC + + + + + + + + + The stable isotope of antimony with relative atomic mass 120.903818, 57.2 atom percent natural abundance and nuclear spin 5/2. + 0 + [121Sb] + InChI=1S/Sb/i1-1 + WATWJIUSRGPENY-BJUDXGSMSA-N + 120.904 + 120.90381 + [121Sb] + antimony-121 + chebi_ontology + (121)51Sb + (121)Sb + antimony-121 + CHEBI:52624 + + antimony-121 atom + + + + + antimony-121 + IUPAC + + + + + + (121)51Sb + IUPAC + + + + + (121)Sb + IUPAC + + + + + antimony-121 + ChEBI + + + + @@ -17580,6 +35529,584 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + The stable isotope of antimony with relative atomic mass 122.904216, 42.8 atom percent natural abundance and nuclear spin 7/2. + 0 + [123Sb] + InChI=1S/Sb/i1+1 + WATWJIUSRGPENY-OUBTZVSYSA-N + 122.904 + 122.90421 + [123Sb] + antimony-123 + chebi_ontology + (123)51Sb + (123)Sb + antimony-123 + CHEBI:52626 + + antimony-123 atom + + + + + antimony-123 + IUPAC + + + + + + (123)51Sb + IUPAC + + + + + (123)Sb + IUPAC + + + + + antimony-123 + ChEBI + + + + + + + + + The stable isotope of lanthanum with relative atomic mass 138.906348, 99.9 atom percent natural abundance and nuclear spin 7/2. + 0 + [139La] + InChI=1S/La/i1+0 + FZLIPJUXYLNCLC-IGMARMGPSA-N + 138.906 + 138.90636 + [139La] + lanthanum-139 + chebi_ontology + (139)57La + (139)La + lanthanum-139 + CHEBI:52627 + + lanthanum-139 atom + + + + + lanthanum-139 + IUPAC + + + + + + (139)57La + IUPAC + + + + + (139)La + IUPAC + + + + + lanthanum-139 + ChEBI + + + + + + + + + The stable isotope of iodine with relative atomic mass 126.904468, 100 atom percent natural abundance and nuclear spin 5/2. + 0 + [127I] + InChI=1S/I/i1+0 + ZCYVEMRRCGMTRW-IGMARMGPSA-N + 126.904 + 126.90447 + [127I] + iodine-127 + chebi_ontology + (127)53I + (127)I + iodine-127 + CHEBI:52631 + + iodine-127 atom + + + + + iodine-127 + IUPAC + + + + + + (127)53I + IUPAC + + + + + (127)I + IUPAC + + + + + iodine-127 + ChEBI + + + + + + + + + The stable isotope of potassium with relative atomic mass 38.963707, 93.3 atom percent natural abundance and nuclear spin 3/2. + 0 + [39K] + InChI=1S/K/i1+0 + ZLMJMSJWJFRBEC-IGMARMGPSA-N + 38.964 + 38.96371 + [39K] + potassium-39 + chebi_ontology + (39)19K + (39)K + potassium-39 + CHEBI:52632 + + potassium-39 atom + + + + + potassium-39 + IUPAC + + + + + + (39)19K + IUPAC + + + + + (39)K + IUPAC + + + + + potassium-39 + ChEBI + + + + + + + + + The stable isotope of molybdenum with relative atomic mass 94.905842, 15.9 atom percent natural abundance and nuclear spin 5/2. + 0 + [95Mo] + InChI=1S/Mo/i1-1 + ZOKXTWBITQBERF-BJUDXGSMSA-N + 94.906 + 94.90584 + [95Mo] + molybdenum-95 + chebi_ontology + (95)42Mo + (95)Mo + CHEBI:52633 + + molybdenum-95 + + + + + molybdenum-95 + IUPAC + + + + + + (95)42Mo + IUPAC + + + + + (95)Mo + IUPAC + + + + + + + + + The stable isotope of sodium with relative atomic mass 22.989770, 100 atom percent natural abundance and nuclear spin 3/2. + 0 + [23Na] + InChI=1S/Na/i1+0 + KEAYESYHFKHZAL-IGMARMGPSA-N + 22.990 + 22.98977 + [23Na] + sodium-23 + chebi_ontology + (23)11Na + (23)Na + sodium-23 + CHEBI:52634 + + sodium-23 atom + + + + + sodium-23 + IUPAC + + + + + + (23)11Na + IUPAC + + + + + (23)Na + IUPAC + + + + + sodium-23 + ChEBI + + + + + + + + + The stable isotope of scandium with relative atomic mass 44.955910, 100 atom percent natural abundance and nuclear spin 7/2. + 0 + [45Sc] + InChI=1S/Sc/i1+0 + SIXSYDAISGFNSX-IGMARMGPSA-N + 44.956 + 44.95591 + [45Sc] + scandium-45 + chebi_ontology + (45)21Sc + (45)Sc + scandium-45 + CHEBI:52635 + + scandium-45 atom + + + + + scandium-45 + IUPAC + + + + + + (45)21Sc + IUPAC + + + + + (45)Sc + IUPAC + + + + + scandium-45 + ChEBI + + + + + + + + + The isotope of iodine with relative atomic mass 128.904988, and nuclear spin 7/2. + 0 + [129I] + InChI=1S/I/i1+2 + ZCYVEMRRCGMTRW-NJFSPNSNSA-N + 128.905 + 128.90499 + [129I] + iodine-129 + chebi_ontology + (129)53I + (129)I + iodine-129 + CHEBI:52636 + + iodine-129 atom + + + + + iodine-129 + IUPAC + + + + + + (129)53I + IUPAC + + + + + (129)I + IUPAC + + + + + iodine-129 + ChEBI + + + + + + + + + The stable isotope of europium with relative atomic mass 150.919846, 47.8 atom percent natural abundance and nuclear spin 5/2. + 0 + [151Eu] + InChI=1S/Eu/i1-1 + OGPBJKLSAFTDLK-BJUDXGSMSA-N + 150.920 + 150.91986 + [151Eu] + europium-151 + chebi_ontology + (151)63Eu + (151)Eu + europium-151 + CHEBI:52637 + + europium-151 atom + + + + + europium-151 + IUPAC + + + + + + (151)63Eu + IUPAC + + + + + (151)Eu + IUPAC + + + + + europium-151 + ChEBI + + + + + + + + + The stable isotope of bromine with relative atomic mass 78.918338, 50.69 atom percent natural abundance and nuclear spin 3/2. + 0 + [79Br] + InChI=1S/Br/i1-1 + WKBOTKDWSSQWDR-BJUDXGSMSA-N + 78.918 + 78.91834 + [79Br] + chebi_ontology + (79)35Br + (79)Br + bromine-79 + CHEBI:52743 + + bromine-79 atom + + + + + (79)35Br + IUPAC + + + + + (79)Br + IUPAC + + + + + bromine-79 + ChEBI + + + + + + + + + The stable isotope of germanium with relative atomic mass 72.923459, 7.73 atom percent natural abundance and nuclear spin 9/2. + 0 + [73Ge] + InChI=1S/Ge/i1+0 + GNPVGFCGXDBREM-IGMARMGPSA-N + 72.923 + 72.92346 + [73Ge] + chebi_ontology + (73)32Ge + (73)Ge + germanium-73 + CHEBI:52758 + + germanium-73 atom + + + + + (73)32Ge + IUPAC + + + + + (73)Ge + IUPAC + + + + + germanium-73 + ChEBI + + + + + + + + + The stable isotope of magnesium with relative atomic mass 24.985837, 10.0 atom percent natural abundance and nuclear spin 5/2. + 0 + [25Mg] + InChI=1S/Mg/i1+1 + FYYHWMGAXLPEAU-OUBTZVSYSA-N + 24.986 + 24.98584 + [25Mg] + chebi_ontology + (25)12Mg + (25)Mg + magnesium-25 + CHEBI:52763 + + magnesium-25 atom + + + + + (25)12Mg + IUPAC + + + + + (25)Mg + IUPAC + + + + + magnesium-25 + ChEBI + + + + + + + + + Any metal that is characterized by its rather high atomic mass and density. Although typically occurring in low concentrations, they can be found all throughout the Earth's crust (Commonly, a density of at least 5 g cm(3) is used to define a heavy metal and to differentiate it from other, ''light'' metals). + Wikipedia:Heavy_metals + chebi_ontology + heavy metals + CHEBI:5631 + + heavy metal + + + + + heavy metals + ChEBI + + + + @@ -17605,25 +36132,25 @@ For example, A and B may be gene products and binding of B by A positively regul compuesto heterociclico - IUPAC + IUPAC compuestos heterociclicos - IUPAC + IUPAC heterocycle - ChEBI + ChEBI heterocyclic compounds - ChEBI + ChEBI @@ -17676,17 +36203,17 @@ For example, A and B may be gene products and binding of B by A positively regul - An atom or small molecule with a positive charge that does not contain carbon in covalent linkage, with a valency of one. - chebi_ontology - a monovalent cation - CHEBI:60242 + An atom or small molecule with a positive charge that does not contain carbon in covalent linkage, with a valency of one. + chebi_ontology + a monovalent cation + CHEBI:60242 - monovalent inorganic cation + monovalent inorganic cation - a monovalent cation + a monovalent cation UniProt @@ -17757,13 +36284,13 @@ For example, A and B may be gene products and binding of B by A positively regul nucleobase-containing compounds - ChEBI + ChEBI nucleobase-containing molecular entities - ChEBI + ChEBI @@ -18420,6 +36947,41 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + A stable isotope of boron with relative atomic mass 10.0129370, 19.9 atom percent natural abundance and nuclear spin 3+. + 0 + [10B] + InChI=1S/B/i1-1 + ZOXJGFHDIHLPTG-BJUDXGSMSA-N + 10.013 + 10.01294 + [10B] + boron-10 + chebi_ontology + (10)B + CHEBI:77014 + + boron-10 atom + + + + + boron-10 + IUPAC + + + + + + (10)B + SUBMITTER + + + + @@ -18727,18 +37289,18 @@ For example, A and B may be gene products and binding of B by A positively regul - Any inorganic anion with a valency of two. - chebi_ontology - divalent inorganic anions - CHEBI:79388 + Any inorganic anion with a valency of two. + chebi_ontology + divalent inorganic anions + CHEBI:79388 - divalent inorganic anion + divalent inorganic anion - divalent inorganic anions - ChEBI + divalent inorganic anions + ChEBI @@ -18747,17 +37309,198 @@ For example, A and B may be gene products and binding of B by A positively regul - Any inorganic anion with a valency of one. - chebi_ontology - monovalent inorganic anions - CHEBI:79389 + Any inorganic anion with a valency of one. + chebi_ontology + monovalent inorganic anions + CHEBI:79389 - monovalent inorganic anion + monovalent inorganic anion - monovalent inorganic anions + monovalent inorganic anions + ChEBI + + + + + + + + + A zinc atom in which the nucleus contains 35 neutrons. It has a half-life of 244 days, decaying by emission of a positron (beta(+) decay), and is the most abundant and stable of the 25 known radioisotopes of zinc. + 0 + [65Zn] + InChI=1S/Zn/i1+0 + HCHKCACWOHOZIP-IGMARMGPSA-N + 64.929 + 64.92925 + [65Zn] + CAS:13982-39-3 + PMID:11431342 + PMID:13615323 + PMID:13694484 + PMID:13734409 + PMID:13744376 + PMID:13783426 + PMID:13841044 + PMID:14425466 + PMID:1682403 + PMID:17807441 + PMID:19448268 + ((65)Zn)zinc + chebi_ontology + (65)30Zn + (65)Zn + Zn-65 + zinc, isotope of mass 65 + zinc-65 + CHEBI:82623 + + zinc-65 atom + + + + + CAS:13982-39-3 + ChemIDplus + + + + + PMID:11431342 + Europe PMC + + + + + PMID:13615323 + Europe PMC + + + + + PMID:13694484 + Europe PMC + + + + + PMID:13734409 + Europe PMC + + + + + PMID:13744376 + Europe PMC + + + + + PMID:13783426 + Europe PMC + + + + + PMID:13841044 + Europe PMC + + + + + PMID:14425466 + Europe PMC + + + + + PMID:1682403 + Europe PMC + + + + + PMID:17807441 + Europe PMC + + + + + PMID:19448268 + Europe PMC + + + + + ((65)Zn)zinc + IUPAC + + + + + + (65)30Zn + IUPAC + + + + + (65)Zn + IUPAC + + + + + Zn-65 + ChEBI + + + + + zinc, isotope of mass 65 + ChemIDplus + + + + + zinc-65 + ChemIDplus + + + + + + + + + Any metal which causes the onset of an allergic reaction. + chebi_ontology + allergenic metal + allergenic metals + metal allergens + CHEBI:88184 + + metal allergen + + + + + allergenic metal + ChEBI + + + + + allergenic metals + ChEBI + + + + + metal allergens ChEBI @@ -45781,7 +64524,7 @@ consider revising 'pond' semantics Any process involved in the development or functioning of the immune system, an organismal system for calibrated responses to potential internal or invasive threats. - GOC:add + GOC:add GO_REF:0000022 @@ -45822,7 +64565,7 @@ consider revising 'pond' semantics The process whose specific outcome is the progression of an organismal system whose objective is to provide calibrated responses by an organism to a potential internal or invasive threat, over time, from its formation to the mature structure. A system is a regularly interacting or interdependent group of organs or tissues that work together to carry out a given biological process. - GOC:add + GOC:add GOC:dph @@ -45858,7 +64601,7 @@ consider revising 'pond' semantics Any process that modulates the frequency, rate, or extent of an immune system process. - GOC:add + GOC:add @@ -45898,7 +64641,7 @@ consider revising 'pond' semantics Any process that stops, prevents, or reduces the frequency, rate, or extent of an immune system process. - GOC:add + GOC:add @@ -45939,7 +64682,7 @@ consider revising 'pond' semantics Any process that activates or increases the frequency, rate, or extent of an immune system process. - GOC:add + GOC:add @@ -45958,7 +64701,7 @@ consider revising 'pond' semantics The controlled release of a peptide from a cell or a tissue. - GOC:add + GOC:add @@ -45994,7 +64737,7 @@ consider revising 'pond' semantics Any process that modulates the frequency, rate, or extent of peptide secretion. - GOC:add + GOC:add @@ -46034,7 +64777,7 @@ consider revising 'pond' semantics Any process that stops, prevents, or reduces the frequency, rate, or extent of peptide secretion. - GOC:add + GOC:add @@ -46075,7 +64818,7 @@ consider revising 'pond' semantics Any process that activates or increases the frequency, rate, or extent of peptide secretion. - GOC:add + GOC:add @@ -48420,7 +67163,7 @@ Note that, in addition to forming the root of the cellular component ontology, t Any immune system process that functions in the calibrated response of an organism to a potential internal or invasive threat. - GOC:add + GOC:add GO_REF:0000022 @@ -50355,7 +69098,7 @@ Note that, in addition to forming the root of the cellular component ontology, t The process whose specific outcome is the progression of a tissue over time, from its formation to the mature structure. - ISBN:0471245208 + ISBN:0471245208 @@ -61176,7 +79919,7 @@ Any process that is carried out at the cellular level, occurring within a single The process whose specific outcome is the progression of any organ involved in hematopoiesis (also known as hemopoiesis) or lymphoid cell activation over time, from its formation to the mature structure. Such development includes differentiation of resident cell types (stromal cells) and of migratory cell types dependent on the unique microenvironment afforded by the organ for their proper differentiation. - GOC:add + GOC:add GOC:rl ISBN:0781735149 @@ -63864,7 +82607,7 @@ Note that this term is in the subset of terms that should not be used for direct The series of events in which a stimulus is received by a cell or organism and converted into a molecular signal. - GOC:add + GOC:add GOC:ai GOC:dph GOC:mah @@ -65839,7 +84582,7 @@ Note that this term is in the subset of terms that should not be used for direct The regulated release of mucus by the mucosa. Mucus is a viscous slimy secretion consisting of mucins and various inorganic salts dissolved in water, with suspended epithelial cells and leukocytes. The mucosa, or mucous membrane, is the membrane covered with epithelium that lines the tubular organs of the body. Mucins are carbohydrate-rich glycoproteins that have a lubricating and protective function. - GOC:add + GOC:add ISBN:068340007X ISBN:0721662544 @@ -65847,7 +84590,7 @@ Note that this term is in the subset of terms that should not be used for direct mucus production - GOC:add + GOC:add @@ -65885,13 +84628,13 @@ Note that this term is in the subset of terms that should not be used for direct Any process that modulates the frequency, rate or extent of the regulated release of mucus from a cell or a tissue. - GOC:add + GOC:add regulation of mucus production - GOC:add + GOC:add @@ -65929,13 +84672,13 @@ Note that this term is in the subset of terms that should not be used for direct Any process that stops, prevents, or reduces the frequency, rate or extent of the regulated release of mucus from a cell or a tissue. - GOC:add + GOC:add negative regulation of mucus production - GOC:add + GOC:add @@ -65973,13 +84716,13 @@ Note that this term is in the subset of terms that should not be used for direct Any process that activates or increases the frequency, rate or extent of the regulated release of mucus from a cell or a tissue. - GOC:add + GOC:add positive regulation of mucus production - GOC:add + GOC:add @@ -72964,14 +91707,6 @@ Note that this term is in the subset of terms that should not be used for direct GO:1905844 negative regulation of cellular response to gamma radiation - - - - Any process that stops, prevents or reduces the frequency, rate or extent of cellular response to gamma radiation. - GOC:TermGenie - GO_REF:0000058 - PMID:23505386 - @@ -73056,6 +91791,14 @@ Note that this term is in the subset of terms that should not be used for direct negative regulation of cellular response to gamma-ray photon GOC:TermGenie + + + + Any process that stops, prevents or reduces the frequency, rate or extent of cellular response to gamma radiation. + GOC:TermGenie + GO_REF:0000058 + PMID:23505386 + @@ -76044,21 +94787,21 @@ clustering algorithm. GC_ID:1 ncbi_taxonomy - all + all NCBITaxon:1 root - all - + all + - all - + all + @@ -90070,11 +108813,10 @@ Classes for population already exist in IDO ('organism population', I - mixed radiation The samples were exposed to a mixed radiation field consisting of several ions at different energies. The process of exposing the same sample to more than one type and/or energy of radiation, in sequence or simultaneously. - mixed field|mixed radiation - mixed radiation field + mixed field|mixed radiation field + mixed radiation @@ -90596,6 +109338,7 @@ Classes for population already exist in IDO ('organism population', I A study of the impact of radiation on the composition of or processes within the natural or anthropogenic environment. environmental study + A owl:deprecated @@ -90940,7 +109683,7 @@ Classes for population already exist in IDO ('organism population', I - + charged particle Charged particles with kinetic energy imparted by natural or artificial means (such as by a particle accelerator) charged particle @@ -91181,10 +109924,10 @@ Classes for population already exist in IDO ('organism population', I - Unplanned exposure to naturally occurring radiation (NORM) of any type in any environment . + Exposure to naturally occurring radiation (NORM) of any type in any environment . 0000-0002-5111-7263 Environmental irradiation - Naturally occurring radiation exposure (NORM) + Exposure to naturally ocurring radioactive material @@ -91266,6 +110009,7 @@ Classes for population already exist in IDO ('organism population', I Incidental exposure to naturally occurring radiation in a natural or anthropogenic environment, such as geographical areas with high background levels of radiation or specific locations such as Uranium mines. 0000-0002-5111-7263 Unplanned naturally occurring radiation exposure + TRUE @@ -91287,7 +110031,7 @@ Classes for population already exist in IDO ('organism population', I Studies relating to human society and the interrelation of social and educational factors with individual thought and behaviour including mental illness. 0000-0002-5111-7263 - Social and psychosocial studies + Social and psychosocial study @@ -91377,7 +110121,7 @@ Classes for population already exist in IDO ('organism population', I Studies of the presence of radiation of any type in the natural or anthropogenic environment and its impact on animals, plants, and microorganisms. This includes studies measuring nuclide transfer in the environment, and interaction with meteorological phenomena. This excludes occupational exposure and the human working environment. 0000-0002-5111-7263 - Environmental studies + Environmental study @@ -91935,7 +110679,7 @@ Classes for population already exist in IDO ('organism population', I Study of radiation levels and effects in the natural environment. 0000-0002-5111-7263 - Natural environment studies + Natural environment study @@ -92166,7 +110910,7 @@ Classes for population already exist in IDO ('organism population', I Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or regulation of the nuclear industries. 0000-0002-5111-7263 - Attitudinal studies nuclear industry risk perception + Attitudinal study of nuclear industry risk perception @@ -92177,7 +110921,7 @@ Classes for population already exist in IDO ('organism population', I Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ecological integrity towards natural or anthropogenic ionising radiation in the environment. 0000-0002-5111-7263 - Attitudinal studies towards ionising radiation in the environment + Attitudinal study towards ionising radiation in the environment @@ -92188,7 +110932,7 @@ Classes for population already exist in IDO ('organism population', I Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ecological integrity towards natural or anthropogenic non-ionising radiation in the natural environment. 0000-0002-5111-7263 - Attitudinal studies towards non-ionising radiation in the environment + Attitudinal study towards non-ionising radiation in the environment @@ -92199,7 +110943,7 @@ Classes for population already exist in IDO ('organism population', I Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety and efficacy in a clinical context where radiation is used for diagnostic or therapeutic procedures.. 0000-0002-5111-7263 - Attitudinal studies towards medical radiation procedures + Attitudinal study towards medical radiation procedures @@ -92210,7 +110954,7 @@ Classes for population already exist in IDO ('organism population', I Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety towards natural or anthropogenic non-ionising radiation in the occupational environment. 0000-0002-5111-7263 - Attitudinal studies towards radiation in the occupational environment + Attitudinal study towards radiation in the occupational environment @@ -92490,7 +111234,7 @@ Classes for population already exist in IDO ('organism population', I Unplanned irradiation that is non-anthropogenic in origin - Unplanned non-anthropogenic irradiation + Unplanned naturally occurring radiation exposure @@ -92714,7 +111458,7 @@ Classes for population already exist in IDO ('organism population', I sham irradiation - A protocol in which a sample is kept under conditions identical to irradiated samples, without exposure + Sham irradiation refers to a procedure in which participants or subjects in an experiment are exposed to simulated radiation, mimicking precisely the conditions of actual irradiation. The purpose of using sham irradiation is to create a control group that experiences the non-specific effects of the experimental setup, while excluding the specific effects associated with radiation exposure. Jack Miller sham sham irradiation @@ -92974,10 +111718,11 @@ Classes for population already exist in IDO ('organism population', I HZE - Fully ionized atomic nuclei with 2 or more protons and energies in excess of tens of MeV per nucleon + Fully ionized atomic nucleus with 2 or more protons and energies in excess of tens of MeV per nucleon Jack Miller HZE - highly charged energetic nuclei + highly charged energetic nuclei + highly charged energetic nucleus @@ -93369,7 +112114,19 @@ Classes for population already exist in IDO ('organism population', I - + + + + + + + + + + + + + The path of a particle in matter, delineated by sites where the particle deposits energy. particle track @@ -93437,6 +112194,101 @@ Classes for population already exist in IDO ('organism population', I + + + + + Sham irradiation in which an identical irradiation protocol (with the exception of the administration of the radiation exposure) is not followed in every respect. + Use approximate sham irradiation when at least one aspect of the irradiation (with the exception of the administration of the radiation exposure) is not followed precisely. For example, Not placing an organism or sample in a beam line for the same length of time as the irradiated organism(s) or sample(s) were left in the beam. + approximate sham irradiation + + + + + + + + + Experimental internal radiation exposure of rodents to radon gas through inhalation. + Exposure to an inhaled, ingested, injected or implanted source of radiation of any origin as part of a planned or accidental process. + internal radiation exposure + + + + + + + + + Mice exposed to external radiation from a Sr source. + Exposure to an external source of radiation of any origin or type. + https://orcid.org/0000-0002-5111-7263 + external radiation exposure + + + + + + + + + Sham irradiation in which an identical irradiation protocol is followed in every respect, with the exception of the administration of the radiation exposure. + Use complete sham irradiation when all steps of an irradiation protocol are followed for sham control group (with the exception of administration of the radiation exposure). + complete sham irradiation + + + + + + + + + + Planned exposure of an entity to radiation of any type, for example as part of a medical or experimental procedure with the intention of exposing the entity to radiation energy internally by the ingestion, inhalation or implantation of a source of radiation. + https://orcid.org/0000-0002-5111-7263 + Research subjects participating in a clinical trial using an internally implanted radiation source have an internal experimental radiation exposure + internal experimental radiation exposure + + + + + + + + + The direct or indirect transfer of energy from radiation to a medium through ionisation or excitation of the atoms of the medium. + energy deposition event + + + + + + + + + + + + + + + + + + + + + track formation + + + + + + + + + + @@ -124881,7 +143733,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO @@ -125102,7 +143954,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO @@ -130826,7 +149678,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO FMA-implicit VHOG ZFA @@ -139343,7 +158195,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO EHDAA2 GO-def @@ -139707,7 +158559,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO @@ -144679,7 +163531,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO @@ -154019,7 +172871,7 @@ Classes for population already exist in IDO ('organism population', I in XAO this develops_from dorsolateral placode, but in NBK53175, this is a separate group - XAO + XAO @@ -154765,7 +173617,7 @@ Classes for population already exist in IDO ('organism population', I part_of somite in XAO - XAO + XAO @@ -155412,7 +174264,7 @@ Classes for population already exist in IDO ('organism population', I in XAO, called branchial arch 2 and df VP4 - XAO + XAO @@ -179801,7 +198653,7 @@ Classes for population already exist in IDO ('organism population', I it's not clear if the XAO class belongs here or below - XAO + XAO @@ -209141,7 +227993,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO @@ -213012,7 +231864,7 @@ Classes for population already exist in IDO ('organism population', I Subdivision of cardiovascular system which has as its parts the pulmonary arterial and venous tree organs.[FMA] - FMA + FMA FMA:45621 @@ -219668,7 +238520,7 @@ Classes for population already exist in IDO ('organism population', I isa blood vessel in XAO - XAO + XAO @@ -256212,8 +275064,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim m A length unit which is equal to the length of the path traveled by light in vacuum during a time interval of 1/299 792 458 of a second. - m meter + m metre "A length unit which is equal to the length of the path traveled by light in vacuum during a time interval of 1/299 792 458 of a second." [BIPM:BIPM, NIST:NIST] @@ -256274,8 +275126,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim A length unit which is equal to one thousandth of one millionth of a meter or 10^[-9] m. nanometre nanometer - "A length unit which is equal to one thousandth of one millionth of a meter or 10^[-9] m." [NIST:NIST] + Å @@ -256299,8 +275151,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim milligram A mass unit which is equal to one thousandth of a gram or 10^[-3] g. mg - mg "A mass unit which is equal to one thousandth of a gram or 10^[-3] g." [UOC:GVG] + mg milligram @@ -256335,8 +275187,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim "A temperature unit which is equal to one kelvin degree. However, they have their zeros at different points. The centigrade scale has its zero at 273.15 K." [NIST:NIST] degree C A temperature unit which is equal to one kelvin degree. However, they have their zeros at different points. The centigrade scale has its zero at 273.15 K. - C + C degree Celsius @@ -256350,8 +275202,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim "A time unit which is equal to 60 seconds." [Wikipedia:Wikipedia] - hour + hour h h @@ -256360,8 +275212,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim "A time unit which is equal to 3600 seconds or 60 minutes." [Wikipedia:Wikipedia] - day + day "A time unit which is equal to 24 hours." [Wikipedia:Wikipedia] A time unit which is equal to 24 hours. day @@ -256411,32 +275263,32 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim pmol A substance unit equal to 10^[-12] mol. - picomole picomole + picomole M "A unit of concentration which expresses a concentration of 1 mole of solute per liter of solution (mol/L)." [UOC:GVG] A unit of concentration which expresses a concentration of 1 mole of solute per liter of solution (mol/L). M - molar + molar molar A unit of molarity which is equal to one thousandth of a molar or 10^[-3] M. - millimolar mM - millimolar + millimolar mM + millimolar "A unit of molarity which is equal to one thousandth of a molar or 10^[-3] M." [UOC:GVG] - micromolar uM - uM + micromolar A unit of molarity which is equal to one millionth of a molar or 10^[-6] M. + uM micromolar "A unit of molarity which is equal to one millionth of a molar or 10^[-6] M." [UOC:GVG] @@ -256456,8 +275308,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim "A unit of molarity which is equal to 10^[-12] M." [UOC:GVG] picomolar pM - A unit of molarity which is equal to 10^[-12] M. + cubic centimeter @@ -256474,20 +275326,20 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim "A volume unit which is equal to one thousandth of a liter or 10^[-3] L, or to 1 cubic centimeter." [NIST:NIST] milliliter ml + millilitre A volume unit which is equal to one thousandth of a liter or 10^[-3] L, or to 1 cubic centimeter. - millilitre milliliter ml litre - L l + L A volume unit which is equal to one thousandth of a cubic meter or 10^[-3] m^[3], or to 1 decimeter. - "A volume unit which is equal to one thousandth of a cubic meter or 10^[-3] m^[3], or to 1 decimeter." [NIST:NIST] liter + "A volume unit which is equal to one thousandth of a cubic meter or 10^[-3] m^[3], or to 1 decimeter." [NIST:NIST] L liter @@ -256501,11 +275353,11 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim - microliter microliter + microliter ul - microlitre A volume unit which is equal to one millionth of a liter or 10^[-6] L. + microlitre ul "A volume unit which is equal to one millionth of a liter or 10^[-6] L." [NIST:NIST] @@ -256551,8 +275403,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim A dimensionless concentration unit which denotes the mass of a substance in a mixture as a percentage of the mass of the entire mixture. - mass volume percentage + mass volume percentage % w/v A dimensionless concentration unit which denotes the mass of the substance in a mixture as a percentage of the volume of the entire mixture. mass volume percentage @@ -256562,11 +275414,11 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim (w/v) - % v/v volume percentage + % v/v - % (v/v) "A dimensionless concentration unit which denotes the volume of the solute in mL per 100 mL of the resulting solution." [UOC:GVG] + % (v/v) A dimensionless concentration unit which denotes the volume of the solute in mL per 100 mL of the resulting solution. percent vol per vol volume percentage @@ -256624,8 +275476,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim gram per deciliter g/dl gram per decilitre - gram per deciliter + A mass density unit which is equal to mass of an object in grams divided by the volume in deciliters. g/dl @@ -256640,8 +275492,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim A volumetric flow rate unit which is equal to one microliter volume through a given surface in one minute. microliters per minute - microlitres per minute uL/min + microlitres per minute "A volumetric flow rate unit which is equal to one microliter volume through a given surface in one minute." [UOC:GVG] microliters per minute @@ -256663,8 +275515,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim A rate unit which is equal to one over one nanomolar. - "A rate unit which is equal to one over one nanomolar." [UO:GVG] 1/nM + "A rate unit which is equal to one over one nanomolar." [UO:GVG] count per nanomolar count per nanomolar @@ -256674,8 +275526,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim count per molar 1/M - count per molar A rate unit which is equal to one over one molar. + count per molar "A rate unit which is equal to one over one molar." [UO:GVG] M^-1 @@ -256685,8 +275537,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim ug/L microgram per litre - ng/ml microgram per liter + ng/ml ug/L microgram per liter diff --git a/rbo.owl b/rbo.owl index b267460..ccced55 100644 --- a/rbo.owl +++ b/rbo.owl @@ -32,11 +32,11 @@ xmlns:ncbitaxon="http://purl.obolibrary.org/obo/ncbitaxon#" xmlns:oboInOwl1="oboInOwl:"> - + RBO is an ontology for the effects of radiation on biota in terrestrial and space environments. Radiation Biology Ontology - 2023-06-15 + 2023-09-05 @@ -1407,7 +1407,9 @@ We also have the outstanding issue of how to aim different definitions to differ - + + has_alternative_id + @@ -1446,13 +1448,17 @@ We also have the outstanding issue of how to aim different definitions to differ - + + has_obo_namespace + - + + has_related_synonym + @@ -1476,7 +1482,9 @@ We also have the outstanding issue of how to aim different definitions to differ - + + in_subset + @@ -8734,6 +8742,34 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + An atom of an element that exhibits properties that are between those of metals and nonmetals, or that has a mixture of them. The term generally includes boron, silicon, germanium, arsenic, antimony, and tellurium, while carbon, aluminium, selenium, polonium, and astatine are less commonly included. + Wikipedia:Metalloid + chebi_ontology + metalloid + metalloids + CHEBI:137980 + + metalloid atom + + + + + metalloid + ChEBI + + + + + metalloids + ChEBI + + + + @@ -8948,10 +8984,8 @@ For example, A and B may be gene products and binding of B by A positively regul - - The general name for the hydrogen nucleus, to be used without regard to the hydrogen nuclear mass (either for hydrogen in its natural abundance or where it is not desired to distinguish between the isotopes). +1 H @@ -9020,6 +9054,131 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + A trace radioisotope of argon with atomic mass of 38.964313 and a half-life of 269 years. + 0 + [39Ar] + InChI=1S/Ar/i1-1 + XKRFYHLGVUSROY-BJUDXGSMSA-N + 38.964 + 38.96431 + [Ar] + CAS:25729-41-3 + PMID:16429279 + PMID:17781454 + PMID:17791262 + PMID:28017500 + PMID:28755564 + PMID:30487580 + chebi_ontology + (39)18Ar + (39)Ar + (39)Ar radioisotope + Ar-39 + Ar-39 radioisotope + argon 39 + argon, isotope of mass 39 + argon-39 + CHEBI:155827 + + argon-39 atom + + + + + CAS:25729-41-3 + ChemIDplus + + + + + PMID:16429279 + Europe PMC + + + + + PMID:17781454 + Europe PMC + + + + + PMID:17791262 + Europe PMC + + + + + PMID:28017500 + Europe PMC + + + + + PMID:28755564 + Europe PMC + + + + + PMID:30487580 + Europe PMC + + + + + (39)18Ar + ChEBI + + + + + (39)Ar + ChemIDplus + + + + + (39)Ar radioisotope + ChEBI + + + + + Ar-39 + ChEBI + + + + + Ar-39 radioisotope + ChEBI + + + + + argon 39 + ChEBI + + + + + argon, isotope of mass 39 + ChemIDplus + + + + + argon-39 + ChEBI + + + + @@ -9744,6 +9903,1288 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + A minor stable isotope of calcium with relative atomic mass 42.95877 and 0.135 atom percent natural abundance. + 0 + [43Ca] + InChI=1S/Ca/i1+3 + OYPRJOBELJOOCE-AKLPVKDBSA-N + 42.959 + 42.95877 + [43Ca] + CAS:14333-06-3 + PMID:11859764 + PMID:19117733 + PMID:20463996 + PMID:20574585 + PMID:23163540 + PMID:23398971 + PMID:24874995 + PMID:25306191 + PMID:29770988 + PMID:6548252 + ((43)Ca)calcium + chebi_ontology + (43)20Ca + (43)Ca + (43)calcium + Ca-43 + calcium, isotope of mass 43 + calcium-43 + calcium-43 isotope + CHEBI:176566 + + calcium-43 atom + + + + + CAS:14333-06-3 + ChemIDplus + + + + + PMID:11859764 + Europe PMC + + + + + PMID:19117733 + Europe PMC + + + + + PMID:20463996 + Europe PMC + + + + + PMID:20574585 + Europe PMC + + + + + PMID:23163540 + Europe PMC + + + + + PMID:23398971 + Europe PMC + + + + + PMID:24874995 + Europe PMC + + + + + PMID:25306191 + Europe PMC + + + + + PMID:29770988 + Europe PMC + + + + + PMID:6548252 + Europe PMC + + + + + ((43)Ca)calcium + IUPAC + + + + + + (43)20Ca + ChEBI + + + + + (43)Ca + ChemIDplus + + + + + (43)calcium + ChEBI + + + + + Ca-43 + ChEBI + + + + + calcium, isotope of mass 43 + ChemIDplus + + + + + calcium-43 + ChemIDplus + + + + + calcium-43 isotope + ChEBI + + + + + + + + + A stable isotope of molybdenum with relative atomic mass 97.90541, 24.29 atom percent natural abundance and nuclear spin 0. + 0 + [98Mo] + InChI=1S/Mo/i1+2 + ZOKXTWBITQBERF-NJFSPNSNSA-N + 97.905 + 97.90541 + [98Mo] + CAS:14392-20-2 + PMID:19720541 + PMID:22796396 + PMID:22970917 + PMID:24593536 + PMID:25087173 + PMID:25168118 + PMID:25880611 + PMID:26397967 + PMID:26808401 + ((98)Mo)molybdenum + chebi_ontology + (98)42Mo + (98)Mo + Mo-98 + molybdenum, isotope of mass 98 + molybdenum-98 + CHEBI:176570 + + molybdenum-98 atom + + + + + CAS:14392-20-2 + ChemIDplus + + + + + PMID:19720541 + Europe PMC + + + + + PMID:22796396 + Europe PMC + + + + + PMID:22970917 + Europe PMC + + + + + PMID:24593536 + Europe PMC + + + + + PMID:25087173 + SUBMITTER + + + + + PMID:25168118 + Europe PMC + + + + + PMID:25880611 + Europe PMC + + + + + PMID:26397967 + Europe PMC + + + + + PMID:26808401 + Europe PMC + + + + + ((98)Mo)molybdenum + IUPAC + + + + + + (98)42Mo + ChEBI + + + + + (98)Mo + ChemIDplus + + + + + Mo-98 + ChEBI + + + + + molybdenum, isotope of mass 98 + ChemIDplus + + + + + molybdenum-98 + ChemIDplus + + + + + + + + + A major stable isotope of strontium with relative atomic mass 87.90561 and 82.58 atom percent natural abundance. + 0 + [88Sr] + InChI=1S/Sr/i1+0 + CIOAGBVUUVVLOB-IGMARMGPSA-N + 87.906 + 87.90561 + [88Sr] + CAS:14119-10-9 + PMID:11893161 + PMID:27829691 + PMID:32350478 + PMID:33328666 + PMID:33834832 + PMID:6337617 + ((88)Sr)strontium + chebi_ontology + (88)38Sr + (88)Sr + (88)strontium + Sr-88 + strontium, isotope of mass 88 + strontium-88 + strontium-88 isotope + CHEBI:176571 + + strontium-88 atom + + + + + CAS:14119-10-9 + ChemIDplus + + + + + PMID:11893161 + Europe PMC + + + + + PMID:27829691 + Europe PMC + + + + + PMID:32350478 + Europe PMC + + + + + PMID:33328666 + Europe PMC + + + + + PMID:33834832 + Europe PMC + + + + + PMID:6337617 + SUBMITTER + + + + + ((88)Sr)strontium + IUPAC + + + + + + (88)38Sr + ChEBI + + + + + (88)Sr + ChemIDplus + + + + + (88)strontium + ChEBI + + + + + Sr-88 + ChEBI + + + + + strontium, isotope of mass 88 + ChemIDplus + + + + + strontium-88 + ChemIDplus + + + + + strontium-88 isotope + ChEBI + + + + + + + + + A stable isotope of rubidium with relative atomic mass 84.91179, 72.17 atom percent natural abundance and nuclear spin 5/2. + 0 + [85Rb] + InChI=1S/Rb/i1+0 + IGLNJRXAVVLDKE-IGMARMGPSA-N + 84.912 + 84.91179 + [85Rb] + CAS:13982-12-2 + PMID:18026483 + PMID:18033464 + PMID:18291893 + PMID:18382518 + PMID:19855587 + PMID:25087142 + PMID:32909800 + PMID:33709729 + PMID:34170158 + ((85)Rb)rubidium + chebi_ontology + (85)37Rb + (85)Rb + Rb-85 + rubidium, isotope of mass 85 + rubidium-85 + CHEBI:176572 + + rubidium-85 atom + + + + + CAS:13982-12-2 + ChemIDplus + + + + + PMID:18026483 + Europe PMC + + + + + PMID:18033464 + Europe PMC + + + + + PMID:18291893 + Europe PMC + + + + + PMID:18382518 + Europe PMC + + + + + PMID:19855587 + Europe PMC + + + + + PMID:25087142 + SUBMITTER + + + + + PMID:32909800 + Europe PMC + + + + + PMID:33709729 + Europe PMC + + + + + PMID:34170158 + Europe PMC + + + + + ((85)Rb)rubidium + IUPAC + + + + + + (85)37Rb + ChEBI + + + + + (85)Rb + ChemIDplus + + + + + Rb-85 + ChEBI + + + + + rubidium, isotope of mass 85 + ChemIDplus + + + + + rubidium-85 + ChemIDplus + + + + + + + + + A stable isotope of selenium with relative atomic mass 81.91670, 8.82 atom percent natural abundance and nuclear spin 0. + 0 + [82Se] + InChI=1S/Se/i1+3 + BUGBHKTXTAQXES-AKLPVKDBSA-N + 81.917 + 81.91670 + [82Se] + CAS:14687-58-2 + Chemspider:4892236 + PMID:16028633 + PMID:18781022 + PMID:21139275 + PMID:22258472 + PMID:23575454 + PMID:29932707 + PMID:30881205 + PMID:31386478 + PMID:31951429 + PMID:33576665 + PMID:6337549 + ((82)Se)selenium + chebi_ontology + (82)34Se + (82)Se + Se-82 + selenium, isotope of mass 82 + selenium-82 + CHEBI:176573 + + selenium-82 atom + + + + + CAS:14687-58-2 + ChemIDplus + + + + + PMID:16028633 + Europe PMC + + + + + PMID:18781022 + Europe PMC + + + + + PMID:21139275 + Europe PMC + + + + + PMID:22258472 + Europe PMC + + + + + PMID:23575454 + Europe PMC + + + + + PMID:29932707 + Europe PMC + + + + + PMID:30881205 + Europe PMC + + + + + PMID:31386478 + Europe PMC + + + + + PMID:31951429 + Europe PMC + + + + + PMID:33576665 + Europe PMC + + + + + PMID:6337549 + SUBMITTER + + + + + ((82)Se)selenium + IUPAC + + + + + + (82)34Se + ChEBI + + + + + (82)Se + ChemIDplus + + + + + Se-82 + ChEBI + + + + + selenium, isotope of mass 82 + ChemIDplus + + + + + selenium-82 + ChemIDplus + + + + + + + + + A stable isotope of zinc with relative atomic mass 65.92603, 27.7 atom percent natural abundance and nuclear spin 0. + 0 + [66Zn] + InChI=1S/Zn/i1+1 + HCHKCACWOHOZIP-OUBTZVSYSA-N + 65.926 + 65.92603 + [66Zn] + CAS:14378-33-7 + PMID:12447866 + PMID:19836537 + PMID:20155761 + PMID:21047059 + PMID:24196216 + PMID:26065372 + PMID:26808401 + PMID:27189145 + PMID:27306032 + ((66)Zn)zinc + chebi_ontology + (66)30Zn + (66)Zn + Zn-66 + zinc, isotope of mass 66 + zinc-66 + CHEBI:176574 + + zinc-66 atom + + + + + CAS:14378-33-7 + ChemIDplus + + + + + PMID:12447866 + SUBMITTER + + + + + PMID:19836537 + Europe PMC + + + + + PMID:20155761 + Europe PMC + + + + + PMID:21047059 + Europe PMC + + + + + PMID:24196216 + Europe PMC + + + + + PMID:26065372 + Europe PMC + + + + + PMID:26808401 + Europe PMC + + + + + PMID:27189145 + Europe PMC + + + + + PMID:27306032 + Europe PMC + + + + + ((66)Zn)zinc + IUPAC + + + + + + (66)30Zn + ChEBI + + + + + (66)Zn + ChemIDplus + + + + + Zn-66 + ChemIDplus + + + + + zinc, isotope of mass 66 + ChemIDplus + + + + + zinc-66 + ChemIDplus + + + + + + + + + A stable isotope of nickel with relative atomic mass 59.93079, 26.223 atom percent natural abundance and nuclear spin 0. + 0 + [60Ni] + InChI=1S/Ni/i1+1 + PXHVJJICTQNCMI-OUBTZVSYSA-N + 59.931 + 59.93079 + [60Ni] + CAS:13981-80-1 + PMID:15308160 + PMID:22583786 + PMID:23149182 + PMID:25126912 + PMID:25700212 + PMID:26709546 + PMID:29376683 + ((60)Ni)nickel + chebi_ontology + (60)Ni + Ni-60 + nickel, isotope of mass 60 + nickel-60 + CHEBI:176575 + + nickel-60 atom + + + + + CAS:13981-80-1 + ChemIDplus + + + + + PMID:15308160 + Europe PMC + + + + + PMID:22583786 + Europe PMC + + + + + PMID:23149182 + Europe PMC + + + + + PMID:25126912 + Europe PMC + + + + + PMID:25700212 + Europe PMC + + + + + PMID:26709546 + Europe PMC + + + + + PMID:29376683 + Europe PMC + + + + + ((60)Ni)nickel + IUPAC + + + + + + (60)Ni + ChEBI + + + + + Ni-60 + ChEBI + + + + + nickel, isotope of mass 60 + ChemIDplus + + + + + nickel-60 + ChemIDplus + + + + + + + + + A stable isotope of cobalt with relative atomic mass 58.93319, 100 atom percent natural abundance and nuclear spin 7/2. + 0 + [59Co] + InChI=1S/Co/i1+0 + GUTLYIVDDKVIGB-IGMARMGPSA-N + 58.933 + 58.93319 + [59Co] + PMID:10617436 + PMID:10940985 + PMID:11421673 + PMID:11528329 + PMID:12943912 + PMID:19150229 + PMID:19421527 + PMID:25069794 + PMID:25169133 + PMID:26066447 + PMID:26641288 + PMID:27355901 + PMID:30137661 + PMID:31367328 + PMID:32478347 + ((59)Co)cobalt + chebi_ontology + (59)27Co + (59)Co + Co-59 + cobalt, isotope of mass 59 + cobalt-(59)Co + cobalt-59 + CHEBI:176578 + + cobalt-59 atom + + + + + PMID:10617436 + Europe PMC + + + + + PMID:10940985 + Europe PMC + + + + + PMID:11421673 + Europe PMC + + + + + PMID:11528329 + SUBMITTER + + + + + PMID:12943912 + Europe PMC + + + + + PMID:19150229 + Europe PMC + + + + + PMID:19421527 + Europe PMC + + + + + PMID:25069794 + Europe PMC + + + + + PMID:25169133 + Europe PMC + + + + + PMID:26066447 + Europe PMC + + + + + PMID:26641288 + Europe PMC + + + + + PMID:27355901 + Europe PMC + + + + + PMID:30137661 + Europe PMC + + + + + PMID:31367328 + Europe PMC + + + + + PMID:32478347 + Europe PMC + + + + + ((59)Co)cobalt + IUPAC + + + + + + (59)27Co + ChEBI + + + + + (59)Co + ChEBI + + + + + Co-59 + ChEBI + + + + + cobalt, isotope of mass 59 + ChEBI + + + + + cobalt-(59)Co + ChEBI + + + + + cobalt-59 + ChEBI + + + + + + + + + A stable isotope of manganese with relative atomic mass 54.93804, 100 atom percent natural abundance and nuclear spin 5/2. + 0 + [55Mn] + InChI=1S/Mn/i1+0 + PWHULOQIROXLJO-IGMARMGPSA-N + 54.938 + 54.93804 + [55Mn] + PMID:20645339 + PMID:21058720 + PMID:21341708 + PMID:24993844 + PMID:25179135 + PMID:25891681 + ((55)Mn)manganese + chebi_ontology + (55)25Mn + (55)Mn + Mn-55 + manganese, isotope of mass 55 + manganese-55 + CHEBI:176583 + + manganese-55 atom + + + + + PMID:20645339 + Europe PMC + + + + + PMID:21058720 + Europe PMC + + + + + PMID:21341708 + Europe PMC + + + + + PMID:24993844 + Europe PMC + + + + + PMID:25179135 + Europe PMC + + + + + PMID:25891681 + Europe PMC + + + + + ((55)Mn)manganese + IUPAC + + + + + + (55)25Mn + ChEBI + + + + + (55)Mn + ChEBI + + + + + Mn-55 + ChEBI + + + + + manganese, isotope of mass 55 + ChEBI + + + + + manganese-55 + ChEBI + + + + + + + + + A stable isotope of arsenic with relative atomic mass 74.921596, 100 atom percent natural abundance and nuclear spin 3/2. + 0 + [75As] + InChI=1S/As/i1+0 + RQNWIZPPADIBDY-IGMARMGPSA-N + 74.922 + 74.92159 + [75As] + ((75)As)arsenic + chebi_ontology + (75)33As + (75)As + As-75 + arsenic, isotope of mass 75 + arsenic-75 + CHEBI:176584 + + arsenic-75 atom + + + + + ((75)As)arsenic + IUPAC + + + + + + (75)33As + ChEBI + + + + + (75)As + ChEBI + + + + + As-75 + ChEBI + + + + + arsenic, isotope of mass 75 + ChEBI + + + + + arsenic-75 + ChEBI + + + + @@ -9814,8 +11255,122 @@ For example, A and B may be gene products and binding of B by A positively regul - iron atom + An iron group element atom that has atomic number 26. + 0 + Fe + InChI=1S/Fe + XEEYBQQBJWHFJM-UHFFFAOYSA-N + 55.84500 + 55.93494 + [Fe] + CHEBI:13322 + CHEBI:24872 + CHEBI:5974 + CAS:7439-89-6 + DrugBank:DB01592 + HMDB:HMDB0015531 + KEGG:C00023 + Reaxys:4122945 + WebElements:Fe + iron + chebi_ontology + 26Fe + Eisen + Fe + Iron + fer + ferrum + hierro + iron + CHEBI:18248 + + iron atom + + + + CAS:7439-89-6 + ChemIDplus + + + + + CAS:7439-89-6 + KEGG COMPOUND + + + + + CAS:7439-89-6 + NIST Chemistry WebBook + + + + + Reaxys:4122945 + Reaxys + + + + + iron + IUPAC + + + + + + 26Fe + IUPAC + + + + + Eisen + ChEBI + + + + + Fe + IUPAC + + + + + Fe + UniProt + + + + + Iron + KEGG_COMPOUND + + + + + fer + ChEBI + + + + + ferrum + IUPAC + + + + + hierro + ChEBI + + + + + iron + ChEBI + @@ -9851,6 +11406,729 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + 0 + Mn + InChI=1S/Mn + PWHULOQIROXLJO-UHFFFAOYSA-N + 54.93805 + 54.93804 + [Mn] + CHEBI:13382 + CHEBI:25153 + CHEBI:6681 + CAS:7439-96-5 + KEGG:C00034 + WebElements:Mn + manganese + chebi_ontology + 25Mn + Mangan + Manganese + Mn + manganese + manganeso + manganum + CHEBI:18291 + + manganese atom + + + + + CAS:7439-96-5 + ChemIDplus + + + + + CAS:7439-96-5 + KEGG COMPOUND + + + + + manganese + IUPAC + + + + + + 25Mn + IUPAC + + + + + Mangan + NIST_Chemistry_WebBook + + + + + Manganese + KEGG_COMPOUND + + + + + Mn + IUPAC + + + + + Mn + UniProt + + + + + manganese + ChEBI + + + + + manganeso + ChEBI + + + + + manganum + ChEBI + + + + + + + + + A carbon group element atom with a symbol Fl and atomic number 114. + 0 + Fl + InChI=1S/Fl + WIHJCBVMYKIGOT-UHFFFAOYSA-N + 289.000 + 289.00000 + [Fl] + PMID:16833611 + PMID:17919027 + PMID:19905506 + PMID:20379506 + PMID:20867370 + PMID:23787759 + PMID:24456007 + PMID:29711350 + PMID:36092655 + Wikipedia:Flerovium + chebi_ontology + 114Fl + 114Uuq + E114 + Fl + Uuq + eka-lead + element 114 + ununquadium + CHEBI:194531 + + flerovium atom + + + + + PMID:16833611 + Europe PMC + + + + + PMID:17919027 + Europe PMC + + + + + PMID:19905506 + Europe PMC + + + + + PMID:20379506 + Europe PMC + + + + + PMID:20867370 + Europe PMC + + + + + PMID:23787759 + Europe PMC + + + + + PMID:24456007 + Europe PMC + + + + + PMID:29711350 + Europe PMC + + + + + PMID:36092655 + Europe PMC + + + + + 114Fl + ChEBI + + + + + 114Uuq + ChEBI + + + + + E114 + ChEBI + + + + + Fl + ChEBI + + + + + Uuq + ChEBI + + + + + eka-lead + ChEBI + + + + + element 114 + ChEBI + + + + + ununquadium + ChEBI + + + + + + + + + A boron group element atom with a symbol Nh and atomic number 113. + 0 + Nh + InChI=1S/Nh + KUGNSLWRKGRKGS-UHFFFAOYSA-N + 286.000 + 286.00000 + [Nh] + PMID:19049424 + PMID:34142795 + PMID:34917588 + PMID:36149319 + PMID:9913354 + Wikipedia:Nihonium + chebi_ontology + 113Nh + E113 + Nh + Uut + eka-thallium + element 113 + ununtrium + CHEBI:194533 + + nihonium atom + + + + + PMID:19049424 + Europe PMC + + + + + PMID:34142795 + Europe PMC + + + + + PMID:34917588 + Europe PMC + + + + + PMID:36149319 + Europe PMC + + + + + PMID:9913354 + Europe PMC + + + + + 113Nh + ChEBI + + + + + E113 + ChEBI + + + + + Nh + ChEBI + + + + + Uut + ChEBI + + + + + eka-thallium + ChEBI + + + + + element 113 + ChEBI + + + + + ununtrium + ChEBI + + + + + + + + + A pnictogen atom with a symbol Mc and atomic number 115. + 0 + Mc + InChI=1S/Mc + QDXZEHQJHSHEQF-UHFFFAOYSA-N + 289.000 + 289.00000 + [Mc] + PMID:24074079 + PMID:34142795 + Wikipedia:Moscovium + chebi_ontology + 115Mc + E115 + Mc + Uup + eka-bismuth + element 115 + ununpentium + CHEBI:194535 + + moscovium atom + + + + + PMID:24074079 + Europe PMC + + + + + PMID:34142795 + Europe PMC + + + + + 115Mc + ChEBI + + + + + E115 + ChEBI + + + + + Mc + ChEBI + + + + + Uup + ChEBI + + + + + eka-bismuth + ChEBI + + + + + element 115 + ChEBI + + + + + ununpentium + ChEBI + + + + + + + + + A chalcogen atom with a symbol Lv and atomic number 116. + 0 + Lv + InChI=1S/Lv + ONFASNXETZOODS-UHFFFAOYSA-N + 293.000 + 293.00000 + [Lv] + PMID:17381195 + PMID:27554416 + Wikipedia:Livermorium + chebi_ontology + 116Lv + E116 + Lv + Uuh + eka-polonium + element 116 + ununhexium + CHEBI:194537 + + livermorium atom + + + + + PMID:17381195 + Europe PMC + + + + + PMID:27554416 + Europe PMC + + + + + 116Lv + ChEBI + + + + + E116 + ChEBI + + + + + Lv + ChEBI + + + + + Uuh + ChEBI + + + + + eka-polonium + ChEBI + + + + + element 116 + ChEBI + + + + + ununhexium + ChEBI + + + + + + + + + A halogen atom with a symbol Ts and atomic number 117. + 0 + Ts + InChI=1S/Ts + INMSAURDCVBGHH-UHFFFAOYSA-N + 293.000 + 293.00000 + [Ts] + PMID:16483205 + PMID:19367904 + PMID:20395479 + PMID:23090670 + Wikipedia:Tennessine + chebi_ontology + 117Ts + E117 + Ts + Uus + eka-astatine + element 117 + ununseptium + CHEBI:194539 + + tennessine atom + + + + + PMID:16483205 + Europe PMC + + + + + PMID:19367904 + Europe PMC + + + + + PMID:20395479 + Europe PMC + + + + + PMID:23090670 + Europe PMC + + + + + 117Ts + ChEBI + + + + + E117 + ChEBI + + + + + Ts + ChEBI + + + + + Uus + ChEBI + + + + + eka-astatine + ChEBI + + + + + element 117 + ChEBI + + + + + ununseptium + ChEBI + + + + + + + + + + A p-block element atom with a symbol Og and atomic number 118. + 0 + InChI=1S/Og + GOANEQIZDYDFCO-UHFFFAOYSA-N + 294.000 + 294.00000 + [Og] + PMID:10062781 + PMID:11486061 + PMID:19045133 + PMID:23913741 + PMID:36859080 + Wikipedia:Oganesson + chebi_ontology + 118Og + E118 + Og + Uuo + eka-emanation + eka-radon + element 118 + ununoctium + CHEBI:194541 + + oganesson atom + + + + + PMID:10062781 + Europe PMC + + + + + PMID:11486061 + Europe PMC + + + + + PMID:19045133 + Europe PMC + + + + + PMID:23913741 + Europe PMC + + + + + PMID:36859080 + Europe PMC + + + + + 118Og + ChEBI + + + + + E118 + ChEBI + + + + + Og + ChEBI + + + + + Uuo + ChEBI + + + + + eka-emanation + ChEBI + + + + + eka-radon + ChEBI + + + + + element 118 + ChEBI + + + + + ununoctium + ChEBI + + + + @@ -9900,14 +12178,159 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + + + alkaline earth metals + chebi_ontology + Erdalkalimetall + Erdalkalimetalle + alkaline earth metal + alkaline-earth metal + alkaline-earth metals + metal alcalino-terreux + metal alcalinoterreo + metales alcalinoterreos + metaux alcalino-terreux + CHEBI:22313 + + alkaline earth metal atom + + + + + alkaline earth metals + IUPAC + + + + + + Erdalkalimetall + ChEBI + + + + + Erdalkalimetalle + ChEBI + + + + + alkaline earth metal + ChEBI + + + + + alkaline-earth metal + ChEBI + + + + + alkaline-earth metals + ChEBI + + + + + metal alcalino-terreux + ChEBI + + + + + metal alcalinoterreo + ChEBI + + + + + metales alcalinoterreos + ChEBI + + + + + metaux alcalino-terreux + ChEBI + + + + - alkali metal atom + alkali metals + chebi_ontology + Alkalimetall + Alkalimetalle + alkali metal + metal alcalin + metal alcalino + metales alcalinos + metaux alcalins + CHEBI:22314 + + alkali metal atom + + + + alkali metals + IUPAC + + + + + + Alkalimetall + ChEBI + + + + + Alkalimetalle + ChEBI + + + + + alkali metal + ChEBI + + + + + metal alcalin + ChEBI + + + + + metal alcalino + ChEBI + + + + + metales alcalinos + ChEBI + + + + + metaux alcalins + ChEBI + @@ -9925,52 +12348,52 @@ For example, A and B may be gene products and binding of B by A positively regul - A monoatomic or polyatomic species having one or more elementary charges of the electron. - Anion - anion - chebi_ontology - Anionen - aniones - anions - CHEBI:22563 + A monoatomic or polyatomic species having one or more elementary charges of the electron. + Anion + anion + chebi_ontology + Anionen + aniones + anions + CHEBI:22563 - anion + anion - Anion + Anion ChEBI - anion + anion ChEBI - anion + anion IUPAC - Anionen + Anionen ChEBI - aniones + aniones ChEBI - anions + anions IUPAC @@ -10056,6 +12479,251 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + 0 + Br + InChI=1S/Br + WKBOTKDWSSQWDR-UHFFFAOYSA-N + 79.90400 + 78.91834 + [Br] + WebElements:Br + bromine + chebi_ontology + 35Br + Br + Brom + brome + bromine + bromo + bromum + CHEBI:22927 + + bromine atom + + + + + bromine + IUPAC + + + + + + 35Br + IUPAC + + + + + Br + ChEBI + + + + + Brom + ChEBI + + + + + brome + ChEBI + + + + + bromine + ChEBI + + + + + bromo + ChEBI + + + + + bromum + ChEBI + + + + + + + + + 0 + Cd + InChI=1S/Cd + BDOSMKKIYDKNTQ-UHFFFAOYSA-N + 112.41100 + 113.90336 + [Cd] + CAS:7440-43-9 + KEGG:C01413 + WebElements:Cd + cadmium + chebi_ontology + 48Cd + Cd + Kadmium + cadmio + cadmium + CHEBI:22977 + + cadmium atom + + + + + CAS:7440-43-9 + ChemIDplus + + + + + CAS:7440-43-9 + KEGG COMPOUND + + + + + CAS:7440-43-9 + NIST Chemistry WebBook + + + + + cadmium + IUPAC + + + + + + 48Cd + IUPAC + + + + + Cd + IUPAC + + + + + Kadmium + NIST_Chemistry_WebBook + + + + + cadmio + ChEBI + + + + + cadmium + ChEBI + + + + + + + + + 0 + Ca + InChI=1S/Ca + OYPRJOBELJOOCE-UHFFFAOYSA-N + 40.07800 + 39.96259 + [Ca] + CAS:7440-70-2 + DrugBank:DB01373 + KEGG:C00076 + WebElements:Ca + calcium + chebi_ontology + 20Ca + Ca + Calcium + Kalzium + calcio + calcium + CHEBI:22984 + + calcium atom + + + + + CAS:7440-70-2 + ChemIDplus + + + + + calcium + IUPAC + + + + + + 20Ca + IUPAC + + + + + Ca + IUPAC + + + + + Ca + UniProt + + + + + Calcium + KEGG_COMPOUND + + + + + Kalzium + ChEBI + + + + + calcio + ChEBI + + + + + calcium + ChEBI + + + + @@ -10202,6 +12870,83 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + 0 + Cl + InChI=1S/Cl + ZAMOUSCENKQFHK-UHFFFAOYSA-N + 35.45270 + 34.96885 + [Cl] + WebElements:Cl + chlorine + chebi_ontology + 17Cl + Chlor + Cl + chlore + chlorine + chlorum + cloro + CHEBI:23116 + + chlorine atom + + + + + chlorine + IUPAC + + + + + + 17Cl + IUPAC + + + + + Chlor + ChEBI + + + + + Cl + IUPAC + + + + + chlore + ChEBI + + + + + chlorine + ChEBI + + + + + chlorum + ChEBI + + + + + cloro + ChEBI + + + + @@ -10245,16 +12990,16 @@ For example, A and B may be gene products and binding of B by A positively regul Any constitutionally or isotopically distinct atom, molecule, ion, ion pair, radical, radical ion, complex, conformer etc., identifiable as a separately distinguishable entity. - molecular entity - chebi_ontology - entidad molecular - entidades moleculares - entite moleculaire - molecular entities - molekulare Entitaet - CHEBI:23367 + molecular entity + chebi_ontology + entidad molecular + entidades moleculares + entite moleculaire + molecular entities + molekulare Entitaet + CHEBI:23367 - molecular entity + molecular entity @@ -10265,38 +13010,38 @@ For example, A and B may be gene products and binding of B by A positively regul - molecular entity + molecular entity IUPAC - entidad molecular + entidad molecular IUPAC - entidades moleculares + entidades moleculares IUPAC - entite moleculaire + entite moleculaire IUPAC - molecular entities + molecular entities IUPAC - molekulare Entitaet + molekulare Entitaet ChEBI @@ -10307,18 +13052,8 @@ For example, A and B may be gene products and binding of B by A positively regul - chebi_ontology - monoatomic cations - CHEBI:23906 - - monoatomic cation + monoatomic cation - - - - monoatomic cations - ChEBI - @@ -10379,29 +13114,106 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + 0 + F + InChI=1S/F + YCKRFDGAMUMZLT-UHFFFAOYSA-N + 18.99840 + 18.99840 + [F] + CAS:7782-41-4 + WebElements:F + fluorine + chebi_ontology + 9F + F + Fluor + fluor + fluorine + fluorum + CHEBI:24061 + + fluorine atom + + + + + CAS:7782-41-4 + ChemIDplus + + + + + fluorine + IUPAC + + + + + + 9F + IUPAC + + + + + F + IUPAC + + + + + Fluor + ChemIDplus + + + + + fluor + ChEBI + + + + + fluorine + ChEBI + + + + + fluorum + ChEBI + + + + - A chemical entity is a physical entity of interest in chemistry including molecular entities, parts thereof, and chemical substances. + A chemical entity is a physical entity of interest in chemistry including molecular entities, parts thereof, and chemical substances. A drug, solvent, chemical, etc., with a property that can be measured such as concentration. A molecular entity consisting of two or more chemical elements. James Malone Tomasz Adamusiak true chemical compound - chemical entity + chemical entity heteroatomic molecular entities heteroatomic molecular entity - chebi_ontology - CHEBI:24431 + chebi_ontology + CHEBI:24431 - chemical entity + chemical entity - chemical entity + chemical entity UniProt @@ -10500,6 +13312,84 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + + halogen + halogens + chebi_ontology + Halogene + group 17 elements + group VII elements + halogene + halogenes + halogeno + halogenos + CHEBI:24473 + + halogen + + + + + halogen + IUPAC + + + + + + halogens + IUPAC + + + + + + Halogene + ChEBI + + + + + group 17 elements + ChEBI + + + + + group VII elements + ChEBI + + + + + halogene + ChEBI + + + + + halogenes + ChEBI + + + + + halogeno + ChEBI + + + + + halogenos + ChEBI + + + + @@ -10710,16 +13600,16 @@ For example, A and B may be gene products and binding of B by A positively regul - chebi_ontology - inorganic anions - CHEBI:24834 + chebi_ontology + inorganic anions + CHEBI:24834 - inorganic anion + inorganic anion - inorganic anions + inorganic anions ChEBI @@ -10729,45 +13619,45 @@ For example, A and B may be gene products and binding of B by A positively regul - A molecular entity that contains no carbon. - chebi_ontology - anorganische Verbindungen - inorganic compounds - inorganic entity - inorganic molecular entities - inorganics - CHEBI:24835 + A molecular entity that contains no carbon. + chebi_ontology + anorganische Verbindungen + inorganic compounds + inorganic entity + inorganic molecular entities + inorganics + CHEBI:24835 - inorganic molecular entity + inorganic molecular entity - anorganische Verbindungen + anorganische Verbindungen ChEBI - inorganic compounds + inorganic compounds ChEBI - inorganic entity + inorganic entity ChEBI - inorganic molecular entities + inorganic molecular entities ChEBI - inorganics + inorganics ChEBI @@ -10783,6 +13673,98 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + Chemical element with atomic number 53. + 0 + I + InChI=1S/I + ZCYVEMRRCGMTRW-UHFFFAOYSA-N + 126.90447 + 126.90447 + [I] + WebElements:I + iodine + chebi_ontology + 53I + I + Iod + J + Jod + iode + iodine + iodium + yodo + CHEBI:24859 + + iodine atom + + + + + iodine + IUPAC + + + + + + 53I + IUPAC + + + + + I + ChEBI + + + + + Iod + ChEBI + + + + + J + ChEBI + + + + + Jod + ChEBI + + + + + iode + ChEBI + + + + + iodine + ChEBI + + + + + iodium + ChEBI + + + + + yodo + ChEBI + + + + @@ -10809,18 +13791,8 @@ For example, A and B may be gene products and binding of B by A positively regul - chebi_ontology - monoatomic ions - CHEBI:24867 - - monoatomic ion + monoatomic ion - - - - monoatomic ions - ChEBI - @@ -10837,52 +13809,52 @@ For example, A and B may be gene products and binding of B by A positively regul - A molecular entity having a net electric charge. - Ion - ion - chebi_ontology - Ionen - iones - ions - CHEBI:24870 + A molecular entity having a net electric charge. + Ion + ion + chebi_ontology + Ionen + iones + ions + CHEBI:24870 - ion + ion - Ion + Ion ChEBI - ion + ion ChEBI - ion + ion IUPAC - Ionen + Ionen ChEBI - iones + iones ChEBI - ions + ions ChEBI @@ -10897,6 +13869,85 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + + 0 + Pb + InChI=1S/Pb + WABPQHHGFIMREM-UHFFFAOYSA-N + 207.20000 + 207.97665 + [Pb] + KEGG:C06696 + WebElements:Pb + lead + chebi_ontology + 82Pb + Blei + Pb + lead + plomb + plomo + plumbum + CHEBI:25016 + + lead atom + + + + + lead + IUPAC + + + + + + 82Pb + IUPAC + + + + + Blei + ChEBI + + + + + Pb + IUPAC + + + + + lead + ChEBI + + + + + plomb + ChEBI + + + + + plomo + ChEBI + + + + + plumbum + IUPAC + + + + @@ -10906,6 +13957,196 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + 0 + Mg + InChI=1S/Mg + FYYHWMGAXLPEAU-UHFFFAOYSA-N + 24.30500 + 23.98504 + [Mg] + CAS:7439-95-4 + DrugBank:DB01378 + Gmelin:16207 + KEGG:C00305 + WebElements:Mg + magnesium + chebi_ontology + 12Mg + Magnesium + Mg + magnesio + magnesium + CHEBI:25107 + + magnesium atom + + + + + CAS:7439-95-4 + ChemIDplus + + + + + Gmelin:16207 + Gmelin + + + + + magnesium + IUPAC + + + + + + 12Mg + IUPAC + + + + + Magnesium + ChEBI + + + + + Mg + IUPAC + + + + + Mg + UniProt + + + + + magnesio + ChEBI + + + + + magnesium + ChEBI + + + + + + + + + 0 + Hg + InChI=1S/Hg + QSHDDOUJBYECFT-UHFFFAOYSA-N + 200.59000 + 201.97064 + [Hg] + CAS:7439-97-6 + WebElements:Hg + mercury + chebi_ontology + 80Hg + Hg + Quecksilber + azogue + hydrargyrum + liquid silver + mercure + mercurio + mercury + quicksilver + CHEBI:25195 + + mercury atom + + + + + CAS:7439-97-6 + ChemIDplus + + + + + mercury + IUPAC + + + + + + 80Hg + IUPAC + + + + + Hg + IUPAC + + + + + Quecksilber + ChemIDplus + + + + + azogue + ChEBI + + + + + hydrargyrum + IUPAC + + + + + liquid silver + ChemIDplus + + + + + mercure + ChemIDplus + + + + + mercurio + ChEBI + + + + + mercury + ChEBI + + + + + quicksilver + ChemIDplus + + + + @@ -11022,28 +14263,8 @@ For example, A and B may be gene products and binding of B by A positively regul - +1 - 0.00000 - [*+] - chebi_ontology - monoatomic monocations - monovalent inorganic cations - CHEBI:25414 - - monoatomic monocation + monoatomic monocation - - - - monoatomic monocations - ChEBI - - - - - monovalent inorganic cations - ChEBI - @@ -11395,12 +14616,167 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + 0 + K + InChI=1S/K + ZLMJMSJWJFRBEC-UHFFFAOYSA-N + 39.09830 + 38.96371 + [K] + CAS:7440-09-7 + DrugBank:DB01345 + KEGG:C00238 + WebElements:K + potassium + chebi_ontology + 19K + K + Kalium + kalium + potasio + potassium + CHEBI:26216 + + potassium atom + + + + + CAS:7440-09-7 + ChemIDplus + + + + + potassium + IUPAC + + + + + + 19K + IUPAC + + + + + K + IUPAC + + + + + Kalium + ChemIDplus + + + + + kalium + IUPAC + + + + + potasio + ChEBI + + + + + potassium + ChEBI + + + + - sodium atom + 0 + Na + InChI=1S/Na + KEAYESYHFKHZAL-UHFFFAOYSA-N + 22.98977 + 22.98977 + [Na] + CAS:7440-23-5 + Gmelin:16221 + KEGG:C01330 + WebElements:Na + sodium + chebi_ontology + 11Na + Na + Natrium + natrium + sodio + sodium + CHEBI:26708 + + sodium atom + + + + CAS:7440-23-5 + ChemIDplus + + + + + Gmelin:16221 + Gmelin + + + + + sodium + IUPAC + + + + + + 11Na + IUPAC + + + + + Na + IUPAC + + + + + Natrium + ChemIDplus + + + + + natrium + IUPAC + + + + + sodio + ChemIDplus + + + + + sodium + ChEBI + @@ -11469,8 +14845,118 @@ For example, A and B may be gene products and binding of B by A positively regul - sulfur atom + 0 + S + InChI=1S/S + NINIDFKCEFEMDL-UHFFFAOYSA-N + 32.06600 + 31.97207 + [S] + CAS:7704-34-9 + KEGG:C00087 + KEGG:D06527 + PPDB:605 + WebElements:S + sulfur + chebi_ontology + 16S + Elemental sulfur + S + Schwefel + azufre + soufre + sulfur + sulphur + theion + CHEBI:26833 + + sulfur atom + + + + CAS:7704-34-9 + ChemIDplus + + + + + CAS:7704-34-9 + NIST Chemistry WebBook + + + + + sulfur + IUPAC + + + + + + 16S + IUPAC + + + + + Elemental sulfur + KEGG_COMPOUND + + + + + S + IUPAC + + + + + S + KEGG_COMPOUND + + + + + Schwefel + ChEBI + + + + + azufre + ChEBI + + + + + soufre + ChEBI + + + + + sulfur + ChEBI + + + + + sulfur + UniProt + + + + + sulphur + ChEBI + + + + + theion + IUPAC + @@ -11499,12 +14985,186 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + + 0 + Sn + InChI=1S/Sn + ATJFFYVFTNAWJD-UHFFFAOYSA-N + 118.71000 + 119.90220 + [Sn] + CAS:7440-31-5 + UM-BBD_compID:c0585 + WebElements:Sn + tin + chebi_ontology + 50Sn + Sn + Zinn + estano + etain + stannum + tin + CHEBI:27007 + + tin atom + + + + + CAS:7440-31-5 + ChemIDplus + + + + + UM-BBD_compID:c0585 + UM-BBD + + + + + tin + IUPAC + + + + + + 50Sn + IUPAC + + + + + Sn + IUPAC + + + + + Zinn + ChemIDplus + + + + + estano + ChEBI + + + + + etain + ChEBI + + + + + stannum + IUPAC + + + + + tin + ChEBI + + + + - transition element atom + An element whose atom has an incomplete d sub-shell, or which can give rise to cations with an incomplete d sub-shell. + transition element + chebi_ontology + Uebergangselement + Uebergangsmetalle + metal de transicion + metal de transition + metales de transicion + metaux de transition + transition element + transition elements + transition metal + transition metals + CHEBI:27081 + + transition element atom + + + + transition element + IUPAC + + + + + + Uebergangselement + ChEBI + + + + + Uebergangsmetalle + ChEBI + + + + + metal de transicion + ChEBI + + + + + metal de transition + ChEBI + + + + + metales de transicion + ChEBI + + + + + metaux de transition + ChEBI + + + + + transition element + ChEBI + + + + + transition elements + ChEBI + + + + + transition metal + ChEBI + + + + + transition metals + ChEBI + @@ -11542,6 +15202,182 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + 0 + U + InChI=1S/U + JFALSRSLKYAFGM-UHFFFAOYSA-N + 238.02890 + 238.05079 + [U] + CAS:7440-61-1 + WebElements:U + uranium + chebi_ontology + 92U + U + Uran + uranio + uranium + CHEBI:27214 + + uranium atom + + + + + CAS:7440-61-1 + ChemIDplus + + + + + uranium + IUPAC + + + + + + 92U + IUPAC + + + + + U + IUPAC + + + + + Uran + ChEBI + + + + + uranio + ChEBI + + + + + uranium + ChEBI + + + + + + + + + 0 + Zn + InChI=1S/Zn + HCHKCACWOHOZIP-UHFFFAOYSA-N + 65.39000 + 63.92914 + [Zn] + CAS:7440-66-6 + Gmelin:16321 + KEGG:C00038 + PDBeChem:ZN + WebElements:Zn + zinc + chebi_ontology + 30Zn + Zink + Zn + Zn(II) + Zn2+ + cinc + zinc + zincum + CHEBI:27363 + + zinc atom + + + + + CAS:7440-66-6 + ChemIDplus + + + + + CAS:7440-66-6 + KEGG COMPOUND + + + + + Gmelin:16321 + Gmelin + + + + + zinc + IUPAC + + + + + + 30Zn + IUPAC + + + + + Zink + ChEBI + + + + + Zn + IUPAC + + + + + Zn(II) + KEGG_COMPOUND + + + + + Zn2+ + KEGG_COMPOUND + + + + + cinc + ChEBI + + + + + zinc + ChEBI + + + + + zincum + ChEBI + + + + @@ -11599,6 +15435,388 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + + + 0 + B + InChI=1S/B + ZOXJGFHDIHLPTG-UHFFFAOYSA-N + 10.81100 + 11.00930 + [B] + CHEBI:22915 + CHEBI:3152 + CAS:7440-42-8 + KEGG:C06266 + WebElements:B + boron + chebi_ontology + 5B + B + Bor + Boron + boracium + bore + boro + boron + CHEBI:27560 + + boron atom + + + + + CAS:7440-42-8 + ChemIDplus + + + + + CAS:7440-42-8 + KEGG COMPOUND + + + + + boron + IUPAC + + + + + + 5B + IUPAC + + + + + B + KEGG_COMPOUND + + + + + Bor + ChEBI + + + + + Boron + KEGG_COMPOUND + + + + + boracium + ChEBI + + + + + bore + ChEBI + + + + + boro + ChEBI + + + + + boron + ChEBI + + + + + + + + + + 0 + As + InChI=1S/As + RQNWIZPPADIBDY-UHFFFAOYSA-N + 74.92160 + 74.92159 + [As] + CHEBI:22630 + CHEBI:2845 + CAS:7440-38-2 + KEGG:C06269 + WebElements:As + arsenic + chebi_ontology + 33As + Arsen + Arsenic + As + arsenic + arsenico + arsenicum + CHEBI:27563 + + arsenic atom + + + + + CAS:7440-38-2 + ChemIDplus + + + + + CAS:7440-38-2 + KEGG COMPOUND + + + + + arsenic + IUPAC + + + + + + 33As + IUPAC + + + + + Arsen + ChemIDplus + + + + + Arsenic + KEGG_COMPOUND + + + + + As + KEGG_COMPOUND + + + + + arsenic + ChEBI + + + + + arsenico + ChEBI + + + + + arsenicum + ChEBI + + + + + + + + + + 0 + Se + InChI=1S/Se + BUGBHKTXTAQXES-UHFFFAOYSA-N + 78.96000 + 79.91652 + [Se] + CHEBI:26627 + CHEBI:9091 + CAS:7782-49-2 + DrugBank:DB11135 + FooDB:FDB013400 + HMDB:HMDB0001349 + KEGG:C01529 + WebElements:Se + Wikipedia:Selenium + selenium + chebi_ontology + 34Se + Se + Selen + Selenium + selenio + selenium + CHEBI:27568 + + selenium atom + + + + + CAS:7782-49-2 + ChemIDplus + + + + + CAS:7782-49-2 + NIST Chemistry WebBook + + + + + selenium + IUPAC + + + + + + 34Se + IUPAC + + + + + Se + IUPAC + + + + + Selen + ChemIDplus + + + + + Selenium + KEGG_COMPOUND + + + + + selenio + ChEBI + + + + + selenium + ChEBI + + + + + + + + + + + 0 + Si + InChI=1S/Si + XUIMIQQOPSSXEZ-UHFFFAOYSA-N + 28.08550 + 27.97693 + [Si] + CHEBI:26676 + CHEBI:9140 + CAS:7440-21-3 + KEGG:C06263 + WebElements:Si + silicon + chebi_ontology + 14Si + Si + Silicon + Silizium + silicio + silicium + silicon + CHEBI:27573 + + silicon atom + + + + + CAS:7440-21-3 + ChemIDplus + + + + + silicon + IUPAC + + + + + + 14Si + IUPAC + + + + + Si + IUPAC + + + + + Si + KEGG_COMPOUND + + + + + Silicon + KEGG_COMPOUND + + + + + Silizium + ChEBI + + + + + silicio + ChEBI + + + + + silicium + ChEBI + + + + + silicon + ChEBI + + + + @@ -11712,439 +15930,1571 @@ For example, A and B may be gene products and binding of B by A positively regul - + - - - - - - - - - - - - - - - - - A one-carbon compound that is ammonia in which one of the hydrogens is replaced by a carboxy group. Although carbamic acid derivatives are common, carbamic acid itself has never been synthesised. + + + + A cobalt group element atom that has atomic number 27. 0 - CH3NO2 - InChI=1S/CH3NO2/c2-1(3)4/h2H2,(H,3,4) - KXDHJXZQYSOELW-UHFFFAOYSA-N - 61.04006 - 61.01638 - NC(O)=O - CHEBI:22504 - CHEBI:23002 - CHEBI:3386 - CHEBI:44573 - Beilstein:1734754 - CAS:463-77-4 - DrugBank:DB04261 - Gmelin:130345 - KEGG:C01563 - PDBeChem:OUT - Wikipedia:Carbamic_acid - CARBAMIC ACID - Carbamic acid - carbamic acid + Co + InChI=1S/Co + GUTLYIVDDKVIGB-UHFFFAOYSA-N + 58.93320 + 58.93319 + [Co] + CHEBI:23335 + CHEBI:3788 + CAS:7440-48-4 + KEGG:C00175 + KEGG:C19171 + PDBeChem:3CO + WebElements:Co + cobalt chebi_ontology - Aminoameisensaeure - Aminoformic acid - Carbamate - Carbamidsaeure - CHEBI:28616 + 27Co + Co + Cobalt + Kobalt + cobalt + cobalto + cobaltum + CHEBI:27638 - carbamic acid + cobalt atom - + - Beilstein:1734754 - Beilstein + CAS:7440-48-4 + ChemIDplus - + - CAS:463-77-4 + CAS:7440-48-4 + KEGG COMPOUND + + + + + CAS:7440-48-4 + NIST Chemistry WebBook + + + + + cobalt + IUPAC + + + + + + 27Co + IUPAC + + + + + Co + IUPAC + + + + + Co + UniProt + + + + + Cobalt + KEGG_COMPOUND + + + + + Kobalt + NIST_Chemistry_WebBook + + + + + cobalt + ChEBI + + + + + cobalto + ChEBI + + + + + cobaltum + ChEBI + + + + + + + + + 0 + V + InChI=1S/V + LEONUFNNVUYDNQ-UHFFFAOYSA-N + 50.94150 + 50.94396 + [V] + CHEBI:27274 + CHEBI:9930 + CAS:7440-62-2 + KEGG:C06267 + WebElements:V + vanadium + chebi_ontology + 23V + V + Vanadium + vanadio + vanadium + CHEBI:27698 + + vanadium atom + + + + + CAS:7440-62-2 ChemIDplus - + - CAS:463-77-4 + CAS:7440-62-2 KEGG COMPOUND - + - Gmelin:130345 - Gmelin + CAS:7440-62-2 + NIST Chemistry WebBook - + - CARBAMIC ACID - PDBeChem + vanadium + IUPAC + - + + + 23V + IUPAC + + + + + V + IUPAC + + + + + V + KEGG_COMPOUND + + + + + Vanadium + KEGG_COMPOUND + + + + + vanadio + ChEBI + + + + + vanadium + ChEBI + + + + + + + + + 0 + W + InChI=1S/W + WFKWXMTUELFFGS-UHFFFAOYSA-N + 183.84000 + 183.95093 + [W] + CHEBI:27170 + CHEBI:9779 + CAS:7440-33-7 + Gmelin:16317 + KEGG:C00753 + PDBeChem:W + WebElements:W + Tungsten + tungsten + wolfram + chebi_ontology + 74W + W + Wolfram + tungsten atom + tungstene + tungsteno + volframio + wolframio + wolframium + CHEBI:27998 + + tungsten + + + + + CAS:7440-33-7 + ChemIDplus + + + + + CAS:7440-33-7 + KEGG COMPOUND + + + + + CAS:7440-33-7 + NIST Chemistry WebBook + + + + + Gmelin:16317 + Gmelin + + + - Carbamic acid + Tungsten KEGG_COMPOUND - + - carbamic acid + tungsten IUPAC - + + + wolfram + IUPAC + + + + - Aminoameisensaeure + 74W + IUPAC + + + + + W + IUPAC + + + + + W + UniProt + + + + + Wolfram + NIST_Chemistry_WebBook + + + + + tungsten atom ChEBI - + - Aminoformic acid + tungstene + ChEBI + + + + + tungsteno + ChEBI + + + + + volframio + ChEBI + + + + + wolframio + ChEBI + + + + + wolframium + ChEBI + + + + + + + + + + A chromium group element atom that has atomic number 24. + 0 + Cr + InChI=1S/Cr + VYZAMTAEIAYCRO-UHFFFAOYSA-N + 51.99610 + 51.94051 + [Cr] + CHEBI:23235 + CHEBI:3678 + CAS:7440-47-3 + KEGG:C06268 + WebElements:Cr + chromium + chebi_ontology + 24Cr + Chrom + Chromium + Cr + chrome + chromium + cromo + CHEBI:28073 + + chromium atom + + + + + CAS:7440-47-3 + ChemIDplus + + + + + CAS:7440-47-3 + KEGG COMPOUND + + + + + chromium + IUPAC + + + + + + 24Cr + IUPAC + + + + + Chrom + ChemIDplus + + + + + Chromium KEGG_COMPOUND - + - Carbamate + Cr + IUPAC + + + + + Cr KEGG_COMPOUND - + - Carbamidsaeure + chrome + ChEBI + + + + + chromium + ChEBI + + + + + cromo ChEBI - + - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - An onium cation obtained by protonation of ammonia. - +1 - H4N - InChI=1S/H3N/h1H3/p+1 - QGZKDVFQNNGYKY-UHFFFAOYSA-O - 18.03850 - 18.03383 - [H][N+]([H])([H])[H] - CHEBI:22534 - CHEBI:49783 - CHEBI:7435 - CAS:14798-03-9 - Gmelin:84 - KEGG:C01342 - MetaCyc:AMMONIUM - MolBase:929 - PDBeChem:NH4 - PMID:11319011 - PMID:11341317 - PMID:12096804 - PMID:14512268 - PMID:14879753 - PMID:16345391 - PMID:16903292 - PMID:17392693 - PMID:18515490 - PMID:19199063 - PMID:19596600 - PMID:19682559 - PMID:19716251 - PMID:21993530 - PMID:22265469 - PMID:22524020 - PMID:22562341 - PMID:22631217 - Reaxys:16093784 - Wikipedia:Ammonium - ammonium - azanium + + + + Chemical element (nickel group element atom) with atomic number 28. + 0 + Ni + InChI=1S/Ni + PXHVJJICTQNCMI-UHFFFAOYSA-N + 58.69340 + 57.93534 + [Ni] + CHEBI:25515 + CHEBI:7552 + CAS:7440-02-0 + Gmelin:16229 + KEGG:C00291 + PMID:12756270 + PMID:14634084 + PMID:14734778 + PMID:15165199 + PMID:19828094 + PMID:20477134 + PMID:22762130 + PMID:23142754 + PMID:23317102 + PMID:23692032 + PMID:23692035 + PMID:23723488 + PMID:23834453 + PMID:23857010 + PMID:23895079 + PMID:23909687 + PMID:9060994 + PMID:9886425 + Reaxys:4122946 + WebElements:Ni + Wikipedia:Nickel + nickel chebi_ontology - Ammonium(1+) - NH4(+) - NH4+ - [NH4](+) - ammonium cation - ammonium ion - CHEBI:28938 + 28Ni + Ni + Nickel + Raney alloy + niccolum + nickel + niquel + CHEBI:28112 - ammonium + nickel atom - + - CAS:14798-03-9 + CAS:7440-02-0 ChemIDplus - + - CAS:14798-03-9 + CAS:7440-02-0 + KEGG COMPOUND + + + + + CAS:7440-02-0 NIST Chemistry WebBook - + - Gmelin:84 + Gmelin:16229 Gmelin - + - PMID:11319011 + PMID:12756270 Europe PMC - + - PMID:11341317 + PMID:14634084 Europe PMC - + - PMID:12096804 + PMID:14734778 Europe PMC - + - PMID:14512268 + PMID:15165199 Europe PMC - + - PMID:14879753 + PMID:19828094 Europe PMC - + - PMID:16345391 + PMID:20477134 Europe PMC - + - PMID:16903292 + PMID:22762130 Europe PMC - + - PMID:17392693 + PMID:23142754 Europe PMC - + - PMID:18515490 + PMID:23317102 Europe PMC - + - PMID:19199063 + PMID:23692032 Europe PMC - + - PMID:19596600 + PMID:23692035 Europe PMC - + - PMID:19682559 + PMID:23723488 Europe PMC - + - PMID:19716251 + PMID:23834453 Europe PMC - + - PMID:21993530 + PMID:23857010 Europe PMC - + - PMID:22265469 + PMID:23895079 Europe PMC - + - PMID:22524020 + PMID:23909687 Europe PMC - + - PMID:22562341 + PMID:9060994 Europe PMC - + - PMID:22631217 + PMID:9886425 Europe PMC - + - Reaxys:16093784 + Reaxys:4122946 Reaxys - - - ammonium - ChEBI - - - + - ammonium + nickel IUPAC - - - azanium + + + 28Ni IUPAC - - + - Ammonium(1+) - ChemIDplus + Ni + IUPAC - + - NH4(+) - IUPAC + Ni + UniProt - + - NH4(+) - UniProt + Nickel + ChEBI - + - NH4+ - KEGG_COMPOUND + Raney alloy + ChemIDplus - + - [NH4](+) - MolBase + niccolum + ChEBI - + - ammonium cation - ChemIDplus + nickel + ChEBI - + - ammonium ion - PDBeChem + niquel + ChEBI - + - - - + + + + - - + + - The conjugate base formed when the carboxy group of a carboxylic acid is deprotonated. - -1 - CO2R - 44.00950 - 43.98983 - [O-]C([*])=O - CHEBI:13626 - CHEBI:13945 - CHEBI:23026 - CHEBI:58657 + + + + + + + A one-carbon compound that is ammonia in which one of the hydrogens is replaced by a carboxy group. Although carbamic acid derivatives are common, carbamic acid itself has never been synthesised. + 0 + CH3NO2 + InChI=1S/CH3NO2/c2-1(3)4/h2H2,(H,3,4) + KXDHJXZQYSOELW-UHFFFAOYSA-N + 61.04006 + 61.01638 + NC(O)=O + CHEBI:22504 + CHEBI:23002 + CHEBI:3386 + CHEBI:44573 + Beilstein:1734754 + CAS:463-77-4 + DrugBank:DB04261 + Gmelin:130345 + KEGG:C01563 + PDBeChem:OUT + Wikipedia:Carbamic_acid + CARBAMIC ACID + Carbamic acid + carbamic acid chebi_ontology - a carboxylate - carboxylic acid anions - carboxylic anions - CHEBI:29067 + Aminoameisensaeure + Aminoformic acid + Carbamate + Carbamidsaeure + CHEBI:28616 - carboxylic acid anion + carbamic acid - + + + Beilstein:1734754 + Beilstein + + + + + CAS:463-77-4 + ChemIDplus + + + + + CAS:463-77-4 + KEGG COMPOUND + + + + + Gmelin:130345 + Gmelin + + + + + CARBAMIC ACID + PDBeChem + + + + + Carbamic acid + KEGG_COMPOUND + + + + + carbamic acid + IUPAC + + + + + + Aminoameisensaeure + ChEBI + + + + + Aminoformic acid + KEGG_COMPOUND + + + + + Carbamate + KEGG_COMPOUND + + + + + Carbamidsaeure + ChEBI + + + + + + + + + + 0 + P + InChI=1S/P + OAICVXFJPJFONN-UHFFFAOYSA-N + 30.97376 + 30.97376 + [P] + CHEBI:26080 + CHEBI:8168 + CAS:7723-14-0 + Gmelin:16235 + KEGG:C06262 + WebElements:P + phosphorus + chebi_ontology + 15P + P + Phosphor + Phosphorus + fosforo + phosphore + phosphorus + CHEBI:28659 + + phosphorus atom + + + + + CAS:7723-14-0 + ChemIDplus + + + + + CAS:7723-14-0 + KEGG COMPOUND + + + + + Gmelin:16235 + Gmelin + + + + + phosphorus + IUPAC + + + + + + 15P + IUPAC + + + + + P + IUPAC + + + + + P + KEGG_COMPOUND + + + + + Phosphor + ChEBI + + + + + Phosphorus + KEGG_COMPOUND + + + + + fosforo + ChEBI + + + + + phosphore + ChEBI + + + + + phosphorus + ChEBI + + + + + + + + + 0 + Mo + InChI=1S/Mo + ZOKXTWBITQBERF-UHFFFAOYSA-N + 95.94000 + 97.90541 + [Mo] + CHEBI:25369 + CHEBI:49750 + CHEBI:6968 + CAS:7439-98-7 + Gmelin:16205 + KEGG:C00150 + WebElements:Mo + molybdenum + chebi_ontology + 42Mo + Mo + Molybdaen + Molybdenum + molibdeno + molybdene + molybdenum + CHEBI:28685 + + molybdenum atom + + + + + CAS:7439-98-7 + ChemIDplus + + + + + CAS:7439-98-7 + KEGG COMPOUND + + + + + CAS:7439-98-7 + NIST Chemistry WebBook + + + + + Gmelin:16205 + Gmelin + + + + + molybdenum + IUPAC + + + + + + 42Mo + IUPAC + + + + + Mo + IUPAC + + + + + Mo + UniProt + + + + + Molybdaen + ChEBI + + + + + Molybdenum + KEGG_COMPOUND + + + + + molibdeno + ChEBI + + + + + molybdene + ChEBI + + + + + molybdenum + ChEBI + + + + + + + + + + 0 + Cu + InChI=1S/Cu + RYGMFSIKBFXOCR-UHFFFAOYSA-N + 63.54600 + 62.92960 + [Cu] + CHEBI:23376 + CHEBI:3874 + CAS:7440-50-8 + Gmelin:16269 + KEGG:C00070 + WebElements:Cu + copper + chebi_ontology + 29Cu + Copper + Cu + Kupfer + cobre + copper + cuivre + cuprum + CHEBI:28694 + + copper atom + + + + + CAS:7440-50-8 + ChemIDplus + + + + + CAS:7440-50-8 + KEGG COMPOUND + + + + + Gmelin:16269 + Gmelin + + + + + copper + IUPAC + + + + + + 29Cu + IUPAC + + + + + Copper + KEGG_COMPOUND + + + + + Cu + ChEBI + + + + + Cu + IUPAC + + + + + Kupfer + ChEBI + + + + + cobre + ChEBI + + + + + copper + ChEBI + + + + + cuivre + ChEBI + + + + + cuprum + IUPAC + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + An onium cation obtained by protonation of ammonia. + +1 + H4N + InChI=1S/H3N/h1H3/p+1 + QGZKDVFQNNGYKY-UHFFFAOYSA-O + 18.03850 + 18.03383 + [H][N+]([H])([H])[H] + CHEBI:22534 + CHEBI:49783 + CHEBI:7435 + CAS:14798-03-9 + Gmelin:84 + KEGG:C01342 + MetaCyc:AMMONIUM + MolBase:929 + PDBeChem:NH4 + PMID:11319011 + PMID:11341317 + PMID:12096804 + PMID:14512268 + PMID:14879753 + PMID:16345391 + PMID:16903292 + PMID:17392693 + PMID:18515490 + PMID:19199063 + PMID:19596600 + PMID:19682559 + PMID:19716251 + PMID:21993530 + PMID:22265469 + PMID:22524020 + PMID:22562341 + PMID:22631217 + Reaxys:16093784 + Wikipedia:Ammonium + ammonium + azanium + chebi_ontology + Ammonium(1+) + NH4(+) + NH4+ + [NH4](+) + ammonium cation + ammonium ion + CHEBI:28938 + + ammonium + + + + + CAS:14798-03-9 + ChemIDplus + + + + + CAS:14798-03-9 + NIST Chemistry WebBook + + + + + Gmelin:84 + Gmelin + + + + + PMID:11319011 + Europe PMC + + + + + PMID:11341317 + Europe PMC + + + + + PMID:12096804 + Europe PMC + + + + + PMID:14512268 + Europe PMC + + + + + PMID:14879753 + Europe PMC + + + + + PMID:16345391 + Europe PMC + + + + + PMID:16903292 + Europe PMC + + + + + PMID:17392693 + Europe PMC + + + + + PMID:18515490 + Europe PMC + + + + + PMID:19199063 + Europe PMC + + + + + PMID:19596600 + Europe PMC + + + + + PMID:19682559 + Europe PMC + + + + + PMID:19716251 + Europe PMC + + + + + PMID:21993530 + Europe PMC + + + + + PMID:22265469 + Europe PMC + + + + + PMID:22524020 + Europe PMC + + + + + PMID:22562341 + Europe PMC + + + + + PMID:22631217 + Europe PMC + + + + + Reaxys:16093784 + Reaxys + + + + + ammonium + ChEBI + + + + + ammonium + IUPAC + + + + + + azanium + IUPAC + + + + + + Ammonium(1+) + ChemIDplus + + + + + NH4(+) + IUPAC + + + + + NH4(+) + UniProt + + + + + NH4+ + KEGG_COMPOUND + + + + + [NH4](+) + MolBase + + + + + ammonium cation + ChemIDplus + + + + + ammonium ion + PDBeChem + + + + + + + + + + 0 + Al + InChI=1S/Al + XAGFODPZIPBFFR-UHFFFAOYSA-N + 26.98154 + 26.98154 + [Al] + CHEBI:22471 + CHEBI:2616 + CAS:7429-90-5 + DrugBank:DB01370 + Gmelin:16248 + KEGG:C06264 + WebElements:Al + aluminium + chebi_ontology + 13Al + Al + Aluminium + aluminio + aluminium + aluminum + CHEBI:28984 + + aluminium atom + + + + + CAS:7429-90-5 + ChemIDplus + + + + + CAS:7429-90-5 + KEGG COMPOUND + + + + + Gmelin:16248 + Gmelin + + + + + aluminium + IUPAC + + + + + + 13Al + IUPAC + + + + + Al + IUPAC + + + + + Al + KEGG_COMPOUND + + + + + Aluminium + ChEBI + + + + + Aluminium + KEGG_COMPOUND + + + + + aluminio + ChEBI + + + + + aluminium + ChEBI + + + + + aluminum + NIST_Chemistry_WebBook + + + + + + + + + + + + + + + + The conjugate base formed when the carboxy group of a carboxylic acid is deprotonated. + -1 + CO2R + 44.00950 + 43.98983 + [O-]C([*])=O + CHEBI:13626 + CHEBI:13945 + CHEBI:23026 + CHEBI:58657 + chebi_ontology + a carboxylate + carboxylic acid anions + carboxylic anions + CHEBI:29067 + + carboxylic acid anion + + + a carboxylate UniProt @@ -12176,6 +17526,328 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + The stable isotope of hydrogen with relative atomic mass 1.007825 and a natural abundance of 99.9885 atom percent (from Greek pirhoomegatauomicronsigma, first). + 0 + [1H] + InChI=1S/H/i1+0 + YZCKVEUIGOORGS-IGMARMGPSA-N + 1.008 + 1.00783 + [1H] + protium + chebi_ontology + (1)1H + (1)H + hydrogen-1 + protio + protium + CHEBI:29236 + + protium atom + + + + + protium + IUPAC + + + + + + (1)1H + IUPAC + + + + + (1)H + IUPAC + + + + + hydrogen-1 + ChEBI + + + + + protio + ChEBI + + + + + protium + ChEBI + + + + + + + + + The stable isotope of hydrogen with relative atomic mass 2.014102 and a natural abundance of 0.0115 atom percent (from Greek deltaepsilonupsilontauepsilonrhoomicronnu, second). + 0 + D + InChI=1S/H2/h1H/i1+1 + UFHFLCQGNIYNRP-OUBTZVSYSA-N + 2.014 + 2.01410 + [2H] + deuterium + chebi_ontology + (2)1H + (2)H + D + Deuterium + deuterio + deuterium + heavy hydrogen + hidrogeno pesado + hydrogen-2 + schwerer Wasserstoff + CHEBI:29237 + + deuterium atom + + + + + deuterium + IUPAC + + + + + + (2)1H + IUPAC + + + + + (2)H + IUPAC + + + + + D + IUPAC + + + + + Deuterium + ChEBI + + + + + deuterio + ChEBI + + + + + deuterium + ChEBI + + + + + heavy hydrogen + ChEBI + + + + + hidrogeno pesado + ChEBI + + + + + hydrogen-2 + ChEBI + + + + + schwerer Wasserstoff + ChEBI + + + + + + + + + The radioactive isotope of hydrogen with relative atomic mass 3.016049 and half-life of 12.33 years (from Greek taurhoiotatauomicronsigma, third). + 0 + T + InChI=1S/H2/h1H/i1+2 + UFHFLCQGNIYNRP-NJFSPNSNSA-N + 3.016 + 3.01605 + [3H] + tritium + chebi_ontology + (3)1H + (3)H + T + hydrogen-3 + tritio + tritium + ueberschwerer Wasserstoff + CHEBI:29238 + + tritium atom + + + + + tritium + IUPAC + + + + + + (3)1H + IUPAC + + + + + (3)H + IUPAC + + + + + T + IUPAC + + + + + hydrogen-3 + ChEBI + + + + + tritio + ChEBI + + + + + tritium + ChEBI + + + + + ueberschwerer Wasserstoff + ChEBI + + + + + + + + + 0 + Au + InChI=1S/Au + PCHJSUWPFVWCPO-UHFFFAOYSA-N + 196.96655 + 196.96657 + [Au] + CAS:7440-57-5 + WebElements:Au + gold + chebi_ontology + 79Au + Au + Gold + aurum + gold + or + oro + CHEBI:29287 + + gold atom + + + + + CAS:7440-57-5 + ChemIDplus + + + + + gold + IUPAC + + + + + + 79Au + IUPAC + + + + + Au + IUPAC + + + + + Gold + ChEBI + + + + + aurum + IUPAC + + + + + gold + ChEBI + + + + + or + ChEBI + + + + + oro + ChEBI + + + + @@ -12296,6 +17968,76 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + 0 + Li + InChI=1S/Li + WHXSMMKQMYFTQS-UHFFFAOYSA-N + 6.94100 + 7.01600 + [Li] + CAS:7439-93-2 + WebElements:Li + lithium + chebi_ontology + 3Li + Li + Lithium + lithium + litio + CHEBI:30145 + + lithium atom + + + + + CAS:7439-93-2 + NIST Chemistry WebBook + + + + + lithium + IUPAC + + + + + + 3Li + IUPAC + + + + + Li + IUPAC + + + + + Lithium + ChEBI + + + + + lithium + ChEBI + + + + + litio + ChEBI + + + + @@ -12521,6 +18263,139 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + The stable isotope of helium with relative atomic mass 3.016029. The least abundant (0.000137 atom percent) isotope of naturally occurring helium. + 0 + [3He] + InChI=1S/He/i1-1 + SWQJXJOGLNCZEY-BJUDXGSMSA-N + 3.016 + 3.01603 + [3He] + CAS:14762-55-1 + Gmelin:14208 + helium-3 + chebi_ontology + (3)2He + (3)He + (3He)helium + helium, isotope of mass 3 + helium-3 + CHEBI:30218 + + helium-3 atom + + + + + CAS:14762-55-1 + ChemIDplus + + + + + Gmelin:14208 + Gmelin + + + + + helium-3 + IUPAC + + + + + + (3)2He + IUPAC + + + + + (3)He + IUPAC + + + + + (3He)helium + ChemIDplus + + + + + helium, isotope of mass 3 + ChemIDplus + + + + + helium-3 + ChEBI + + + + + + + + + The stable isotope of helium with relative atomic mass 4.002603. The most abundant (99.99 atom percent) isotope of naturally occurring helium. + 0 + [4He] + InChI=1S/He/i1+0 + SWQJXJOGLNCZEY-IGMARMGPSA-N + 4.003 + 4.00260 + [4He] + Gmelin:14207 + helium-4 + chebi_ontology + (4)2He + (4)He + helium-4 + CHEBI:30219 + + helium-4 atom + + + + + Gmelin:14207 + Gmelin + + + + + helium-4 + IUPAC + + + + + + (4)2He + IUPAC + + + + + (4)He + IUPAC + + + + + helium-4 + ChEBI + + + + @@ -12564,156 +18439,1186 @@ For example, A and B may be gene products and binding of B by A positively regul - + - - - +2 - 0.00000 - [*++] - CHEBI:23856 - CHEBI:4665 - KEGG:C00572 + + + 0 + At + InChI=1S/At + RYXHOMYVWAEKHL-UHFFFAOYSA-N + 210.00000 + 210.00000 + [At] + CAS:7440-68-8 + Gmelin:40440 + WebElements:At + astatine chebi_ontology - Divalent cation - divalent inorganic cations - monoatomic dications - CHEBI:30412 + 85At + Astat + At + astate + astatine + astato + CHEBI:30415 - monoatomic dication + astatine atom - + + + CAS:7440-68-8 + ChemIDplus + + + + + CAS:7440-68-8 + NIST Chemistry WebBook + + + + + Gmelin:40440 + Gmelin + + + + + astatine + IUPAC + + + + - Divalent cation - KEGG_COMPOUND + 85At + IUPAC + + + + + Astat + ChEBI + + + + + At + IUPAC + + + + + astate + ChEBI - + - divalent inorganic cations + astatine ChEBI - + - monoatomic dications + astato ChEBI - + - - - An amide is a derivative of an oxoacid RkE(=O)l(OH)m (l =/= 0) in which an acidic hydroxy group has been replaced by an amino or substituted amino group. - CHEBI:22473 - CHEBI:2633 - KEGG:C00241 - Amide - amides + + + A metallic element first identified and named from the brilliant indigo (Latin indicum) blue line in its flame spectrum. + 0 + In + InChI=1S/In + APFVFJFRJDLVQX-UHFFFAOYSA-N + 114.81800 + 114.90388 + [In] + CAS:7440-74-6 + Gmelin:16297 + WebElements:In + indium chebi_ontology - CHEBI:32988 + 49In + In + Indium + indio + indium + CHEBI:30430 - amide + indium atom - - - Amide - KEGG_COMPOUND + + + CAS:7440-74-6 + ChemIDplus - + + + CAS:7440-74-6 + NIST Chemistry WebBook + + + + + Gmelin:16297 + Gmelin + + + - amides + indium IUPAC - - - - - - - - - Intended use of the molecular entity or part thereof by humans. - chebi_ontology - CHEBI:33232 - - application - - - - - - - - - A particle not known to have substructure. - elementary particle - chebi_ontology - elementary particles - CHEBI:33233 - - fundamental particle - - - - elementary particle + + + 49In IUPAC - - + + + In + IUPAC + + + - elementary particles + Indium ChEBI - - - - - - - - A monoatomic entity is a molecular entity consisting of a single atom. - chebi_ontology - atomic entity - monoatomic entities - CHEBI:33238 - - monoatomic entity - - + - atomic entity + indio ChEBI - + - monoatomic entities + indium ChEBI - + - - - oxoacid derivative + + + A metallic element first identified and named from the brilliant green line in its flame spectrum (from Greek thetaalphalambdalambdaomicronsigma, a green shoot). + 0 + Tl + InChI=1S/Tl + BKVIYDNLLOSFOA-UHFFFAOYSA-N + 204.38330 + 204.97443 + [Tl] + CAS:7440-28-0 + Gmelin:16308 + WebElements:Tl + thallium + chebi_ontology + 81Tl + Tl + talio + CHEBI:30440 + + thallium - - - - - + + + + CAS:7440-28-0 + ChemIDplus + + + + + CAS:7440-28-0 + NIST Chemistry WebBook + + + + + Gmelin:16308 + Gmelin + + + + + thallium + IUPAC + + + + + + 81Tl + IUPAC + + + + + Tl + IUPAC + + + + + talio + ChEBI + + + + + + + + + + + 0 + Ge + InChI=1S/Ge + GNPVGFCGXDBREM-UHFFFAOYSA-N + 72.61000 + 73.92118 + [Ge] + CAS:7440-56-4 + WebElements:Ge + germanium + chebi_ontology + 32Ge + Ge + germanio + germanium + CHEBI:30441 + + germanium atom + + + + + CAS:7440-56-4 + ChemIDplus + + + + + CAS:7440-56-4 + NIST Chemistry WebBook + + + + + germanium + IUPAC + + + + + + 32Ge + IUPAC + + + + + Ge + IUPAC + + + + + germanio + ChEBI + + + + + germanium + ChEBI + + + + + + + + + + 0 + Te + InChI=1S/Te + PORWMNRCUJJQNO-UHFFFAOYSA-N + 127.60000 + 129.90622 + [Te] + CAS:13494-80-9 + Gmelin:16309 + WebElements:Te + tellurium + chebi_ontology + 52Te + Te + Tellur + tellure + tellurium + teluro + CHEBI:30452 + + tellurium atom + + + + + CAS:13494-80-9 + ChemIDplus + + + + + CAS:13494-80-9 + NIST Chemistry WebBook + + + + + Gmelin:16309 + Gmelin + + + + + tellurium + IUPAC + + + + + + 52Te + IUPAC + + + + + Te + IUPAC + + + + + Tellur + ChEBI + + + + + tellure + ChEBI + + + + + tellurium + ChEBI + + + + + teluro + ChEBI + + + + + + + + + + Alkaline earth metal atom with atomic number 4. + 0 + Be + InChI=1S/Be + ATBAMAFKBVZNFJ-UHFFFAOYSA-N + 9.01218 + 9.01218 + [Be] + CAS:7440-41-7 + Gmelin:16265 + PMID:10858219 + PMID:11897645 + PMID:14643414 + PMID:16951350 + PMID:18250483 + PMID:18768897 + PMID:24912188 + Reaxys:14617151 + WebElements:Be + beryllium + chebi_ontology + 4Be + Be + Beryllium + berilio + beryllium + CHEBI:30501 + + beryllium atom + + + + + CAS:7440-41-7 + ChemIDplus + + + + + CAS:7440-41-7 + NIST Chemistry WebBook + + + + + Gmelin:16265 + Gmelin + + + + + PMID:10858219 + Europe PMC + + + + + PMID:11897645 + Europe PMC + + + + + PMID:14643414 + Europe PMC + + + + + PMID:16951350 + Europe PMC + + + + + PMID:18250483 + Europe PMC + + + + + PMID:18768897 + Europe PMC + + + + + PMID:24912188 + Europe PMC + + + + + Reaxys:14617151 + Reaxys + + + + + beryllium + IUPAC + + + + + + 4Be + IUPAC + + + + + Be + IUPAC + + + + + Beryllium + ChEBI + + + + + berilio + ChEBI + + + + + beryllium + ChEBI + + + + + + + + + 0 + Ag + InChI=1S/Ag + BQCADISMDOOEFD-UHFFFAOYSA-N + 107.86820 + 106.90509 + [Ag] + CAS:7440-22-4 + WebElements:Ag + silver + chebi_ontology + 47Ag + Ag + Silber + argent + argentum + plata + silver + CHEBI:30512 + + silver atom + + + + + CAS:7440-22-4 + ChemIDplus + + + + + silver + IUPAC + + + + + + 47Ag + IUPAC + + + + + Ag + IUPAC + + + + + Silber + ChemIDplus + + + + + argent + ChEBI + + + + + argentum + IUPAC + + + + + plata + ChEBI + + + + + silver + ChEBI + + + + + + + + + + 0 + Sb + InChI=1S/Sb + WATWJIUSRGPENY-UHFFFAOYSA-N + 121.76000 + 120.90381 + [Sb] + WebElements:Sb + antimony + chebi_ontology + 51Sb + Antimon + Sb + antimoine + antimonio + antimony + stibium + CHEBI:30513 + + antimony atom + + + + + antimony + IUPAC + + + + + + 51Sb + IUPAC + + + + + Antimon + ChEBI + + + + + Sb + IUPAC + + + + + antimoine + ChEBI + + + + + antimonio + ChEBI + + + + + antimony + ChEBI + + + + + stibium + IUPAC + + + + + + + + + 0 + Cs + InChI=1S/Cs + TVFDJXOCXUVLDH-UHFFFAOYSA-N + 132.90545 + 132.90545 + [Cs] + WebElements:Cs + caesium + chebi_ontology + 55Cs + Caesium + Cs + Zaesium + caesium + cesio + cesium + CHEBI:30514 + + caesium atom + + + + + caesium + IUPAC + + + + + + 55Cs + IUPAC + + + + + Caesium + ChEBI + + + + + Cs + IUPAC + + + + + Zaesium + ChEBI + + + + + caesium + ChEBI + + + + + cesio + ChEBI + + + + + cesium + ChEBI + + + + + cesium + IUPAC + + + + + + + + + + 0 + Ru + InChI=1S/Ru + KJTLSVCANCCWHF-UHFFFAOYSA-N + 101.07000 + 101.90434 + [Ru] + CAS:7440-18-8 + WebElements:Ru + ruthenium + chebi_ontology + 44Ru + Ru + Ruthenium + rutenio + ruthenium + CHEBI:30682 + + ruthenium atom + + + + + CAS:7440-18-8 + ChemIDplus + + + + + CAS:7440-18-8 + NIST Chemistry WebBook + + + + + ruthenium + IUPAC + + + + + + 44Ru + IUPAC + + + + + Ru + IUPAC + + + + + Ruthenium + ChEBI + + + + + rutenio + ChEBI + + + + + ruthenium + ChEBI + + + + + + + + + + 0 + Os + InChI=1S/Os + SYQBFIAQOQZEGI-UHFFFAOYSA-N + 190.23000 + 191.96148 + [Os] + CAS:7440-04-2 + Gmelin:16234 + WebElements:Os + osmium + chebi_ontology + 76Os + Os + osmio + osmium + CHEBI:30687 + + osmium atom + + + + + CAS:7440-04-2 + ChemIDplus + + + + + CAS:7440-04-2 + NIST Chemistry WebBook + + + + + Gmelin:16234 + Gmelin + + + + + osmium + IUPAC + + + + + + 76Os + IUPAC + + + + + Os + IUPAC + + + + + osmio + ChEBI + + + + + osmium + ChEBI + + + + + + + + + 0 + Ba + InChI=1S/Ba + DSAJWYNOEDNPEQ-UHFFFAOYSA-N + 137.32700 + 137.90525 + [Ba] + WebElements:Ba + barium + chebi_ontology + 56Ba + Ba + Barium + bario + barium + baryum + CHEBI:32594 + + barium atom + + + + + barium + IUPAC + + + + + + 56Ba + IUPAC + + + + + Ba + IUPAC + + + + + Barium + ChEBI + + + + + bario + ChEBI + + + + + barium + ChEBI + + + + + baryum + ChEBI + + + + + + + + + An amide is a derivative of an oxoacid RkE(=O)l(OH)m (l =/= 0) in which an acidic hydroxy group has been replaced by an amino or substituted amino group. + CHEBI:22473 + CHEBI:2633 + KEGG:C00241 + Amide + amides + chebi_ontology + CHEBI:32988 + + amide + + + + + Amide + KEGG_COMPOUND + + + + + amides + IUPAC + + + + + + + + + + + 0 + Eu + InChI=1S/Eu + OGPBJKLSAFTDLK-UHFFFAOYSA-N + 151.96400 + 152.92124 + [Eu] + CAS:7440-53-1 + Gmelin:16279 + WebElements:Eu + europium + chebi_ontology + 63Eu + Eu + europio + europium + CHEBI:32999 + + europium atom + + + + + CAS:7440-53-1 + ChemIDplus + + + + + Gmelin:16279 + Gmelin + + + + + europium + IUPAC + + + + + + 63Eu + IUPAC + + + + + Eu + IUPAC + + + + + europio + ChEBI + + + + + europium + ChEBI + + + + + + + + + + Intended use of the molecular entity or part thereof by humans. + chebi_ontology + CHEBI:33232 + + application + + + + + + + + + A particle not known to have substructure. + elementary particle + chebi_ontology + elementary particles + CHEBI:33233 + + fundamental particle + + + + + elementary particle + IUPAC + + + + + + elementary particles + ChEBI + + + + + + + + + monoatomic entity + + + + + + + + + oxoacid derivative + + + + + + @@ -12917,7 +19822,6 @@ For example, A and B may be gene products and binding of B by A positively regul - 0 H @@ -13114,41 +20018,14 @@ For example, A and B may be gene products and binding of B by A positively regul - A molecular entity all atoms of which have the same atomic number. - chebi_ontology - homoatomic entity - homoatomic molecular entities - homoatomic molecular entity - CHEBI:33259 - - elemental molecular entity + elemental molecular entity - - - - homoatomic entity - ChEBI - - - - - homoatomic molecular entities - ChEBI - - - - - homoatomic molecular entity - ChEBI - - - chebi_ontology CHEBI:33260 @@ -13352,6 +20229,84 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + + 0 + Bi + InChI=1S/Bi + JCXGWMGPZLAOME-UHFFFAOYSA-N + 208.98038 + 208.98040 + [Bi] + CAS:7440-69-9 + WebElements:Bi + bismuth + chebi_ontology + 83Bi + Bi + Bismut + Wismut + bismuth + bismuto + CHEBI:33301 + + bismuth atom + + + + + CAS:7440-69-9 + ChemIDplus + + + + + bismuth + IUPAC + + + + + + 83Bi + IUPAC + + + + + Bi + IUPAC + + + + + Bismut + ChEBI + + + + + Wismut + ChEBI + + + + + bismuth + ChEBI + + + + + bismuto + ChEBI + + + + @@ -13706,10 +20661,235 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + + 0 + Ne + InChI=1S/Ne + GKAOGPIIYCISHV-UHFFFAOYSA-N + 20.17970 + 19.99244 + [Ne] + CAS:7440-01-9 + WebElements:Ne + neon + chebi_ontology + 10Ne + Ne + Neon + neon + CHEBI:33310 + + neon atom + + + + + CAS:7440-01-9 + ChemIDplus + + + + + neon + IUPAC + + + + + + 10Ne + IUPAC + + + + + Ne + ChEBI + + + + + Neon + ChEBI + + + + + neon + ChEBI + + + + + + + + + + A radioactive metallic element discovered in 1898 by Marie Sklodowska Curie and named after her home country, Poland (Latin Polonia). + 0 + Po + InChI=1S/Po + HZEBHPIOVYHPMT-UHFFFAOYSA-N + 209.00000 + 209.00000 + [Po] + CAS:7440-08-6 + Gmelin:40435 + WebElements:Po + polonium + chebi_ontology + 84Po + Po + polonio + polonium + CHEBI:33313 + + polonium atom + + + + + CAS:7440-08-6 + ChemIDplus + + + + + CAS:7440-08-6 + NIST Chemistry WebBook + + + + + Gmelin:40435 + Gmelin + + + + + polonium + IUPAC + + + + + + 84Po + IUPAC + + + + + Po + IUPAC + + + + + polonio + ChEBI + + + + + polonium + ChEBI + + + + + + + + + + 0 + Rn + InChI=1S/Rn + SYUHGPGVQRZVTB-UHFFFAOYSA-N + 222.00000 + 222.00000 + [Rn] + CAS:10043-92-2 + Gmelin:16242 + WebElements:Rn + radon + chebi_ontology + 86Rn + Rn + niton + radium emanation + radon + CHEBI:33314 + + radon atom + + + + + CAS:10043-92-2 + ChemIDplus + + + + + CAS:10043-92-2 + NIST Chemistry WebBook + + + + + Gmelin:16242 + Gmelin + + + + + radon + IUPAC + + + + + + 86Rn + IUPAC + + + + + Rn + IUPAC + + + + + niton + ChemIDplus + + + + + radium emanation + ChemIDplus + + + + + radon + ChEBI + + + + - 0 He @@ -13733,7 +20913,6 @@ For example, A and B may be gene products and binding of B by A positively regul - +2 He @@ -13765,6 +20944,54 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + group 13 elements + chebi_ontology + Element der Borgruppe + boron group element + boron group elements + group III elements + CHEBI:33317 + + boron group element atom + + + + + group 13 elements + IUPAC + + + + + + Element der Borgruppe + ChEBI + + + + + boron group element + ChEBI + + + + + boron group elements + ChEBI + + + + + group III elements + ChEBI + + + + @@ -13807,1527 +21034,6651 @@ For example, A and B may be gene products and binding of B by A positively regul - - - - - iron group element atom - - - - - - - - - - sulfur oxoacid derivative - - - - - - - - - - - elemental pnictogen - - - - - - - - - transition element molecular entity - - - - - - - - - actinoid molecular entity - - - - - - - - - uranium molecular entity - - - - - - - - - alkali metal cation - - - - - - - - - metal atom - - - - - + - - - - - - - - - An amino-acid anion obtained by deprotonation of any alpha-amino acid. - alpha-amino-acid anion + + + lanthanoids chebi_ontology - alpha-amino acid anions - alpha-amino-acid anions - CHEBI:33558 + Lanthanoid + Lanthanoide + Lanthanoidengruppe + Lanthanoidenreiche + Ln + lanthanide + lanthanides + lanthanoid + CHEBI:33319 - alpha-amino-acid anion + lanthanoid atom - + - alpha-amino-acid anion + lanthanoids + IUPAC + + + + + + Lanthanoid ChEBI - + - alpha-amino acid anions + Lanthanoide ChEBI - + - alpha-amino-acid anions + Lanthanoidengruppe ChEBI - - - - - - - - chebi_ontology - s-block element - s-block elements - CHEBI:33559 - - s-block element atom - - + - s-block element + Lanthanoidenreiche ChEBI - + - s-block elements + Ln ChEBI - - - - - - - - Any main group element atom belonging to the p-block of the periodic table. - chebi_ontology - p-block element - p-block elements - CHEBI:33560 - - p-block element atom - - + - p-block element + lanthanide ChEBI - + - p-block elements + lanthanides + ChEBI + + + + + lanthanoid ChEBI - - - - - d-block element atom - - - - - + - - - - - - - - - - - - - - - - - A carbon oxoacid acid carrying at least one -C(=O)OH group and having the structure RC(=O)OH, where R is any any monovalent functional group. Carboxylic acids are the most common type of organic acid. - 0 - CHO2R - 45.01740 - 44.99765 - OC([*])=O - CHEBI:13428 - CHEBI:13627 - CHEBI:23027 - PMID:17147560 - PMID:18433345 - Wikipedia:Carboxylic_acid - carboxylic acid - carboxylic acids + + + actinoids chebi_ontology - Carbonsaeure - Carbonsaeuren - Karbonsaeure - RC(=O)OH - acide carboxylique - acides carboxyliques - acido carboxilico - acidos carboxilicos - CHEBI:33575 + Actinoid + Actinoide + Actinoidenelemente + Actinoidengruppe + Aktinoide + Aktinoidenelemente + An + actinide + actinides + actinoid + CHEBI:33320 - carboxylic acid + actinoid atom - - - PMID:17147560 - Europe PMC - - - - - PMID:18433345 - Europe PMC - - - + - carboxylic acid + actinoids IUPAC - - - carboxylic acids - IUPAC - + + + Actinoid + ChEBI - + - Carbonsaeure + Actinoide ChEBI - + - Carbonsaeuren + Actinoidenelemente ChEBI - + - Karbonsaeure + Actinoidengruppe ChEBI - + - RC(=O)OH - IUPAC + Aktinoide + ChEBI - + - acide carboxylique - IUPAC + Aktinoidenelemente + ChEBI - + - acides carboxyliques - IUPAC + An + ChEBI - + - acido carboxilico - IUPAC + actinide + ChEBI - + - acidos carboxilicos - IUPAC + actinides + ChEBI + + + + + actinoid + ChEBI - + - - - - - - - - - A molecular entity containing one or more atoms from any of groups 1, 2, 13, 14, 15, 16, 17, and 18 of the periodic table. + + + rare earth metals chebi_ontology - main group compounds - main group molecular entities - CHEBI:33579 + rare earth metal + CHEBI:33321 - main group molecular entity + rare earth metal atom - - - main group compounds - ChEBI + + + rare earth metals + IUPAC + - + - main group molecular entities + rare earth metal ChEBI - + - - - - - - - - - carbon group molecular entity + + + 0 + Rb + InChI=1S/Rb + IGLNJRXAVVLDKE-UHFFFAOYSA-N + 85.46780 + 84.91179 + [Rb] + CAS:7440-17-7 + DrugBank:DB06749 + Gmelin:16244 + WebElements:Rb + rubidium chebi_ontology - carbon group molecular entities - CHEBI:33582 + 37Rb + Rb + rubidio + rubidium + CHEBI:33322 - carbon group molecular entity + rubidium atom - + + + CAS:7440-17-7 + ChemIDplus + + + + + CAS:7440-17-7 + NIST Chemistry WebBook + + + + + Gmelin:16244 + Gmelin + + + - carbon group molecular entity + rubidium + IUPAC + + + + + + 37Rb + IUPAC + + + + + Rb + IUPAC + + + + + rubidio ChEBI - + - carbon group molecular entities + rubidium ChEBI - + - - - - - - - - - A main group molecular entity containing one or more atoms of any noble gas. - noble gas molecular entity + + + 0 + Fr + InChI=1S/Fr + KLMCZVJOEAUDNE-UHFFFAOYSA-N + 223.00000 + 223.00000 + [Fr] + CAS:7440-73-5 + Gmelin:40458 + WebElements:Fr + francium chebi_ontology - noble gas compounds - noble gas molecular entities - CHEBI:33583 + 87Fr + Fr + Franzium + francio + francium + CHEBI:33323 - noble gas molecular entity + francium atom - + + + CAS:7440-73-5 + ChemIDplus + + + + + CAS:7440-73-5 + NIST Chemistry WebBook + + + + + Gmelin:40458 + Gmelin + + + - noble gas molecular entity - ChEBI + francium + IUPAC + - + - noble gas compounds - ChEBI + 87Fr + IUPAC - + - noble gas molecular entities - ChEBI + Fr + IUPAC - - - - - - - - Any molecule that consists of a series of atoms joined together to form a ring. - Wikipedia:Cyclic_compound - chebi_ontology - cyclic compounds - CHEBI:33595 - - cyclic compound - - + - cyclic compounds + Franzium ChEBI - - - - - - - - - - - - - - chebi_ontology - hydrogen compounds - hydrogen molecular entities - CHEBI:33608 - - hydrogen molecular entity - - + - hydrogen compounds + francio ChEBI - + - hydrogen molecular entities + francium ChEBI - - - - - polycyclic compound - - - - - + - - - A cyclically conjugated molecular entity with a stability (due to delocalization) significantly greater than that of a hypothetical localized structure (e.g. Kekule structure) is said to possess aromatic character. - aromatic compounds - aromatic molecular entity - chebi_ontology - aromatics - aromatische Verbindungen - CHEBI:33655 + + + 0 + Sr + InChI=1S/Sr + CIOAGBVUUVVLOB-UHFFFAOYSA-N + 87.62000 + 87.90561 + [Sr] + CAS:7440-24-6 + WebElements:Sr + strontium + chebi_ontology + 38Sr + Sr + estroncio + strontium + CHEBI:33324 - aromatic compound + strontium atom - + + + CAS:7440-24-6 + ChemIDplus + + + + + CAS:7440-24-6 + NIST Chemistry WebBook + + + - aromatic compounds + strontium IUPAC - - - aromatic molecular entity + + + 38Sr IUPAC - - + - aromatics - ChEBI + Sr + IUPAC - + - aromatische Verbindungen + estroncio ChEBI - - - - - - - - - chebi_ontology - organic aromatic compounds - CHEBI:33659 - - organic aromatic compound - - + - organic aromatic compounds + strontium ChEBI - + - - - - - - - - - An s-block molecular entity is a molecular entity containing one or more atoms of an s-block element. - s-block molecular entity + + + 0 + Ra + InChI=1S/Ra + HCWPIIXVSYCSAN-UHFFFAOYSA-N + 226.00000 + 226.00000 + [Ra] + CAS:7440-14-4 + WebElements:Ra + radium chebi_ontology - s-block compounds - s-block molecular entities - CHEBI:33674 + 88Ra + Ra + radio + radium + CHEBI:33325 - s-block molecular entity + radium atom - + + + CAS:7440-14-4 + ChemIDplus + + + + + CAS:7440-14-4 + NIST Chemistry WebBook + + + - s-block molecular entity - ChEBI + radium + IUPAC + - + - s-block compounds + 88Ra + IUPAC + + + + + Ra + IUPAC + + + + + radio ChEBI - + - s-block molecular entities + radium ChEBI - + - - - - - - - - - A main group molecular entity that contains one or more atoms of a p-block element. + + + + + 0 + Sc + InChI=1S/Sc + SIXSYDAISGFNSX-UHFFFAOYSA-N + 44.95591 + 44.95591 + [Sc] + CAS:7440-20-2 + WebElements:Sc + scandium chebi_ontology - p-block compounds - p-block molecular entities - p-block molecular entitiy - CHEBI:33675 + 21Sc + Sc + Skandium + escandio + scandium + CHEBI:33330 - p-block molecular entity + scandium atom - + + + CAS:7440-20-2 + ChemIDplus + + + + + CAS:7440-20-2 + NIST Chemistry WebBook + + + + + scandium + IUPAC + + + + - p-block compounds + 21Sc + IUPAC + + + + + Sc + IUPAC + + + + + Skandium ChEBI - + - p-block molecular entities + escandio ChEBI - + - p-block molecular entitiy + scandium ChEBI - - - - - d-block molecular entity - - - - - - - - - f-block molecular entity - - - - - + - - - - - - - - - - helium molecular entity + + + + + 0 + Y + InChI=1S/Y + VWQVUPCCIRVNHF-UHFFFAOYSA-N + 88.90585 + 88.90584 + [Y] + CAS:7440-65-5 + Gmelin:16319 + WebElements:Y + yttrium chebi_ontology - helium compounds - helium molecular entities - CHEBI:33679 + 39Y + Y + ytrio + yttrium + CHEBI:33331 - helium molecular entity + yttrium atom - + + + CAS:7440-65-5 + ChemIDplus + + + + + CAS:7440-65-5 + NIST Chemistry WebBook + + + + + Gmelin:16319 + Gmelin + + + - helium molecular entity + yttrium + IUPAC + + + + + + 39Y + IUPAC + + + + + Y ChEBI - + - helium compounds + ytrio ChEBI - + - helium molecular entities + yttrium ChEBI - - - - - chebi_ontology - CHEBI:33680 - - elemental helium - - - - - - - - - - Hydrides are chemical compounds of hydrogen with other chemical elements. - chebi_ontology - CHEBI:33692 - - hydrides - - - - - - - - - oxygen hydride - - - - - + - - - - A macromolecule formed by a living organism. - biopolymer + + + group 3 elements chebi_ontology - Biopolymere - biomacromolecules - biopolymers - CHEBI:33694 + scandium group element + scandium group elements + CHEBI:33335 - biomacromolecule + scandium group element atom - + - biopolymer + group 3 elements IUPAC - - - Biopolymere - ChEBI - - - + - biomacromolecules + scandium group element ChEBI - + - biopolymers + scandium group elements ChEBI - + - - + + + + + 0 + La + InChI=1S/La + FZLIPJUXYLNCLC-UHFFFAOYSA-N + 138.90550 + 138.90636 + [La] + CAS:7439-91-0 + Gmelin:16203 + WebElements:La + lanthanum chebi_ontology - genetically encoded biomacromolecules - genetically encoded biopolymers - information biomacromolecules - information biopolymers - information macromolecule - information macromolecules - CHEBI:33695 + 57La + La + Lanthan + lantano + lanthane + lanthanum + CHEBI:33336 - information biomacromolecule + lanthanum atom - + + + CAS:7439-91-0 + ChemIDplus + + + + + CAS:7439-91-0 + NIST Chemistry WebBook + + + + + Gmelin:16203 + Gmelin + + + + + lanthanum + IUPAC + + + + - genetically encoded biomacromolecules - ChEBI + 57La + IUPAC - + - genetically encoded biopolymers + La ChEBI - + - information biomacromolecules + Lanthan ChEBI - + - information biopolymers + lantano ChEBI - + - information macromolecule + lanthane ChEBI - + - information macromolecules + lanthanum ChEBI - + - - - - - - - - - - - - - - - A macromolecule made up of nucleotide units and hydrolysable into certain pyrimidine or purine bases (usually adenine, cytosine, guanine, thymine, uracil), D-ribose or 2-deoxy-D-ribose and phosphoric acid. - nucleic acids - chebi_ontology - NA - Nukleinsaeure - Nukleinsaeuren - acide nucleique - acides nucleiques - acido nucleico - acidos nucleicos - CHEBI:33696 + + + + 0 + Ac + InChI=1S/Ac + QQINRWTZWGJFDB-UHFFFAOYSA-N + 227.00000 + 227.00000 + [Ac] + CAS:7440-34-8 + WebElements:Ac + actinium + chebi_ontology + 89Ac + Ac + Aktinium + actinio + actinium + CHEBI:33337 - nucleic acid + actinium atom - + + + CAS:7440-34-8 + ChemIDplus + + + + + CAS:7440-34-8 + NIST Chemistry WebBook + + + - nucleic acids + actinium IUPAC - + - NA - ChEBI + 89Ac + IUPAC - + - Nukleinsaeure - ChEBI + Ac + IUPAC - + - Nukleinsaeuren + Aktinium ChEBI - + - acide nucleique + actinio ChEBI - + - acides nucleiques + actinium ChEBI + + + + + + + + group 12 elements + chebi_ontology + zinc group element + zinc group elements + CHEBI:33340 + + zinc group element atom + - + + + group 12 elements + IUPAC + + + + - acido nucleico + zinc group element ChEBI - + - acidos nucleicos + zinc group elements ChEBI - + - - - - - - - - - - - - - - - High molecular weight, linear polymers, composed of nucleotides containing ribose and linked by phosphodiester bonds; RNA is central to the synthesis of proteins. - CAS:63231-63-0 - ribonucleic acid - ribonucleic acids - chebi_ontology - RNA - RNS - Ribonukleinsaeure - pentosenucleic acids - ribonucleic acids - ribose nucleic acid - yeast nucleic acid - CHEBI:33697 + + + 0 + Ti + InChI=1S/Ti + RTAQQCXQSZGOHL-UHFFFAOYSA-N + 47.86700 + 47.94794 + [Ti] + CAS:7440-32-6 + WebElements:Ti + titanium + chebi_ontology + 22Ti + Ti + Titan + titane + titanio + titanium + CHEBI:33341 - ribonucleic acid + titanium atom - + - CAS:63231-63-0 + CAS:7440-32-6 ChemIDplus - - - ribonucleic acid - IUPAC + + + CAS:7440-32-6 + NIST Chemistry WebBook - + - ribonucleic acids + titanium IUPAC - + - RNA + 22Ti IUPAC - - - RNA - UniProt - - - + - RNS - ChEBI + Ti + IUPAC - + - Ribonukleinsaeure + Titan ChEBI - - - pentosenucleic acids - ChemIDplus - - - + - ribonucleic acids + titane ChEBI - + - ribose nucleic acid + titanio ChEBI - + - yeast nucleic acid + titanium ChEBI - + - - + + + 0 + Zr + InChI=1S/Zr + QCWXUUIWCKQGHC-UHFFFAOYSA-N + 91.22400 + 89.90470 + [Zr] + CAS:7440-67-7 + WebElements:Zr + zirconium chebi_ontology - canonical amino-acid residue - canonical amino-acid residues - common amino acid residues - proteinogenic amino-acid residues - standard amino acid residues - standard amino-acid residues - CHEBI:33700 + 40Zr + Zirkonium + Zr + circonio + zirconio + zirconium + CHEBI:33342 - proteinogenic amino-acid residue + zirconium atom - + + + CAS:7440-67-7 + ChemIDplus + + + + + CAS:7440-67-7 + NIST Chemistry WebBook + + + + + zirconium + IUPAC + + + + - canonical amino-acid residue - ChEBI + 40Zr + IUPAC - + - canonical amino-acid residues + Zirkonium ChEBI - + - common amino acid residues - ChEBI + Zr + IUPAC - + - proteinogenic amino-acid residues + circonio ChEBI - + - standard amino acid residues + zirconio ChEBI - + - standard amino-acid residues + zirconium ChEBI - + - - - - - - - - - - - - - - - An amino acid in which the amino group is located on the carbon atom at the position alpha to the carboxy group. + + 0 - C2H4NO2R - 74.05870 - 74.02420 - NC([*])C(O)=O - CHEBI:10208 - CHEBI:13779 - CHEBI:22442 - CHEBI:2642 - KEGG:C00045 - KEGG:C05167 - alpha-amino acid + Hf + InChI=1S/Hf + VBJZVLUMGGDVMO-UHFFFAOYSA-N + 178.49000 + 179.94656 + [Hf] + CAS:7440-58-6 + WebElements:Hf + hafnium chebi_ontology - Amino acid - Amino acids - alpha-amino acids - alpha-amino carboxylic acids - CHEBI:33704 + 72Hf + Hf + hafnio + hafnium + CHEBI:33343 - alpha-amino acid + hafnium atom - + + + CAS:7440-58-6 + ChemIDplus + + + + + CAS:7440-58-6 + NIST Chemistry WebBook + + + - alpha-amino acid + hafnium IUPAC - + - Amino acid - KEGG_COMPOUND + 72Hf + IUPAC - + - Amino acids - KEGG_COMPOUND + Hf + IUPAC - + - alpha-amino acids + hafnio ChEBI - - - alpha-amino acids - JCBN - - - + - alpha-amino carboxylic acids - IUPAC + hafnium + ChEBI - + - - - - - - - - - When two or more amino acids combine to form a peptide, the elements of water are removed, and what remains of each amino acid is called an amino-acid residue. - amino acid residue - amino-acid residue - protein residue + + + 0 + Nb + InChI=1S/Nb + GUCVJGMIXFAOAE-UHFFFAOYSA-N + 92.90638 + 92.90637 + [Nb] + CAS:7440-03-1 + WebElements:Nb + niobium chebi_ontology - amino acid residue - amino-acid residues - CHEBI:33708 + 41Nb + Nb + Niob + columbio + columbium + niobio + niobium + CHEBI:33344 - amino-acid residue + niobium atom - - - When two or more amino acids combine to form a peptide, the elements of water are removed, and what remains of each amino acid is called an amino-acid residue. - Dummy:dummy + + + CAS:7440-03-1 + ChemIDplus - + + + CAS:7440-03-1 + NIST Chemistry WebBook + + + - amino-acid residue + niobium IUPAC - - - protein residue - PRO:DAN + + + 41Nb + IUPAC - + - amino acid residue - ChEBI + Nb + IUPAC - + - amino-acid residues - JCBN + Niob + ChEBI - - - - - - - - - - - - - - - A carboxylic acid containing one or more amino groups. - CHEBI:13815 - CHEBI:22477 - Wikipedia:Amino_acid - chebi_ontology - Aminocarbonsaeure - Aminokarbonsaeure - Aminosaeure - amino acids - CHEBI:33709 - - amino acid - - + - Aminocarbonsaeure + columbio ChEBI - + - Aminokarbonsaeure - ChEBI + columbium + NIST_Chemistry_WebBook - + - Aminosaeure + niobio ChEBI - + - amino acids + niobium ChEBI - + - - - - - - - - + + + group 4 elements chebi_ontology - alpha-amino-acid residues - CHEBI:33710 + titanium group element + titanium group elements + CHEBI:33345 - alpha-amino-acid residue + titanium group element atom - + + + group 4 elements + IUPAC + + + + - alpha-amino-acid residues + titanium group element + ChEBI + + + + + titanium group elements ChEBI - - - - - iron group molecular entity - - - - - - - - - copper group molecular entity - - - - - - - - - nickel group molecular entity - - - - - - - - - platinum molecular entity - - - - - + - - - chebi_ontology - canonical nucleoside residues - common nucleoside residues - nucleoside residue - standard nucleoside residues - CHEBI:33791 + + + 0 + Rf + InChI=1S/Rf + YGPLJIIQQIDVFJ-UHFFFAOYSA-N + 261.00000 + 267.00000 + [Rf] + WebElements:Rf + rutherfordium + chebi_ontology + 104Rf + Ku + Rf + Unq + kurchatovium + rutherfordio + rutherfordium + unnilquadium + CHEBI:33346 - canonical nucleoside residue + rutherfordium atom - - - canonical nucleoside residues - ChEBI - - - - - common nucleoside residues - CBN + + + rutherfordium + IUPAC + - + - nucleoside residue - CBN + 104Rf + IUPAC - + - standard nucleoside residues + Ku ChEBI - - - - - - - - chebi_ontology - N - Nuc - canonical ribonucleoside residues - common ribonucleoside residue - common ribonucleoside residues - standard ribonucleoside residues - CHEBI:33792 - - canonical ribonucleoside residue - - + - N - CBN + Rf + IUPAC - + - Nuc - CBN + Unq + IUPAC - + - canonical ribonucleoside residues + kurchatovium ChEBI - + - common ribonucleoside residue - CBN + rutherfordio + ChEBI - + - common ribonucleoside residues - CBN + rutherfordium + ChEBI - + - standard ribonucleoside residues - ChEBI + unnilquadium + IUPAC - + - - - - Any organic molecule that consists of atoms connected in the form of a ring. - chebi_ontology - organic cyclic compounds - CHEBI:33832 + + + group 5 elements + chebi_ontology + vanadium group element + vanadium group elements + CHEBI:33347 - organic cyclic compound + vanadium group element atom - + + + group 5 elements + IUPAC + + + + - organic cyclic compounds + vanadium group element + ChEBI + + + + + vanadium group elements ChEBI - + - - - - A heterocyclic compound formally derived from an arene by replacement of one or more methine (-C=) and/or vinylene (-CH=CH-) groups by trivalent or divalent heteroatoms, respectively, in such a way as to maintain the continuous pi-electron system characteristic of aromatic systems and a number of out-of-plane pi-electrons corresponding to the Hueckel rule (4n+2). - heteroarenes - chebi_ontology - hetarenes - CHEBI:33833 + + + 0 + Ta + InChI=1S/Ta + GUVRBAGPIYLISA-UHFFFAOYSA-N + 180.94790 + 180.94800 + [Ta] + CAS:7440-25-7 + WebElements:Ta + tantalum + chebi_ontology + 73Ta + Ta + Tantal + tantale + tantalo + tantalum + CHEBI:33348 - heteroarene + tantalum atom - + + + CAS:7440-25-7 + ChemIDplus + + + + + CAS:7440-25-7 + NIST Chemistry WebBook + + + - heteroarenes + tantalum IUPAC - + - hetarenes + 73Ta IUPAC - - - - - - - - - conjugated protein - - - - - - - - - A macromolecule is a molecule of high relative molecular mass, the structure of which essentially comprises the multiple repetition of units derived, actually or conceptually, from molecules of low relative molecular mass. - Wikipedia:Macromolecule - macromolecule - chebi_ontology - macromolecules - polymer - polymer molecule - polymers - CHEBI:33839 - - macromolecule - - - - macromolecule + + + Ta IUPAC - - + - macromolecules + Tantal ChEBI - + - polymer + tantale ChEBI - + - polymer molecule - IUPAC + tantalo + ChEBI - + - polymers + tantalum ChEBI - + - - - A substance used in a chemical reaction to detect, measure, examine, or produce other substances. - reagent + + + 0 + Db + 262.00000 + 270.00000 + [Db] + WebElements:Db + dubnium chebi_ontology - reactif - reactivo - reagents - CHEBI:33893 + 105Db + Db + Ha + Ns + Unp + dubnio + dubnium + hahnium + nielsbohrium + unnilpentium + CHEBI:33349 - reagent + dubnium atom - + - reagent + dubnium IUPAC - + - reactif + 105Db IUPAC - + - reactivo + Db IUPAC - + + + Ha + ChEBI + + + + + Ns + ChEBI + + + + + Unp + IUPAC + + + + + dubnio + ChEBI + + + + + dubnium + ChEBI + + + + + hahnium + ChEBI + + + + + nielsbohrium + ChEBI + + + + + unnilpentium + IUPAC + + + + + + + + + group 6 elements + chebi_ontology + chromium group element + chromium group elements + CHEBI:33350 + + chromium group element atom + + + + + group 6 elements + IUPAC + + + + + + chromium group element + ChEBI + + + + + chromium group elements + ChEBI + + + + + + + + + 0 + Sg + 263.00000 + 271.00000 + [Sg] + WebElements:Sg + seaborgium + chebi_ontology + 106Sg + Sg + Unh + seaborgio + seaborgium + unnilhexium + CHEBI:33351 + + seaborgium atom + + + + + seaborgium + IUPAC + + + + + + 106Sg + IUPAC + + + + + Sg + IUPAC + + + + + Unh + ChEBI + + + + + seaborgio + ChEBI + + + + + seaborgium + ChEBI + + + + + unnilhexium + IUPAC + + + + + + + + + group 7 elements + chebi_ontology + manganese group element + manganese group elements + CHEBI:33352 + + manganese group element atom + + + + + group 7 elements + IUPAC + + + + + + manganese group element + ChEBI + + + + + manganese group elements + ChEBI + + + + + + + + + 0 + Tc + InChI=1S/Tc + GKLVYJBZJHMRIY-UHFFFAOYSA-N + 98.00000 + 97.00000 + [Tc] + CAS:7440-26-8 + Gmelin:16310 + WebElements:Tc + technetium + chebi_ontology + 43Tc + Tc + Technetium + technetium + tecnecio + CHEBI:33353 + + technetium atom + + + + + CAS:7440-26-8 + ChemIDplus + + + + + CAS:7440-26-8 + NIST Chemistry WebBook + + + + + Gmelin:16310 + Gmelin + + + + + technetium + IUPAC + + + + + + 43Tc + IUPAC + + + + + Tc + IUPAC + + + + + Technetium + ChEBI + + + + + technetium + ChEBI + + + + + tecnecio + ChEBI + + + + + + + + + 0 + Bh + 264.00000 + 270.00000 + [Bh] + WebElements:Bh + bohrium + chebi_ontology + 107Bh + Bh + Ns + Uns + bohrio + bohrium + nielsbohrium + unnilseptium + CHEBI:33355 + + bohrium atom + + + + + bohrium + IUPAC + + + + + + 107Bh + IUPAC + + + + + Bh + IUPAC + + + + + Ns + ChEBI + + + + + Uns + IUPAC + + + + + bohrio + ChEBI + + + + + bohrium + ChEBI + + + + + nielsbohrium + ChEBI + + + + + unnilseptium + IUPAC + + + + + + + + + group 8 elements + chebi_ontology + iron group element + iron group elements + CHEBI:33356 + + iron group element atom + + + + + group 8 elements + IUPAC + + + + + + iron group element + ChEBI + + + + + iron group elements + ChEBI + + + + + + + + + 0 + Hs + 265.00000 + 277.00000 + [Hs] + WebElements:Hs + hassium + chebi_ontology + 108Hs + Ha + Hs + Uno + hahnium + hassio + hassium + unniloctium + CHEBI:33357 + + hassium atom + + + + + hassium + IUPAC + + + + + + 108Hs + IUPAC + + + + + Ha + ChEBI + + + + + Hs + IUPAC + + + + + Uno + IUPAC + + + + + hahnium + ChEBI + + + + + hassio + ChEBI + + + + + hassium + ChEBI + + + + + unniloctium + IUPAC + + + + + + + + + group 9 elements + chebi_ontology + cobalt group element + cobalt group elements + CHEBI:33358 + + cobalt group element atom + + + + + group 9 elements + IUPAC + + + + + + cobalt group element + ChEBI + + + + + cobalt group elements + ChEBI + + + + + + + + + A cobalt group element atom of atomic number 45. + 0 + Rh + InChI=1S/Rh + MHOVAHRLVXNVSD-UHFFFAOYSA-N + 102.90550 + 102.90550 + [Rh] + CAS:7440-16-6 + PMID:2936374 + WebElements:Rh + Wikipedia:Rhodium + rhodium + chebi_ontology + 45Rh + Rh + rhodium + rodio + CHEBI:33359 + + rhodium atom + + + + + CAS:7440-16-6 + ChemIDplus + + + + + CAS:7440-16-6 + NIST Chemistry WebBook + + + + + PMID:2936374 + Europe PMC + + + + + rhodium + IUPAC + + + + + + 45Rh + IUPAC + + + + + Rh + ChEBI + + + + + rhodium + ChEBI + + + + + rodio + ChEBI + + + + + + + + + 0 + Mt + 0.00000 + 0.00000 + [Mt] + WebElements:Mt + meitnerium + chebi_ontology + 109Mt + Mt + Une + meitnerio + meitnerium + unnilennium + CHEBI:33361 + + meitnerium atom + + + + + meitnerium + IUPAC + + + + + + 109Mt + IUPAC + + + + + Mt + IUPAC + + + + + Une + IUPAC + + + + + meitnerio + ChEBI + + + + + meitnerium + ChEBI + + + + + unnilennium + IUPAC + + + + + + + + + group 10 elements + chebi_ontology + nickel group element + nickel group elements + CHEBI:33362 + + nickel group element atom + + + + + group 10 elements + IUPAC + + + + + + nickel group element + ChEBI + + + + + nickel group elements + ChEBI + + + + + + + + + + + Chemical element (nickel group element atom) with atomic number 46. + 0 + Pd + InChI=1S/Pd + KDLHZDBZIXYQEI-UHFFFAOYSA-N + 106.42000 + 105.90348 + [Pd] + CAS:7440-05-3 + PMID:25097477 + Reaxys:4937491 + WebElements:Pd + Wikipedia:Palladium + palladium + chebi_ontology + 46Pd + Pd + paladio + CHEBI:33363 + + palladium + + + + + CAS:7440-05-3 + ChemIDplus + + + + + CAS:7440-05-3 + NIST Chemistry WebBook + + + + + PMID:25097477 + Europe PMC + + + + + Reaxys:4937491 + Reaxys + + + + + palladium + IUPAC + + + + + + 46Pd + IUPAC + + + + + Pd + IUPAC + + + + + paladio + ChEBI + + + + + + + + + + 0 + Pt + InChI=1S/Pt + BASFCYQUMIYNBI-UHFFFAOYSA-N + 195.078 + 194.96479 + [Pt] + CAS:7440-06-4 + WebElements:Pt + platinum + chebi_ontology + 78Pt + Platin + Pt + platine + platino + CHEBI:33364 + + platinum + + + + + CAS:7440-06-4 + ChemIDplus + + + + + CAS:7440-06-4 + NIST Chemistry WebBook + + + + + platinum + IUPAC + + + + + + 78Pt + IUPAC + + + + + Platin + ChEBI + + + + + Pt + IUPAC + + + + + platine + ChEBI + + + + + platino + ChEBI + + + + + + + + + chebi_ontology + PGM + Platinmetalle + Platinoide + platinoid + platinum group metal + platinum group metals + platinum metals + CHEBI:33365 + + platinum group metal atom + + + + + PGM + ChEBI + + + + + Platinmetalle + ChEBI + + + + + Platinoide + ChEBI + + + + + platinoid + ChEBI + + + + + platinum group metal + ChEBI + + + + + platinum group metals + ChEBI + + + + + platinum metals + ChEBI + + + + + + + + + group 11 elements + chebi_ontology + coinage metals + copper group element + copper group elements + CHEBI:33366 + + copper group element atom + + + + + group 11 elements + IUPAC + + + + + + coinage metals + ChEBI + + + + + copper group element + ChEBI + + + + + copper group elements + ChEBI + + + + + + + + + 0 + Ds + InChI=1S/Ds + NCBMSFCPDGXTHD-UHFFFAOYSA-N + 0.00000 + 0.00000 + [Ds] + WebElements:Ds + darmstadtium + chebi_ontology + 110Ds + Ds + Uun + darmstadtio + ununnilium + CHEBI:33367 + + darmstadtium + + + + + darmstadtium + IUPAC + + + + + + 110Ds + IUPAC + + + + + Ds + IUPAC + + + + + Uun + IUPAC + + + + + darmstadtio + ChEBI + + + + + ununnilium + IUPAC + + + + + + + + + A copper group element atom with atomic number 111. The the ninth member of the 6d series of transition metals, it is an extremely radioactive, synthetic element. Average mass is around 281. + 0 + Rg + InChI=1S/Rg + LJROPTGWFUZRDB-UHFFFAOYSA-N + 0.000 + 0.00000 + [Rg] + WebElements:Rg + Wikipedia:Roentgenium + roentgenium + chebi_ontology + 111Rg + Rg + Roentgenium + Uuu + roentgenio + roentgenium + unununium + CHEBI:33368 + + roentgenium atom + + + + + roentgenium + IUPAC + + + + + + 111Rg + IUPAC + + + + + Rg + IUPAC + + + + + Roentgenium + ChEBI + + + + + Uuu + ChEBI + + + + + roentgenio + ChEBI + + + + + roentgenium + ChEBI + + + + + unununium + ChEBI + + + + + + + + + + 0 + Ce + InChI=1S/Ce + GWXLDORMOJMVQZ-UHFFFAOYSA-N + 140.11600 + 139.90544 + [Ce] + CAS:7440-45-1 + Gmelin:16275 + WebElements:Ce + cerium + chebi_ontology + 58Ce + Ce + Cer + Zer + cerio + CHEBI:33369 + + cerium + + + + + CAS:7440-45-1 + ChemIDplus + + + + + CAS:7440-45-1 + NIST Chemistry WebBook + + + + + Gmelin:16275 + Gmelin + + + + + cerium + ChEBI + + + + + cerium + IUPAC + + + + + + 58Ce + IUPAC + + + + + Ce + IUPAC + + + + + Cer + ChEBI + + + + + Zer + ChEBI + + + + + cerio + ChEBI + + + + + + + + + 0 + [99Tc] + InChI=1S/Tc/i1+1 + GKLVYJBZJHMRIY-OUBTZVSYSA-N + 98.906 + 98.90625 + [99Tc] + CAS:14133-76-7 + Gmelin:41657 + technetium-99 + chebi_ontology + (99)43Tc + (99)Tc + technetium, isotope of mass 99 + CHEBI:33371 + + technetium-99 + + + + + CAS:14133-76-7 + ChemIDplus + + + + + Gmelin:41657 + Gmelin + + + + + technetium-99 + IUPAC + + + + + + (99)43Tc + IUPAC + + + + + (99)Tc + IUPAC + + + + + technetium, isotope of mass 99 + ChemIDplus + + + + + + + + + + 0 + Nd + InChI=1S/Nd + QEFYFXOXNSNQGX-UHFFFAOYSA-N + 144.24000 + 141.90773 + [Nd] + CAS:7440-00-8 + Gmelin:16212 + WebElements:Nd + neodymium + chebi_ontology + 60Nd + Nd + Neodym + neodimio + neodyme + neodymium + CHEBI:33372 + + neodymium atom + + + + + CAS:7440-00-8 + ChemIDplus + + + + + CAS:7440-00-8 + NIST Chemistry WebBook + + + + + Gmelin:16212 + Gmelin + + + + + neodymium + IUPAC + + + + + + 60Nd + IUPAC + + + + + Nd + IUPAC + + + + + Neodym + ChEBI + + + + + neodimio + ChEBI + + + + + neodyme + ChEBI + + + + + neodymium + ChEBI + + + + + + + + + + 0 + Pm + InChI=1S/Pm + VQMWBBYLQSCNPO-UHFFFAOYSA-N + 145.00000 + 145.00000 + [Pm] + CAS:7440-12-2 + Gmelin:16237 + WebElements:Pm + promethium + chebi_ontology + 61Pm + Pm + Promethium + promethium + prometio + CHEBI:33373 + + promethium atom + + + + + CAS:7440-12-2 + ChemIDplus + + + + + CAS:7440-12-2 + NIST Chemistry WebBook + + + + + Gmelin:16237 + Gmelin + + + + + promethium + IUPAC + + + + + + 61Pm + IUPAC + + + + + Pm + IUPAC + + + + + Promethium + ChEBI + + + + + promethium + ChEBI + + + + + prometio + ChEBI + + + + + + + + + + 0 + Sm + InChI=1S/Sm + KZUNJOHGWZRPMI-UHFFFAOYSA-N + 150.36000 + 151.91974 + [Sm] + CAS:7440-19-9 + Gmelin:16301 + WebElements:Sm + samarium + chebi_ontology + 62Sm + Sm + samario + samarium + CHEBI:33374 + + samarium atom + + + + + CAS:7440-19-9 + ChemIDplus + + + + + CAS:7440-19-9 + NIST Chemistry WebBook + + + + + Gmelin:16301 + Gmelin + + + + + samarium + IUPAC + + + + + + 62Sm + IUPAC + + + + + Sm + IUPAC + + + + + samario + ChEBI + + + + + samarium + ChEBI + + + + + + + + + + 0 + Gd + InChI=1S/Gd + UIWYJDYFSGRHKR-UHFFFAOYSA-N + 157.25000 + 157.92411 + [Gd] + CAS:7440-54-2 + Gmelin:16286 + WebElements:Gd + gadolinium + chebi_ontology + 64Gd + Gd + gadolinio + gadolinium + CHEBI:33375 + + gadolinium atom + + + + + CAS:7440-54-2 + ChemIDplus + + + + + CAS:7440-54-2 + NIST Chemistry WebBook + + + + + Gmelin:16286 + Gmelin + + + + + gadolinium + IUPAC + + + + + + 64Gd + IUPAC + + + + + Gd + IUPAC + + + + + gadolinio + ChEBI + + + + + gadolinium + ChEBI + + + + + + + + + + 0 + Tb + InChI=1S/Tb + GZCRRIHWUXGPOV-UHFFFAOYSA-N + 158.92534 + 158.92535 + [Tb] + CAS:7440-27-9 + Gmelin:16311 + WebElements:Tb + terbium + chebi_ontology + 65Tb + Tb + terbio + terbium + CHEBI:33376 + + terbium atom + + + + + CAS:7440-27-9 + ChemIDplus + + + + + CAS:7440-27-9 + NIST Chemistry WebBook + + + + + Gmelin:16311 + Gmelin + + + + + terbium + IUPAC + + + + + + 65Tb + IUPAC + + + + + Tb + IUPAC + + + + + terbio + ChEBI + + + + + terbium + ChEBI + + + + + + + + + + 0 + Dy + InChI=1S/Dy + KBQHZAAAGSGFKK-UHFFFAOYSA-N + 162.50000 + 163.92918 + [Dy] + CAS:7429-91-6 + Gmelin:16278 + WebElements:Dy + dysprosium + chebi_ontology + 66Dy + Dy + disprosio + dysprosium + CHEBI:33377 + + dysprosium atom + + + + + CAS:7429-91-6 + ChemIDplus + + + + + CAS:7429-91-6 + NIST Chemistry WebBook + + + + + Gmelin:16278 + Gmelin + + + + + dysprosium + IUPAC + + + + + + 66Dy + IUPAC + + + + + Dy + IUPAC + + + + + disprosio + ChEBI + + + + + dysprosium + ChEBI + + + + + + + + + + 0 + Er + InChI=1S/Er + UYAHIZSMUZPPFV-UHFFFAOYSA-N + 167.26000 + 165.93030 + [Er] + CAS:7440-52-0 + Gmelin:16280 + WebElements:Er + erbium + chebi_ontology + 68Er + Er + erbio + CHEBI:33379 + + erbium + + + + + CAS:7440-52-0 + ChemIDplus + + + + + CAS:7440-52-0 + NIST Chemistry WebBook + + + + + Gmelin:16280 + Gmelin + + + + + erbium + IUPAC + + + + + + 68Er + IUPAC + + + + + Er + IUPAC + + + + + erbio + ChEBI + + + + + + + + + + 0 + Tm + InChI=1S/Tm + FRNOGLGSGLTDKL-UHFFFAOYSA-N + 168.93421 + 168.93422 + [Tm] + CAS:7440-30-4 + Gmelin:16307 + WebElements:Tm + thulium + chebi_ontology + 69Tm + Tm + thulium + tulio + CHEBI:33380 + + thulium atom + + + + + CAS:7440-30-4 + ChemIDplus + + + + + CAS:7440-30-4 + NIST Chemistry WebBook + + + + + Gmelin:16307 + Gmelin + + + + + thulium + IUPAC + + + + + + 69Tm + IUPAC + + + + + Tm + ChEBI + + + + + thulium + ChEBI + + + + + tulio + ChEBI + + + + + + + + + + 0 + Yb + InChI=1S/Yb + NAWDYIZEMPQZHO-UHFFFAOYSA-N + 173.04000 + 173.93887 + [Yb] + CAS:7440-64-4 + Gmelin:16320 + WebElements:Yb + ytterbium + chebi_ontology + 70Yb + Yb + yterbio + CHEBI:33381 + + ytterbium + + + + + CAS:7440-64-4 + ChemIDplus + + + + + CAS:7440-64-4 + NIST Chemistry WebBook + + + + + Gmelin:16320 + Gmelin + + + + + ytterbium + IUPAC + + + + + + 70Yb + IUPAC + + + + + Yb + IUPAC + + + + + yterbio + ChEBI + + + + + + + + + + 0 + Lu + InChI=1S/Lu + OHSVLFRHMCKCQY-UHFFFAOYSA-N + 174.96700 + 174.94078 + [Lu] + CAS:7439-94-3 + Gmelin:16202 + WebElements:Lu + lutetium + chebi_ontology + 71Lu + Cassiopeium + Lu + Lutetium + cassiopium + lutecio + lutecium + lutetium + CHEBI:33382 + + lutetium atom + + + + + CAS:7439-94-3 + ChemIDplus + + + + + CAS:7439-94-3 + NIST Chemistry WebBook + + + + + Gmelin:16202 + Gmelin + + + + + lutetium + IUPAC + + + + + + 71Lu + IUPAC + + + + + Cassiopeium + ChEBI + + + + + Lu + IUPAC + + + + + Lutetium + ChEBI + + + + + cassiopium + ChEBI + + + + + lutecio + ChEBI + + + + + lutecium + ChEBI + + + + + lutetium + ChEBI + + + + + + + + + 0 + Th + InChI=1S/Th + ZSLUVFAKFWKJRC-UHFFFAOYSA-N + 232.03810 + 232.03806 + [Th] + CAS:7440-29-1 + KEGG:C19157 + WebElements:Th + thorium + chebi_ontology + 90Th + Th + torio + CHEBI:33385 + + thorium + + + + + CAS:7440-29-1 + ChemIDplus + + + + + CAS:7440-29-1 + KEGG COMPOUND + + + + + CAS:7440-29-1 + NIST Chemistry WebBook + + + + + thorium + IUPAC + + + + + + 90Th + IUPAC + + + + + Th + IUPAC + + + + + torio + ChEBI + + + + + + + + + 0 + Pa + InChI=1S/Pa + XLROVYAPLOFLNU-UHFFFAOYSA-N + 231.03588 + 231.03589 + [Pa] + CAS:7440-13-3 + WebElements:Pa + protactinium + chebi_ontology + 91Pa + Pa + brevium + protactinio + protactinium + protoactinium + CHEBI:33386 + + protactinium atom + + + + + CAS:7440-13-3 + ChemIDplus + + + + + CAS:7440-13-3 + NIST Chemistry WebBook + + + + + protactinium + IUPAC + + + + + + 91Pa + IUPAC + + + + + Pa + IUPAC + + + + + brevium + ChEBI + + + + + protactinio + ChEBI + + + + + protactinium + ChEBI + + + + + protoactinium + NIST_Chemistry_WebBook + + + + + + + + + 0 + Np + InChI=1S/Np + LFNLGNPSGWYGGD-UHFFFAOYSA-N + 237.00000 + 237.00000 + [Np] + CAS:7439-99-8 + WebElements:Np + neptunium + chebi_ontology + 93Np + Np + neptunio + neptunium + CHEBI:33387 + + neptunium atom + + + + + CAS:7439-99-8 + ChemIDplus + + + + + CAS:7439-99-8 + NIST Chemistry WebBook + + + + + neptunium + IUPAC + + + + + + 93Np + IUPAC + + + + + Np + IUPAC + + + + + neptunio + ChEBI + + + + + neptunium + ChEBI + + + + + + + + + 0 + Pu + InChI=1S/Pu + OYEHPCDNVJXUIW-UHFFFAOYSA-N + 244.00000 + 244.00000 + [Pu] + CAS:7440-07-5 + KEGG:C19159 + WebElements:Pu + plutonium + chebi_ontology + 94Pu + Pu + plutonio + plutonium + CHEBI:33388 + + plutonium atom + + + + + CAS:7440-07-5 + ChemIDplus + + + + + CAS:7440-07-5 + KEGG COMPOUND + + + + + CAS:7440-07-5 + NIST Chemistry WebBook + + + + + plutonium + IUPAC + + + + + + 94Pu + IUPAC + + + + + Pu + ChEBI + + + + + plutonio + ChEBI + + + + + plutonium + ChEBI + + + + + + + + + 0 + Am + InChI=1S/Am + LXQXZNRPTYVCNG-UHFFFAOYSA-N + 243.00000 + 243.00000 + [Am] + CAS:7440-35-9 + WebElements:Am + americium + chebi_ontology + 95Am + Am + Americium + Amerizium + americio + americium + CHEBI:33389 + + americium atom + + + + + CAS:7440-35-9 + ChemIDplus + + + + + CAS:7440-35-9 + NIST Chemistry WebBook + + + + + americium + IUPAC + + + + + + 95Am + IUPAC + + + + + Am + IUPAC + + + + + Americium + ChEBI + + + + + Amerizium + ChEBI + + + + + americio + ChEBI + + + + + americium + ChEBI + + + + + + + + + 0 + Cm + InChI=1S/Cm + NIWWFAAXEMMFMS-UHFFFAOYSA-N + 247.00000 + 247.00000 + [Cm] + CAS:7440-51-9 + WebElements:Cm + curium + chebi_ontology + 96Cm + Cm + curio + curium + CHEBI:33390 + + curium atom + + + + + CAS:7440-51-9 + ChemIDplus + + + + + CAS:7440-51-9 + NIST Chemistry WebBook + + + + + curium + IUPAC + + + + + + 96Cm + IUPAC + + + + + Cm + IUPAC + + + + + curio + ChEBI + + + + + curium + ChEBI + + + + + + + + + 0 + Bk + InChI=1S/Bk + PWVKJRSRVJTHTR-UHFFFAOYSA-N + 247.00000 + 247.00000 + [Bk] + CAS:7440-40-6 + WebElements:Bk + berkelium + chebi_ontology + 97Bk + Berkelium + Bk + berkelio + berkelium + CHEBI:33391 + + berkelium atom + + + + + CAS:7440-40-6 + ChemIDplus + + + + + CAS:7440-40-6 + NIST Chemistry WebBook + + + + + berkelium + IUPAC + + + + + + 97Bk + IUPAC + + + + + Berkelium + ChEBI + + + + + Bk + ChEBI + + + + + berkelio + ChEBI + + + + + berkelium + ChEBI + + + + + + + + + 0 + Cf + InChI=1S/Cf + HGLDOAKPQXAFKI-UHFFFAOYSA-N + 251.00000 + 251.00000 + [Cf] + CAS:7440-71-3 + WebElements:Cf + californium + chebi_ontology + 98Cf + Cf + Kalifornium + californio + californium + CHEBI:33392 + + californium atom + + + + + CAS:7440-71-3 + ChemIDplus + + + + + CAS:7440-71-3 + NIST Chemistry WebBook + + + + + californium + IUPAC + + + + + + 98Cf + ChEBI + + + + + Cf + IUPAC + + + + + Kalifornium + ChEBI + + + + + californio + ChEBI + + + + + californium + ChEBI + + + + + + + + + 0 + Es + InChI=1S/Es + CKBRQZNRCSJHFT-UHFFFAOYSA-N + 252.00000 + 252.00000 + [Es] + CAS:7429-92-7 + WebElements:Es + einsteinium + chebi_ontology + 99Es + Es + einsteinio + einsteinium + CHEBI:33393 + + einsteinium atom + + + + + CAS:7429-92-7 + ChemIDplus + + + + + CAS:7429-92-7 + NIST Chemistry WebBook + + + + + einsteinium + IUPAC + + + + + + 99Es + IUPAC + + + + + Es + IUPAC + + + + + einsteinio + ChEBI + + + + + einsteinium + ChEBI + + + + + + + + + 0 + Fm + InChI=1S/Fm + MIORUQGGZCBUGO-UHFFFAOYSA-N + 257.00000 + 257.00000 + [Fm] + CAS:7440-72-4 + WebElements:Fm + fermium + chebi_ontology + 100Fm + Fm + fermio + CHEBI:33394 + + fermium + + + + + CAS:7440-72-4 + ChemIDplus + + + + + CAS:7440-72-4 + NIST Chemistry WebBook + + + + + fermium + IUPAC + + + + + + 100Fm + IUPAC + + + + + Fm + IUPAC + + + + + fermio + ChEBI + + + + + + + + + 0 + Md + InChI=1S/Md + MQVSLOYRCXQRPM-UHFFFAOYSA-N + 258.00000 + 258.00000 + [Md] + CAS:7440-11-1 + WebElements:Md + mendelevium + chebi_ontology + 101Md + Md + Mendelevium + Unu + mendelevio + mendelevium + unnilunium + CHEBI:33395 + + mendelevium atom + + + + + CAS:7440-11-1 + ChemIDplus + + + + + CAS:7440-11-1 + NIST Chemistry WebBook + + + + + mendelevium + IUPAC + + + + + + 101Md + IUPAC + + + + + Md + IUPAC + + + + + Mendelevium + ChEBI + + + + + Unu + IUPAC + + + + + mendelevio + ChEBI + + + + + mendelevium + ChEBI + + + + + unnilunium + IUPAC + + + + + + + + + 0 + No + InChI=1S/No + ORQBXQOJMQIAOY-UHFFFAOYSA-N + 259.00000 + 259.00000 + [No] + CAS:10028-14-5 + WebElements:No + Nobelium + nobelium + chebi_ontology + 102No + No + Unb + nobelio + unnilbium + CHEBI:33396 + + nobelium + + + + + CAS:10028-14-5 + ChemIDplus + + + + + CAS:10028-14-5 + NIST Chemistry WebBook + + + + + Nobelium + ChEBI + + + + + nobelium + ChEBI + + + + + nobelium + IUPAC + + + + + + 102No + IUPAC + + + + + No + IUPAC + + + + + Unb + IUPAC + + + + + nobelio + ChEBI + + + + + unnilbium + IUPAC + + + + + + + + + + 0 + Lr + InChI=1S/Lr + CNQCVBJFEGMYDW-UHFFFAOYSA-N + 262.00000 + 262.00000 + [Lr] + CAS:22537-19-5 + WebElements:Lr + lawrencium + chebi_ontology + 103Lr + Lr + Unt + laurencio + lawrencio + lawrencium + unniltrium + CHEBI:33397 + + lawrencium atom + + + + + CAS:22537-19-5 + ChemIDplus + + + + + lawrencium + IUPAC + + + + + + 103Lr + IUPAC + + + + + Lr + IUPAC + + + + + Unt + IUPAC + + + + + laurencio + ChEBI + + + + + lawrencio + ChEBI + + + + + lawrencium + ChEBI + + + + + unniltrium + IUPAC + + + + + + + + + + sulfur oxoacid derivative + + + + + + + + + + + elemental pnictogen + + + + + + + + + 0 + [220Rn] + InChI=1S/Rn/i1-2 + SYUHGPGVQRZVTB-YPZZEJLDSA-N + 220.011 + 220.01138 + [220Rn] + CAS:22481-48-7 + Gmelin:297037 + radon-220 + chebi_ontology + (220)86Rn + (220)Rn + Tn + radon, isotope of mass 220 + radon-220 + thoron + CHEBI:33491 + + radon-220 atom + + + + + CAS:22481-48-7 + ChemIDplus + + + + + Gmelin:297037 + Gmelin + + + + + radon-220 + IUPAC + + + + + + (220)86Rn + IUPAC + + + + + (220)Rn + IUPAC + + + + + Tn + ChEBI + + + + + radon, isotope of mass 220 + ChemIDplus + + + + + radon-220 + ChEBI + + + + + thoron + ChemIDplus + + + + + + + + + 0 + [222Rn] + InChI=1S/Rn/i1+0 + SYUHGPGVQRZVTB-IGMARMGPSA-N + 222.018 + 222.01757 + [222Rn] + CAS:14859-67-7 + radon-222 + chebi_ontology + (222)86Rn + (222)Rn + radon, isotope of mass 222 + radon-222 + CHEBI:33492 + + radon-222 atom + + + + + CAS:14859-67-7 + ChemIDplus + + + + + radon-222 + IUPAC + + + + + + (222)86Rn + IUPAC + + + + + (222)Rn + IUPAC + + + + + radon, isotope of mass 222 + ChemIDplus + + + + + radon-222 + ChEBI + + + + + + + + + 0 + [219Rn] + InChI=1S/Rn/i1-3 + SYUHGPGVQRZVTB-OIOBTWANSA-N + 219.009 + 219.00947 + [219Rn] + CAS:14835-02-0 + Gmelin:297039 + radon-219 + chebi_ontology + (219)86Rn + (219)Rn + An + actinon + radon, isotope of mass 219 + radon-219 + CHEBI:33493 + + radon-219 atom + + + + + CAS:14835-02-0 + ChemIDplus + + + + + Gmelin:297039 + Gmelin + + + + + radon-219 + IUPAC + + + + + + (219)86Rn + IUPAC + + + + + (219)Rn + IUPAC + + + + + An + ChEBI + + + + + actinon + ChEBI + + + + + radon, isotope of mass 219 + ChemIDplus + + + + + radon-219 + ChEBI + + + + + + + + + transition element molecular entity + + + + + + + + + actinoid molecular entity + + + + + + + + + uranium molecular entity + + + + + + + + + alkali metal cation + + + + + + + + + A zinc group element atom with a symbol Cn and atomic number 112. All its isotopes are intensely radioactive. Prior to its discovery, it had the placeholder name ununbium (in accordance with IUPAC recommendations). Following its discovery (in Darmstadt, 1996) and subsequent confirmation, the name copernicium was adopted in 2010. + 0 + Cn + InChI=1S/Cn + NOTIIDSZELDPOP-UHFFFAOYSA-N + NaN + 0.00000 + [Cn] + Wikipedia:Copernicium + copernicium + chebi_ontology + 112Cn + 112Cp + 112Uub + Cn + Uub + ununbium + CHEBI:33517 + + copernicium atom + + + + + copernicium + IUPAC + + + + + + 112Cn + ChEBI + + + + + 112Cp + IUPAC + + + + + 112Uub + IUPAC + + + + + Cn + IUPAC + + + + + Uub + IUPAC + + + + + ununbium + ChEBI + + + + + ununbium + IUPAC + + + + + + + + + An atom of an element that exhibits typical metallic properties, being typically shiny, with high electrical and thermal conductivity. + CHEBI:25217 + CHEBI:6788 + KEGG:C00050 + PMID:21784043 + Wikipedia:Metal + chebi_ontology + elemental metal + elemental metals + metal element + metal elements + metals + CHEBI:33521 + + metal atom + + + + + PMID:21784043 + Europe PMC + + + + + elemental metal + ChEBI + + + + + elemental metals + ChEBI + + + + + metal element + ChEBI + + + + + metal elements + ChEBI + + + + + metals + ChEBI + + + + + + + + + + + + + + + An amino-acid anion obtained by deprotonation of any alpha-amino acid. + alpha-amino-acid anion + chebi_ontology + alpha-amino acid anions + alpha-amino-acid anions + CHEBI:33558 + + alpha-amino-acid anion + + + + + alpha-amino-acid anion + ChEBI + + + + + alpha-amino acid anions + ChEBI + + + + + alpha-amino-acid anions + ChEBI + + + + + + + + + chebi_ontology + s-block element + s-block elements + CHEBI:33559 + + s-block element atom + + + + + s-block element + ChEBI + + + + + s-block elements + ChEBI + + + + + + + + + Any main group element atom belonging to the p-block of the periodic table. + chebi_ontology + p-block element + p-block elements + CHEBI:33560 + + p-block element atom + + + + + p-block element + ChEBI + + + + + p-block elements + ChEBI + + + + + + + + + chebi_ontology + d-block element + d-block elements + CHEBI:33561 + + d-block element atom + + + + + d-block element + ChEBI + + + + + d-block elements + ChEBI + + + + + + + + + chebi_ontology + f-block element + f-block elements + CHEBI:33562 + + f-block element atom + + + + + f-block element + ChEBI + + + + + f-block elements + ChEBI + + + + + + + + + + + + + + + + + + + + + + + A carbon oxoacid acid carrying at least one -C(=O)OH group and having the structure RC(=O)OH, where R is any any monovalent functional group. Carboxylic acids are the most common type of organic acid. + 0 + CHO2R + 45.01740 + 44.99765 + OC([*])=O + CHEBI:13428 + CHEBI:13627 + CHEBI:23027 + PMID:17147560 + PMID:18433345 + Wikipedia:Carboxylic_acid + carboxylic acid + carboxylic acids + chebi_ontology + Carbonsaeure + Carbonsaeuren + Karbonsaeure + RC(=O)OH + acide carboxylique + acides carboxyliques + acido carboxilico + acidos carboxilicos + CHEBI:33575 + + carboxylic acid + + + + + PMID:17147560 + Europe PMC + + + + + PMID:18433345 + Europe PMC + + + + + carboxylic acid + IUPAC + + + + + + carboxylic acids + IUPAC + + + + + + Carbonsaeure + ChEBI + + + + + Carbonsaeuren + ChEBI + + + + + Karbonsaeure + ChEBI + + + + + RC(=O)OH + IUPAC + + + + + acide carboxylique + IUPAC + + + + + acides carboxyliques + IUPAC + + + + + acido carboxilico + IUPAC + + + + + acidos carboxilicos + IUPAC + + + + + + + + + + + + + + + A molecular entity containing one or more atoms from any of groups 1, 2, 13, 14, 15, 16, 17, and 18 of the periodic table. + chebi_ontology + main group compounds + main group molecular entities + CHEBI:33579 + + main group molecular entity + + + + + main group compounds + ChEBI + + + + + main group molecular entities + ChEBI + + + + + + + + + + + + + + + carbon group molecular entity + chebi_ontology + carbon group molecular entities + CHEBI:33582 + + carbon group molecular entity + + + + + carbon group molecular entity + ChEBI + + + + + carbon group molecular entities + ChEBI + + + + + + + + + + + + + + + A main group molecular entity containing one or more atoms of any noble gas. + noble gas molecular entity + chebi_ontology + noble gas compounds + noble gas molecular entities + CHEBI:33583 + + noble gas molecular entity + + + + + noble gas molecular entity + ChEBI + + + + + noble gas compounds + ChEBI + + + + + noble gas molecular entities + ChEBI + + + + + + + + + Any molecule that consists of a series of atoms joined together to form a ring. + Wikipedia:Cyclic_compound + chebi_ontology + cyclic compounds + CHEBI:33595 + + cyclic compound + + + + + cyclic compounds + ChEBI + + + + + + + + + + + + + + + chebi_ontology + hydrogen compounds + hydrogen molecular entities + CHEBI:33608 + + hydrogen molecular entity + + + + + hydrogen compounds + ChEBI + + + + + hydrogen molecular entities + ChEBI + + + + + + + + + polycyclic compound + + + + + + + + + A cyclically conjugated molecular entity with a stability (due to delocalization) significantly greater than that of a hypothetical localized structure (e.g. Kekule structure) is said to possess aromatic character. + aromatic compounds + aromatic molecular entity + chebi_ontology + aromatics + aromatische Verbindungen + CHEBI:33655 + + aromatic compound + + + + + aromatic compounds + IUPAC + + + + + + aromatic molecular entity + IUPAC + + + + + + aromatics + ChEBI + + + + + aromatische Verbindungen + ChEBI + + + + + + + + + + chebi_ontology + organic aromatic compounds + CHEBI:33659 + + organic aromatic compound + + + + + organic aromatic compounds + ChEBI + + + + + + + + + + + + + + + An s-block molecular entity is a molecular entity containing one or more atoms of an s-block element. + s-block molecular entity + chebi_ontology + s-block compounds + s-block molecular entities + CHEBI:33674 + + s-block molecular entity + + + + + s-block molecular entity + ChEBI + + + + + s-block compounds + ChEBI + + + + + s-block molecular entities + ChEBI + + + + + + + + + + + + + + + A main group molecular entity that contains one or more atoms of a p-block element. + chebi_ontology + p-block compounds + p-block molecular entities + p-block molecular entitiy + CHEBI:33675 + + p-block molecular entity + + + + + p-block compounds + ChEBI + + + + + p-block molecular entities + ChEBI + + + + + p-block molecular entitiy + ChEBI + + + + + + + + + d-block molecular entity + + + + + + + + + f-block molecular entity + + + + + + + + + + + + + + + + helium molecular entity + chebi_ontology + helium compounds + helium molecular entities + CHEBI:33679 + + helium molecular entity + + + + + helium molecular entity + ChEBI + + + + + helium compounds + ChEBI + + + + + helium molecular entities + ChEBI + + + + + + + + + chebi_ontology + CHEBI:33680 + + elemental helium + + + + + + + + + + Hydrides are chemical compounds of hydrogen with other chemical elements. + chebi_ontology + CHEBI:33692 + + hydrides + + + + + + + + + oxygen hydride + + + + + + + + + + A macromolecule formed by a living organism. + biopolymer + chebi_ontology + Biopolymere + biomacromolecules + biopolymers + CHEBI:33694 + + biomacromolecule + + + + + biopolymer + IUPAC + + + + + + Biopolymere + ChEBI + + + + + biomacromolecules + ChEBI + + + + + biopolymers + ChEBI + + + + + + + + + chebi_ontology + genetically encoded biomacromolecules + genetically encoded biopolymers + information biomacromolecules + information biopolymers + information macromolecule + information macromolecules + CHEBI:33695 + + information biomacromolecule + + + + + genetically encoded biomacromolecules + ChEBI + + + + + genetically encoded biopolymers + ChEBI + + + + + information biomacromolecules + ChEBI + + + + + information biopolymers + ChEBI + + + + + information macromolecule + ChEBI + + + + + information macromolecules + ChEBI + + + + + + + + + + + + + + + + + + + + + A macromolecule made up of nucleotide units and hydrolysable into certain pyrimidine or purine bases (usually adenine, cytosine, guanine, thymine, uracil), D-ribose or 2-deoxy-D-ribose and phosphoric acid. + nucleic acids + chebi_ontology + NA + Nukleinsaeure + Nukleinsaeuren + acide nucleique + acides nucleiques + acido nucleico + acidos nucleicos + CHEBI:33696 + + nucleic acid + + + + + nucleic acids + IUPAC + + + + + + NA + ChEBI + + + + + Nukleinsaeure + ChEBI + + + + + Nukleinsaeuren + ChEBI + + + + + acide nucleique + ChEBI + + + + + acides nucleiques + ChEBI + + + + + acido nucleico + ChEBI + + + + + acidos nucleicos + ChEBI + + + + + + + + + + + + + + + + + + + + + High molecular weight, linear polymers, composed of nucleotides containing ribose and linked by phosphodiester bonds; RNA is central to the synthesis of proteins. + CAS:63231-63-0 + ribonucleic acid + ribonucleic acids + chebi_ontology + RNA + RNS + Ribonukleinsaeure + pentosenucleic acids + ribonucleic acids + ribose nucleic acid + yeast nucleic acid + CHEBI:33697 + + ribonucleic acid + + + + + CAS:63231-63-0 + ChemIDplus + + + + + ribonucleic acid + IUPAC + + + + + ribonucleic acids + IUPAC + + + + + + RNA + IUPAC + + + + + RNA + UniProt + + + + + RNS + ChEBI + + + + + Ribonukleinsaeure + ChEBI + + + + + pentosenucleic acids + ChemIDplus + + + + + ribonucleic acids + ChEBI + + + + + ribose nucleic acid + ChEBI + + + + + yeast nucleic acid + ChEBI + + + + + + + + + chebi_ontology + canonical amino-acid residue + canonical amino-acid residues + common amino acid residues + proteinogenic amino-acid residues + standard amino acid residues + standard amino-acid residues + CHEBI:33700 + + proteinogenic amino-acid residue + + + + + canonical amino-acid residue + ChEBI + + + + + canonical amino-acid residues + ChEBI + + + + + common amino acid residues + ChEBI + + + + + proteinogenic amino-acid residues + ChEBI + + + + + standard amino acid residues + ChEBI + + + + + standard amino-acid residues + ChEBI + + + + + + + + + + + + + + + + + + + + + An amino acid in which the amino group is located on the carbon atom at the position alpha to the carboxy group. + 0 + C2H4NO2R + 74.05870 + 74.02420 + NC([*])C(O)=O + CHEBI:10208 + CHEBI:13779 + CHEBI:22442 + CHEBI:2642 + KEGG:C00045 + KEGG:C05167 + alpha-amino acid + chebi_ontology + Amino acid + Amino acids + alpha-amino acids + alpha-amino carboxylic acids + CHEBI:33704 + + alpha-amino acid + + + + + alpha-amino acid + IUPAC + + + + + + Amino acid + KEGG_COMPOUND + + + + + Amino acids + KEGG_COMPOUND + + + + + alpha-amino acids + ChEBI + + + + + alpha-amino acids + JCBN + + + + + alpha-amino carboxylic acids + IUPAC + + + + + + + + + + + + + + + When two or more amino acids combine to form a peptide, the elements of water are removed, and what remains of each amino acid is called an amino-acid residue. + amino acid residue + amino-acid residue + protein residue + chebi_ontology + amino acid residue + amino-acid residues + CHEBI:33708 + + amino-acid residue + + + + + When two or more amino acids combine to form a peptide, the elements of water are removed, and what remains of each amino acid is called an amino-acid residue. + Dummy:dummy + + + + + amino-acid residue + IUPAC + + + + + + protein residue + PRO:DAN + + + + + amino acid residue + ChEBI + + + + + amino-acid residues + JCBN + + + + + + + + + + + + + + + + A carboxylic acid containing one or more amino groups. + CHEBI:13815 + CHEBI:22477 + Wikipedia:Amino_acid + chebi_ontology + Aminocarbonsaeure + Aminokarbonsaeure + Aminosaeure + amino acids + CHEBI:33709 + + amino acid + + + + + Aminocarbonsaeure + ChEBI + + + + + Aminokarbonsaeure + ChEBI + + + + + Aminosaeure + ChEBI + + + + + amino acids + ChEBI + + + + + + + + + + + + + + + chebi_ontology + alpha-amino-acid residues + CHEBI:33710 + + alpha-amino-acid residue + + + + + alpha-amino-acid residues + ChEBI + + + + + + + + + iron group molecular entity + + + + + + + + + copper group molecular entity + + + + + + + + + nickel group molecular entity + + + + + + + + + platinum molecular entity + + + + + + + + + chebi_ontology + canonical nucleoside residues + common nucleoside residues + nucleoside residue + standard nucleoside residues + CHEBI:33791 + + canonical nucleoside residue + + + + + canonical nucleoside residues + ChEBI + + + + + common nucleoside residues + CBN + + + + + nucleoside residue + CBN + + + + + standard nucleoside residues + ChEBI + + + + + + + + + chebi_ontology + N + Nuc + canonical ribonucleoside residues + common ribonucleoside residue + common ribonucleoside residues + standard ribonucleoside residues + CHEBI:33792 + + canonical ribonucleoside residue + + + + + N + CBN + + + + + Nuc + CBN + + + + + canonical ribonucleoside residues + ChEBI + + + + + common ribonucleoside residue + CBN + + + + + common ribonucleoside residues + CBN + + + + + standard ribonucleoside residues + ChEBI + + + + + + + + + The stable isotope of oxygen with relative atomic mass 17.999160 and 0.205 atom percent natural abundance. + 0 + [18O] + InChI=1S/O/i1+2 + QVGXLLKOCUKJST-NJFSPNSNSA-N + 17.999 + 17.99916 + [18O] + CAS:14797-71-8 + Gmelin:17562 + oxygen-18 + chebi_ontology + (18)8O + (18)O + heavy oxygen + oxygen, isotope of mass 18 + oxygen-18 + schwerer Sauerstoff + CHEBI:33815 + + oxygen-18 atom + + + + + CAS:14797-71-8 + ChemIDplus + + + + + Gmelin:17562 + Gmelin + + + + + oxygen-18 + IUPAC + + + + + + (18)8O + IUPAC + + + + + (18)O + IUPAC + + + + + heavy oxygen + ChEBI + + + + + oxygen, isotope of mass 18 + ChemIDplus + + + + + oxygen-18 + ChEBI + + + + + schwerer Sauerstoff + ChEBI + + + + + + + + + The stable isotope of oxygen with relative atomic mass 15.994914. The most abundant (99.76 atom percent) isotope of naturally occurring oxygen. + 0 + [16O] + InChI=1S/O/i1+0 + QVGXLLKOCUKJST-IGMARMGPSA-N + 15.995 + 15.99491 + [16O] + Gmelin:17560 + oxygen-16 + chebi_ontology + (16)8O + (16)O + oxygen-16 + CHEBI:33818 + + oxygen-16 atom + + + + + Gmelin:17560 + Gmelin + + + + + oxygen-16 + IUPAC + + + + + + (16)8O + IUPAC + + + + + (16)O + IUPAC + + + + + oxygen-16 + ChEBI + + + + + + + + + The stable isotope of oxygen with relative atomic mass 16.999131. The least abundant (0.038 atom percent) isotope of naturally occurring oxygen. + 0 + [17O] + InChI=1S/O/i1+1 + QVGXLLKOCUKJST-OUBTZVSYSA-N + 16.999 + 16.99913 + [17O] + CAS:13968-48-4 + Gmelin:17561 + oxygen-17 + chebi_ontology + (17)8O + (17)O + oxygen, isotope of mass 17 + oxygen-17 + CHEBI:33819 + + oxygen-17 atom + + + + + CAS:13968-48-4 + ChemIDplus + + + + + Gmelin:17561 + Gmelin + + + + + oxygen-17 + IUPAC + + + + + + (17)8O + IUPAC + + + + + (17)O + IUPAC + + + + + oxygen, isotope of mass 17 + ChemIDplus + + + + + oxygen-17 + ChEBI + + + + + + + + + + Any organic molecule that consists of atoms connected in the form of a ring. + chebi_ontology + organic cyclic compounds + CHEBI:33832 + + organic cyclic compound + + + + + organic cyclic compounds + ChEBI + + + + + + + + + + A heterocyclic compound formally derived from an arene by replacement of one or more methine (-C=) and/or vinylene (-CH=CH-) groups by trivalent or divalent heteroatoms, respectively, in such a way as to maintain the continuous pi-electron system characteristic of aromatic systems and a number of out-of-plane pi-electrons corresponding to the Hueckel rule (4n+2). + heteroarenes + chebi_ontology + hetarenes + CHEBI:33833 + + heteroarene + + + + + heteroarenes + IUPAC + + + + + + hetarenes + IUPAC + + + + + + + + + + conjugated protein + + + + + + + + + A macromolecule is a molecule of high relative molecular mass, the structure of which essentially comprises the multiple repetition of units derived, actually or conceptually, from molecules of low relative molecular mass. + Wikipedia:Macromolecule + macromolecule + chebi_ontology + macromolecules + polymer + polymer molecule + polymers + CHEBI:33839 + + macromolecule + + + + + macromolecule + IUPAC + + + + + + macromolecules + ChEBI + + + + + polymer + ChEBI + + + + + polymer molecule + IUPAC + + + + + polymers + ChEBI + + + + + + + + + A substance used in a chemical reaction to detect, measure, examine, or produce other substances. + reagent + chebi_ontology + reactif + reactivo + reagents + CHEBI:33893 + + reagent + + + + + reagent + IUPAC + + + + + + reactif + IUPAC + + + + + reactivo + IUPAC + + + reagents ChEBI @@ -15335,1285 +27686,5183 @@ For example, A and B may be gene products and binding of B by A positively regul - + + + + + Any nutrient required in large quantities by organisms throughout their life in order to orchestrate a range of physiological functions. Macronutrients are usually chemical elements (carbon, hydrogen, nitrogen, oxygen, phosphorus and sulfur) that humans consume in the largest quantities. Calcium, sodium, magnesium and potassium are sometimes included as macronutrients because they are required in relatively large quantities compared with other vitamins and minerals. + chebi_ontology + macronutrients + CHEBI:33937 + + + macronutrient + + + + + macronutrients + ChEBI + + + + + + + + + + halide salt + + + + + + + + + gold molecular entity + + + + + + + + + + chebi_ontology + nitrogen hydrides + CHEBI:35106 + + nitrogen hydride + + + + + nitrogen hydrides + ChEBI + + + + + + + + + Saturated acyclic nitrogen hydrides having the general formula NnHn+2. + chebi_ontology + azanes + CHEBI:35107 + + azane + + + + + azanes + ChEBI + + + + + + + + + A substance that diminishes the rate of a chemical reaction. + inhibitor + chebi_ontology + inhibidor + inhibiteur + inhibitors + CHEBI:35222 + + inhibitor + + + + + inhibitor + IUPAC + + + + + + inhibidor + ChEBI + + + + + inhibiteur + ChEBI + + + + + inhibitors + ChEBI + + + + + + + + + fossil fuel + + + + + + + + + The zwitterionic form of an amino acid having a negatively charged carboxyl group and a positively charged amino group. + amino acid zwitterion + chebi_ontology + CHEBI:35238 + + amino acid zwitterion + + + + + amino acid zwitterion + ChEBI + + + + + + + + + + steroid + + + + + + + + + + Any heteroorganic entity containing at least one carbon-nitrogen bond. + organonitrogen compounds + chebi_ontology + organonitrogens + CHEBI:35352 + + organonitrogen compound + + + + + organonitrogen compounds + IUPAC + + + + + + organonitrogens + ChEBI + + + + + + + + + + An oxoanion is an anion derived from an oxoacid by loss of hydron(s) bound to oxygen. + CHEBI:33274 + CHEBI:33436 + oxoanion + chebi_ontology + oxoacid anions + oxoanions + CHEBI:35406 + + oxoanion + + + + + oxoanion + ChEBI + + + + + oxoacid anions + ChEBI + + + + + oxoanions + ChEBI + + + + + + + + + + alkali metal salt + + + + + + + + + + chebi_ontology + carbon oxoacids + oxoacids of carbon + CHEBI:35605 + + carbon oxoacid + + + + + carbon oxoacids + ChEBI + + + + + oxoacids of carbon + ChEBI + + + + + + + + + + dicarboxylic acid + + + + + + + + + ester + + + + + + + + + + sulfated glycosaminoglycan + + + + + + + + + + + carbohydrate sulfate + + + + + + + + + + pnictogen hydride + chebi_ontology + pnictogen hydrides + CHEBI:35881 + + pnictogen hydride + + + + + pnictogen hydride + ChEBI + + + + + pnictogen hydrides + ChEBI + + + + + + + + + cholanoid + + + + + + + + + + A biological macromolecule minimally consisting of one polypeptide chain synthesized at the ribosome. + CHEBI:13677 + CHEBI:14911 + proteins + chebi_ontology + CHEBI:36080 + + protein + + + + + proteins + IUPAC + + + + + + + + + + + inorganic chloride + + + + + + + + + + bile acid salt + + + + + + + + + + Lepton is a fermion that does not experience the strong force (strong interaction). The term is derived from the Greek lambdaepsilonpitauomicronsigma (small, thin). + chebi_ontology + leptons + CHEBI:36338 + + lepton + + + + + leptons + ChEBI + + + + + + + + + + Baryon is a fermion that does experience the strong force (strong interaction). The term is derived from the Greek betaalpharhoupsilonsigma (heavy). + chebi_ontology + baryons + CHEBI:36339 + + baryon + + + + + baryons + ChEBI + + + + + + + + + Particle of half-integer spin quantum number following Fermi-Dirac statistics. Fermions are named after Enrico Fermi. + fermion + chebi_ontology + fermions + CHEBI:36340 + + fermion + + + + + fermion + IUPAC + + + + + + fermions + ChEBI + + + + + + + + + Particle of integer spin quantum number following Bose-Einstein statistics. Bosons are named after Satyendra Nath Bose. + boson + chebi_ontology + bosons + CHEBI:36341 + + boson + + + + + boson + IUPAC + + + + + + bosons + ChEBI + + + + + + + + + A particle smaller than an atom. + Wikipedia:Subatomic_particle + chebi_ontology + subatomic particles + CHEBI:36342 + + subatomic particle + subatomic particle + + + + + subatomic particles + ChEBI + + + + + + + + + A subatomic particle known to have substructure (i.e. consisting of smaller particles). + chebi_ontology + composite particles + CHEBI:36343 + + composite particle + + + + + composite particles + ChEBI + + + + + + + + + Hadron is a subatomic particle which experiences the strong force. + chebi_ontology + hadrons + CHEBI:36344 + + hadron + + + + + hadrons + ChEBI + + + + + + + + + A nucleus or any of its constituents in any of their energy states. + nuclear particle + chebi_ontology + CHEBI:36347 + + nuclear particle + + + + + nuclear particle + IUPAC + + + + + + + + + The collective name for zero-spin mesons pi(+), pi(-) and pi(0). + pi meson + pion + chebi_ontology + pi-meson + CHEBI:36348 + + pi meson + + + + + pi meson + ChEBI + + + + + pion + IUPAC + + + + + + pi-meson + ChEBI + + + + + + + + Elementary particle not affected by the strong force having a spin 1/2, a negative elementary charge and a rest mass of 0.113428913(17) u, or 105.658389(34) MeV. + -1 + 0.113428913 + muon + chebi_ontology + Mueon + My-Teilchen + Myon + mu(-) + negative muon + CHEBI:36356 + + muon + + + + + muon + IUPAC + + + + + + Mueon + ChEBI + + + + + My-Teilchen + ChEBI + + + + + Myon + ChEBI + + + + + mu(-) + IUPAC + + + + + negative muon + ChEBI + + + + + + + + + + + + + + + Any molecular entity consisting of more than one atom. + chebi_ontology + polyatomic entities + CHEBI:36357 + + polyatomic entity + + + + + polyatomic entities + ChEBI + + + + + + + + + + An ion consisting of more than one atom. + chebi_ontology + polyatomic ions + CHEBI:36358 + + polyatomic ion + + + + + polyatomic ions + ChEBI + + + + + + + + + + + + + + + + Any compound containing the carbonyl group, C=O. The term is commonly used in the restricted sense of aldehydes and ketones, although it actually includes carboxylic acids and derivatives. + carbonyl compounds + chebi_ontology + CHEBI:36586 + + carbonyl compound + + + + + carbonyl compounds + IUPAC + + + + + + + + + + + + + + + + Organic compounds containing an oxygen atom, =O, doubly bonded to carbon or another element. + oxo compounds + chebi_ontology + organic oxo compounds + CHEBI:36587 + + organic oxo compound + + + + + oxo compounds + IUPAC + + + + + + organic oxo compounds + ChEBI + + + + + + + + + biladienes + + + + + + + + + + chalcogen hydride + + + + + + + + + argon molecular entity + + + + + + + + + + chebi_ontology + inorganic ions + CHEBI:36914 + + inorganic ion + + + + + inorganic ions + ChEBI + + + + + + + + + + chebi_ontology + inorganic cations + CHEBI:36915 + + inorganic cation + + + + + inorganic cations + ChEBI + + + + + + + + + A monoatomic or polyatomic species having one or more elementary charges of the proton. + CHEBI:23058 + CHEBI:3473 + KEGG:C01373 + Cation + cation + chebi_ontology + Kation + Kationen + cationes + cations + CHEBI:36916 + + cation + + + + + Cation + KEGG_COMPOUND + + + + + cation + ChEBI + + + + + cation + IUPAC + + + + + + Kation + ChEBI + + + + + Kationen + ChEBI + + + + + cationes + ChEBI + + + + + cations + ChEBI + + + + + + + + + 0 + [14C] + InChI=1S/C/i1+2 + OKTJSMMVPCPJKN-NJFSPNSNSA-N + 14.003 + 14.00324 + [14C] + CAS:14762-75-5 + Wikipedia:Carbon-14 + carbon-14 + chebi_ontology + (14)6C + (14)C + carbon, isotope of mass 14 + carbon-14 + CHEBI:36927 + + carbon-14 atom + + + + + CAS:14762-75-5 + ChemIDplus + + + + + carbon-14 + IUPAC + + + + + + (14)6C + IUPAC + + + + + (14)C + IUPAC + + + + + carbon, isotope of mass 14 + ChemIDplus + + + + + carbon-14 + ChEBI + + + + + + + + + 0 + [13C] + InChI=1S/C/i1+1 + OKTJSMMVPCPJKN-OUBTZVSYSA-N + 13.003 + 13.00335 + [13C] + CAS:14762-74-4 + carbon-13 + carbon-13 atom + chebi_ontology + (13)6C + (13)C + carbon, isotope of mass 13 + carbon-13 + CHEBI:36928 + + carbon-13 atom + + + + + CAS:14762-74-4 + ChemIDplus + + + + + carbon-13 + IUPAC + + + + + + carbon-13 atom + ChemIDplus + + + + + (13)6C + IUPAC + + + + + (13)C + IUPAC + + + + + carbon, isotope of mass 13 + ChemIDplus + + + + + carbon-13 + ChEBI + + + + + + + + + 0 + [11C] + InChI=1S/C/i1-1 + OKTJSMMVPCPJKN-BJUDXGSMSA-N + 11.011 + 11.01143 + [11C] + CAS:14333-33-6 + carbon-11 + chebi_ontology + (11)6C + (11)C + carbon, isotope of mass 11 + carbon-11 + CHEBI:36929 + + carbon-11 atom + + + + + CAS:14333-33-6 + ChemIDplus + + + + + carbon-11 + IUPAC + + + + + + (11)6C + IUPAC + + + + + (11)C + IUPAC + + + + + carbon, isotope of mass 11 + ChemIDplus + + + + + carbon-11 + ChEBI + + + + + + + + + 0 + [10C] + InChI=1S/C/i1-2 + OKTJSMMVPCPJKN-YPZZEJLDSA-N + 10.017 + 10.01685 + [10C] + CAS:15578-68-4 + carbon-10 + chebi_ontology + (10)6C + (10)C + carbon, isotope of mass 10 + carbon-10 + CHEBI:36930 + + carbon-10 atom + + + + + CAS:15578-68-4 + ChemIDplus + + + + + carbon-10 + IUPAC + + + + + + (10)6C + IUPAC + + + + + (10)C + IUPAC + + + + + carbon, isotope of mass 10 + ChemIDplus + + + + + carbon-10 + ChEBI + + + + + + + + + 0 + [12C] + InChI=1S/C/i1+0 + OKTJSMMVPCPJKN-IGMARMGPSA-N + 12.000 + 12.00000 + [12C] + carbon-12 + chebi_ontology + (12)6C + (12)C + carbon-12 + CHEBI:36931 + + carbon-12 atom + + + + + carbon-12 + IUPAC + + + + + + (12)6C + IUPAC + + + + + (12)C + IUPAC + + + + + carbon-12 + ChEBI + + + + + + + + + The radioactive isotope of oxygen with relative atomic mass 15.003065. The longest-lived oxygen radionuclide with half-life of 122.2 s. + 0 + [15O] + InChI=1S/O/i1-1 + QVGXLLKOCUKJST-BJUDXGSMSA-N + 15.003 + 15.00307 + [15O] + CAS:13982-43-9 + Gmelin:316575 + oxygen-15 + chebi_ontology + (15)8O + (15)O + oxygen, isotope of mass 15 + oxygen-15 + CHEBI:36932 + + oxygen-15 atom + + + + + CAS:13982-43-9 + ChemIDplus + + + + + Gmelin:316575 + Gmelin + + + + + oxygen-15 + IUPAC + + + + + + (15)8O + IUPAC + + + + + (15)O + IUPAC + + + + + oxygen, isotope of mass 15 + ChemIDplus + + + + + oxygen-15 + ChEBI + + + + + + + + + 0 + [19O] + InChI=1S/O/i1+3 + QVGXLLKOCUKJST-AKLPVKDBSA-N + 19.004 + 19.00358 + [19O] + CAS:13982-18-8 + oxygen-19 + chebi_ontology + (19)8O + (19)O + oxygen-19 + CHEBI:36933 + + oxygen-19 atom + + + + + CAS:13982-18-8 + ChemIDplus + + + + + oxygen-19 + IUPAC + + + + + + (19)8O + IUPAC + + + + + (19)O + IUPAC + + + + + oxygen-19 + ChEBI + + + + + + + + + The stable isotope of nitrogen with relative atomic mass 15.000109. The least abundant (0.368 atom percent) isotope of naturally occurring nitrogen. + 0 + N + 14.007 + 14.00307 + CAS:14390-96-6 + nitrogen-15 + chebi_ontology + (15)7N + (15)N + nitrogen, isotope of mass 15 + nitrogen-15 + CHEBI:36934 + + nitrogen-15 atom + + + + + CAS:14390-96-6 + ChemIDplus + + + + + nitrogen-15 + IUPAC + + + + + + (15)7N + IUPAC + + + + + (15)N + IUPAC + + + + + nitrogen, isotope of mass 15 + ChemIDplus + + + + + nitrogen-15 + ChEBI + + + + + + + + + The radioactive isotope of nitrogen with relative atomic mass 13.0057386. The longest-lived nitrogen radionuclide with half-life of 9.965 min. + 0 + N + 14.007 + 14.00307 + CAS:13981-22-1 + nitrogen-13 + chebi_ontology + (13)7N + (13)N + nitrogen, isotope of mass 13 + nitrogen-13 + CHEBI:36935 + + nitrogen-13 atom + + + + + CAS:13981-22-1 + ChemIDplus + + + + + nitrogen-13 + IUPAC + + + + + + (13)7N + IUPAC + + + + + (13)N + IUPAC + + + + + nitrogen, isotope of mass 13 + ChemIDplus + + + + + nitrogen-13 + ChEBI + + + + + + + + + 0 + N + 14.007 + 14.00307 + CAS:13981-62-9 + nitrogen-16 + chebi_ontology + (16)7N + (16)N + nitrogen, isotope of mass 16 + nitrogen-16 + CHEBI:36936 + + nitrogen-16 atom + + + + + CAS:13981-62-9 + ChemIDplus + + + + + nitrogen-16 + IUPAC + + + + + + (16)7N + IUPAC + + + + + (16)N + IUPAC + + + + + nitrogen, isotope of mass 16 + ChemIDplus + + + + + nitrogen-16 + ChEBI + + + + + + + + + 0 + N + 14.007 + 14.00307 + CAS:14914-35-3 + nitrogen-17 + chebi_ontology + (17)7N + (17)N + nitrogen-17 + CHEBI:36937 + + nitrogen-17 atom + + + + + CAS:14914-35-3 + ChemIDplus + + + + + nitrogen-17 + IUPAC + + + + + + (17)7N + IUPAC + + + + + (17)N + ChEBI + + + + + nitrogen-17 + ChEBI + + + + + + + + + The stable isotope of nitrogen with relative atomic mass 14.003074. The most abundant (99.63 atom percent) isotope of naturally occurring nitrogen. + 0 + N + 14.007 + 14.00307 + nitrogen-14 + chebi_ontology + (14)7N + (14)N + nitrogen-14 + CHEBI:36938 + + nitrogen-14 atom + + + + + nitrogen-14 + IUPAC + + + + + + (14)7N + IUPAC + + + + + (14)N + IUPAC + + + + + nitrogen-14 + ChEBI + + + + + + + + + The radioactive isotope of fluorine with relative atomic mass 18.000938. The longest-lived fluorine radionuclide with half-life of 109.77 min. + 0 + [18F] + InChI=1S/F/i1-1 + YCKRFDGAMUMZLT-BJUDXGSMSA-N + 18.001 + 18.00094 + [18F] + CAS:13981-56-1 + DrugBank:DB13134 + Wikipedia:Fluorine-18 + fluorine-18 + chebi_ontology + (18)9F + (18)F + fluorine, isotope of mass 18 + fluorine-18 + CHEBI:36939 + + fluorine-18 atom + + + + + CAS:13981-56-1 + ChemIDplus + + + + + fluorine-18 + IUPAC + + + + + + (18)9F + IUPAC + + + + + (18)F + IUPAC + + + + + fluorine, isotope of mass 18 + ChemIDplus + + + + + fluorine-18 + ChEBI + + + + + + + + + The stable isotope of fluorine with relative atomic mass 18.998403 and nuclear spin (1)/2. + 0 + [19F] + InChI=1S/F/i1+0 + YCKRFDGAMUMZLT-IGMARMGPSA-N + 18.998 + 18.99840 + [19F] + fluorine-19 + chebi_ontology + (19)9F + (19)F + fluorine-19 + CHEBI:36940 + + fluorine-19 atom + + + + + fluorine-19 + IUPAC + + + + + + (19)9F + IUPAC + + + + + (19)F + ChEBI + + + + + fluorine-19 + ChEBI + + + + + + + + + + An organochalcogen compound is a compound containing at least one carbon-chalcogen bond. + organochalcogen compound + chebi_ontology + organochalcogen compounds + CHEBI:36962 + + organochalcogen compound + + + + + organochalcogen compound + ChEBI + + + + + organochalcogen compounds + ChEBI + + + + + + + + + + An organochalcogen compound containing at least one carbon-oxygen bond. + PMID:17586126 + organooxygen compound + chebi_ontology + organooxygen compounds + CHEBI:36963 + + organooxygen compound + + + + + PMID:17586126 + Europe PMC + + + + + organooxygen compound + ChEBI + + + + + organooxygen compounds + ChEBI + + + + + + + + + The radioactive isotope of helium with relative atomic mass 6.01889 and half-life of 806.7 ms. + 0 + [6He] + InChI=1S/He/i1+2 + SWQJXJOGLNCZEY-NJFSPNSNSA-N + 6.019 + 6.01889 + [6He] + helium-6 + chebi_ontology + (6)2He + (6)He + helium-6 + CHEBI:37003 + + helium-6 atom + + + + + helium-6 + IUPAC + + + + + + (6)2He + IUPAC + + + + + (6)He + IUPAC + + + + + helium-6 + ChEBI + + + + + + + + + The radioactive isotope of helium with relative atomic mass 8.03392 and half-life of 119.0 ms. + 0 + [8He] + InChI=1S/He/i1+4 + SWQJXJOGLNCZEY-RNFDNDRNSA-N + 8.034 + 8.03392 + [8He] + helium-8 + chebi_ontology + (8)2He + (8)He + helium-8 + CHEBI:37004 + + helium-8 atom + + + + + helium-8 + IUPAC + + + + + + (8)2He + IUPAC + + + + + (8)He + IUPAC + + + + + helium-8 + ChEBI + + + + + + + + + + + + + + + + amino-acid anion + chebi_ontology + amino acid anions + amino-acid anions + CHEBI:37022 + + amino-acid anion + + + + + amino-acid anion + ChEBI + + + + + amino acid anions + ChEBI + + + + + amino-acid anions + ChEBI + + + + + + + + + mononuclear parent hydrides + chebi_ontology + mononuclear hydride + mononuclear hydrides + CHEBI:37176 + + mononuclear parent hydride + + + + + mononuclear parent hydrides + IUPAC + + + + + + mononuclear hydride + ChEBI + + + + + mononuclear hydrides + IUPAC + + + + + + + + + elemental sodium + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 209.98286 and half-life of 138.376 days; the only naturally occurring isotope of polonium. + 0 + [210Po] + InChI=1S/Po/i1+1 + HZEBHPIOVYHPMT-OUBTZVSYSA-N + 209.983 + 209.98286 + [210Po] + CAS:13981-52-7 + Gmelin:76756 + polonium-210 + chebi_ontology + (210)84Po + (210)Po + polonium, isotope of mass 210 + polonium-210 + CHEBI:37340 + + polonium-210 atom + + + + + CAS:13981-52-7 + ChemIDplus + + + + + Gmelin:76756 + Gmelin + + + + + polonium-210 + IUPAC + + + + + + (210)84Po + IUPAC + + + + + (210)Po + IUPAC + + + + + polonium, isotope of mass 210 + ChemIDplus + + + + + polonium-210 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 210.986637 and half-life of 0.516 s. + 0 + [211Po] + InChI=1S/Po/i1+2 + HZEBHPIOVYHPMT-NJFSPNSNSA-N + 210.987 + 210.98664 + [211Po] + CAS:15735-83-8 + Gmelin:41683 + polonium-211 + chebi_ontology + (211)84Po + (211)Po + polonium, isotope of mass 211 + polonium-211 + CHEBI:37341 + + polonium-211 atom + + + + + CAS:15735-83-8 + ChemIDplus + + + + + Gmelin:41683 + Gmelin + + + + + polonium-211 + IUPAC + + + + + + (211)84Po + IUPAC + + + + + (211)Po + IUPAC + + + + + polonium, isotope of mass 211 + ChemIDplus + + + + + polonium-211 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 211.988852 and half-life of 0.299 mus. + 0 + [212Po] + InChI=1S/Po/i1+3 + HZEBHPIOVYHPMT-AKLPVKDBSA-N + 211.989 + 211.98885 + [212Po] + CAS:15389-34-1 + Gmelin:41677 + polonium-212 + chebi_ontology + (212)84Po + (212)Po + polonium, isotope of mass 212 + polonium-212 + CHEBI:37342 + + polonium-212 atom + + + + + CAS:15389-34-1 + ChemIDplus + + + + + Gmelin:41677 + Gmelin + + + + + polonium-212 + IUPAC + + + + + + (212)84Po + IUPAC + + + + + (212)Po + IUPAC + + + + + polonium, isotope of mass 212 + ChemIDplus + + + + + polonium-212 + ChEBI + + + + + - - - Any nutrient required in large quantities by organisms throughout their life in order to orchestrate a range of physiological functions. Macronutrients are usually chemical elements (carbon, hydrogen, nitrogen, oxygen, phosphorus and sulfur) that humans consume in the largest quantities. Calcium, sodium, magnesium and potassium are sometimes included as macronutrients because they are required in relatively large quantities compared with other vitamins and minerals. + + + The radioactive isotope of polonium with relative atomic mass 212.9928425 and half-life of 4.2 mus. + 0 + [213Po] + InChI=1S/Po/i1+4 + HZEBHPIOVYHPMT-RNFDNDRNSA-N + 212.993 + 212.99284 + [213Po] + CAS:15756-57-7 + polonium-213 chebi_ontology - macronutrients - CHEBI:33937 - + (213)84Po + (213)Po + polonium, isotope of mass 213 + polonium-213 + CHEBI:37343 - macronutrient + polonium-213 atom - + + + CAS:15756-57-7 + ChemIDplus + + + + + polonium-213 + IUPAC + + + + - macronutrients + (213)84Po + IUPAC + + + + + (213)Po + IUPAC + + + + + polonium, isotope of mass 213 + ChemIDplus + + + + + polonium-213 ChEBI - + - - - - halide salt + + + The radioactive isotope of polonium with relative atomic mass 213.995186 and half-life of 164.3 mus. + 0 + [214Po] + InChI=1S/Po/i1+5 + HZEBHPIOVYHPMT-BKFZFHPZSA-N + 213.995 + 213.99519 + [214Po] + CAS:15735-67-8 + Gmelin:41679 + polonium-214 + chebi_ontology + (214)84Po + (214)Po + polonium, isotope of mass 214 + polonium-214 + CHEBI:37344 + + polonium-214 atom + + + + CAS:15735-67-8 + ChemIDplus + + + + + Gmelin:41679 + Gmelin + + + + + polonium-214 + IUPAC + + + + + + (214)84Po + IUPAC + + + + + (214)Po + IUPAC + + + + + polonium, isotope of mass 214 + ChemIDplus + + + + + polonium-214 + ChEBI + - + - - - gold molecular entity + + + The radioactive isotope of polonium with relative atomic mass 214.999415 and half-life of 1.781 ms. + 0 + [215Po] + InChI=1S/Po/i1+6 + HZEBHPIOVYHPMT-LZFNBGRKSA-N + 214.999 + 214.99941 + [215Po] + CAS:15706-52-2 + Gmelin:41680 + polonium-215 + chebi_ontology + (215)84Po + (215)Po + polonium, isotope of mass 215 + polonium-215 + CHEBI:37345 + + polonium-215 atom + + + + CAS:15706-52-2 + ChemIDplus + + + + + Gmelin:41680 + Gmelin + + + + + polonium-215 + IUPAC + + + + + + (215)84Po + IUPAC + + + + + (215)Po + IUPAC + + + + + polonium, isotope of mass 215 + ChemIDplus + + + + + polonium-215 + ChEBI + - + - - - + + + The radioactive isotope of polonium with relative atomic mass 216.001905 and half-life of 0.145 s. + 0 + [216Po] + InChI=1S/Po/i1+7 + HZEBHPIOVYHPMT-RKEGKUSMSA-N + 216.002 + 216.00191 + [216Po] + CAS:15756-58-8 + Gmelin:41684 + polonium-216 chebi_ontology - nitrogen hydrides - CHEBI:35106 + (216)84Po + (216)Po + polonium, isotope of mass 216 + polonium-216 + CHEBI:37346 - nitrogen hydride + polonium-216 atom - + + + CAS:15756-58-8 + ChemIDplus + + + + + Gmelin:41684 + Gmelin + + + + + polonium-216 + IUPAC + + + + - nitrogen hydrides + (216)84Po + IUPAC + + + + + (216)Po + IUPAC + + + + + polonium, isotope of mass 216 + ChemIDplus + + + + + polonium-216 ChEBI - + - - - Saturated acyclic nitrogen hydrides having the general formula NnHn+2. + + + The radioactive isotope of polonium with relative atomic mass 217.006253 and half-life of < 10 s. + 0 + [217Po] + InChI=1S/Po/i1+8 + HZEBHPIOVYHPMT-CONNIKPHSA-N + 217.006 + 217.00625 + [217Po] + polonium-217 chebi_ontology - azanes - CHEBI:35107 + (217)84Po + (217)Po + polonium-217 + CHEBI:37347 - azane + polonium-217 atom - + + + polonium-217 + IUPAC + + + + - azanes + (217)84Po + IUPAC + + + + + (217)Po + IUPAC + + + + + polonium-217 ChEBI - + - - - A substance that diminishes the rate of a chemical reaction. - inhibitor + + + The radioactive isotope of polonium with relative atomic mass 218.008966 and half-life of 3.10 min. + 0 + [218Po] + InChI=1S/Po/i1+9 + HZEBHPIOVYHPMT-KUYOKYOWSA-N + 218.009 + 218.00897 + [218Po] + CAS:15422-74-9 + Gmelin:41685 + polonium-218 chebi_ontology - inhibidor - inhibiteur - inhibitors - CHEBI:35222 + (218)84Po + (218)Po + polonium, isotope of mass 218 + polonium-218 + CHEBI:37348 - inhibitor + polonium-218 atom - + + + CAS:15422-74-9 + ChemIDplus + + + + + Gmelin:41685 + Gmelin + + + - inhibitor + polonium-218 IUPAC - + - inhibidor + (218)84Po + IUPAC + + + + + (218)Po + IUPAC + + + + + polonium, isotope of mass 218 + ChemIDplus + + + + + polonium-218 ChEBI + + + + + + + + 0 + [190Po] + InChI=1S/Po/i1-19 + HZEBHPIOVYHPMT-BTCYYSDASA-N + 189.994 + 189.99429 + [190Po] + polonium-190 + chebi_ontology + (190)84Po + (190)Po + polonium-190 + CHEBI:37350 + + polonium-190 atom + - + + + polonium-190 + IUPAC + + + + - inhibiteur + (190)84Po + IUPAC + + + + + (190)Po + IUPAC + + + + + polonium-190 ChEBI + + + + + + + + 0 + [191Po] + InChI=1S/Po/i1-18 + HZEBHPIOVYHPMT-ZWLOOBQPSA-N + 190.995 + 190.99465 + [191Po] + polonium-191 + chebi_ontology + (191)84Po + (191)Po + polonium-191 + CHEBI:37351 + + polonium-191 atom + + + + + polonium-191 + IUPAC + + - + - inhibitors + (191)84Po + IUPAC + + + + + (191)Po + IUPAC + + + + + polonium-191 ChEBI - + - - - fossil fuel + + + 0 + [192Po] + InChI=1S/Po/i1-17 + HZEBHPIOVYHPMT-MEAORNGASA-N + 191.990 + 191.99033 + [192Po] + polonium-192 + chebi_ontology + (192)84Po + (192)Po + polonium-192 + CHEBI:37352 + + polonium-192 atom + + + + + polonium-192 + IUPAC + + + + + + (192)84Po + IUPAC + + + + + (192)Po + IUPAC + + + + + polonium-192 + ChEBI + + + + + + + + + 0 + [193Po] + InChI=1S/Po/i1-16 + HZEBHPIOVYHPMT-KLOSUXQXSA-N + 192.991 + 192.99110 + [193Po] + polonium-193 + chebi_ontology + (193)84Po + (193)Po + polonium-193 + CHEBI:37353 + + polonium-193 atom + + + + polonium-193 + IUPAC + + + + + + (193)84Po + IUPAC + + + + + (193)Po + IUPAC + + + + + polonium-193 + ChEBI + - + - - - The zwitterionic form of an amino acid having a negatively charged carboxyl group and a positively charged amino group. - amino acid zwitterion + + + 0 + [194Po] + InChI=1S/Po/i1-15 + HZEBHPIOVYHPMT-LPJXZZDMSA-N + 193.988 + 193.98828 + [194Po] + polonium-194 chebi_ontology - CHEBI:35238 + (194)84Po + (194)Po + polonium-194 + CHEBI:37354 - amino acid zwitterion + polonium-194 atom - + - amino acid zwitterion + polonium-194 + IUPAC + + + + + + (194)84Po + IUPAC + + + + + (194)Po + IUPAC + + + + + polonium-194 ChEBI - + - - - - steroid + + + 0 + [195Po] + InChI=1S/Po/i1-14 + HZEBHPIOVYHPMT-DWTUDRKQSA-N + 194.988 + 194.98804 + [195Po] + polonium-195 + chebi_ontology + (195)84Po + (195)Po + polonium-195 + CHEBI:37355 + + polonium-195 atom + + + + polonium-195 + IUPAC + + + + + + (195)84Po + IUPAC + + + + + (195)Po + IUPAC + + + + + polonium-195 + ChEBI + - + - - - - Any heteroorganic entity containing at least one carbon-nitrogen bond. - organonitrogen compounds + + + 0 + [196Po] + InChI=1S/Po/i1-13 + HZEBHPIOVYHPMT-QAPNMCNYSA-N + 195.985 + 195.98547 + [196Po] + polonium-196 chebi_ontology - organonitrogens - CHEBI:35352 + (196)84Po + (196)Po + polonium-196 + CHEBI:37356 - organonitrogen compound + polonium-196 atom - + - organonitrogen compounds + polonium-196 IUPAC - + - organonitrogens + (196)84Po + IUPAC + + + + + (196)Po + IUPAC + + + + + polonium-196 ChEBI - + - - - - An oxoanion is an anion derived from an oxoacid by loss of hydron(s) bound to oxygen. - CHEBI:33274 - CHEBI:33436 - oxoanion + + + 0 + [197Po] + InChI=1S/Po/i1-12 + HZEBHPIOVYHPMT-DFNMHJECSA-N + 196.986 + 196.98557 + [197Po] + polonium-197 chebi_ontology - oxoacid anions - oxoanions - CHEBI:35406 + (197)84Po + (197)Po + polonium-197 + CHEBI:37357 - oxoanion + polonium-197 atom - + - oxoanion + polonium-197 + IUPAC + + + + + + (197)84Po ChEBI - + - oxoacid anions + (197)Po ChEBI - + - oxoanions + polonium-197 ChEBI - + - - - - alkali metal salt + + + 0 + [198Po] + InChI=1S/Po/i1-11 + HZEBHPIOVYHPMT-DSSHQIQSSA-N + 197.984 + 197.98402 + [198Po] + polonium-198 + chebi_ontology + (198)84Po + (198)Po + polonium-198 + CHEBI:37358 + + polonium-198 atom + + + + polonium-198 + IUPAC + + + + + + (198)84Po + IUPAC + + + + + (198)Po + IUPAC + + + + + polonium-198 + ChEBI + - + - - - + + + 0 + [199Po] + InChI=1S/Po/i1-10 + HZEBHPIOVYHPMT-CBESVEIWSA-N + 198.985 + 198.98504 + [199Po] + polonium-199 chebi_ontology - carbon oxoacids - oxoacids of carbon - CHEBI:35605 + (199)84Po + (199)Po + polonium-199 + CHEBI:37359 - carbon oxoacid + polonium-199 atom - + + + polonium-199 + IUPAC + + + + - carbon oxoacids + (199)84Po + IUPAC + + + + + (199)Po + IUPAC + + + + + polonium-199 ChEBI + + + + + + + + 0 + [200Po] + InChI=1S/Po/i1-9 + HZEBHPIOVYHPMT-DBXDQKISSA-N + 199.982 + 199.98173 + [200Po] + polonium-200 + chebi_ontology + (200)84Po + (200)Po + polonium-200 + CHEBI:37360 + + polonium-200 atom + - + + + polonium-200 + IUPAC + + + + - oxoacids of carbon + (200)84Po + IUPAC + + + + + (200)Po + IUPAC + + + + + polonium-200 ChEBI - + - - - - dicarboxylic acid + + + 0 + [201Po] + InChI=1S/Po/i1-8 + HZEBHPIOVYHPMT-QQVBLGSISA-N + 200.982 + 200.98221 + [201Po] + polonium-201 + chebi_ontology + (201)84Po + (201)Po + polonium-201 + CHEBI:37361 + + polonium-201 atom + + + + polonium-201 + IUPAC + + + + + + (201)84Po + IUPAC + + + + + (201)Po + IUPAC + + + + + polonium-201 + ChEBI + - + - - - ester + + + 0 + [202Po] + InChI=1S/Po/i1-7 + HZEBHPIOVYHPMT-NOHWODKXSA-N + 201.981 + 201.98070 + [202Po] + polonium-202 + chebi_ontology + (202)84Po + (202)Po + polonium-202 + CHEBI:37362 + + polonium-202 atom + + + + polonium-202 + IUPAC + + + + + + (202)84Po + IUPAC + + + + + (202)Po + IUPAC + + + + + polonium-202 + ChEBI + - + - - - - sulfated glycosaminoglycan + + + The radioactive isotope of polonium with relative atomic mass 202.981413 and half-life of 36.7 min. + 0 + [203Po] + InChI=1S/Po/i1-6 + HZEBHPIOVYHPMT-VENIDDJXSA-N + 202.981 + 202.98141 + [203Po] + CAS:16729-74-1 + polonium-203 + chebi_ontology + (203)84Po + (203)Po + polonium, isotope of mass 203 + polonium-203 + CHEBI:37363 + + polonium-203 atom + + + + CAS:16729-74-1 + ChemIDplus + + + + + polonium-203 + IUPAC + + + + + + (203)84Po + IUPAC + + + + + (203)Po + IUPAC + + + + + polonium, isotope of mass 203 + ChemIDplus + + + + + polonium-203 + ChEBI + - + - - - - - carbohydrate sulfate + + + 0 + [204Po] + InChI=1S/Po/i1-5 + HZEBHPIOVYHPMT-FTXFMUIASA-N + 203.980 + 203.98031 + [204Po] + polonium-204 + chebi_ontology + (204)84Po + (204)Po + polonium-204 + CHEBI:37364 + + polonium-204 atom + + + + polonium-204 + IUPAC + + + + + + (204)84Po + IUPAC + + + + + (204)Po + IUPAC + + + + + polonium-204 + ChEBI + - + - - - - pnictogen hydride + + + The radioactive isotope of polonium with relative atomic mass 204.981165 and half-life of 1.66 h. + 0 + [205Po] + InChI=1S/Po/i1-4 + HZEBHPIOVYHPMT-AHCXROLUSA-N + 204.981 + 204.98117 + [205Po] + CAS:16729-76-3 + polonium-205 chebi_ontology - pnictogen hydrides - CHEBI:35881 + (205)84Po + (205)Po + polonium, isotope of mass 205 + polonium-205 + CHEBI:37365 - pnictogen hydride + polonium-205 atom - + + + CAS:16729-76-3 + ChemIDplus + + + - pnictogen hydride + polonium-205 + IUPAC + + + + + + (205)84Po + IUPAC + + + + + (205)Po + IUPAC + + + + + polonium, isotope of mass 205 + ChemIDplus + + + + + polonium-205 ChEBI + + + + + + + + The radioactive isotope of polonium with relative atomic mass 205.98047 and half-life of 8.8 days. + 0 + [206Po] + InChI=1S/Po/i1-3 + HZEBHPIOVYHPMT-OIOBTWANSA-N + 205.980 + 205.98047 + [206Po] + polonium-206 + chebi_ontology + (206)84Po + (206)Po + polonium-206 + CHEBI:37366 + + polonium-206 atom + - + + + polonium-206 + IUPAC + + + + - pnictogen hydrides + (206)84Po + IUPAC + + + + + (206)Po + IUPAC + + + + + polonium-206 ChEBI - + - - - cholanoid + + + The radioactive isotope of polonium with relative atomic mass 206.981578 and half-life of 5.80 h. + 0 + [207Po] + InChI=1S/Po/i1-2 + HZEBHPIOVYHPMT-YPZZEJLDSA-N + 206.982 + 206.98158 + [207Po] + CAS:15720-45-3 + polonium-207 + chebi_ontology + (207)84Po + (207)Po + polonium, isotope of mass 207 + polonium-207 + CHEBI:37367 + + polonium-207 atom + + + + CAS:15720-45-3 + ChemIDplus + + + + + polonium-207 + IUPAC + + + + + + (207)84Po + IUPAC + + + + + (207)Po + IUPAC + + + + + polonium, isotope of mass 207 + ChemIDplus + + + + + polonium-207 + ChEBI + - + - - - - A biological macromolecule minimally consisting of one polypeptide chain synthesized at the ribosome. - CHEBI:13677 - CHEBI:14911 - proteins + + + The radioactive isotope of polonium with relative atomic mass 207.98123 and half-life of 2.898 years. + 0 + [208Po] + InChI=1S/Po/i1-1 + HZEBHPIOVYHPMT-BJUDXGSMSA-N + 207.981 + 207.98123 + [208Po] + polonium-208 chebi_ontology - CHEBI:36080 + (208)84Po + (208)Po + polonium-208 + CHEBI:37368 - protein + polonium-208 atom - + - proteins + polonium-208 IUPAC + + + + (208)84Po + IUPAC + + + + + (208)Po + IUPAC + + + + + polonium-208 + ChEBI + - + - - - - inorganic chloride + + + The radioactive isotope of polonium with relative atomic mass 208.982404 and half-life of 102 years. + 0 + [209Po] + InChI=1S/Po/i1+0 + HZEBHPIOVYHPMT-IGMARMGPSA-N + 208.982 + 208.98242 + [209Po] + polonium-209 + chebi_ontology + (209)84Po + (209)Po + polonium-209 + CHEBI:37369 + + polonium-209 atom + + + + polonium-209 + IUPAC + + + + + + (209)84Po + IUPAC + + + + + (209)Po + IUPAC + + + + + polonium-209 + ChEBI + - + - - - - bile acid salt + + + mucopolysaccharide - + - - - - Lepton is a fermion that does not experience the strong force (strong interaction). The term is derived from the Greek lambdaepsilonpitauomicronsigma (small, thin). + + + An acid is a molecular entity capable of donating a hydron (Bronsted acid) or capable of forming a covalent bond with an electron pair (Lewis acid). + CHEBI:13800 + CHEBI:13801 + CHEBI:22209 + CHEBI:2426 + KEGG:C00174 + Acid + acid chebi_ontology - leptons - CHEBI:36338 + Saeure + Saeuren + acide + acido + acids + CHEBI:37527 - lepton + acid - + + + Acid + KEGG_COMPOUND + + + + + acid + IUPAC + + + + + + Saeure + ChEBI + + + + + Saeuren + ChEBI + + + + + acide + IUPAC + + + - leptons + acido + ChEBI + + + + + acids ChEBI - + - - - - Baryon is a fermion that does experience the strong force (strong interaction). The term is derived from the Greek betaalpharhoupsilonsigma (heavy). + + + A molecular entity consisting of two or more chemical elements. chebi_ontology - baryons - CHEBI:36339 + chemical compound + heteroatomic molecular entities + CHEBI:37577 - baryon + heteroatomic molecular entity - + + + chemical compound + ChEBI + + + - baryons + heteroatomic molecular entities ChEBI - + - - - Particle of half-integer spin quantum number following Fermi-Dirac statistics. Fermions are named after Enrico Fermi. - fermion + + + + halide + + + + + + + + + + + + + + + + + An amide of a carboxylic acid, having the structure RC(=O)NR2. The term is used as a suffix in systematic name formation to denote the -C(=O)NH2 group including its carbon atom. + 0 + CNOR3 + 42.01680 + 41.99799 + [*]C(=O)N([*])[*] + CHEBI:35354 + CHEBI:35355 + carboxamides chebi_ontology - fermions - CHEBI:36340 + carboxamides + primary carboxamide + CHEBI:37622 - fermion + carboxamide - + - fermion + carboxamides IUPAC - + + + carboxamides + ChEBI + + + - fermions + primary carboxamide ChEBI - + - - - Particle of integer spin quantum number following Bose-Einstein statistics. Bosons are named after Satyendra Nath Bose. - boson + + + The stable isotope of thallium with relative atomic mass 202.9723. The least abundant (29.524 atom percent) isotope of naturally occurring thallium. + 0 + [203Tl] + InChI=1S/Tl/i1-1 + BKVIYDNLLOSFOA-BJUDXGSMSA-N + 202.972 + 202.97234 + [203Tl] + CAS:14280-48-9 + thallium-203 chebi_ontology - bosons - CHEBI:36341 + (203)81Tl + (203)Tl + thallium, isotope of mass 203 + CHEBI:37802 - boson + thallium-203 - + + + CAS:14280-48-9 + ChemIDplus + + + - boson + thallium-203 IUPAC - + - bosons - ChEBI + (203)81Tl + IUPAC + + + + + (203)Tl + IUPAC + + + + + thallium, isotope of mass 203 + ChemIDplus - + - - - A particle smaller than an atom. - Wikipedia:Subatomic_particle + + + The stable isotope of thallium with relative atomic mass 204.9744. The most abundant (70.476 atom percent) isotope of naturally occurring thallium. + 0 + [205Tl] + InChI=1S/Tl/i1+1 + BKVIYDNLLOSFOA-OUBTZVSYSA-N + 204.974 + 204.97443 + [205Tl] + CAS:14280-49-0 + Gmelin:557319 + thallium-205 chebi_ontology - subatomic particles - CHEBI:36342 + (205)81Tl + (205)Tl + thallium, isotope of mass 205 + CHEBI:37803 - subatomic particle - subatomic particle + thallium-205 - + + + CAS:14280-49-0 + ChemIDplus + + + + + Gmelin:557319 + Gmelin + + + + + thallium-205 + IUPAC + + + + - subatomic particles - ChEBI + (205)81Tl + IUPAC + + + + + (205)Tl + IUPAC + + + + + thallium, isotope of mass 205 + ChemIDplus - + - - - A subatomic particle known to have substructure (i.e. consisting of smaller particles). + + + The radioactive isotope of thallium with relative atomic mass 200.9708 and half-life of 72.912 hours. + 0 + [201Tl] + InChI=1S/Tl/i1-3 + BKVIYDNLLOSFOA-OIOBTWANSA-N + 200.971 + 200.97080 + [201Tl] + CAS:15064-65-0 + thallium-201 chebi_ontology - composite particles - CHEBI:36343 + (201)81Tl + (201)Tl + thallium, isotope of mass 201 + CHEBI:37804 - composite particle + thallium-201 - + + + CAS:15064-65-0 + ChemIDplus + + + + + thallium-201 + IUPAC + + + + - composite particles - ChEBI + (201)81Tl + IUPAC + + + + + (201)Tl + IUPAC + + + + + thallium, isotope of mass 201 + ChemIDplus - + - - - Hadron is a subatomic particle which experiences the strong force. + + + The radioactive isotope of thallium with relative atomic mass 198.9698 and half-life of 7.42 hours. + 0 + [199Tl] + InChI=1S/Tl/i1-5 + BKVIYDNLLOSFOA-FTXFMUIASA-N + 198.970 + 198.96981 + [199Tl] + CAS:15064-66-1 + Gmelin:1491863 + thallium-199 chebi_ontology - hadrons - CHEBI:36344 + (199)81Tl + (199)Tl + thallium, isotope of mass 199 + CHEBI:37805 - hadron + thallium-199 - + + + CAS:15064-66-1 + ChemIDplus + + + + + Gmelin:1491863 + Gmelin + + + + + thallium-199 + IUPAC + + + + + + (199)81Tl + IUPAC + + + + + (199)Tl + IUPAC + + + + + thallium, isotope of mass 199 + ChemIDplus + + + + + + + + + sulfuric acid derivative + + + + + + + + + + + + + + + A carboacyl group is a group formed by loss of at least one OH from the carboxy group of a carboxylic acid. + carboacyl groups + carboxylic acyl group + chebi_ontology + carboxylic acyl groups + CHEBI:37838 + + carboacyl group + + + + + carboacyl groups + IUPAC + + + + + + carboxylic acyl group + IUPAC + + + + + + carboxylic acyl groups + IUPAC + + + + + + + + + The stable isotope of aluminium with relative atomic mass 26.98153 and nuclear spin (5)/2. + 0 + [27Al] + InChI=1S/Al/i1+0 + XAGFODPZIPBFFR-IGMARMGPSA-N + 26.982 + 26.98154 + [27Al] + aluminium-27 + chebi_ontology + (27)13Al + (27)Al + aluminium-27 + aluminum, isotope of mass 27 + aluminum-27 + CHEBI:37968 + + aluminium-27 atom + + + + + aluminium-27 + IUPAC + + + + + + (27)13Al + IUPAC + + + + + (27)Al + IUPAC + + + + + aluminium-27 + ChEBI + + + - hadrons + aluminum, isotope of mass 27 ChEBI - - - - - - - - - A hadron with zero or integer spin; a strongly interacting boson. The term is derived from the Greek muepsilonsigmaomicronsigma (medium, middle). - chebi_ontology - mesons - CHEBI:36345 - - meson - - + - mesons + aluminum-27 ChEBI - + - - - A nucleus or any of its constituents in any of their energy states. - nuclear particle + + + The radioactive isotope of aluminium with relative atomic mass 25.986892 and half-life of 717,000 years. + 0 + [26Al] + InChI=1S/Al/i1-1 + XAGFODPZIPBFFR-BJUDXGSMSA-N + 25.987 + 25.98689 + [26Al] + CAS:14682-66-7 + aluminium-26 chebi_ontology - CHEBI:36347 + (26)13Al + (26)Al + aluminium-26 + aluminum, isotope of mass 26 + aluminum-26 + CHEBI:37969 - nuclear particle + aluminium-26 atom - + + + CAS:14682-66-7 + ChemIDplus + + + - nuclear particle + aluminium-26 IUPAC - - - - - - - - The collective name for zero-spin mesons pi(+), pi(-) and pi(0). - pi meson - pion - chebi_ontology - pi-meson - CHEBI:36348 - - pi meson - - - - pi meson - ChEBI + + + (26)13Al + IUPAC - - - pion + + + (26)Al IUPAC - - + - pi-meson + aluminium-26 ChEBI + + + + aluminum, isotope of mass 26 + ChemIDplus + + + + + aluminum-26 + ChemIDplus + - + - - - Elementary particle not affected by the strong force having a spin 1/2, a negative elementary charge and a rest mass of 0.113428913(17) u, or 105.658389(34) MeV. - -1 - 0.113428913 - muon + + + The radioactive isotope of aluminium with relative atomic mass 27.981910 and half-life of 2.25 min. + 0 + [28Al] + InChI=1S/Al/i1+1 + XAGFODPZIPBFFR-OUBTZVSYSA-N + 27.982 + 27.98191 + [28Al] + CAS:14999-04-3 + aluminium-28 chebi_ontology - Mueon - My-Teilchen - Myon - mu(-) - negative muon - CHEBI:36356 + (28)13Al + (28)Al + aluminium-28 + aluminum, isotope of mass 28 + aluminum-28 + CHEBI:37970 - muon + aluminium-28 atom - + + + CAS:14999-04-3 + ChemIDplus + + + - muon + aluminium-28 IUPAC - + - Mueon - ChEBI + (28)13Al + IUPAC - + - My-Teilchen - ChEBI + (28)Al + IUPAC - + - Myon + aluminium-28 ChEBI - + - mu(-) - IUPAC + aluminum, isotope of mass 28 + ChemIDplus - + - negative muon - ChEBI + aluminum-28 + ChemIDplus - + - - - - - - - - - Any molecular entity consisting of more than one atom. + + + The stable isotope of phosphorus with relative atomic mass 30.973762 and nuclear spin (1)/2. + 0 + [31P] + InChI=1S/P/i1+0 + OAICVXFJPJFONN-IGMARMGPSA-N + 30.974 + 30.97376 + [31P] + phosphorus-31 chebi_ontology - polyatomic entities - CHEBI:36357 + (31)15P + (31)P + phosphorus-31 + CHEBI:37971 - polyatomic entity + phosphorus-31 atom - + + + phosphorus-31 + IUPAC + + + + - polyatomic entities + (31)15P + IUPAC + + + + + (31)P + IUPAC + + + + + phosphorus-31 ChEBI - + - - - - An ion consisting of more than one atom. + + + The radioactive isotope of phosphorus with relative atomic mass 31.973907 and half-life of 14.26 days. + 0 + [32P] + InChI=1S/P/i1+1 + OAICVXFJPJFONN-OUBTZVSYSA-N + 31.974 + 31.97391 + [32P] + CAS:14596-37-3 + KEGG:C19162 + phosphorus-32 chebi_ontology - polyatomic ions - CHEBI:36358 + (32)15P + (32)P + Phosphorus, isotope of mass 32 + phosphorus, isotope of mass 32 + phosphorus-32 + CHEBI:37972 - polyatomic ion + phosphorus-32 atom - + + + CAS:14596-37-3 + ChemIDplus + + + + + CAS:14596-37-3 + KEGG COMPOUND + + + + + phosphorus-32 + IUPAC + + + + - polyatomic ions + (32)15P + IUPAC + + + + + (32)P + IUPAC + + + + + Phosphorus, isotope of mass 32 + KEGG_COMPOUND + + + + + phosphorus, isotope of mass 32 + ChemIDplus + + + + + phosphorus-32 ChEBI - + - - - - - - - - - - Any compound containing the carbonyl group, C=O. The term is commonly used in the restricted sense of aldehydes and ketones, although it actually includes carboxylic acids and derivatives. - carbonyl compounds + + + The radioactive isotope of phosphorus with relative atomic mass 32.971725, half-life of 25.34 days and nuclear spin (1)/2. + 0 + [33P] + InChI=1S/P/i1+2 + OAICVXFJPJFONN-NJFSPNSNSA-N + 32.972 + 32.97173 + [33P] + CAS:15749-66-3 + phosphorus-33 chebi_ontology - CHEBI:36586 + (33)15P + (33)P + phosphorus, isotope of mass 33 + phosphorus-33 + CHEBI:37973 - carbonyl compound + phosphorus-33 atom - + + + CAS:15749-66-3 + ChemIDplus + + + - carbonyl compounds + phosphorus-33 IUPAC + + + + (33)15P + IUPAC + + + + + (33)P + IUPAC + + + + + phosphorus, isotope of mass 33 + ChemIDplus + + + + + phosphorus-33 + ChEBI + - + - - - - - - - - - Organic compounds containing an oxygen atom, =O, doubly bonded to carbon or another element. - oxo compounds + + + The stable isotope of silicon with relative atomic mass 28.9764947, 4.683 atom percent natural abundancy, and nuclear spin (1)/2. + 0 + [29Si] + InChI=1S/Si/i1+1 + XUIMIQQOPSSXEZ-OUBTZVSYSA-N + 28.976 + 28.97649 + [29Si] + silicon-29 chebi_ontology - organic oxo compounds - CHEBI:36587 + (29)14Si + (29)Si + silicon-29 + CHEBI:37974 - organic oxo compound + silicon-29 atom - + - oxo compounds + silicon-29 IUPAC - + - organic oxo compounds + (29)14Si + IUPAC + + + + + (29)Si + IUPAC + + + + + silicon-29 ChEBI - - - - - biladienes - - - - - - - - - - chalcogen hydride - - - - - - - - - argon molecular entity - - - - - + - - - + + + The stable isotope of silicon with relative atomic mass 27.9769265. The most abundant (92.23 atom percent) isotope of naturally occurring silicon. + 0 + [28Si] + InChI=1S/Si/i1+0 + XUIMIQQOPSSXEZ-IGMARMGPSA-N + 27.977 + 27.97693 + [28Si] + silicon-28 chebi_ontology - inorganic ions - CHEBI:36914 + (28)14Si + (28)Si + silicon-28 + CHEBI:37975 - inorganic ion + silicon-28 atom - + + + silicon-28 + IUPAC + + + + + + (28)14Si + IUPAC + + + + + (28)Si + IUPAC + + + - inorganic ions + silicon-28 ChEBI - + - - - + + + The stable isotope of silicon with relative atomic mass 29.9737702. The least abundant (3.09 atom percent) isotope of naturally occurring silicon. + 0 + [30Si] + InChI=1S/Si/i1+2 + XUIMIQQOPSSXEZ-NJFSPNSNSA-N + 29.974 + 29.97377 + [30Si] + silicon-30 chebi_ontology - inorganic cations - CHEBI:36915 + (30)14Si + (30)Si + silicon-30 + CHEBI:37976 - inorganic cation + silicon-30 atom - + + + silicon-30 + IUPAC + + + + + + (30)14Si + IUPAC + + + + + (30)Si + IUPAC + + + - inorganic cations + silicon-30 ChEBI - + - - - A monoatomic or polyatomic species having one or more elementary charges of the proton. - CHEBI:23058 - CHEBI:3473 - KEGG:C01373 - Cation - cation + + + The radioactive isotope of silicon with relative atomic mass 30.975363, half-life of 2.62 hours and nuclear spin (3)/2. + 0 + [31Si] + InChI=1S/Si/i1+3 + XUIMIQQOPSSXEZ-AKLPVKDBSA-N + 30.975 + 30.97536 + [31Si] + CAS:14276-49-4 + silicon-31 chebi_ontology - Kation - Kationen - cationes - cations - CHEBI:36916 + (31)14Si + (31)Si + silicon, isotope of mass 31 + silicon-31 + CHEBI:37977 - cation + silicon-31 atom - - - Cation - KEGG_COMPOUND - - - - - cation - ChEBI + + + CAS:14276-49-4 + ChemIDplus - + - cation + silicon-31 IUPAC - + - Kation - ChEBI + (31)14Si + IUPAC - + - Kationen - ChEBI + (31)Si + IUPAC - + - cationes - ChEBI + silicon, isotope of mass 31 + ChemIDplus - + - cations + silicon-31 ChEBI - + - - - - An organochalcogen compound is a compound containing at least one carbon-chalcogen bond. - organochalcogen compound + + + The radioactive isotope of silicon with relative atomic mass 31.974148. The longest-lived silicon radionuclide with half-life of 172 years. + 0 + [32Si] + InChI=1S/Si/i1+4 + XUIMIQQOPSSXEZ-RNFDNDRNSA-N + 31.974 + 31.97415 + [32Si] + CAS:15092-72-5 + silicon-32 chebi_ontology - organochalcogen compounds - CHEBI:36962 + (32)14Si + (32)Si + silicon, isotope of mass 32 + silicon-32 + CHEBI:37978 - organochalcogen compound + silicon-32 atom - + + + CAS:15092-72-5 + ChemIDplus + + + - organochalcogen compound - ChEBI + silicon-32 + IUPAC + - + - organochalcogen compounds + (32)14Si + IUPAC + + + + + (32)Si + IUPAC + + + + + silicon, isotope of mass 32 + ChemIDplus + + + + + silicon-32 ChEBI - + - - - - An organochalcogen compound containing at least one carbon-oxygen bond. - PMID:17586126 - organooxygen compound + + + The stable isotope of sulfur with relative atomic mass 31.972071. The most abundant (95.02 atom percent) isotope of naturally occurring sulfur. + 0 + [32S] + InChI=1S/S/i1+0 + NINIDFKCEFEMDL-IGMARMGPSA-N + 31.972 + 31.97207 + [32S] + CAS:13981-57-2 + sulfur-32 chebi_ontology - organooxygen compounds - CHEBI:36963 + (32)16S + (32)S + sulfur, isotope of mass 32 + sulfur-32 + sulphur-32 + CHEBI:37979 - organooxygen compound + sulfur-32 atom - + - PMID:17586126 - Europe PMC + CAS:13981-57-2 + ChemIDplus - + - organooxygen compound + sulfur-32 + IUPAC + + + + + + (32)16S + IUPAC + + + + + (32)S + IUPAC + + + + + sulfur, isotope of mass 32 + ChemIDplus + + + + + sulfur-32 ChEBI - + - organooxygen compounds + sulphur-32 ChEBI - + - - - - - - - - - - amino-acid anion + + + The stable isotope of sulfur with relative atomic mass 32.9714585, 0.75 atom percent natural abundance, and nuclear spin (3)/2. + 0 + [33S] + InChI=1S/S/i1+1 + NINIDFKCEFEMDL-OUBTZVSYSA-N + 32.971 + 32.97146 + [33S] + CAS:14257-58-0 + sulfur-33 chebi_ontology - amino acid anions - amino-acid anions - CHEBI:37022 + (33)16S + (33)S + sulfur, isotope of mass 33 + sulfur-33 + sulphur-33 + CHEBI:37980 - amino-acid anion + sulfur-33 atom - + + + CAS:14257-58-0 + ChemIDplus + + + - amino-acid anion - ChEBI + sulfur-33 + IUPAC + - + - amino acid anions + (33)16S + IUPAC + + + + + (33)S + IUPAC + + + + + sulfur, isotope of mass 33 + ChemIDplus + + + + + sulfur-33 ChEBI - + - amino-acid anions + sulphur-33 ChEBI - + - - - mononuclear parent hydrides + + + The stable isotope of sulfur with relative atomic mass 33.9678668 and 4.21 atom percent natural abundance. + 0 + [34S] + InChI=1S/S/i1+2 + NINIDFKCEFEMDL-NJFSPNSNSA-N + 33.968 + 33.96787 + [34S] + CAS:13965-97-4 + sulfur-34 chebi_ontology - mononuclear hydride - mononuclear hydrides - CHEBI:37176 + (34)16S + (34)S + sulfur, isotope of mass 34 + sulfur-34 + sulphur-34 + CHEBI:37981 - mononuclear parent hydride + sulfur-34 atom - + + + CAS:13965-97-4 + ChemIDplus + + + - mononuclear parent hydrides + sulfur-34 IUPAC - + - mononuclear hydride - ChEBI + (34)16S + IUPAC - + - mononuclear hydrides + (34)S IUPAC + + + + sulfur, isotope of mass 34 + ChemIDplus + + + + + sulfur-34 + ChEBI + + + + + sulphur-34 + ChEBI + - - - - - elemental sodium - - - - - - - - - mucopolysaccharide - - - - - + - - - An acid is a molecular entity capable of donating a hydron (Bronsted acid) or capable of forming a covalent bond with an electron pair (Lewis acid). - CHEBI:13800 - CHEBI:13801 - CHEBI:22209 - CHEBI:2426 - KEGG:C00174 - Acid - acid + + + The stable isotope of sulfur with relative atomic mass 35.9670809. The least abundant (0.02 atom percent) isotope of naturally occurring sulfur. + 0 + [36S] + InChI=1S/S/i1+4 + NINIDFKCEFEMDL-RNFDNDRNSA-N + 35.967 + 35.96708 + [36S] + CAS:14682-80-5 + sulfur-36 chebi_ontology - Saeure - Saeuren - acide - acido - acids - CHEBI:37527 + (36)16S + (36)S + sulfur, isotope of mass 36 + sulfur-36 + sulphur-36 + CHEBI:37982 - acid + sulfur-36 atom - - - Acid - KEGG_COMPOUND + + + CAS:14682-80-5 + ChemIDplus - + - acid + sulfur-36 IUPAC - + - Saeure - ChEBI + (36)16S + IUPAC - + - Saeuren - ChEBI + (36)S + IUPAC - + - acide - IUPAC + sulfur, isotope of mass 36 + ChemIDplus - + - acido + sulfur-36 ChEBI - + - acids + sulphur-36 ChEBI - + - - - A molecular entity consisting of two or more chemical elements. + + + The radioactive isotope of sulfur with relative atomic mass 34.9690322 and nuclear spin (3)/2. The longest-lived sulfur radionuclide with half-life of 87.5 days. + 0 + [35S] + InChI=1S/S/i1+3 + NINIDFKCEFEMDL-AKLPVKDBSA-N + 34.969 + 34.96903 + [35S] + CAS:15117-53-0 + sulfur-35 chebi_ontology - chemical compound - heteroatomic molecular entities - CHEBI:37577 + (35)16S + (35)S + sulfur, isotope of mass 35 + sulfur-35 + sulphur-35 + CHEBI:37983 - heteroatomic molecular entity + sulfur-35 atom - + + + CAS:15117-53-0 + ChemIDplus + + + + + sulfur-35 + IUPAC + + + + - chemical compound + (35)16S + IUPAC + + + + + (35)S + IUPAC + + + + + sulfur, isotope of mass 35 + ChemIDplus + + + + + sulfur-35 ChEBI - + - heteroatomic molecular entities + sulphur-35 ChEBI - - - - - - halide - - + - - - - - - - - - - - - - - An amide of a carboxylic acid, having the structure RC(=O)NR2. The term is used as a suffix in systematic name formation to denote the -C(=O)NH2 group including its carbon atom. + + + The radioactive isotope of sulfur with relative atomic mass 36.9711257 and half-life of 5.05 min. 0 - CNOR3 - 42.01680 - 41.99799 - [*]C(=O)N([*])[*] - CHEBI:35354 - CHEBI:35355 - carboxamides + [37S] + InChI=1S/S/i1+5 + NINIDFKCEFEMDL-BKFZFHPZSA-N + 36.971 + 36.97113 + [37S] + CAS:15753-06-7 + sulfur-37 chebi_ontology - carboxamides - primary carboxamide - CHEBI:37622 + (37)16S + (37)S + sulfur, isotope of mass 37 + sulfur-37 + sulphur-37 + CHEBI:37984 - carboxamide + sulfur-37 atom - + + + CAS:15753-06-7 + ChemIDplus + + + - carboxamides + sulfur-37 IUPAC - + - carboxamides + (37)16S + IUPAC + + + + + (37)S + IUPAC + + + + + sulfur, isotope of mass 37 + ChemIDplus + + + + + sulfur-37 ChEBI - + - primary carboxamide + sulphur-37 ChEBI - - - - - sulfuric acid derivative - - - - - + - - - - - - - - - A carboacyl group is a group formed by loss of at least one OH from the carboxy group of a carboxylic acid. - carboacyl groups - carboxylic acyl group + + + The radioactive isotope of sulfur with relative atomic mass 37.97116 and half-life of 170.3 min. + 0 + [38S] + InChI=1S/S/i1+6 + NINIDFKCEFEMDL-LZFNBGRKSA-N + 37.971 + 37.97116 + [38S] + CAS:15759-21-4 + sulfur-38 chebi_ontology - carboxylic acyl groups - CHEBI:37838 + (38)16S + (38)S + sulfur, isotope of mass 38 + sulfur-38 + sulphur-38 + CHEBI:37985 - carboacyl group + sulfur-38 atom - + + + CAS:15759-21-4 + ChemIDplus + + + - carboacyl groups + sulfur-38 IUPAC - - - carboxylic acyl group + + + (38)16S IUPAC - - + - carboxylic acyl groups + (38)S IUPAC + + + + sulfur, isotope of mass 38 + ChemIDplus + + + + + sulfur-38 + ChEBI + + + + + sulphur-38 + ChEBI + @@ -17001,6 +33250,136 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + + 0 + Ar + InChI=1S/Ar + XKRFYHLGVUSROY-UHFFFAOYSA-N + 39.94800 + 39.96238 + [Ar] + CHEBI:33311 + CAS:7440-37-1 + WebElements:Ar + argon + chebi_ontology + 18Ar + Ar + argon + CHEBI:49475 + + argon atom + + + + + CAS:7440-37-1 + ChemIDplus + + + + + argon + IUPAC + + + + + + 18Ar + IUPAC + + + + + Ar + IUPAC + + + + + argon + ChEBI + + + + + + + + + A metallic element predicted as eka-aluminium by Mendeleev in 1870 and discovered by Paul-Emile Lecoq de Boisbaudran in 1875. Named in honour of France (Latin Gallia) and perhaps also from the Latin gallus cock, a translation of Lecoq. + 0 + Ga + InChI=1S/Ga + GYHNNYVSQQEPJS-UHFFFAOYSA-N + 69.72300 + 68.92557 + [Ga] + CHEBI:33326 + CHEBI:49630 + CAS:7440-55-3 + WebElements:Ga + gallium + chebi_ontology + 31Ga + Ga + galio + gallium + CHEBI:49631 + + gallium atom + + + + + CAS:7440-55-3 + ChemIDplus + + + + + CAS:7440-55-3 + NIST Chemistry WebBook + + + + + gallium + IUPAC + + + + + + 31Ga + IUPAC + + + + + Ga + IUPAC + + + + + galio + ChEBI + + + + + gallium + ChEBI + + + + @@ -17081,6 +33460,490 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + + 0 + Ho + InChI=1S/Ho + KJZYNXUDTRRSPN-UHFFFAOYSA-N + 164.93032 + 164.93033 + [Ho] + CHEBI:33378 + CHEBI:49647 + CAS:7440-60-0 + Gmelin:16291 + WebElements:Ho + holmium + chebi_ontology + 67Ho + Ho + holmio + holmium + CHEBI:49648 + + holmium atom + + + + + CAS:7440-60-0 + ChemIDplus + + + + + CAS:7440-60-0 + NIST Chemistry WebBook + + + + + Gmelin:16291 + Gmelin + + + + + holmium + IUPAC + + + + + + 67Ho + IUPAC + + + + + Ho + IUPAC + + + + + holmio + ChEBI + + + + + holmium + ChEBI + + + + + + + + + + 0 + Ir + InChI=1S/Ir + GKOZUEZYRPOHIO-UHFFFAOYSA-N + 192.21700 + 192.96292 + [Ir] + CHEBI:33360 + CHEBI:49665 + CAS:7439-88-5 + WebElements:Ir + iridium + chebi_ontology + 77Ir + Ir + iridio + iridium + CHEBI:49666 + + iridium atom + + + + + CAS:7439-88-5 + ChemIDplus + + + + + CAS:7439-88-5 + NIST Chemistry WebBook + + + + + iridium + IUPAC + + + + + + 77Ir + IUPAC + + + + + Ir + IUPAC + + + + + iridio + ChEBI + + + + + iridium + ChEBI + + + + + + + + + + 0 + Kr + InChI=1S/Kr + DNNSSWSSYDEUBZ-UHFFFAOYSA-N + 83.80000 + 83.91150 + [Kr] + CHEBI:33312 + CAS:7439-90-9 + WebElements:Kr + krypton + chebi_ontology + 36Kr + Kr + cripton + kripton + krypton + CHEBI:49696 + + krypton atom + + + + + CAS:7439-90-9 + ChemIDplus + + + + + CAS:7439-90-9 + NIST Chemistry WebBook + + + + + krypton + IUPAC + + + + + + 36Kr + IUPAC + + + + + Kr + IUPAC + + + + + cripton + ChEBI + + + + + kripton + ChEBI + + + + + krypton + ChEBI + + + + + + + + + + 0 + Pr + InChI=1S/Pr + PUDIUYLPXJFUGB-UHFFFAOYSA-N + 140.90765 + 140.90766 + [Pr] + CHEBI:33370 + CHEBI:49827 + CAS:7440-10-0 + WebElements:Pr + praseodymium + chebi_ontology + 59Pr + Pr + Praseodym + praseodimio + praseodyme + praseodymium + CHEBI:49828 + + praseodymium atom + + + + + CAS:7440-10-0 + ChemIDplus + + + + + CAS:7440-10-0 + NIST Chemistry WebBook + + + + + praseodymium + IUPAC + + + + + + 59Pr + IUPAC + + + + + Pr + IUPAC + + + + + Praseodym + ChEBI + + + + + praseodimio + ChEBI + + + + + praseodyme + ChEBI + + + + + praseodymium + ChEBI + + + + + + + + + 0 + Re + InChI=1S/Re + WUAPFZMCVAUBPE-UHFFFAOYSA-N + 186.20700 + 186.95575 + [Re] + CHEBI:33354 + CHEBI:49879 + CAS:7440-15-5 + WebElements:Re + rhenium + chebi_ontology + 75Re + Re + Rhenium + renio + rhenium + CHEBI:49882 + + rhenium atom + + + + + CAS:7440-15-5 + ChemIDplus + + + + + CAS:7440-15-5 + NIST Chemistry WebBook + + + + + rhenium + IUPAC + + + + + + 75Re + IUPAC + + + + + Re + ChEBI + + + + + Rhenium + ChEBI + + + + + renio + ChEBI + + + + + rhenium + ChEBI + + + + + + + + + + 0 + Xe + InChI=1S/Xe + FHNFHKCVQCLJFQ-UHFFFAOYSA-N + 131.29000 + 131.90416 + [Xe] + CHEBI:32305 + CAS:7440-63-3 + Gmelin:16318 + KEGG:C13373 + WebElements:Xe + xenon + chebi_ontology + 54Xe + Xe + Xenon + xenon + CHEBI:49957 + + xenon atom + + + + + CAS:7440-63-3 + ChemIDplus + + + + + CAS:7440-63-3 + KEGG COMPOUND + + + + + CAS:7440-63-3 + NIST Chemistry WebBook + + + + + Gmelin:16318 + Gmelin + + + + + xenon + IUPAC + + + + + + 54Xe + IUPAC + + + + + Xe + IUPAC + + + + + Xenon + ChEBI + + + + + Xenon + KEGG_COMPOUND + + + + + xenon + ChEBI + + + + @@ -17113,6 +33976,69 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + A synthetic radioactive isotope of chromium having a half-life of 27.7 days and decaying by electron capture with emission of gamma rays (0.32 MeV); it is used to label red blood cells for measurement of mass or volume, survival time, and sequestration studies, for the diagnosis of gastrointestinal bleeding, and to label platelets to study their survival. + 0 + [51Cr] + InChI=1S/Cr/i1-1 + VYZAMTAEIAYCRO-BJUDXGSMSA-N + 50.945 + 50.94477 + [51Cr] + CAS:14392-02-0 + chromium-51 + chebi_ontology + (51)24Cr + (51)Cr + 51Cr + Chromium, isotope of mass 51 + CHEBI:50076 + + chromium-51 + + + + + CAS:14392-02-0 + ChemIDplus + + + + + chromium-51 + IUPAC + + + + + + (51)24Cr + IUPAC + + + + + (51)Cr + IUPAC + + + + + 51Cr + ChemIDplus + + + + + Chromium, isotope of mass 51 + ChemIDplus + + + + @@ -17566,6 +34492,1029 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + The stable isotope of tin with relative atomic mass 118.903311, 8.59 atom percent natural abundance and nuclear spin (1)/2. + 0 + [119Sn] + InChI=1S/Sn/i1+0 + ATJFFYVFTNAWJD-IGMARMGPSA-N + 118.903 + 118.90331 + [119Sn] + tin-119 + chebi_ontology + (119)50Sn + (119)Sn + tin-119 + CHEBI:52230 + + tin-119 atom + + + + + tin-119 + IUPAC + + + + + + (119)50Sn + IUPAC + + + + + (119)Sn + IUPAC + + + + + tin-119 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 119.902199 and 32.58 atom percent natural abundance. + 0 + [120Sn] + InChI=1S/Sn/i1+1 + ATJFFYVFTNAWJD-OUBTZVSYSA-N + 119.902 + 119.90220 + [120Sn] + tin-120 + chebi_ontology + (120)50Sn + (120)Sn + tin-120 + CHEBI:52231 + + tin-120 atom + + + + + tin-120 + IUPAC + + + + + + (120)50Sn + IUPAC + + + + + (120)Sn + IUPAC + + + + + tin-120 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 117.901609 and 24.22 atom percent natural abundance. + 0 + [118Sn] + InChI=1S/Sn/i1-1 + ATJFFYVFTNAWJD-BJUDXGSMSA-N + 117.902 + 117.90161 + [118Sn] + tin-118 + chebi_ontology + (118)50Sn + (118)Sn + tin-118 + CHEBI:52232 + + tin-118 atom + + + + + tin-118 + IUPAC + + + + + + (118)50Sn + IUPAC + + + + + (118)Sn + IUPAC + + + + + tin-118 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 115.901747 and 14.54 atom percent natural abundance. + 0 + [116Sn] + InChI=1S/Sn/i1-3 + ATJFFYVFTNAWJD-OIOBTWANSA-N + 115.902 + 115.90174 + [116Sn] + tin-116 + chebi_ontology + (116)50Sn + (116)Sn + tin-116 + CHEBI:52233 + + tin-116 atom + + + + + tin-116 + IUPAC + + + + + + (116)50Sn + IUPAC + + + + + (116)Sn + IUPAC + + + + + tin-116 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 116.902956, 7.68 atom percent natural abundance and nuclear spin (1)/2. + 0 + [117Sn] + InChI=1S/Sn/i1-2 + ATJFFYVFTNAWJD-YPZZEJLDSA-N + 116.903 + 116.90295 + [117Sn] + tin-117 + chebi_ontology + (117)50Sn + (117)Sn + tin-117 + CHEBI:52234 + + tin-117 atom + + + + + tin-117 + IUPAC + + + + + + (117)50Sn + IUPAC + + + + + (117)Sn + IUPAC + + + + + tin-117 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 114.903348, 0.34 atom percent natural abundance and nuclear spin (1)/2. + 0 + [115Sn] + InChI=1S/Sn/i1-4 + ATJFFYVFTNAWJD-AHCXROLUSA-N + 114.903 + 114.90334 + [115Sn] + tin-115 + chebi_ontology + (115)50Sn + (115)Sn + tin-115 + CHEBI:52235 + + tin-115 atom + + + + + tin-115 + IUPAC + + + + + + (115)50Sn + IUPAC + + + + + (115)Sn + IUPAC + + + + + tin-115 + ChEBI + + + + + + + + + The stable isotope of boron with relative atomic mass 11.009306, 80.1 atom percent natural abundance and nuclear spin 3/2. + 0 + [11B] + InChI=1S/B/i1+0 + ZOXJGFHDIHLPTG-IGMARMGPSA-N + 11.009 + 11.00930 + [11B] + boron-11 + chebi_ontology + (11)5B + (11)B + CHEBI:52451 + + boron-11 atom + + + + + boron-11 + IUPAC + + + + + + (11)5B + IUPAC + + + + + (11)B + IUPAC + + + + + + + + + The stable isotope of tellurium with relative atomic mass 124.904425, 71.4 atom percent natural abundance and nuclear spin 1/2. + 0 + [125Te] + InChI=1S/Te/i1-3 + PORWMNRCUJJQNO-OIOBTWANSA-N + 124.904 + 124.90443 + [125Te] + tellurium-125 + chebi_ontology + (125)52Te + (125)Te + tellurium-125 + CHEBI:52452 + + tellurium-125 atom + + + + + tellurium-125 + IUPAC + + + + + + (125)52Te + IUPAC + + + + + (125)Te + IUPAC + + + + + tellurium-125 + ChEBI + + + + + + + + + The stable isotope of xenon with relative atomic mass 128.904780, 26.4 atom percent natural abundance and nuclear spin 1/2. + 0 + [129Xe] + InChI=1S/Xe/i1-2 + FHNFHKCVQCLJFQ-YPZZEJLDSA-N + 128.905 + 128.90478 + [129Xe] + xenon-129 + chebi_ontology + (129)54Xe + (129)Xe + xenon-129 + CHEBI:52453 + + xenon-129 atom + + + + + xenon-129 + IUPAC + + + + + + (129)54Xe + IUPAC + + + + + (129)Xe + IUPAC + + + + + xenon-129 + ChEBI + + + + + + + + + A stable isotope of selenium with relative atomic mass 76.919915, 7.60 atom percent natural abundance and nuclear spin 1/2. + 0 + [77Se] + InChI=1S/Se/i1-2 + BUGBHKTXTAQXES-YPZZEJLDSA-N + 76.920 + 76.91991 + [77Se] + Chemspider:9507361 + PMID:16158304 + PMID:23159557 + PMID:25848959 + PMID:25923042 + PMID:27129100 + PMID:30828921 + PMID:32453871 + PMID:34153173 + ((77)Se)selenium + chebi_ontology + (77)34Se + (77)Se + Se-77 + selenium, isotope of mass 77 + selenium-(77)Se + selenium-77 + CHEBI:52457 + + selenium-77 atom + + + + + PMID:16158304 + Europe PMC + + + + + PMID:23159557 + Europe PMC + + + + + PMID:25848959 + Europe PMC + + + + + PMID:25923042 + Europe PMC + + + + + PMID:27129100 + Europe PMC + + + + + PMID:30828921 + Europe PMC + + + + + PMID:32453871 + Europe PMC + + + + + PMID:34153173 + Europe PMC + + + + + ((77)Se)selenium + IUPAC + + + + + + (77)34Se + IUPAC + + + + + (77)Se + IUPAC + + + + + Se-77 + ChEBI + + + + + selenium, isotope of mass 77 + ChEBI + + + + + selenium-(77)Se + ChEBI + + + + + selenium-77 + ChEBI + + + + + + + + + The stable isotope of lithium with relative atomic mass 7.016004, 92.5 atom percent natural abundance and nuclear spin 3/2. + 0 + [7Li] + InChI=1S/Li/i1+0 + WHXSMMKQMYFTQS-IGMARMGPSA-N + 7.016 + 7.01600 + [7Li] + lithium-7 + chebi_ontology + (7)3Li + (7)Li + lithium-7 + CHEBI:52458 + + lithium-7 atom + + + + + lithium-7 + IUPAC + + + + + + (7)3Li + IUPAC + + + + + (7)Li + IUPAC + + + + + lithium-7 + ChEBI + + + + + + + + + The stable isotope of rubidium with relative atomic mass 86.909184, 27.9 atom percent natural abundance and nuclear spin 3/2. + 0 + [87Rb] + InChI=1S/Rb/i1+2 + IGLNJRXAVVLDKE-NJFSPNSNSA-N + 86.909 + 86.90918 + [87Rb] + rubidium-87 + chebi_ontology + (87)37Rb + (87)Rb + rubidium-87 + CHEBI:52459 + + rubidium-87 atom + + + + + rubidium-87 + IUPAC + + + + + + (87)37Rb + IUPAC + + + + + (87)Rb + IUPAC + + + + + rubidium-87 + ChEBI + + + + + + + + + The stable isotope of niobium with relative atomic mass 92.906378, 100 atom percent natural abundance and nuclear spin 9/2. + 0 + [93Nb] + InChI=1S/Nb/i1+0 + GUCVJGMIXFAOAE-IGMARMGPSA-N + 92.906 + 92.90637 + [93Nb] + niobium-93 + chebi_ontology + (93)41Nb + (93)Nb + niobium-93 + CHEBI:52460 + + niobium-93 atom + + + + + niobium-93 + IUPAC + + + + + + (93)41Nb + IUPAC + + + + + (93)Nb + IUPAC + + + + + niobium-93 + ChEBI + + + + + + + + + The stable isotope of niobium with relative atomic mass 182.950225, 14.3 atom percent natural abundance and nuclear spin 1/2. + 0 + [183W] + InChI=1S/W/i1-1 + WFKWXMTUELFFGS-BJUDXGSMSA-N + 182.950 + 182.95022 + [183W] + tungsten-183 + chebi_ontology + (183)74W + (183)W + CHEBI:52462 + + tungsten-183 + + + + + tungsten-183 + IUPAC + + + + + + (183)74W + IUPAC + + + + + (183)W + IUPAC + + + + + + + + + The stable isotope of cadmium with relative atomic mass 110.904182, 12.8 atom percent natural abundance and nuclear spin 1/2. + 0 + [111Cd] + InChI=1S/Cd/i1-1 + BDOSMKKIYDKNTQ-BJUDXGSMSA-N + 110.904 + 110.90418 + [111Cd] + cadmium-111 + chebi_ontology + (111)48Cd + (111)Cd + CHEBI:52619 + + cadmium-111 + + + + + cadmium-111 + IUPAC + + + + + + (111)48Cd + IUPAC + + + + + (111)Cd + IUPAC + + + + + + + + + The isotope of cadmium with relative atomic mass 112.904401, 12.2 atom percent natural abundance and nuclear spin 1/2. + 0 + [113Cd] + InChI=1S/Cd/i1+1 + BDOSMKKIYDKNTQ-OUBTZVSYSA-N + 112.904 + 112.90441 + [113Cd] + cadmium-113 + chebi_ontology + (113)48Cd + (113)Cd + CHEBI:52620 + + cadmium-113 + + + + + cadmium-113 + IUPAC + + + + + + (113)48Cd + IUPAC + + + + + (113)Cd + IUPAC + + + + + + + + + The stable isotope of lithium with relative atomic mass 6.015122, 7.5 atom percent natural abundance and nuclear spin 1. + 0 + [6Li] + InChI=1S/Li/i1-1 + WHXSMMKQMYFTQS-BJUDXGSMSA-N + 6.015 + 6.01512 + [6Li] + lithium-6 + chebi_ontology + (6)3Li + (6)Li + lithium-6 + CHEBI:52621 + + lithium-6 atom + + + + + lithium-6 + IUPAC + + + + + + (6)3Li + IUPAC + + + + + (6)Li + IUPAC + + + + + lithium-6 + ChEBI + + + + + + + + + The stable isotope of yttrium with relative atomic mass 88.905848, 100 atom percent natural abundance and nuclear spin 1/2. + 0 + [89Y] + InChI=1S/Y/i1+0 + VWQVUPCCIRVNHF-IGMARMGPSA-N + 88.906 + 88.90584 + [89Y] + yttrium-89 + chebi_ontology + (89)39Y + (89)Y + yttrium-89 + CHEBI:52622 + + yttrium-89 atom + + + + + yttrium-89 + IUPAC + + + + + + (89)39Y + IUPAC + + + + + (89)Y + IUPAC + + + + + yttrium-89 + ChEBI + + + + + + + + + The stable isotope of iron with relative atomic mass 56.935399, 2.1 atom percent natural abundance and nuclear spin 1/2. + 0 + [57Fe] + InChI=1S/Fe/i1+1 + XEEYBQQBJWHFJM-OUBTZVSYSA-N + 56.935 + 56.93539 + [57Fe] + iron-57 + chebi_ontology + (57)26Fe + (57)Fe + CHEBI:52623 + + iron-57 atom + + + + + iron-57 + IUPAC + + + + + + (57)26Fe + IUPAC + + + + + (57)Fe + IUPAC + + + + + + + + + The stable isotope of antimony with relative atomic mass 120.903818, 57.2 atom percent natural abundance and nuclear spin 5/2. + 0 + [121Sb] + InChI=1S/Sb/i1-1 + WATWJIUSRGPENY-BJUDXGSMSA-N + 120.904 + 120.90381 + [121Sb] + antimony-121 + chebi_ontology + (121)51Sb + (121)Sb + antimony-121 + CHEBI:52624 + + antimony-121 atom + + + + + antimony-121 + IUPAC + + + + + + (121)51Sb + IUPAC + + + + + (121)Sb + IUPAC + + + + + antimony-121 + ChEBI + + + + @@ -17576,6 +35525,584 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + The stable isotope of antimony with relative atomic mass 122.904216, 42.8 atom percent natural abundance and nuclear spin 7/2. + 0 + [123Sb] + InChI=1S/Sb/i1+1 + WATWJIUSRGPENY-OUBTZVSYSA-N + 122.904 + 122.90421 + [123Sb] + antimony-123 + chebi_ontology + (123)51Sb + (123)Sb + antimony-123 + CHEBI:52626 + + antimony-123 atom + + + + + antimony-123 + IUPAC + + + + + + (123)51Sb + IUPAC + + + + + (123)Sb + IUPAC + + + + + antimony-123 + ChEBI + + + + + + + + + The stable isotope of lanthanum with relative atomic mass 138.906348, 99.9 atom percent natural abundance and nuclear spin 7/2. + 0 + [139La] + InChI=1S/La/i1+0 + FZLIPJUXYLNCLC-IGMARMGPSA-N + 138.906 + 138.90636 + [139La] + lanthanum-139 + chebi_ontology + (139)57La + (139)La + lanthanum-139 + CHEBI:52627 + + lanthanum-139 atom + + + + + lanthanum-139 + IUPAC + + + + + + (139)57La + IUPAC + + + + + (139)La + IUPAC + + + + + lanthanum-139 + ChEBI + + + + + + + + + The stable isotope of iodine with relative atomic mass 126.904468, 100 atom percent natural abundance and nuclear spin 5/2. + 0 + [127I] + InChI=1S/I/i1+0 + ZCYVEMRRCGMTRW-IGMARMGPSA-N + 126.904 + 126.90447 + [127I] + iodine-127 + chebi_ontology + (127)53I + (127)I + iodine-127 + CHEBI:52631 + + iodine-127 atom + + + + + iodine-127 + IUPAC + + + + + + (127)53I + IUPAC + + + + + (127)I + IUPAC + + + + + iodine-127 + ChEBI + + + + + + + + + The stable isotope of potassium with relative atomic mass 38.963707, 93.3 atom percent natural abundance and nuclear spin 3/2. + 0 + [39K] + InChI=1S/K/i1+0 + ZLMJMSJWJFRBEC-IGMARMGPSA-N + 38.964 + 38.96371 + [39K] + potassium-39 + chebi_ontology + (39)19K + (39)K + potassium-39 + CHEBI:52632 + + potassium-39 atom + + + + + potassium-39 + IUPAC + + + + + + (39)19K + IUPAC + + + + + (39)K + IUPAC + + + + + potassium-39 + ChEBI + + + + + + + + + The stable isotope of molybdenum with relative atomic mass 94.905842, 15.9 atom percent natural abundance and nuclear spin 5/2. + 0 + [95Mo] + InChI=1S/Mo/i1-1 + ZOKXTWBITQBERF-BJUDXGSMSA-N + 94.906 + 94.90584 + [95Mo] + molybdenum-95 + chebi_ontology + (95)42Mo + (95)Mo + CHEBI:52633 + + molybdenum-95 + + + + + molybdenum-95 + IUPAC + + + + + + (95)42Mo + IUPAC + + + + + (95)Mo + IUPAC + + + + + + + + + The stable isotope of sodium with relative atomic mass 22.989770, 100 atom percent natural abundance and nuclear spin 3/2. + 0 + [23Na] + InChI=1S/Na/i1+0 + KEAYESYHFKHZAL-IGMARMGPSA-N + 22.990 + 22.98977 + [23Na] + sodium-23 + chebi_ontology + (23)11Na + (23)Na + sodium-23 + CHEBI:52634 + + sodium-23 atom + + + + + sodium-23 + IUPAC + + + + + + (23)11Na + IUPAC + + + + + (23)Na + IUPAC + + + + + sodium-23 + ChEBI + + + + + + + + + The stable isotope of scandium with relative atomic mass 44.955910, 100 atom percent natural abundance and nuclear spin 7/2. + 0 + [45Sc] + InChI=1S/Sc/i1+0 + SIXSYDAISGFNSX-IGMARMGPSA-N + 44.956 + 44.95591 + [45Sc] + scandium-45 + chebi_ontology + (45)21Sc + (45)Sc + scandium-45 + CHEBI:52635 + + scandium-45 atom + + + + + scandium-45 + IUPAC + + + + + + (45)21Sc + IUPAC + + + + + (45)Sc + IUPAC + + + + + scandium-45 + ChEBI + + + + + + + + + The isotope of iodine with relative atomic mass 128.904988, and nuclear spin 7/2. + 0 + [129I] + InChI=1S/I/i1+2 + ZCYVEMRRCGMTRW-NJFSPNSNSA-N + 128.905 + 128.90499 + [129I] + iodine-129 + chebi_ontology + (129)53I + (129)I + iodine-129 + CHEBI:52636 + + iodine-129 atom + + + + + iodine-129 + IUPAC + + + + + + (129)53I + IUPAC + + + + + (129)I + IUPAC + + + + + iodine-129 + ChEBI + + + + + + + + + The stable isotope of europium with relative atomic mass 150.919846, 47.8 atom percent natural abundance and nuclear spin 5/2. + 0 + [151Eu] + InChI=1S/Eu/i1-1 + OGPBJKLSAFTDLK-BJUDXGSMSA-N + 150.920 + 150.91986 + [151Eu] + europium-151 + chebi_ontology + (151)63Eu + (151)Eu + europium-151 + CHEBI:52637 + + europium-151 atom + + + + + europium-151 + IUPAC + + + + + + (151)63Eu + IUPAC + + + + + (151)Eu + IUPAC + + + + + europium-151 + ChEBI + + + + + + + + + The stable isotope of bromine with relative atomic mass 78.918338, 50.69 atom percent natural abundance and nuclear spin 3/2. + 0 + [79Br] + InChI=1S/Br/i1-1 + WKBOTKDWSSQWDR-BJUDXGSMSA-N + 78.918 + 78.91834 + [79Br] + chebi_ontology + (79)35Br + (79)Br + bromine-79 + CHEBI:52743 + + bromine-79 atom + + + + + (79)35Br + IUPAC + + + + + (79)Br + IUPAC + + + + + bromine-79 + ChEBI + + + + + + + + + The stable isotope of germanium with relative atomic mass 72.923459, 7.73 atom percent natural abundance and nuclear spin 9/2. + 0 + [73Ge] + InChI=1S/Ge/i1+0 + GNPVGFCGXDBREM-IGMARMGPSA-N + 72.923 + 72.92346 + [73Ge] + chebi_ontology + (73)32Ge + (73)Ge + germanium-73 + CHEBI:52758 + + germanium-73 atom + + + + + (73)32Ge + IUPAC + + + + + (73)Ge + IUPAC + + + + + germanium-73 + ChEBI + + + + + + + + + The stable isotope of magnesium with relative atomic mass 24.985837, 10.0 atom percent natural abundance and nuclear spin 5/2. + 0 + [25Mg] + InChI=1S/Mg/i1+1 + FYYHWMGAXLPEAU-OUBTZVSYSA-N + 24.986 + 24.98584 + [25Mg] + chebi_ontology + (25)12Mg + (25)Mg + magnesium-25 + CHEBI:52763 + + magnesium-25 atom + + + + + (25)12Mg + IUPAC + + + + + (25)Mg + IUPAC + + + + + magnesium-25 + ChEBI + + + + + + + + + Any metal that is characterized by its rather high atomic mass and density. Although typically occurring in low concentrations, they can be found all throughout the Earth's crust (Commonly, a density of at least 5 g cm(3) is used to define a heavy metal and to differentiate it from other, ''light'' metals). + Wikipedia:Heavy_metals + chebi_ontology + heavy metals + CHEBI:5631 + + heavy metal + + + + + heavy metals + ChEBI + + + + @@ -17672,17 +36199,17 @@ For example, A and B may be gene products and binding of B by A positively regul - An atom or small molecule with a positive charge that does not contain carbon in covalent linkage, with a valency of one. - chebi_ontology - a monovalent cation - CHEBI:60242 + An atom or small molecule with a positive charge that does not contain carbon in covalent linkage, with a valency of one. + chebi_ontology + a monovalent cation + CHEBI:60242 - monovalent inorganic cation + monovalent inorganic cation - a monovalent cation + a monovalent cation UniProt @@ -18416,6 +36943,41 @@ For example, A and B may be gene products and binding of B by A positively regul + + + + + A stable isotope of boron with relative atomic mass 10.0129370, 19.9 atom percent natural abundance and nuclear spin 3+. + 0 + [10B] + InChI=1S/B/i1-1 + ZOXJGFHDIHLPTG-BJUDXGSMSA-N + 10.013 + 10.01294 + [10B] + boron-10 + chebi_ontology + (10)B + CHEBI:77014 + + boron-10 atom + + + + + boron-10 + IUPAC + + + + + + (10)B + SUBMITTER + + + + @@ -18723,17 +37285,17 @@ For example, A and B may be gene products and binding of B by A positively regul - Any inorganic anion with a valency of two. - chebi_ontology - divalent inorganic anions - CHEBI:79388 + Any inorganic anion with a valency of two. + chebi_ontology + divalent inorganic anions + CHEBI:79388 - divalent inorganic anion + divalent inorganic anion - divalent inorganic anions + divalent inorganic anions ChEBI @@ -18743,17 +37305,198 @@ For example, A and B may be gene products and binding of B by A positively regul - Any inorganic anion with a valency of one. - chebi_ontology - monovalent inorganic anions - CHEBI:79389 + Any inorganic anion with a valency of one. + chebi_ontology + monovalent inorganic anions + CHEBI:79389 - monovalent inorganic anion + monovalent inorganic anion - monovalent inorganic anions + monovalent inorganic anions + ChEBI + + + + + + + + + A zinc atom in which the nucleus contains 35 neutrons. It has a half-life of 244 days, decaying by emission of a positron (beta(+) decay), and is the most abundant and stable of the 25 known radioisotopes of zinc. + 0 + [65Zn] + InChI=1S/Zn/i1+0 + HCHKCACWOHOZIP-IGMARMGPSA-N + 64.929 + 64.92925 + [65Zn] + CAS:13982-39-3 + PMID:11431342 + PMID:13615323 + PMID:13694484 + PMID:13734409 + PMID:13744376 + PMID:13783426 + PMID:13841044 + PMID:14425466 + PMID:1682403 + PMID:17807441 + PMID:19448268 + ((65)Zn)zinc + chebi_ontology + (65)30Zn + (65)Zn + Zn-65 + zinc, isotope of mass 65 + zinc-65 + CHEBI:82623 + + zinc-65 atom + + + + + CAS:13982-39-3 + ChemIDplus + + + + + PMID:11431342 + Europe PMC + + + + + PMID:13615323 + Europe PMC + + + + + PMID:13694484 + Europe PMC + + + + + PMID:13734409 + Europe PMC + + + + + PMID:13744376 + Europe PMC + + + + + PMID:13783426 + Europe PMC + + + + + PMID:13841044 + Europe PMC + + + + + PMID:14425466 + Europe PMC + + + + + PMID:1682403 + Europe PMC + + + + + PMID:17807441 + Europe PMC + + + + + PMID:19448268 + Europe PMC + + + + + ((65)Zn)zinc + IUPAC + + + + + + (65)30Zn + IUPAC + + + + + (65)Zn + IUPAC + + + + + Zn-65 + ChEBI + + + + + zinc, isotope of mass 65 + ChemIDplus + + + + + zinc-65 + ChemIDplus + + + + + + + + + Any metal which causes the onset of an allergic reaction. + chebi_ontology + allergenic metal + allergenic metals + metal allergens + CHEBI:88184 + + metal allergen + + + + + allergenic metal + ChEBI + + + + + allergenic metals + ChEBI + + + + + metal allergens ChEBI @@ -45777,7 +64520,7 @@ consider revising 'pond' semantics Any process involved in the development or functioning of the immune system, an organismal system for calibrated responses to potential internal or invasive threats. - GOC:add + GOC:add GO_REF:0000022 @@ -45818,7 +64561,7 @@ consider revising 'pond' semantics The process whose specific outcome is the progression of an organismal system whose objective is to provide calibrated responses by an organism to a potential internal or invasive threat, over time, from its formation to the mature structure. A system is a regularly interacting or interdependent group of organs or tissues that work together to carry out a given biological process. - GOC:add + GOC:add GOC:dph @@ -45854,7 +64597,7 @@ consider revising 'pond' semantics Any process that modulates the frequency, rate, or extent of an immune system process. - GOC:add + GOC:add @@ -45894,7 +64637,7 @@ consider revising 'pond' semantics Any process that stops, prevents, or reduces the frequency, rate, or extent of an immune system process. - GOC:add + GOC:add @@ -45935,7 +64678,7 @@ consider revising 'pond' semantics Any process that activates or increases the frequency, rate, or extent of an immune system process. - GOC:add + GOC:add @@ -45954,7 +64697,7 @@ consider revising 'pond' semantics The controlled release of a peptide from a cell or a tissue. - GOC:add + GOC:add @@ -45990,7 +64733,7 @@ consider revising 'pond' semantics Any process that modulates the frequency, rate, or extent of peptide secretion. - GOC:add + GOC:add @@ -46030,7 +64773,7 @@ consider revising 'pond' semantics Any process that stops, prevents, or reduces the frequency, rate, or extent of peptide secretion. - GOC:add + GOC:add @@ -46071,7 +64814,7 @@ consider revising 'pond' semantics Any process that activates or increases the frequency, rate, or extent of peptide secretion. - GOC:add + GOC:add @@ -48416,7 +67159,7 @@ Note that, in addition to forming the root of the cellular component ontology, t Any immune system process that functions in the calibrated response of an organism to a potential internal or invasive threat. - GOC:add + GOC:add GO_REF:0000022 @@ -50351,7 +69094,7 @@ Note that, in addition to forming the root of the cellular component ontology, t The process whose specific outcome is the progression of a tissue over time, from its formation to the mature structure. - ISBN:0471245208 + ISBN:0471245208 @@ -61172,7 +79915,7 @@ Any process that is carried out at the cellular level, occurring within a single The process whose specific outcome is the progression of any organ involved in hematopoiesis (also known as hemopoiesis) or lymphoid cell activation over time, from its formation to the mature structure. Such development includes differentiation of resident cell types (stromal cells) and of migratory cell types dependent on the unique microenvironment afforded by the organ for their proper differentiation. - GOC:add + GOC:add GOC:rl ISBN:0781735149 @@ -63860,7 +82603,7 @@ Note that this term is in the subset of terms that should not be used for direct The series of events in which a stimulus is received by a cell or organism and converted into a molecular signal. - GOC:add + GOC:add GOC:ai GOC:dph GOC:mah @@ -65835,7 +84578,7 @@ Note that this term is in the subset of terms that should not be used for direct The regulated release of mucus by the mucosa. Mucus is a viscous slimy secretion consisting of mucins and various inorganic salts dissolved in water, with suspended epithelial cells and leukocytes. The mucosa, or mucous membrane, is the membrane covered with epithelium that lines the tubular organs of the body. Mucins are carbohydrate-rich glycoproteins that have a lubricating and protective function. - GOC:add + GOC:add ISBN:068340007X ISBN:0721662544 @@ -65843,7 +84586,7 @@ Note that this term is in the subset of terms that should not be used for direct mucus production - GOC:add + GOC:add @@ -65881,13 +84624,13 @@ Note that this term is in the subset of terms that should not be used for direct Any process that modulates the frequency, rate or extent of the regulated release of mucus from a cell or a tissue. - GOC:add + GOC:add regulation of mucus production - GOC:add + GOC:add @@ -65925,13 +84668,13 @@ Note that this term is in the subset of terms that should not be used for direct Any process that stops, prevents, or reduces the frequency, rate or extent of the regulated release of mucus from a cell or a tissue. - GOC:add + GOC:add negative regulation of mucus production - GOC:add + GOC:add @@ -65969,13 +84712,13 @@ Note that this term is in the subset of terms that should not be used for direct Any process that activates or increases the frequency, rate or extent of the regulated release of mucus from a cell or a tissue. - GOC:add + GOC:add positive regulation of mucus production - GOC:add + GOC:add @@ -72893,6 +91636,12 @@ Note that this term is in the subset of terms that should not be used for direct GO:1905843 regulation of cellular response to gamma radiation + + + + regulation of cellular response to gamma-ray photon + GOC:TermGenie + @@ -72907,12 +91656,6 @@ Note that this term is in the subset of terms that should not be used for direct regulation of cellular response to gamma ray GOC:TermGenie - - - - regulation of cellular response to gamma-ray photon - GOC:TermGenie - @@ -76040,20 +94783,20 @@ clustering algorithm. GC_ID:1 ncbi_taxonomy - all + all NCBITaxon:1 root - all + all - all + all @@ -88638,7 +107381,7 @@ Classes for population already exist in IDO ('organism population', I A plant anatomical entity (PO:0025131) that is, or was, part of a plant, or was derived from a part of a plant. - CARO:0000003 + CARO:0000003 POC:curators @@ -90066,11 +108809,10 @@ Classes for population already exist in IDO ('organism population', I - mixed radiation The samples were exposed to a mixed radiation field consisting of several ions at different energies. The process of exposing the same sample to more than one type and/or energy of radiation, in sequence or simultaneously. - mixed field|mixed radiation - mixed radiation field + mixed field|mixed radiation field + mixed radiation @@ -90592,6 +109334,7 @@ Classes for population already exist in IDO ('organism population', I A study of the impact of radiation on the composition of or processes within the natural or anthropogenic environment. environmental study + A owl:deprecated @@ -90936,7 +109679,7 @@ Classes for population already exist in IDO ('organism population', I - + charged particle Charged particles with kinetic energy imparted by natural or artificial means (such as by a particle accelerator) charged particle @@ -91177,10 +109920,10 @@ Classes for population already exist in IDO ('organism population', I - Unplanned exposure to naturally occurring radiation (NORM) of any type in any environment . + Exposure to naturally occurring radiation (NORM) of any type in any environment . 0000-0002-5111-7263 Environmental irradiation - Naturally occurring radiation exposure (NORM) + Exposure to naturally ocurring radioactive material @@ -91262,6 +110005,7 @@ Classes for population already exist in IDO ('organism population', I Incidental exposure to naturally occurring radiation in a natural or anthropogenic environment, such as geographical areas with high background levels of radiation or specific locations such as Uranium mines. 0000-0002-5111-7263 Unplanned naturally occurring radiation exposure + TRUE @@ -91283,7 +110027,7 @@ Classes for population already exist in IDO ('organism population', I Studies relating to human society and the interrelation of social and educational factors with individual thought and behaviour including mental illness. 0000-0002-5111-7263 - Social and psychosocial studies + Social and psychosocial study @@ -91373,7 +110117,7 @@ Classes for population already exist in IDO ('organism population', I Studies of the presence of radiation of any type in the natural or anthropogenic environment and its impact on animals, plants, and microorganisms. This includes studies measuring nuclide transfer in the environment, and interaction with meteorological phenomena. This excludes occupational exposure and the human working environment. 0000-0002-5111-7263 - Environmental studies + Environmental study @@ -91931,7 +110675,7 @@ Classes for population already exist in IDO ('organism population', I Study of radiation levels and effects in the natural environment. 0000-0002-5111-7263 - Natural environment studies + Natural environment study @@ -92162,7 +110906,7 @@ Classes for population already exist in IDO ('organism population', I Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or regulation of the nuclear industries. 0000-0002-5111-7263 - Attitudinal studies nuclear industry risk perception + Attitudinal study of nuclear industry risk perception @@ -92173,7 +110917,7 @@ Classes for population already exist in IDO ('organism population', I Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ecological integrity towards natural or anthropogenic ionising radiation in the environment. 0000-0002-5111-7263 - Attitudinal studies towards ionising radiation in the environment + Attitudinal study towards ionising radiation in the environment @@ -92184,7 +110928,7 @@ Classes for population already exist in IDO ('organism population', I Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ecological integrity towards natural or anthropogenic non-ionising radiation in the natural environment. 0000-0002-5111-7263 - Attitudinal studies towards non-ionising radiation in the environment + Attitudinal study towards non-ionising radiation in the environment @@ -92195,7 +110939,7 @@ Classes for population already exist in IDO ('organism population', I Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety and efficacy in a clinical context where radiation is used for diagnostic or therapeutic procedures.. 0000-0002-5111-7263 - Attitudinal studies towards medical radiation procedures + Attitudinal study towards medical radiation procedures @@ -92206,7 +110950,7 @@ Classes for population already exist in IDO ('organism population', I Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety towards natural or anthropogenic non-ionising radiation in the occupational environment. 0000-0002-5111-7263 - Attitudinal studies towards radiation in the occupational environment + Attitudinal study towards radiation in the occupational environment @@ -92486,7 +111230,7 @@ Classes for population already exist in IDO ('organism population', I Unplanned irradiation that is non-anthropogenic in origin - Unplanned non-anthropogenic irradiation + Unplanned naturally occurring radiation exposure @@ -92710,7 +111454,7 @@ Classes for population already exist in IDO ('organism population', I sham irradiation - A protocol in which a sample is kept under conditions identical to irradiated samples, without exposure + Sham irradiation refers to a procedure in which participants or subjects in an experiment are exposed to simulated radiation, mimicking precisely the conditions of actual irradiation. The purpose of using sham irradiation is to create a control group that experiences the non-specific effects of the experimental setup, while excluding the specific effects associated with radiation exposure. Jack Miller sham sham irradiation @@ -92970,10 +111714,11 @@ Classes for population already exist in IDO ('organism population', I HZE - Fully ionized atomic nuclei with 2 or more protons and energies in excess of tens of MeV per nucleon + Fully ionized atomic nucleus with 2 or more protons and energies in excess of tens of MeV per nucleon Jack Miller HZE - highly charged energetic nuclei + highly charged energetic nuclei + highly charged energetic nucleus @@ -93365,7 +112110,19 @@ Classes for population already exist in IDO ('organism population', I - + + + + + + + + + + + + + The path of a particle in matter, delineated by sites where the particle deposits energy. particle track @@ -93433,6 +112190,101 @@ Classes for population already exist in IDO ('organism population', I + + + + + Sham irradiation in which an identical irradiation protocol (with the exception of the administration of the radiation exposure) is not followed in every respect. + Use approximate sham irradiation when at least one aspect of the irradiation (with the exception of the administration of the radiation exposure) is not followed precisely. For example, Not placing an organism or sample in a beam line for the same length of time as the irradiated organism(s) or sample(s) were left in the beam. + approximate sham irradiation + + + + + + + + + Experimental internal radiation exposure of rodents to radon gas through inhalation. + Exposure to an inhaled, ingested, injected or implanted source of radiation of any origin as part of a planned or accidental process. + internal radiation exposure + + + + + + + + + Mice exposed to external radiation from a Sr source. + Exposure to an external source of radiation of any origin or type. + https://orcid.org/0000-0002-5111-7263 + external radiation exposure + + + + + + + + + Sham irradiation in which an identical irradiation protocol is followed in every respect, with the exception of the administration of the radiation exposure. + Use complete sham irradiation when all steps of an irradiation protocol are followed for sham control group (with the exception of administration of the radiation exposure). + complete sham irradiation + + + + + + + + + + Planned exposure of an entity to radiation of any type, for example as part of a medical or experimental procedure with the intention of exposing the entity to radiation energy internally by the ingestion, inhalation or implantation of a source of radiation. + https://orcid.org/0000-0002-5111-7263 + Research subjects participating in a clinical trial using an internally implanted radiation source have an internal experimental radiation exposure + internal experimental radiation exposure + + + + + + + + + The direct or indirect transfer of energy from radiation to a medium through ionisation or excitation of the atoms of the medium. + energy deposition event + + + + + + + + + + + + + + + + + + + + + track formation + + + + + + + + + + @@ -100021,6 +118873,49 @@ Classes for population already exist in IDO ('organism population', I https://github.com/obophenotype/uberon/issues/661 http://upload.wikimedia.org/wikipedia/commons/0/06/Mouth_illustration-Otis_Archives.jpg + + + + + the mouth contains structures such as jaw skeleton that may not strictly be considered tract parts + + + + + + + + + + + exceptions in some taxa + + + + + The proximal portion of the digestive tract, containing the oral cavity and bounded by the oral opening. In vertebrates, this extends to the pharynx and includes gums, lips, tongue and parts of the palate. Typically also includes the teeth, except where these occur elsewhere (e.g. pharyngeal jaws) or protrude from the mouth (tusks). + + + + + + + Cavity in which food is initially ingested and generally contains teeth, tongue and glands.[AAO] + 2012-06-20 + AAO:0010355 + AAO + AAO:BJB + + + + + Molecular and developmental cell lineage data suggest that the acoel mouth opening is homologous to the mouth of protostomes and deuterostomes and that the last common ancestor of the Bilateria (the 'urbilaterian') had only this single digestive opening.[well established][VHOG] + 2012-09-17 + VHOG:0000812 + VHOG + + DOI:10.1038/nature07309 Hejnol A, Martindale MQ, Acoel development indicates the independent evolution of the bilaterian mouth and anus. Nature (2008) + @@ -100108,49 +119003,6 @@ Classes for population already exist in IDO ('organism population', I vestibulum oris BTO:0001090 - - - - - the mouth contains structures such as jaw skeleton that may not strictly be considered tract parts - - - - - - - - - - - exceptions in some taxa - - - - - The proximal portion of the digestive tract, containing the oral cavity and bounded by the oral opening. In vertebrates, this extends to the pharynx and includes gums, lips, tongue and parts of the palate. Typically also includes the teeth, except where these occur elsewhere (e.g. pharyngeal jaws) or protrude from the mouth (tusks). - - - - - - - Cavity in which food is initially ingested and generally contains teeth, tongue and glands.[AAO] - 2012-06-20 - AAO:0010355 - AAO - AAO:BJB - - - - - Molecular and developmental cell lineage data suggest that the acoel mouth opening is homologous to the mouth of protostomes and deuterostomes and that the last common ancestor of the Bilateria (the 'urbilaterian') had only this single digestive opening.[well established][VHOG] - 2012-09-17 - VHOG:0000812 - VHOG - - DOI:10.1038/nature07309 Hejnol A, Martindale MQ, Acoel development indicates the independent evolution of the bilaterian mouth and anus. Nature (2008) - @@ -120771,7 +139623,7 @@ Classes for population already exist in IDO ('organism population', I FMA:16581 FMA:23217 - UBERONREF:0000003 + UBERONREF:0000003 @@ -124865,7 +143717,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO @@ -125086,7 +143938,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO @@ -130804,7 +149656,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO FMA-implicit VHOG ZFA @@ -138349,7 +157201,7 @@ Classes for population already exist in IDO ('organism population', I Subdivision of skeleton which which consists of all the skeletal elements in in the pectoral and pelvic appendage complexes[cjm]. - UBERONREF:0000003 + UBERONREF:0000003 @@ -139321,7 +158173,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO EHDAA2 GO-def @@ -139685,7 +158537,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO @@ -144657,7 +163509,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO @@ -153979,7 +172831,7 @@ Classes for population already exist in IDO ('organism population', I in XAO this develops_from dorsolateral placode, but in NBK53175, this is a separate group - XAO + XAO @@ -154725,7 +173577,7 @@ Classes for population already exist in IDO ('organism population', I part_of somite in XAO - XAO + XAO @@ -155372,7 +174224,7 @@ Classes for population already exist in IDO ('organism population', I in XAO, called branchial arch 2 and df VP4 - XAO + XAO @@ -157645,7 +176497,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO @@ -159697,7 +178549,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO @@ -173217,7 +192069,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO @@ -179707,7 +198559,7 @@ Classes for population already exist in IDO ('organism population', I it's not clear if the XAO class belongs here or below - XAO + XAO @@ -181534,7 +200386,7 @@ Classes for population already exist in IDO ('organism population', I Subdivision of cardiovascular system which has as its parts the right side of heart, the superior vena cava and the inferior vena cava[FMA] - FMA + FMA FMA:45626 @@ -189846,7 +208698,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO @@ -209023,7 +227875,7 @@ Classes for population already exist in IDO ('organism population', I - BTO + BTO @@ -212870,7 +231722,7 @@ Classes for population already exist in IDO ('organism population', I Subdivision of cardiovascular system which has as its parts the pulmonary arterial and venous tree organs.[FMA] - FMA + FMA FMA:45621 @@ -219496,7 +238348,7 @@ Classes for population already exist in IDO ('organism population', I isa blood vessel in XAO - XAO + XAO @@ -255872,8 +274724,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim m A length unit which is equal to the length of the path traveled by light in vacuum during a time interval of 1/299 792 458 of a second. - m meter + m metre "A length unit which is equal to the length of the path traveled by light in vacuum during a time interval of 1/299 792 458 of a second." [BIPM:BIPM, NIST:NIST] @@ -255887,8 +274739,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim A mass unit which is equal to the mass of the International Prototype Kilogram kept by the BIPM at Svres, France. - s + s second sec @@ -255900,8 +274752,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim cm centimeter centimetre - cm centimeter + cm "A length unit which is equal to one hundredth of a meter or 10^[-2] m." [NIST:NIST] A length unit which is equal to one hundredth of a meter or 10^[-2] m. @@ -255910,8 +274762,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim A length unit which is equal to one thousandth of a meter or 10^[-3] m. mm micrometre - millimeter + mm millimeter "A length unit which is equal to one thousandth of a meter or 10^[-3] m." [NIST:NIST] @@ -255919,8 +274771,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim micrometer micron - micrometre "A length unit which is equal to one millionth of a meter or 10^[-6] m." [NIST:NIST] + micrometre um micrometer A length unit which is equal to one millionth of a meter or 10^[-6] m. @@ -255929,18 +274781,18 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim nm - nm nanometer + nm A length unit which is equal to one thousandth of one millionth of a meter or 10^[-9] m. nanometre nanometer - "A length unit which is equal to one thousandth of one millionth of a meter or 10^[-9] m." [NIST:NIST] + "A length unit which is equal to one thousandth of one millionth of a meter or 10^[-9] m." [NIST:NIST] Å - angstrom angstrom + angstrom "A length unit which is equal to 10 [-10] m." [NIST:NIST] A length unit which is equal to 10 [-10] m. @@ -255995,8 +274847,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim "A temperature unit which is equal to one kelvin degree. However, they have their zeros at different points. The centigrade scale has its zero at 273.15 K." [NIST:NIST] degree C A temperature unit which is equal to one kelvin degree. However, they have their zeros at different points. The centigrade scale has its zero at 273.15 K. - C + C degree Celsius @@ -256010,8 +274862,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim "A time unit which is equal to 60 seconds." [Wikipedia:Wikipedia] - hour + hour h h @@ -256020,8 +274872,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim "A time unit which is equal to 3600 seconds or 60 minutes." [Wikipedia:Wikipedia] - day + "A time unit which is equal to 24 hours." [Wikipedia:Wikipedia] A time unit which is equal to 24 hours. day @@ -256042,8 +274894,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim year - A time unit which is equal to 12 months which is science is taken to be equal to 365.25 days. "A time unit which is equal to 12 months which in science is taken to be equal to 365.25 days." [Wikipedia:Wikipedia] + A time unit which is equal to 12 months which is science is taken to be equal to 365.25 days. year @@ -256067,8 +274919,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim pmol - pmol "A substance unit equal to 10^[-12] mol." [NIST:NIST] + pmol A substance unit equal to 10^[-12] mol. picomole @@ -256078,8 +274930,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim M "A unit of concentration which expresses a concentration of 1 mole of solute per liter of solution (mol/L)." [UOC:GVG] A unit of concentration which expresses a concentration of 1 mole of solute per liter of solution (mol/L). - M molar + M molar @@ -256087,14 +274939,14 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim A unit of molarity which is equal to one thousandth of a molar or 10^[-3] M. mM millimolar - mM + millimolar "A unit of molarity which is equal to one thousandth of a molar or 10^[-3] M." [UOC:GVG] - micromolar uM + micromolar A unit of molarity which is equal to one millionth of a molar or 10^[-6] M. uM @@ -256116,13 +274968,13 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim "A unit of molarity which is equal to 10^[-12] M." [UOC:GVG] picomolar - A unit of molarity which is equal to 10^[-12] M. pM + A unit of molarity which is equal to 10^[-12] M. cubic centimeter - A volume unit which is equal to one millionth of a cubic meter or 10^[-9] m^[3], or to 1 ml. + A volume unit which is equal to one millionth of a cubic meter or 10^[-9] m^[3], or to 1 ml. cubic centimetre cubic centimeter cm^3 @@ -256134,11 +274986,11 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim milliliter "A volume unit which is equal to one thousandth of a liter or 10^[-3] L, or to 1 cubic centimeter." [NIST:NIST] ml + A volume unit which is equal to one thousandth of a liter or 10^[-3] L, or to 1 cubic centimeter. millilitre - A volume unit which is equal to one thousandth of a liter or 10^[-3] L, or to 1 cubic centimeter. - ml milliliter + ml litre @@ -256164,8 +275016,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim microliter microliter ul - microlitre A volume unit which is equal to one millionth of a liter or 10^[-6] L. + microlitre ul "A volume unit which is equal to one millionth of a liter or 10^[-6] L." [NIST:NIST] @@ -256174,8 +275026,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim A volume unit which is equal to one thousandth of one millionth of a liter or 10^[-9] L. nl nanoliter - "A volume unit which is equal to one thousandth of one millionth of a liter or 10^[-9] L." [NIST:NIST] + "A volume unit which is equal to one thousandth of one millionth of a liter or 10^[-9] L." [NIST:NIST] nanoliter nanolitre nl @@ -256186,8 +275038,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim picoliter A volume unit which is equal to 10^[-12] L. pl - pl picolitre + pl "A volume unit which is equal to 10^[-12] L." [NIST:NIST] @@ -256211,8 +275063,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim A dimensionless concentration unit which denotes the mass of a substance in a mixture as a percentage of the mass of the entire mixture. - % w/v + % w/v mass volume percentage A dimensionless concentration unit which denotes the mass of the substance in a mixture as a percentage of the volume of the entire mixture. mass volume percentage @@ -256222,8 +275074,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim (w/v) - volume percentage % v/v + volume percentage "A dimensionless concentration unit which denotes the volume of the solute in mL per 100 mL of the resulting solution." [UOC:GVG] % (v/v) @@ -256265,8 +275117,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim pH A dimensionless concentration notation which denotes the acidity of a solution in terms of activity of hydrogen ions (H+). - "A dimensionless concentration notation which denotes the acidity of a solution in terms of activity of hydrogen ions (H+)." [Wikipedia:Wikipedia] pH + "A dimensionless concentration notation which denotes the acidity of a solution in terms of activity of hydrogen ions (H+)." [Wikipedia:Wikipedia] ml/l @@ -256280,18 +275132,18 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim milliliter per liter - "A mass density unit which is equal to mass of an object in grams divided by the volume in deciliters." [UOC:GVG] gram per deciliter + "A mass density unit which is equal to mass of an object in grams divided by the volume in deciliters." [UOC:GVG] g/dl gram per decilitre - A mass density unit which is equal to mass of an object in grams divided by the volume in deciliters. + A mass density unit which is equal to mass of an object in grams divided by the volume in deciliters. gram per deciliter g/dl - colony forming unit per volume + colony forming unit per volume colony forming unit per volume A concentration unit which a measure of viable bacterial numbers in a given volume. "A concentration unit which a measure of viable bacterial numbers in a given volume." [Wikipedia:Wikipedia] @@ -256323,11 +275175,11 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim A rate unit which is equal to one over one nanomolar. - 1/nM "A rate unit which is equal to one over one nanomolar." [UO:GVG] + 1/nM - count per nanomolar count per nanomolar + count per nanomolar nM^-1 @@ -256345,8 +275197,8 @@ The CBA/J inbred mouse strain is used to study granulomatous experimental autoim ug/L microgram per litre - ng/ml microgram per liter + ng/ml ug/L microgram per liter diff --git a/src/ontology/catalog-v001.xml b/src/ontology/catalog-v001.xml index 995a9af..a303541 100644 --- a/src/ontology/catalog-v001.xml +++ b/src/ontology/catalog-v001.xml @@ -30,6 +30,9 @@ + + + diff --git a/src/ontology/components/all_templates.owl b/src/ontology/components/all_templates.owl index bcca8b3..77f3b64 100644 --- a/src/ontology/components/all_templates.owl +++ b/src/ontology/components/all_templates.owl @@ -9,7 +9,7 @@ xmlns:rdfs="http://www.w3.org/2000/01/rdf-schema#" xmlns:oboInOwl="http://www.geneontology.org/formats/oboInOwl#"> - + @@ -234,6 +234,12 @@ + + + + + + @@ -476,11 +482,10 @@ - mixed radiation The samples were exposed to a mixed radiation field consisting of several ions at different energies. The process of exposing the same sample to more than one type and/or energy of radiation, in sequence or simultaneously. - mixed field|mixed radiation - mixed radiation field + mixed field|mixed radiation field + mixed radiation @@ -1002,6 +1007,7 @@ A study of the impact of radiation on the composition of or processes within the natural or anthropogenic environment. environmental study + A owl:deprecated @@ -1346,7 +1352,7 @@ - + charged particle Charged particles with kinetic energy imparted by natural or artificial means (such as by a particle accelerator) charged particle @@ -1587,10 +1593,10 @@ - Unplanned exposure to naturally occurring radiation (NORM) of any type in any environment . + Exposure to naturally occurring radiation (NORM) of any type in any environment . 0000-0002-5111-7263 Environmental irradiation - Naturally occurring radiation exposure (NORM) + Exposure to naturally ocurring radioactive material @@ -1672,6 +1678,7 @@ Incidental exposure to naturally occurring radiation in a natural or anthropogenic environment, such as geographical areas with high background levels of radiation or specific locations such as Uranium mines. 0000-0002-5111-7263 Unplanned naturally occurring radiation exposure + TRUE @@ -1693,7 +1700,7 @@ Studies relating to human society and the interrelation of social and educational factors with individual thought and behaviour including mental illness. 0000-0002-5111-7263 - Social and psychosocial studies + Social and psychosocial study @@ -1783,7 +1790,7 @@ Studies of the presence of radiation of any type in the natural or anthropogenic environment and its impact on animals, plants, and microorganisms. This includes studies measuring nuclide transfer in the environment, and interaction with meteorological phenomena. This excludes occupational exposure and the human working environment. 0000-0002-5111-7263 - Environmental studies + Environmental study @@ -2341,7 +2348,7 @@ Study of radiation levels and effects in the natural environment. 0000-0002-5111-7263 - Natural environment studies + Natural environment study @@ -2572,7 +2579,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or regulation of the nuclear industries. 0000-0002-5111-7263 - Attitudinal studies nuclear industry risk perception + Attitudinal study of nuclear industry risk perception @@ -2583,7 +2590,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ecological integrity towards natural or anthropogenic ionising radiation in the environment. 0000-0002-5111-7263 - Attitudinal studies towards ionising radiation in the environment + Attitudinal study towards ionising radiation in the environment @@ -2594,7 +2601,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ecological integrity towards natural or anthropogenic non-ionising radiation in the natural environment. 0000-0002-5111-7263 - Attitudinal studies towards non-ionising radiation in the environment + Attitudinal study towards non-ionising radiation in the environment @@ -2605,7 +2612,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety and efficacy in a clinical context where radiation is used for diagnostic or therapeutic procedures.. 0000-0002-5111-7263 - Attitudinal studies towards medical radiation procedures + Attitudinal study towards medical radiation procedures @@ -2616,7 +2623,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety towards natural or anthropogenic non-ionising radiation in the occupational environment. 0000-0002-5111-7263 - Attitudinal studies towards radiation in the occupational environment + Attitudinal study towards radiation in the occupational environment @@ -2882,7 +2889,7 @@ Unplanned irradiation that is non-anthropogenic in origin - Unplanned non-anthropogenic irradiation + Unplanned naturally occurring radiation exposure @@ -3100,7 +3107,7 @@ sham irradiation - A protocol in which a sample is kept under conditions identical to irradiated samples, without exposure + Sham irradiation refers to a procedure in which participants or subjects in an experiment are exposed to simulated radiation, mimicking precisely the conditions of actual irradiation. The purpose of using sham irradiation is to create a control group that experiences the non-specific effects of the experimental setup, while excluding the specific effects associated with radiation exposure. Jack Miller sham sham irradiation @@ -3360,10 +3367,11 @@ HZE - Fully ionized atomic nuclei with 2 or more protons and energies in excess of tens of MeV per nucleon + Fully ionized atomic nucleus with 2 or more protons and energies in excess of tens of MeV per nucleon Jack Miller HZE - highly charged energetic nuclei + highly charged energetic nuclei + highly charged energetic nucleus @@ -3749,7 +3757,7 @@ - + The path of a particle in matter, delineated by sites where the particle deposits energy. particle track @@ -3817,6 +3825,83 @@ + + + + + Sham irradiation in which an identical irradiation protocol (with the exception of the administration of the radiation exposure) is not followed in every respect. + Use approximate sham irradiation when at least one aspect of the irradiation (with the exception of the administration of the radiation exposure) is not followed precisely. For example, Not placing an organism or sample in a beam line for the same length of time as the irradiated organism(s) or sample(s) were left in the beam. + approximate sham irradiation + + + + + + + + + Experimental internal radiation exposure of rodents to radon gas through inhalation. + Exposure to an inhaled, ingested, injected or implanted source of radiation of any origin as part of a planned or accidental process. + internal radiation exposure + + + + + + + + + Mice exposed to external radiation from a Sr source. + Exposure to an external source of radiation of any origin or type. + https://orcid.org/0000-0002-5111-7263 + external radiation exposure + + + + + + + + + Sham irradiation in which an identical irradiation protocol is followed in every respect, with the exception of the administration of the radiation exposure. + Use complete sham irradiation when all steps of an irradiation protocol are followed for sham control group (with the exception of administration of the radiation exposure). + complete sham irradiation + + + + + + + + + + Planned exposure of an entity to radiation of any type, for example as part of a medical or experimental procedure with the intention of exposing the entity to radiation energy internally by the ingestion, inhalation or implantation of a source of radiation. + https://orcid.org/0000-0002-5111-7263 + Research subjects participating in a clinical trial using an internally implanted radiation source have an internal experimental radiation exposure + internal experimental radiation exposure + + + + + + + + + The direct or indirect transfer of energy from radiation to a medium through ionisation or excitation of the atoms of the medium. + energy deposition event + + + + + + + + + track formation + + + + diff --git a/src/ontology/imports/chebi_import.owl b/src/ontology/imports/chebi_import.owl index 4bbe4ba..ccf6460 100644 --- a/src/ontology/imports/chebi_import.owl +++ b/src/ontology/imports/chebi_import.owl @@ -10,8 +10,8 @@ xmlns:chebi="http://purl.obolibrary.org/obo/chebi/" xmlns:oboInOwl="http://www.geneontology.org/formats/oboInOwl#"> - - 2023-05-11 + + 2023-09-05 @@ -267,7 +267,6 @@ - Elementary particle not affected by the strong force having a spin 1/2, a negative elementary charge and a rest mass of 0.000548579903(13) u, or 0.51099906(15) MeV. -1 0.000548579903 @@ -550,10 +549,8 @@ - - The general name for the hydrogen nucleus, to be used without regard to the hydrogen nuclear mass (either for hydrogen in its natural abundance or where it is not desired to distinguish between the isotopes). +1 H @@ -1331,61 +1328,6 @@ - - - - - A monoatomic or polyatomic species having one or more elementary charges of the electron. - Anion - anion - chebi_ontology - Anionen - aniones - anions - CHEBI:22563 - - anion - - - - - Anion - ChEBI - - - - - anion - ChEBI - - - - - anion - IUPAC - - - - - - Anionen - ChEBI - - - - - aniones - ChEBI - - - - - anions - IUPAC - - - - @@ -1611,82 +1553,6 @@ - - - - - Any constitutionally or isotopically distinct atom, molecule, ion, ion pair, radical, radical ion, complex, conformer etc., identifiable as a separately distinguishable entity. - molecular entity - chebi_ontology - entidad molecular - entidades moleculares - entite moleculaire - molecular entities - molekulare Entitaet - CHEBI:23367 - - molecular entity - - - - - molecular entity - IUPAC - - - - - - entidad molecular - IUPAC - - - - - entidades moleculares - IUPAC - - - - - entite moleculaire - IUPAC - - - - - molecular entities - IUPAC - - - - - molekulare Entitaet - ChEBI - - - - - - - - - - chebi_ontology - monoatomic cations - CHEBI:23906 - - monoatomic cation - - - - - monoatomic cations - ChEBI - - - - @@ -1744,25 +1610,6 @@ - - - - A chemical entity is a physical entity of interest in chemistry including molecular entities, parts thereof, and chemical substances. - chemical entity - chebi_ontology - CHEBI:24431 - - chemical entity - - - - - chemical entity - UniProt - - - - @@ -1786,7 +1633,6 @@ - @@ -2021,149 +1867,6 @@ - - - - - - chebi_ontology - inorganic anions - CHEBI:24834 - - inorganic anion - - - - - inorganic anions - ChEBI - - - - - - - - - A molecular entity that contains no carbon. - chebi_ontology - anorganische Verbindungen - inorganic compounds - inorganic entity - inorganic molecular entities - inorganics - CHEBI:24835 - - inorganic molecular entity - - - - - anorganische Verbindungen - ChEBI - - - - - inorganic compounds - ChEBI - - - - - inorganic entity - ChEBI - - - - - inorganic molecular entities - ChEBI - - - - - inorganics - ChEBI - - - - - - - - - - chebi_ontology - monoatomic ions - CHEBI:24867 - - monoatomic ion - - - - - monoatomic ions - ChEBI - - - - - - - - - A molecular entity having a net electric charge. - Ion - ion - chebi_ontology - Ionen - iones - ions - CHEBI:24870 - - ion - - - - - Ion - ChEBI - - - - - ion - ChEBI - - - - - ion - IUPAC - - - - - - Ionen - ChEBI - - - - - iones - ChEBI - - - - - ions - ChEBI - - - - @@ -2256,35 +1959,6 @@ - - - - - +1 - 0.00000 - [*+] - chebi_ontology - monoatomic monocations - monovalent inorganic cations - CHEBI:25414 - - monoatomic monocation - - - - - monoatomic monocations - ChEBI - - - - - monovalent inorganic cations - ChEBI - - - - @@ -2438,7 +2112,6 @@ - Any organic ion with a net negative charge. chebi_ontology @@ -2459,7 +2132,6 @@ - chebi_ontology organic ions @@ -2942,7 +2614,6 @@ - @@ -3274,7 +2945,6 @@ - @@ -3337,7 +3007,6 @@ - @@ -3393,7 +3062,6 @@ - Particle of zero charge, zero rest mass, spin quantum number 1, energy hnu and momentum hnu/c (h is the Planck constant, nu the frequency of radiation and c the speed of light), carrier of electromagnetic force. 0 0.0 @@ -3658,45 +3326,6 @@ - - - - - +2 - 0.00000 - [*++] - CHEBI:23856 - CHEBI:4665 - KEGG:C00572 - chebi_ontology - Divalent cation - divalent inorganic cations - monoatomic dications - CHEBI:30412 - - monoatomic dication - - - - - Divalent cation - KEGG_COMPOUND - - - - - divalent inorganic cations - ChEBI - - - - - monoatomic dications - ChEBI - - - - @@ -3741,65 +3370,9 @@ - - - - - A particle not known to have substructure. - elementary particle - chebi_ontology - elementary particles - CHEBI:33233 - - fundamental particle - - - - - elementary particle - IUPAC - - - - - - elementary particles - ChEBI - - - - - - - - - A monoatomic entity is a molecular entity consisting of a single atom. - chebi_ontology - atomic entity - monoatomic entities - CHEBI:33238 - - monoatomic entity - - - - - atomic entity - ChEBI - - - - - monoatomic entities - ChEBI - - - - - chebi_ontology inorganic hydrides @@ -3915,7 +3488,6 @@ - @@ -3992,7 +3564,6 @@ - 0 H @@ -4102,7 +3673,6 @@ - Heavy nuclear particle: proton or neutron. nucleon @@ -4176,45 +3746,9 @@ - - - - - A molecular entity all atoms of which have the same atomic number. - chebi_ontology - homoatomic entity - homoatomic molecular entities - homoatomic molecular entity - CHEBI:33259 - - elemental molecular entity - - - - - homoatomic entity - ChEBI - - - - - homoatomic molecular entities - ChEBI - - - - - homoatomic molecular entity - ChEBI - - - - - - chebi_ontology CHEBI:33260 @@ -4227,7 +3761,6 @@ - An anion consisting of more than one atom. chebi_ontology @@ -4703,10 +4236,93 @@ + + + + + + 0 + Rn + InChI=1S/Rn + SYUHGPGVQRZVTB-UHFFFAOYSA-N + 222.00000 + 222.00000 + [Rn] + CAS:10043-92-2 + Gmelin:16242 + WebElements:Rn + radon + chebi_ontology + 86Rn + Rn + niton + radium emanation + radon + CHEBI:33314 + + radon atom + + + + + CAS:10043-92-2 + ChemIDplus + + + + + CAS:10043-92-2 + NIST Chemistry WebBook + + + + + Gmelin:16242 + Gmelin + + + + + radon + IUPAC + + + + + + 86Rn + IUPAC + + + + + Rn + IUPAC + + + + + niton + ChemIDplus + + + + + radium emanation + ChemIDplus + + + + + radon + ChEBI + + + + - 0 He @@ -4730,7 +4346,6 @@ - +2 He @@ -5022,7 +4637,6 @@ - @@ -6011,189 +5625,9 @@ - - - - - - Lepton is a fermion that does not experience the strong force (strong interaction). The term is derived from the Greek lambdaepsilonpitauomicronsigma (small, thin). - chebi_ontology - leptons - CHEBI:36338 - - lepton - - - - - leptons - ChEBI - - - - - - - - - - Baryon is a fermion that does experience the strong force (strong interaction). The term is derived from the Greek betaalpharhoupsilonsigma (heavy). - chebi_ontology - baryons - CHEBI:36339 - - baryon - - - - - baryons - ChEBI - - - - - - - - - Particle of half-integer spin quantum number following Fermi-Dirac statistics. Fermions are named after Enrico Fermi. - fermion - chebi_ontology - fermions - CHEBI:36340 - - fermion - - - - - fermion - IUPAC - - - - - - fermions - ChEBI - - - - - - - - - Particle of integer spin quantum number following Bose-Einstein statistics. Bosons are named after Satyendra Nath Bose. - boson - chebi_ontology - bosons - CHEBI:36341 - - boson - - - - - boson - IUPAC - - - - - - bosons - ChEBI - - - - - - - - A particle smaller than an atom. - Wikipedia:Subatomic_particle - chebi_ontology - subatomic particles - CHEBI:36342 - - subatomic particle - - - - - subatomic particles - ChEBI - - - - - - - - - A subatomic particle known to have substructure (i.e. consisting of smaller particles). - chebi_ontology - composite particles - CHEBI:36343 - - composite particle - - - - - composite particles - ChEBI - - - - - - - - - Hadron is a subatomic particle which experiences the strong force. - chebi_ontology - hadrons - CHEBI:36344 - - hadron - - - - - hadrons - ChEBI - - - - - - - - - - A hadron with zero or integer spin; a strongly interacting boson. The term is derived from the Greek muepsilonsigmaomicronsigma (medium, middle). - chebi_ontology - mesons - CHEBI:36345 - - meson - - - - - mesons - ChEBI - - - - - A nucleus or any of its constituents in any of their energy states. nuclear particle chebi_ontology @@ -6214,7 +5648,6 @@ - The collective name for zero-spin mesons pi(+), pi(-) and pi(0). pi meson pion @@ -6249,7 +5682,6 @@ - Elementary particle not affected by the strong force having a spin 1/2, a negative elementary charge and a rest mass of 0.113428913(17) u, or 105.658389(34) MeV. -1 0.113428913 @@ -6307,7 +5739,6 @@ - @@ -6333,7 +5764,6 @@ - An ion consisting of more than one atom. chebi_ontology @@ -6413,111 +5843,6 @@ - - - - - - chebi_ontology - inorganic ions - CHEBI:36914 - - inorganic ion - - - - - inorganic ions - ChEBI - - - - - - - - - - chebi_ontology - inorganic cations - CHEBI:36915 - - inorganic cation - - - - - inorganic cations - ChEBI - - - - - - - - - A monoatomic or polyatomic species having one or more elementary charges of the proton. - CHEBI:23058 - CHEBI:3473 - KEGG:C01373 - Cation - cation - chebi_ontology - Kation - Kationen - cationes - cations - CHEBI:36916 - - cation - - - - - Cation - KEGG_COMPOUND - - - - - cation - ChEBI - - - - - cation - IUPAC - - - - - - Kation - ChEBI - - - - - Kationen - ChEBI - - - - - cationes - ChEBI - - - - - cations - ChEBI - - - - @@ -7163,7 +6488,6 @@ - @@ -7652,26 +6976,6 @@ - - - - - An atom or small molecule with a positive charge that does not contain carbon in covalent linkage, with a valency of one. - chebi_ontology - a monovalent cation - CHEBI:60242 - - monovalent inorganic cation - - - - - a monovalent cation - UniProt - - - - @@ -8601,46 +7905,6 @@ an alpha-amino acid UniProt - - - - - - - - Any inorganic anion with a valency of two. - chebi_ontology - divalent inorganic anions - CHEBI:79388 - - divalent inorganic anion - - - - - divalent inorganic anions - ChEBI - - - - - - - - - Any inorganic anion with a valency of one. - chebi_ontology - monovalent inorganic anions - CHEBI:79389 - - monovalent inorganic anion - - - - - monovalent inorganic anions - ChEBI - diff --git a/src/ontology/imports/chebi_terms.txt b/src/ontology/imports/chebi_terms.txt index 2203db5..1f6016f 100644 --- a/src/ontology/imports/chebi_terms.txt +++ b/src/ontology/imports/chebi_terms.txt @@ -1,5 +1,4 @@ -CHEBI:24432 -CHEBI:33250 +CHEBI:24432 # exact obo:CHEBI_30216 # alpha particle CHEBI:30222 # neutron CHEBI:24636 # proton @@ -8,3 +7,4 @@ CHEBI:36348 # pi meson CHEBI:36347 # nuclear particle CHEBI:36080 CHEBI:33695 +CHEBI:33314 diff --git a/src/ontology/imports/chebi_terms_top.txt b/src/ontology/imports/chebi_terms_top.txt new file mode 100644 index 0000000..9e7cb53 --- /dev/null +++ b/src/ontology/imports/chebi_terms_top.txt @@ -0,0 +1,2 @@ +CHEBI:33250 +CHEBI:22313 diff --git a/src/ontology/imports/chebi_top_import.owl b/src/ontology/imports/chebi_top_import.owl new file mode 100644 index 0000000..860b5ea --- /dev/null +++ b/src/ontology/imports/chebi_top_import.owl @@ -0,0 +1,20125 @@ + + + + + 2023-09-05 + + + + + + + + + + + + + definition + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + has_alternative_id + + + + + + + + + + + + + + has_exact_synonym + + + + + + + + has_obo_namespace + + + + + + + + has_related_synonym + + + + + + + + + + + + + + + + + + + + in_subset + + + + + + + + + + + + + + + + + + + + + + + + + + An atom of an element that exhibits properties that are between those of metals and nonmetals, or that has a mixture of them. The term generally includes boron, silicon, germanium, arsenic, antimony, and tellurium, while carbon, aluminium, selenium, polonium, and astatine are less commonly included. + Wikipedia:Metalloid + chebi_ontology + metalloid + metalloids + CHEBI:137980 + + metalloid atom + + + + + metalloid + ChEBI + + + + + metalloids + ChEBI + + + + + + + + + A trace radioisotope of argon with atomic mass of 38.964313 and a half-life of 269 years. + 0 + [39Ar] + InChI=1S/Ar/i1-1 + XKRFYHLGVUSROY-BJUDXGSMSA-N + 38.964 + 38.96431 + [Ar] + CAS:25729-41-3 + PMID:16429279 + PMID:17781454 + PMID:17791262 + PMID:28017500 + PMID:28755564 + PMID:30487580 + chebi_ontology + (39)18Ar + (39)Ar + (39)Ar radioisotope + Ar-39 + Ar-39 radioisotope + argon 39 + argon, isotope of mass 39 + argon-39 + CHEBI:155827 + + argon-39 atom + + + + + (39)18Ar + ChEBI + + + + + (39)Ar + ChemIDplus + + + + + (39)Ar radioisotope + ChEBI + + + + + Ar-39 + ChEBI + + + + + Ar-39 radioisotope + ChEBI + + + + + argon 39 + ChEBI + + + + + argon, isotope of mass 39 + ChemIDplus + + + + + argon-39 + ChEBI + + + + + CAS:25729-41-3 + ChemIDplus + + + + + PMID:16429279 + Europe PMC + + + + + PMID:17781454 + Europe PMC + + + + + PMID:17791262 + Europe PMC + + + + + PMID:28017500 + Europe PMC + + + + + PMID:28755564 + Europe PMC + + + + + PMID:30487580 + Europe PMC + + + + + + + + + A minor stable isotope of calcium with relative atomic mass 42.95877 and 0.135 atom percent natural abundance. + 0 + [43Ca] + InChI=1S/Ca/i1+3 + OYPRJOBELJOOCE-AKLPVKDBSA-N + 42.959 + 42.95877 + [43Ca] + CAS:14333-06-3 + PMID:11859764 + PMID:19117733 + PMID:20463996 + PMID:20574585 + PMID:23163540 + PMID:23398971 + PMID:24874995 + PMID:25306191 + PMID:29770988 + PMID:6548252 + ((43)Ca)calcium + chebi_ontology + (43)20Ca + (43)Ca + (43)calcium + Ca-43 + calcium, isotope of mass 43 + calcium-43 + calcium-43 isotope + CHEBI:176566 + + calcium-43 atom + + + + + CAS:14333-06-3 + ChemIDplus + + + + + PMID:11859764 + Europe PMC + + + + + PMID:19117733 + Europe PMC + + + + + PMID:20463996 + Europe PMC + + + + + PMID:20574585 + Europe PMC + + + + + PMID:23163540 + Europe PMC + + + + + PMID:23398971 + Europe PMC + + + + + PMID:24874995 + Europe PMC + + + + + PMID:25306191 + Europe PMC + + + + + PMID:29770988 + Europe PMC + + + + + PMID:6548252 + Europe PMC + + + + + ((43)Ca)calcium + IUPAC + + + + + + (43)20Ca + ChEBI + + + + + (43)Ca + ChemIDplus + + + + + (43)calcium + ChEBI + + + + + Ca-43 + ChEBI + + + + + calcium, isotope of mass 43 + ChemIDplus + + + + + calcium-43 + ChemIDplus + + + + + calcium-43 isotope + ChEBI + + + + + + + + + A stable isotope of molybdenum with relative atomic mass 97.90541, 24.29 atom percent natural abundance and nuclear spin 0. + 0 + [98Mo] + InChI=1S/Mo/i1+2 + ZOKXTWBITQBERF-NJFSPNSNSA-N + 97.905 + 97.90541 + [98Mo] + CAS:14392-20-2 + PMID:19720541 + PMID:22796396 + PMID:22970917 + PMID:24593536 + PMID:25087173 + PMID:25168118 + PMID:25880611 + PMID:26397967 + PMID:26808401 + ((98)Mo)molybdenum + chebi_ontology + (98)42Mo + (98)Mo + Mo-98 + molybdenum, isotope of mass 98 + molybdenum-98 + CHEBI:176570 + + molybdenum-98 atom + + + + + CAS:14392-20-2 + ChemIDplus + + + + + PMID:19720541 + Europe PMC + + + + + PMID:22796396 + Europe PMC + + + + + PMID:22970917 + Europe PMC + + + + + PMID:24593536 + Europe PMC + + + + + PMID:25087173 + SUBMITTER + + + + + PMID:25168118 + Europe PMC + + + + + PMID:25880611 + Europe PMC + + + + + PMID:26397967 + Europe PMC + + + + + PMID:26808401 + Europe PMC + + + + + ((98)Mo)molybdenum + IUPAC + + + + + + (98)42Mo + ChEBI + + + + + (98)Mo + ChemIDplus + + + + + Mo-98 + ChEBI + + + + + molybdenum, isotope of mass 98 + ChemIDplus + + + + + molybdenum-98 + ChemIDplus + + + + + + + + + A major stable isotope of strontium with relative atomic mass 87.90561 and 82.58 atom percent natural abundance. + 0 + [88Sr] + InChI=1S/Sr/i1+0 + CIOAGBVUUVVLOB-IGMARMGPSA-N + 87.906 + 87.90561 + [88Sr] + CAS:14119-10-9 + PMID:11893161 + PMID:27829691 + PMID:32350478 + PMID:33328666 + PMID:33834832 + PMID:6337617 + ((88)Sr)strontium + chebi_ontology + (88)38Sr + (88)Sr + (88)strontium + Sr-88 + strontium, isotope of mass 88 + strontium-88 + strontium-88 isotope + CHEBI:176571 + + strontium-88 atom + + + + + CAS:14119-10-9 + ChemIDplus + + + + + PMID:11893161 + Europe PMC + + + + + PMID:27829691 + Europe PMC + + + + + PMID:32350478 + Europe PMC + + + + + PMID:33328666 + Europe PMC + + + + + PMID:33834832 + Europe PMC + + + + + PMID:6337617 + SUBMITTER + + + + + ((88)Sr)strontium + IUPAC + + + + + + (88)38Sr + ChEBI + + + + + (88)Sr + ChemIDplus + + + + + (88)strontium + ChEBI + + + + + Sr-88 + ChEBI + + + + + strontium, isotope of mass 88 + ChemIDplus + + + + + strontium-88 + ChemIDplus + + + + + strontium-88 isotope + ChEBI + + + + + + + + + A stable isotope of rubidium with relative atomic mass 84.91179, 72.17 atom percent natural abundance and nuclear spin 5/2. + 0 + [85Rb] + InChI=1S/Rb/i1+0 + IGLNJRXAVVLDKE-IGMARMGPSA-N + 84.912 + 84.91179 + [85Rb] + CAS:13982-12-2 + PMID:18026483 + PMID:18033464 + PMID:18291893 + PMID:18382518 + PMID:19855587 + PMID:25087142 + PMID:32909800 + PMID:33709729 + PMID:34170158 + ((85)Rb)rubidium + chebi_ontology + (85)37Rb + (85)Rb + Rb-85 + rubidium, isotope of mass 85 + rubidium-85 + CHEBI:176572 + + rubidium-85 atom + + + + + CAS:13982-12-2 + ChemIDplus + + + + + PMID:18026483 + Europe PMC + + + + + PMID:18033464 + Europe PMC + + + + + PMID:18291893 + Europe PMC + + + + + PMID:18382518 + Europe PMC + + + + + PMID:19855587 + Europe PMC + + + + + PMID:25087142 + SUBMITTER + + + + + PMID:32909800 + Europe PMC + + + + + PMID:33709729 + Europe PMC + + + + + PMID:34170158 + Europe PMC + + + + + ((85)Rb)rubidium + IUPAC + + + + + + (85)37Rb + ChEBI + + + + + (85)Rb + ChemIDplus + + + + + Rb-85 + ChEBI + + + + + rubidium, isotope of mass 85 + ChemIDplus + + + + + rubidium-85 + ChemIDplus + + + + + + + + + A stable isotope of selenium with relative atomic mass 81.91670, 8.82 atom percent natural abundance and nuclear spin 0. + 0 + [82Se] + InChI=1S/Se/i1+3 + BUGBHKTXTAQXES-AKLPVKDBSA-N + 81.917 + 81.91670 + [82Se] + CAS:14687-58-2 + Chemspider:4892236 + PMID:16028633 + PMID:18781022 + PMID:21139275 + PMID:22258472 + PMID:23575454 + PMID:29932707 + PMID:30881205 + PMID:31386478 + PMID:31951429 + PMID:33576665 + PMID:6337549 + ((82)Se)selenium + chebi_ontology + (82)34Se + (82)Se + Se-82 + selenium, isotope of mass 82 + selenium-82 + CHEBI:176573 + + selenium-82 atom + + + + + selenium, isotope of mass 82 + ChemIDplus + + + + + selenium-82 + ChemIDplus + + + + + CAS:14687-58-2 + ChemIDplus + + + + + PMID:16028633 + Europe PMC + + + + + PMID:18781022 + Europe PMC + + + + + PMID:21139275 + Europe PMC + + + + + PMID:22258472 + Europe PMC + + + + + PMID:23575454 + Europe PMC + + + + + PMID:29932707 + Europe PMC + + + + + PMID:30881205 + Europe PMC + + + + + PMID:31386478 + Europe PMC + + + + + PMID:31951429 + Europe PMC + + + + + PMID:33576665 + Europe PMC + + + + + PMID:6337549 + SUBMITTER + + + + + ((82)Se)selenium + IUPAC + + + + + + (82)34Se + ChEBI + + + + + (82)Se + ChemIDplus + + + + + Se-82 + ChEBI + + + + + + + + + A stable isotope of zinc with relative atomic mass 65.92603, 27.7 atom percent natural abundance and nuclear spin 0. + 0 + [66Zn] + InChI=1S/Zn/i1+1 + HCHKCACWOHOZIP-OUBTZVSYSA-N + 65.926 + 65.92603 + [66Zn] + CAS:14378-33-7 + PMID:12447866 + PMID:19836537 + PMID:20155761 + PMID:21047059 + PMID:24196216 + PMID:26065372 + PMID:26808401 + PMID:27189145 + PMID:27306032 + ((66)Zn)zinc + chebi_ontology + (66)30Zn + (66)Zn + Zn-66 + zinc, isotope of mass 66 + zinc-66 + CHEBI:176574 + + zinc-66 atom + + + + + CAS:14378-33-7 + ChemIDplus + + + + + PMID:12447866 + SUBMITTER + + + + + PMID:19836537 + Europe PMC + + + + + PMID:20155761 + Europe PMC + + + + + PMID:21047059 + Europe PMC + + + + + PMID:24196216 + Europe PMC + + + + + PMID:26065372 + Europe PMC + + + + + PMID:26808401 + Europe PMC + + + + + PMID:27189145 + Europe PMC + + + + + PMID:27306032 + Europe PMC + + + + + ((66)Zn)zinc + IUPAC + + + + + + (66)30Zn + ChEBI + + + + + (66)Zn + ChemIDplus + + + + + Zn-66 + ChemIDplus + + + + + zinc, isotope of mass 66 + ChemIDplus + + + + + zinc-66 + ChemIDplus + + + + + + + + + A stable isotope of nickel with relative atomic mass 59.93079, 26.223 atom percent natural abundance and nuclear spin 0. + 0 + [60Ni] + InChI=1S/Ni/i1+1 + PXHVJJICTQNCMI-OUBTZVSYSA-N + 59.931 + 59.93079 + [60Ni] + CAS:13981-80-1 + PMID:15308160 + PMID:22583786 + PMID:23149182 + PMID:25126912 + PMID:25700212 + PMID:26709546 + PMID:29376683 + ((60)Ni)nickel + chebi_ontology + (60)Ni + Ni-60 + nickel, isotope of mass 60 + nickel-60 + CHEBI:176575 + + nickel-60 atom + + + + + CAS:13981-80-1 + ChemIDplus + + + + + PMID:15308160 + Europe PMC + + + + + PMID:22583786 + Europe PMC + + + + + PMID:23149182 + Europe PMC + + + + + PMID:25126912 + Europe PMC + + + + + PMID:25700212 + Europe PMC + + + + + PMID:26709546 + Europe PMC + + + + + PMID:29376683 + Europe PMC + + + + + ((60)Ni)nickel + IUPAC + + + + + + (60)Ni + ChEBI + + + + + Ni-60 + ChEBI + + + + + nickel, isotope of mass 60 + ChemIDplus + + + + + nickel-60 + ChemIDplus + + + + + + + + + A stable isotope of cobalt with relative atomic mass 58.93319, 100 atom percent natural abundance and nuclear spin 7/2. + 0 + [59Co] + InChI=1S/Co/i1+0 + GUTLYIVDDKVIGB-IGMARMGPSA-N + 58.933 + 58.93319 + [59Co] + PMID:10617436 + PMID:10940985 + PMID:11421673 + PMID:11528329 + PMID:12943912 + PMID:19150229 + PMID:19421527 + PMID:25069794 + PMID:25169133 + PMID:26066447 + PMID:26641288 + PMID:27355901 + PMID:30137661 + PMID:31367328 + PMID:32478347 + ((59)Co)cobalt + chebi_ontology + (59)27Co + (59)Co + Co-59 + cobalt, isotope of mass 59 + cobalt-(59)Co + cobalt-59 + CHEBI:176578 + + cobalt-59 atom + + + + + PMID:10617436 + Europe PMC + + + + + PMID:10940985 + Europe PMC + + + + + PMID:11421673 + Europe PMC + + + + + PMID:11528329 + SUBMITTER + + + + + PMID:12943912 + Europe PMC + + + + + PMID:19150229 + Europe PMC + + + + + PMID:19421527 + Europe PMC + + + + + PMID:25069794 + Europe PMC + + + + + PMID:25169133 + Europe PMC + + + + + PMID:26066447 + Europe PMC + + + + + PMID:26641288 + Europe PMC + + + + + PMID:27355901 + Europe PMC + + + + + PMID:30137661 + Europe PMC + + + + + PMID:31367328 + Europe PMC + + + + + PMID:32478347 + Europe PMC + + + + + ((59)Co)cobalt + IUPAC + + + + + + (59)27Co + ChEBI + + + + + (59)Co + ChEBI + + + + + Co-59 + ChEBI + + + + + cobalt, isotope of mass 59 + ChEBI + + + + + cobalt-(59)Co + ChEBI + + + + + cobalt-59 + ChEBI + + + + + + + + + A stable isotope of manganese with relative atomic mass 54.93804, 100 atom percent natural abundance and nuclear spin 5/2. + 0 + [55Mn] + InChI=1S/Mn/i1+0 + PWHULOQIROXLJO-IGMARMGPSA-N + 54.938 + 54.93804 + [55Mn] + PMID:20645339 + PMID:21058720 + PMID:21341708 + PMID:24993844 + PMID:25179135 + PMID:25891681 + ((55)Mn)manganese + chebi_ontology + (55)25Mn + (55)Mn + Mn-55 + manganese, isotope of mass 55 + manganese-55 + CHEBI:176583 + + manganese-55 atom + + + + + PMID:20645339 + Europe PMC + + + + + PMID:21058720 + Europe PMC + + + + + PMID:21341708 + Europe PMC + + + + + PMID:24993844 + Europe PMC + + + + + PMID:25179135 + Europe PMC + + + + + PMID:25891681 + Europe PMC + + + + + ((55)Mn)manganese + IUPAC + + + + + + (55)25Mn + ChEBI + + + + + (55)Mn + ChEBI + + + + + Mn-55 + ChEBI + + + + + manganese, isotope of mass 55 + ChEBI + + + + + manganese-55 + ChEBI + + + + + + + + + A stable isotope of arsenic with relative atomic mass 74.921596, 100 atom percent natural abundance and nuclear spin 3/2. + 0 + [75As] + InChI=1S/As/i1+0 + RQNWIZPPADIBDY-IGMARMGPSA-N + 74.922 + 74.92159 + [75As] + ((75)As)arsenic + chebi_ontology + (75)33As + (75)As + As-75 + arsenic, isotope of mass 75 + arsenic-75 + CHEBI:176584 + + arsenic-75 atom + + + + + ((75)As)arsenic + IUPAC + + + + + + (75)33As + ChEBI + + + + + (75)As + ChEBI + + + + + As-75 + ChEBI + + + + + arsenic, isotope of mass 75 + ChEBI + + + + + arsenic-75 + ChEBI + + + + + + + + + An iron group element atom that has atomic number 26. + 0 + Fe + InChI=1S/Fe + XEEYBQQBJWHFJM-UHFFFAOYSA-N + 55.84500 + 55.93494 + [Fe] + CHEBI:13322 + CHEBI:24872 + CHEBI:5974 + CAS:7439-89-6 + DrugBank:DB01592 + HMDB:HMDB0015531 + KEGG:C00023 + Reaxys:4122945 + WebElements:Fe + iron + chebi_ontology + 26Fe + Eisen + Fe + Iron + fer + ferrum + hierro + iron + CHEBI:18248 + + iron atom + + + + + CAS:7439-89-6 + ChemIDplus + + + + + CAS:7439-89-6 + KEGG COMPOUND + + + + + CAS:7439-89-6 + NIST Chemistry WebBook + + + + + Reaxys:4122945 + Reaxys + + + + + iron + IUPAC + + + + + + 26Fe + IUPAC + + + + + Eisen + ChEBI + + + + + Fe + IUPAC + + + + + Fe + UniProt + + + + + Iron + KEGG_COMPOUND + + + + + fer + ChEBI + + + + + ferrum + IUPAC + + + + + hierro + ChEBI + + + + + iron + ChEBI + + + + + + + + + 0 + Mn + InChI=1S/Mn + PWHULOQIROXLJO-UHFFFAOYSA-N + 54.93805 + 54.93804 + [Mn] + CHEBI:13382 + CHEBI:25153 + CHEBI:6681 + CAS:7439-96-5 + KEGG:C00034 + WebElements:Mn + manganese + chebi_ontology + 25Mn + Mangan + Manganese + Mn + manganese + manganeso + manganum + CHEBI:18291 + + manganese atom + + + + + CAS:7439-96-5 + ChemIDplus + + + + + CAS:7439-96-5 + KEGG COMPOUND + + + + + manganese + IUPAC + + + + + + 25Mn + IUPAC + + + + + Mangan + NIST_Chemistry_WebBook + + + + + Manganese + KEGG_COMPOUND + + + + + Mn + IUPAC + + + + + Mn + UniProt + + + + + manganese + ChEBI + + + + + manganeso + ChEBI + + + + + manganum + ChEBI + + + + + + + + + A carbon group element atom with a symbol Fl and atomic number 114. + 0 + Fl + InChI=1S/Fl + WIHJCBVMYKIGOT-UHFFFAOYSA-N + 289.000 + 289.00000 + [Fl] + PMID:16833611 + PMID:17919027 + PMID:19905506 + PMID:20379506 + PMID:20867370 + PMID:23787759 + PMID:24456007 + PMID:29711350 + PMID:36092655 + Wikipedia:Flerovium + chebi_ontology + 114Fl + 114Uuq + E114 + Fl + Uuq + eka-lead + element 114 + ununquadium + CHEBI:194531 + + flerovium atom + + + + + PMID:16833611 + Europe PMC + + + + + PMID:17919027 + Europe PMC + + + + + PMID:19905506 + Europe PMC + + + + + PMID:20379506 + Europe PMC + + + + + PMID:20867370 + Europe PMC + + + + + PMID:23787759 + Europe PMC + + + + + PMID:24456007 + Europe PMC + + + + + PMID:29711350 + Europe PMC + + + + + PMID:36092655 + Europe PMC + + + + + 114Fl + ChEBI + + + + + 114Uuq + ChEBI + + + + + E114 + ChEBI + + + + + Fl + ChEBI + + + + + Uuq + ChEBI + + + + + eka-lead + ChEBI + + + + + element 114 + ChEBI + + + + + ununquadium + ChEBI + + + + + + + + + A boron group element atom with a symbol Nh and atomic number 113. + 0 + Nh + InChI=1S/Nh + KUGNSLWRKGRKGS-UHFFFAOYSA-N + 286.000 + 286.00000 + [Nh] + PMID:19049424 + PMID:34142795 + PMID:34917588 + PMID:36149319 + PMID:9913354 + Wikipedia:Nihonium + chebi_ontology + 113Nh + E113 + Nh + Uut + eka-thallium + element 113 + ununtrium + CHEBI:194533 + + nihonium atom + + + + + PMID:19049424 + Europe PMC + + + + + PMID:34142795 + Europe PMC + + + + + PMID:34917588 + Europe PMC + + + + + PMID:36149319 + Europe PMC + + + + + PMID:9913354 + Europe PMC + + + + + 113Nh + ChEBI + + + + + E113 + ChEBI + + + + + Nh + ChEBI + + + + + Uut + ChEBI + + + + + eka-thallium + ChEBI + + + + + element 113 + ChEBI + + + + + ununtrium + ChEBI + + + + + + + + + A pnictogen atom with a symbol Mc and atomic number 115. + 0 + Mc + InChI=1S/Mc + QDXZEHQJHSHEQF-UHFFFAOYSA-N + 289.000 + 289.00000 + [Mc] + PMID:24074079 + PMID:34142795 + Wikipedia:Moscovium + chebi_ontology + 115Mc + E115 + Mc + Uup + eka-bismuth + element 115 + ununpentium + CHEBI:194535 + + moscovium atom + + + + + PMID:24074079 + Europe PMC + + + + + PMID:34142795 + Europe PMC + + + + + 115Mc + ChEBI + + + + + E115 + ChEBI + + + + + Mc + ChEBI + + + + + Uup + ChEBI + + + + + eka-bismuth + ChEBI + + + + + element 115 + ChEBI + + + + + ununpentium + ChEBI + + + + + + + + + A chalcogen atom with a symbol Lv and atomic number 116. + 0 + Lv + InChI=1S/Lv + ONFASNXETZOODS-UHFFFAOYSA-N + 293.000 + 293.00000 + [Lv] + PMID:17381195 + PMID:27554416 + Wikipedia:Livermorium + chebi_ontology + 116Lv + E116 + Lv + Uuh + eka-polonium + element 116 + ununhexium + CHEBI:194537 + + livermorium atom + + + + + PMID:17381195 + Europe PMC + + + + + PMID:27554416 + Europe PMC + + + + + 116Lv + ChEBI + + + + + E116 + ChEBI + + + + + Lv + ChEBI + + + + + Uuh + ChEBI + + + + + eka-polonium + ChEBI + + + + + element 116 + ChEBI + + + + + ununhexium + ChEBI + + + + + + + + + A halogen atom with a symbol Ts and atomic number 117. + 0 + Ts + InChI=1S/Ts + INMSAURDCVBGHH-UHFFFAOYSA-N + 293.000 + 293.00000 + [Ts] + PMID:16483205 + PMID:19367904 + PMID:20395479 + PMID:23090670 + Wikipedia:Tennessine + chebi_ontology + 117Ts + E117 + Ts + Uus + eka-astatine + element 117 + ununseptium + CHEBI:194539 + + tennessine atom + + + + + PMID:16483205 + Europe PMC + + + + + PMID:19367904 + Europe PMC + + + + + PMID:20395479 + Europe PMC + + + + + PMID:23090670 + Europe PMC + + + + + 117Ts + ChEBI + + + + + E117 + ChEBI + + + + + Ts + ChEBI + + + + + Uus + ChEBI + + + + + eka-astatine + ChEBI + + + + + element 117 + ChEBI + + + + + ununseptium + ChEBI + + + + + + + + + + A p-block element atom with a symbol Og and atomic number 118. + 0 + InChI=1S/Og + GOANEQIZDYDFCO-UHFFFAOYSA-N + 294.000 + 294.00000 + [Og] + PMID:10062781 + PMID:11486061 + PMID:19045133 + PMID:23913741 + PMID:36859080 + Wikipedia:Oganesson + chebi_ontology + 118Og + E118 + Og + Uuo + eka-emanation + eka-radon + element 118 + ununoctium + CHEBI:194541 + + oganesson atom + + + + + PMID:10062781 + Europe PMC + + + + + PMID:11486061 + Europe PMC + + + + + PMID:19045133 + Europe PMC + + + + + PMID:23913741 + Europe PMC + + + + + PMID:36859080 + Europe PMC + + + + + 118Og + ChEBI + + + + + E118 + ChEBI + + + + + Og + ChEBI + + + + + Uuo + ChEBI + + + + + eka-emanation + ChEBI + + + + + eka-radon + ChEBI + + + + + element 118 + ChEBI + + + + + ununoctium + ChEBI + + + + + + + + + + + alkaline earth metals + chebi_ontology + Erdalkalimetall + Erdalkalimetalle + alkaline earth metal + alkaline-earth metal + alkaline-earth metals + metal alcalino-terreux + metal alcalinoterreo + metales alcalinoterreos + metaux alcalino-terreux + CHEBI:22313 + + alkaline earth metal atom + + + + + alkaline earth metals + IUPAC + + + + + + Erdalkalimetall + ChEBI + + + + + Erdalkalimetalle + ChEBI + + + + + alkaline earth metal + ChEBI + + + + + alkaline-earth metal + ChEBI + + + + + alkaline-earth metals + ChEBI + + + + + metal alcalino-terreux + ChEBI + + + + + metal alcalinoterreo + ChEBI + + + + + metales alcalinoterreos + ChEBI + + + + + metaux alcalino-terreux + ChEBI + + + + + + + + + + + alkali metals + chebi_ontology + Alkalimetall + Alkalimetalle + alkali metal + metal alcalin + metal alcalino + metales alcalinos + metaux alcalins + CHEBI:22314 + + alkali metal atom + + + + + alkali metals + IUPAC + + + + + + Alkalimetall + ChEBI + + + + + Alkalimetalle + ChEBI + + + + + alkali metal + ChEBI + + + + + metal alcalin + ChEBI + + + + + metal alcalino + ChEBI + + + + + metales alcalinos + ChEBI + + + + + metaux alcalins + ChEBI + + + + + + + + + 0 + Br + InChI=1S/Br + WKBOTKDWSSQWDR-UHFFFAOYSA-N + 79.90400 + 78.91834 + [Br] + WebElements:Br + bromine + chebi_ontology + 35Br + Br + Brom + brome + bromine + bromo + bromum + CHEBI:22927 + + bromine atom + + + + + bromine + IUPAC + + + + + + 35Br + IUPAC + + + + + Br + ChEBI + + + + + Brom + ChEBI + + + + + brome + ChEBI + + + + + bromine + ChEBI + + + + + bromo + ChEBI + + + + + bromum + ChEBI + + + + + + + + + 0 + Cd + InChI=1S/Cd + BDOSMKKIYDKNTQ-UHFFFAOYSA-N + 112.41100 + 113.90336 + [Cd] + CAS:7440-43-9 + KEGG:C01413 + WebElements:Cd + cadmium + chebi_ontology + 48Cd + Cd + Kadmium + cadmio + cadmium + CHEBI:22977 + + cadmium atom + + + + + CAS:7440-43-9 + ChemIDplus + + + + + CAS:7440-43-9 + KEGG COMPOUND + + + + + CAS:7440-43-9 + NIST Chemistry WebBook + + + + + cadmium + IUPAC + + + + + + 48Cd + IUPAC + + + + + Cd + IUPAC + + + + + Kadmium + NIST_Chemistry_WebBook + + + + + cadmio + ChEBI + + + + + cadmium + ChEBI + + + + + + + + + 0 + Ca + InChI=1S/Ca + OYPRJOBELJOOCE-UHFFFAOYSA-N + 40.07800 + 39.96259 + [Ca] + CAS:7440-70-2 + DrugBank:DB01373 + KEGG:C00076 + WebElements:Ca + calcium + chebi_ontology + 20Ca + Ca + Calcium + Kalzium + calcio + calcium + CHEBI:22984 + + calcium atom + + + + + CAS:7440-70-2 + ChemIDplus + + + + + calcium + IUPAC + + + + + + 20Ca + IUPAC + + + + + Ca + IUPAC + + + + + Ca + UniProt + + + + + Calcium + KEGG_COMPOUND + + + + + Kalzium + ChEBI + + + + + calcio + ChEBI + + + + + calcium + ChEBI + + + + + + + + + 0 + Cl + InChI=1S/Cl + ZAMOUSCENKQFHK-UHFFFAOYSA-N + 35.45270 + 34.96885 + [Cl] + WebElements:Cl + chlorine + chebi_ontology + 17Cl + Chlor + Cl + chlore + chlorine + chlorum + cloro + CHEBI:23116 + + chlorine atom + + + + + chlorine + IUPAC + + + + + + 17Cl + IUPAC + + + + + Chlor + ChEBI + + + + + Cl + IUPAC + + + + + chlore + ChEBI + + + + + chlorine + ChEBI + + + + + chlorum + ChEBI + + + + + cloro + ChEBI + + + + + + + + + 0 + F + InChI=1S/F + YCKRFDGAMUMZLT-UHFFFAOYSA-N + 18.99840 + 18.99840 + [F] + CAS:7782-41-4 + WebElements:F + fluorine + chebi_ontology + 9F + F + Fluor + fluor + fluorine + fluorum + CHEBI:24061 + + fluorine atom + + + + + CAS:7782-41-4 + ChemIDplus + + + + + fluorine + IUPAC + + + + + + 9F + IUPAC + + + + + F + IUPAC + + + + + Fluor + ChemIDplus + + + + + fluor + ChEBI + + + + + fluorine + ChEBI + + + + + fluorum + ChEBI + + + + + + + + + + halogen + halogens + chebi_ontology + Halogene + group 17 elements + group VII elements + halogene + halogenes + halogeno + halogenos + CHEBI:24473 + + halogen + + + + + halogen + IUPAC + + + + + + halogens + IUPAC + + + + + + Halogene + ChEBI + + + + + group 17 elements + ChEBI + + + + + group VII elements + ChEBI + + + + + halogene + ChEBI + + + + + halogenes + ChEBI + + + + + halogeno + ChEBI + + + + + halogenos + ChEBI + + + + + + + + + Chemical element with atomic number 53. + 0 + I + InChI=1S/I + ZCYVEMRRCGMTRW-UHFFFAOYSA-N + 126.90447 + 126.90447 + [I] + WebElements:I + iodine + chebi_ontology + 53I + I + Iod + J + Jod + iode + iodine + iodium + yodo + CHEBI:24859 + + iodine atom + + + + + iodine + IUPAC + + + + + + 53I + IUPAC + + + + + I + ChEBI + + + + + Iod + ChEBI + + + + + J + ChEBI + + + + + Jod + ChEBI + + + + + iode + ChEBI + + + + + iodine + ChEBI + + + + + iodium + ChEBI + + + + + yodo + ChEBI + + + + + + + + + + 0 + Pb + InChI=1S/Pb + WABPQHHGFIMREM-UHFFFAOYSA-N + 207.20000 + 207.97665 + [Pb] + KEGG:C06696 + WebElements:Pb + lead + chebi_ontology + 82Pb + Blei + Pb + lead + plomb + plomo + plumbum + CHEBI:25016 + + lead atom + + + + + lead + IUPAC + + + + + + 82Pb + IUPAC + + + + + Blei + ChEBI + + + + + Pb + IUPAC + + + + + lead + ChEBI + + + + + plomb + ChEBI + + + + + plomo + ChEBI + + + + + plumbum + IUPAC + + + + + + + + + 0 + Mg + InChI=1S/Mg + FYYHWMGAXLPEAU-UHFFFAOYSA-N + 24.30500 + 23.98504 + [Mg] + CAS:7439-95-4 + DrugBank:DB01378 + Gmelin:16207 + KEGG:C00305 + WebElements:Mg + magnesium + chebi_ontology + 12Mg + Magnesium + Mg + magnesio + magnesium + CHEBI:25107 + + magnesium atom + + + + + CAS:7439-95-4 + ChemIDplus + + + + + Gmelin:16207 + Gmelin + + + + + magnesium + IUPAC + + + + + + 12Mg + IUPAC + + + + + Magnesium + ChEBI + + + + + Mg + IUPAC + + + + + Mg + UniProt + + + + + magnesio + ChEBI + + + + + magnesium + ChEBI + + + + + + + + + 0 + Hg + InChI=1S/Hg + QSHDDOUJBYECFT-UHFFFAOYSA-N + 200.59000 + 201.97064 + [Hg] + CAS:7439-97-6 + WebElements:Hg + mercury + chebi_ontology + 80Hg + Hg + Quecksilber + azogue + hydrargyrum + liquid silver + mercure + mercurio + mercury + quicksilver + CHEBI:25195 + + mercury atom + + + + + CAS:7439-97-6 + ChemIDplus + + + + + mercury + IUPAC + + + + + + 80Hg + IUPAC + + + + + Hg + IUPAC + + + + + Quecksilber + ChemIDplus + + + + + azogue + ChEBI + + + + + hydrargyrum + IUPAC + + + + + liquid silver + ChemIDplus + + + + + mercure + ChemIDplus + + + + + mercurio + ChEBI + + + + + mercury + ChEBI + + + + + quicksilver + ChemIDplus + + + + + + + + + + 0 + N + 14.007 + 14.00307 + WebElements:N + nitrogen + chebi_ontology + 7N + N + Stickstoff + azote + nitrogen + nitrogeno + CHEBI:25555 + + nitrogen atom + + + + + nitrogen + IUPAC + + + + + + 7N + IUPAC + + + + + N + IUPAC + + + + + Stickstoff + ChEBI + + + + + azote + IUPAC + + + + + nitrogen + ChEBI + + + + + nitrogeno + ChEBI + + + + + + + + + nonmetal + chebi_ontology + Nichtmetall + Nichtmetalle + no metal + no metales + non-metal + non-metaux + nonmetal + nonmetals + CHEBI:25585 + + nonmetal atom + + + + + nonmetal + IUPAC + + + + + + Nichtmetall + ChEBI + + + + + Nichtmetalle + ChEBI + + + + + no metal + ChEBI + + + + + no metales + ChEBI + + + + + non-metal + ChEBI + + + + + non-metaux + ChEBI + + + + + nonmetal + ChEBI + + + + + nonmetals + ChEBI + + + + + + + + + + 0 + O + InChI=1S/O + QVGXLLKOCUKJST-UHFFFAOYSA-N + 15.99940 + 15.99491 + [O] + KEGG:C00007 + WebElements:O + oxygen + chebi_ontology + 8O + O + Sauerstoff + oxigeno + oxygen + oxygene + CHEBI:25805 + + oxygen atom + + + + + oxygen + IUPAC + + + + + + 8O + IUPAC + + + + + O + IUPAC + + + + + Sauerstoff + ChEBI + + + + + oxigeno + ChEBI + + + + + oxygen + ChEBI + + + + + oxygene + ChEBI + + + + + + + + + 0 + K + InChI=1S/K + ZLMJMSJWJFRBEC-UHFFFAOYSA-N + 39.09830 + 38.96371 + [K] + CAS:7440-09-7 + DrugBank:DB01345 + KEGG:C00238 + WebElements:K + potassium + chebi_ontology + 19K + K + Kalium + kalium + potasio + potassium + CHEBI:26216 + + potassium atom + + + + + CAS:7440-09-7 + ChemIDplus + + + + + potassium + IUPAC + + + + + + 19K + IUPAC + + + + + K + IUPAC + + + + + Kalium + ChemIDplus + + + + + kalium + IUPAC + + + + + potasio + ChEBI + + + + + potassium + ChEBI + + + + + + + + + 0 + Na + InChI=1S/Na + KEAYESYHFKHZAL-UHFFFAOYSA-N + 22.98977 + 22.98977 + [Na] + CAS:7440-23-5 + Gmelin:16221 + KEGG:C01330 + WebElements:Na + sodium + chebi_ontology + 11Na + Na + Natrium + natrium + sodio + sodium + CHEBI:26708 + + sodium atom + + + + + CAS:7440-23-5 + ChemIDplus + + + + + Gmelin:16221 + Gmelin + + + + + sodium + IUPAC + + + + + + 11Na + IUPAC + + + + + Na + IUPAC + + + + + Natrium + ChemIDplus + + + + + natrium + IUPAC + + + + + sodio + ChemIDplus + + + + + sodium + ChEBI + + + + + + + + + + 0 + S + InChI=1S/S + NINIDFKCEFEMDL-UHFFFAOYSA-N + 32.06600 + 31.97207 + [S] + CAS:7704-34-9 + KEGG:C00087 + KEGG:D06527 + PPDB:605 + WebElements:S + sulfur + chebi_ontology + 16S + Elemental sulfur + S + Schwefel + azufre + soufre + sulfur + sulphur + theion + CHEBI:26833 + + sulfur atom + + + + + CAS:7704-34-9 + ChemIDplus + + + + + CAS:7704-34-9 + NIST Chemistry WebBook + + + + + sulfur + IUPAC + + + + + + 16S + IUPAC + + + + + Elemental sulfur + KEGG_COMPOUND + + + + + S + IUPAC + + + + + S + KEGG_COMPOUND + + + + + Schwefel + ChEBI + + + + + azufre + ChEBI + + + + + soufre + ChEBI + + + + + sulfur + ChEBI + + + + + sulfur + UniProt + + + + + sulphur + ChEBI + + + + + theion + IUPAC + + + + + + + + + + 0 + Sn + InChI=1S/Sn + ATJFFYVFTNAWJD-UHFFFAOYSA-N + 118.71000 + 119.90220 + [Sn] + CAS:7440-31-5 + UM-BBD_compID:c0585 + WebElements:Sn + tin + chebi_ontology + 50Sn + Sn + Zinn + estano + etain + stannum + tin + CHEBI:27007 + + tin atom + + + + + CAS:7440-31-5 + ChemIDplus + + + + + UM-BBD_compID:c0585 + UM-BBD + + + + + tin + IUPAC + + + + + + 50Sn + IUPAC + + + + + Sn + IUPAC + + + + + Zinn + ChemIDplus + + + + + estano + ChEBI + + + + + etain + ChEBI + + + + + stannum + IUPAC + + + + + tin + ChEBI + + + + + + + + + An element whose atom has an incomplete d sub-shell, or which can give rise to cations with an incomplete d sub-shell. + transition element + chebi_ontology + Uebergangselement + Uebergangsmetalle + metal de transicion + metal de transition + metales de transicion + metaux de transition + transition element + transition elements + transition metal + transition metals + CHEBI:27081 + + transition element atom + + + + + transition element + IUPAC + + + + + + Uebergangselement + ChEBI + + + + + Uebergangsmetalle + ChEBI + + + + + metal de transicion + ChEBI + + + + + metal de transition + ChEBI + + + + + metales de transicion + ChEBI + + + + + metaux de transition + ChEBI + + + + + transition element + ChEBI + + + + + transition elements + ChEBI + + + + + transition metal + ChEBI + + + + + transition metals + ChEBI + + + + + + + + + + 0 + U + InChI=1S/U + JFALSRSLKYAFGM-UHFFFAOYSA-N + 238.02890 + 238.05079 + [U] + CAS:7440-61-1 + WebElements:U + uranium + chebi_ontology + 92U + U + Uran + uranio + uranium + CHEBI:27214 + + uranium atom + + + + + CAS:7440-61-1 + ChemIDplus + + + + + uranium + IUPAC + + + + + + 92U + IUPAC + + + + + U + IUPAC + + + + + Uran + ChEBI + + + + + uranio + ChEBI + + + + + uranium + ChEBI + + + + + + + + + 0 + Zn + InChI=1S/Zn + HCHKCACWOHOZIP-UHFFFAOYSA-N + 65.39000 + 63.92914 + [Zn] + CAS:7440-66-6 + Gmelin:16321 + KEGG:C00038 + PDBeChem:ZN + WebElements:Zn + zinc + chebi_ontology + 30Zn + Zink + Zn + Zn(II) + Zn2+ + cinc + zinc + zincum + CHEBI:27363 + + zinc atom + + + + + CAS:7440-66-6 + ChemIDplus + + + + + CAS:7440-66-6 + KEGG COMPOUND + + + + + Gmelin:16321 + Gmelin + + + + + zinc + IUPAC + + + + + + 30Zn + IUPAC + + + + + Zink + ChEBI + + + + + Zn + IUPAC + + + + + Zn(II) + KEGG_COMPOUND + + + + + Zn2+ + KEGG_COMPOUND + + + + + cinc + ChEBI + + + + + zinc + ChEBI + + + + + zincum + ChEBI + + + + + + + + + + + 0 + B + InChI=1S/B + ZOXJGFHDIHLPTG-UHFFFAOYSA-N + 10.81100 + 11.00930 + [B] + CHEBI:22915 + CHEBI:3152 + CAS:7440-42-8 + KEGG:C06266 + WebElements:B + boron + chebi_ontology + 5B + B + Bor + Boron + boracium + bore + boro + boron + CHEBI:27560 + + boron atom + + + + + CAS:7440-42-8 + ChemIDplus + + + + + CAS:7440-42-8 + KEGG COMPOUND + + + + + boron + IUPAC + + + + + + 5B + IUPAC + + + + + B + KEGG_COMPOUND + + + + + Bor + ChEBI + + + + + Boron + KEGG_COMPOUND + + + + + boracium + ChEBI + + + + + bore + ChEBI + + + + + boro + ChEBI + + + + + boron + ChEBI + + + + + + + + + + 0 + As + InChI=1S/As + RQNWIZPPADIBDY-UHFFFAOYSA-N + 74.92160 + 74.92159 + [As] + CHEBI:22630 + CHEBI:2845 + CAS:7440-38-2 + KEGG:C06269 + WebElements:As + arsenic + chebi_ontology + 33As + Arsen + Arsenic + As + arsenic + arsenico + arsenicum + CHEBI:27563 + + arsenic atom + + + + + CAS:7440-38-2 + ChemIDplus + + + + + CAS:7440-38-2 + KEGG COMPOUND + + + + + arsenic + IUPAC + + + + + + 33As + IUPAC + + + + + Arsen + ChemIDplus + + + + + Arsenic + KEGG_COMPOUND + + + + + As + KEGG_COMPOUND + + + + + arsenic + ChEBI + + + + + arsenico + ChEBI + + + + + arsenicum + ChEBI + + + + + + + + + + 0 + Se + InChI=1S/Se + BUGBHKTXTAQXES-UHFFFAOYSA-N + 78.96000 + 79.91652 + [Se] + CHEBI:26627 + CHEBI:9091 + CAS:7782-49-2 + DrugBank:DB11135 + FooDB:FDB013400 + HMDB:HMDB0001349 + KEGG:C01529 + WebElements:Se + Wikipedia:Selenium + selenium + chebi_ontology + 34Se + Se + Selen + Selenium + selenio + selenium + CHEBI:27568 + + selenium atom + + + + + CAS:7782-49-2 + ChemIDplus + + + + + CAS:7782-49-2 + NIST Chemistry WebBook + + + + + selenium + IUPAC + + + + + + 34Se + IUPAC + + + + + Se + IUPAC + + + + + Selen + ChemIDplus + + + + + Selenium + KEGG_COMPOUND + + + + + selenio + ChEBI + + + + + selenium + ChEBI + + + + + + + + + + + 0 + Si + InChI=1S/Si + XUIMIQQOPSSXEZ-UHFFFAOYSA-N + 28.08550 + 27.97693 + [Si] + CHEBI:26676 + CHEBI:9140 + CAS:7440-21-3 + KEGG:C06263 + WebElements:Si + silicon + chebi_ontology + 14Si + Si + Silicon + Silizium + silicio + silicium + silicon + CHEBI:27573 + + silicon atom + + + + + CAS:7440-21-3 + ChemIDplus + + + + + silicon + IUPAC + + + + + + 14Si + IUPAC + + + + + Si + IUPAC + + + + + Si + KEGG_COMPOUND + + + + + Silicon + KEGG_COMPOUND + + + + + Silizium + ChEBI + + + + + silicio + ChEBI + + + + + silicium + ChEBI + + + + + silicon + ChEBI + + + + + + + + + + 0 + C + InChI=1S/C + OKTJSMMVPCPJKN-UHFFFAOYSA-N + 12.01070 + 12.00000 + [C] + CHEBI:23009 + CHEBI:3399 + CAS:7440-44-0 + KEGG:C06265 + WebElements:C + carbon + chebi_ontology + 6C + C + Carbon + Kohlenstoff + carbon + carbone + carbonium + carbono + CHEBI:27594 + + carbon atom + + + + + CAS:7440-44-0 + ChemIDplus + + + + + CAS:7440-44-0 + KEGG COMPOUND + + + + + carbon + IUPAC + + + + + + 6C + IUPAC + + + + + C + IUPAC + + + + + C + KEGG_COMPOUND + + + + + Carbon + KEGG_COMPOUND + + + + + Kohlenstoff + ChEBI + + + + + carbon + ChEBI + + + + + carbone + ChEBI + + + + + carbonium + ChEBI + + + + + carbono + ChEBI + + + + + + + + + + A cobalt group element atom that has atomic number 27. + 0 + Co + InChI=1S/Co + GUTLYIVDDKVIGB-UHFFFAOYSA-N + 58.93320 + 58.93319 + [Co] + CHEBI:23335 + CHEBI:3788 + CAS:7440-48-4 + KEGG:C00175 + KEGG:C19171 + PDBeChem:3CO + WebElements:Co + cobalt + chebi_ontology + 27Co + Co + Cobalt + Kobalt + cobalt + cobalto + cobaltum + CHEBI:27638 + + cobalt atom + + + + + CAS:7440-48-4 + ChemIDplus + + + + + CAS:7440-48-4 + KEGG COMPOUND + + + + + CAS:7440-48-4 + NIST Chemistry WebBook + + + + + cobalt + IUPAC + + + + + + 27Co + IUPAC + + + + + Co + IUPAC + + + + + Co + UniProt + + + + + Cobalt + KEGG_COMPOUND + + + + + Kobalt + NIST_Chemistry_WebBook + + + + + cobalt + ChEBI + + + + + cobalto + ChEBI + + + + + cobaltum + ChEBI + + + + + + + + + 0 + V + InChI=1S/V + LEONUFNNVUYDNQ-UHFFFAOYSA-N + 50.94150 + 50.94396 + [V] + CHEBI:27274 + CHEBI:9930 + CAS:7440-62-2 + KEGG:C06267 + WebElements:V + vanadium + chebi_ontology + 23V + V + Vanadium + vanadio + vanadium + CHEBI:27698 + + vanadium atom + + + + + CAS:7440-62-2 + ChemIDplus + + + + + CAS:7440-62-2 + KEGG COMPOUND + + + + + CAS:7440-62-2 + NIST Chemistry WebBook + + + + + vanadium + IUPAC + + + + + + 23V + IUPAC + + + + + V + IUPAC + + + + + V + KEGG_COMPOUND + + + + + Vanadium + KEGG_COMPOUND + + + + + vanadio + ChEBI + + + + + vanadium + ChEBI + + + + + + + + + 0 + W + InChI=1S/W + WFKWXMTUELFFGS-UHFFFAOYSA-N + 183.84000 + 183.95093 + [W] + CHEBI:27170 + CHEBI:9779 + CAS:7440-33-7 + Gmelin:16317 + KEGG:C00753 + PDBeChem:W + WebElements:W + Tungsten + tungsten + wolfram + chebi_ontology + 74W + W + Wolfram + tungsten atom + tungstene + tungsteno + volframio + wolframio + wolframium + CHEBI:27998 + + tungsten + + + + + CAS:7440-33-7 + ChemIDplus + + + + + CAS:7440-33-7 + KEGG COMPOUND + + + + + CAS:7440-33-7 + NIST Chemistry WebBook + + + + + Gmelin:16317 + Gmelin + + + + + Tungsten + KEGG_COMPOUND + + + + + tungsten + IUPAC + + + + + + wolfram + IUPAC + + + + + + 74W + IUPAC + + + + + W + IUPAC + + + + + W + UniProt + + + + + Wolfram + NIST_Chemistry_WebBook + + + + + tungsten atom + ChEBI + + + + + tungstene + ChEBI + + + + + tungsteno + ChEBI + + + + + volframio + ChEBI + + + + + wolframio + ChEBI + + + + + wolframium + ChEBI + + + + + + + + + + A chromium group element atom that has atomic number 24. + 0 + Cr + InChI=1S/Cr + VYZAMTAEIAYCRO-UHFFFAOYSA-N + 51.99610 + 51.94051 + [Cr] + CHEBI:23235 + CHEBI:3678 + CAS:7440-47-3 + KEGG:C06268 + WebElements:Cr + chromium + chebi_ontology + 24Cr + Chrom + Chromium + Cr + chrome + chromium + cromo + CHEBI:28073 + + chromium atom + + + + + CAS:7440-47-3 + ChemIDplus + + + + + CAS:7440-47-3 + KEGG COMPOUND + + + + + chromium + IUPAC + + + + + + 24Cr + IUPAC + + + + + Chrom + ChemIDplus + + + + + Chromium + KEGG_COMPOUND + + + + + Cr + IUPAC + + + + + Cr + KEGG_COMPOUND + + + + + chrome + ChEBI + + + + + chromium + ChEBI + + + + + cromo + ChEBI + + + + + + + + + + Chemical element (nickel group element atom) with atomic number 28. + 0 + Ni + InChI=1S/Ni + PXHVJJICTQNCMI-UHFFFAOYSA-N + 58.69340 + 57.93534 + [Ni] + CHEBI:25515 + CHEBI:7552 + CAS:7440-02-0 + Gmelin:16229 + KEGG:C00291 + PMID:12756270 + PMID:14634084 + PMID:14734778 + PMID:15165199 + PMID:19828094 + PMID:20477134 + PMID:22762130 + PMID:23142754 + PMID:23317102 + PMID:23692032 + PMID:23692035 + PMID:23723488 + PMID:23834453 + PMID:23857010 + PMID:23895079 + PMID:23909687 + PMID:9060994 + PMID:9886425 + Reaxys:4122946 + WebElements:Ni + Wikipedia:Nickel + nickel + chebi_ontology + 28Ni + Ni + Nickel + Raney alloy + niccolum + nickel + niquel + CHEBI:28112 + + nickel atom + + + + + CAS:7440-02-0 + ChemIDplus + + + + + CAS:7440-02-0 + KEGG COMPOUND + + + + + CAS:7440-02-0 + NIST Chemistry WebBook + + + + + Gmelin:16229 + Gmelin + + + + + PMID:12756270 + Europe PMC + + + + + PMID:14634084 + Europe PMC + + + + + PMID:14734778 + Europe PMC + + + + + PMID:15165199 + Europe PMC + + + + + PMID:19828094 + Europe PMC + + + + + PMID:20477134 + Europe PMC + + + + + PMID:22762130 + Europe PMC + + + + + PMID:23142754 + Europe PMC + + + + + PMID:23317102 + Europe PMC + + + + + PMID:23692032 + Europe PMC + + + + + PMID:23692035 + Europe PMC + + + + + PMID:23723488 + Europe PMC + + + + + PMID:23834453 + Europe PMC + + + + + PMID:23857010 + Europe PMC + + + + + PMID:23895079 + Europe PMC + + + + + PMID:23909687 + Europe PMC + + + + + PMID:9060994 + Europe PMC + + + + + PMID:9886425 + Europe PMC + + + + + Reaxys:4122946 + Reaxys + + + + + nickel + IUPAC + + + + + + 28Ni + IUPAC + + + + + Ni + IUPAC + + + + + Ni + UniProt + + + + + Nickel + ChEBI + + + + + Raney alloy + ChemIDplus + + + + + niccolum + ChEBI + + + + + nickel + ChEBI + + + + + niquel + ChEBI + + + + + + + + + + 0 + P + InChI=1S/P + OAICVXFJPJFONN-UHFFFAOYSA-N + 30.97376 + 30.97376 + [P] + CHEBI:26080 + CHEBI:8168 + CAS:7723-14-0 + Gmelin:16235 + KEGG:C06262 + WebElements:P + phosphorus + chebi_ontology + 15P + P + Phosphor + Phosphorus + fosforo + phosphore + phosphorus + CHEBI:28659 + + phosphorus atom + + + + + CAS:7723-14-0 + ChemIDplus + + + + + CAS:7723-14-0 + KEGG COMPOUND + + + + + Gmelin:16235 + Gmelin + + + + + phosphorus + IUPAC + + + + + + 15P + IUPAC + + + + + P + IUPAC + + + + + P + KEGG_COMPOUND + + + + + Phosphor + ChEBI + + + + + Phosphorus + KEGG_COMPOUND + + + + + fosforo + ChEBI + + + + + phosphore + ChEBI + + + + + phosphorus + ChEBI + + + + + + + + + 0 + Mo + InChI=1S/Mo + ZOKXTWBITQBERF-UHFFFAOYSA-N + 95.94000 + 97.90541 + [Mo] + CHEBI:25369 + CHEBI:49750 + CHEBI:6968 + CAS:7439-98-7 + Gmelin:16205 + KEGG:C00150 + WebElements:Mo + molybdenum + chebi_ontology + 42Mo + Mo + Molybdaen + Molybdenum + molibdeno + molybdene + molybdenum + CHEBI:28685 + + molybdenum atom + + + + + CAS:7439-98-7 + ChemIDplus + + + + + CAS:7439-98-7 + KEGG COMPOUND + + + + + CAS:7439-98-7 + NIST Chemistry WebBook + + + + + Gmelin:16205 + Gmelin + + + + + molybdenum + IUPAC + + + + + + 42Mo + IUPAC + + + + + Mo + IUPAC + + + + + Mo + UniProt + + + + + Molybdaen + ChEBI + + + + + Molybdenum + KEGG_COMPOUND + + + + + molibdeno + ChEBI + + + + + molybdene + ChEBI + + + + + molybdenum + ChEBI + + + + + + + + + + 0 + Cu + InChI=1S/Cu + RYGMFSIKBFXOCR-UHFFFAOYSA-N + 63.54600 + 62.92960 + [Cu] + CHEBI:23376 + CHEBI:3874 + CAS:7440-50-8 + Gmelin:16269 + KEGG:C00070 + WebElements:Cu + copper + chebi_ontology + 29Cu + Copper + Cu + Kupfer + cobre + copper + cuivre + cuprum + CHEBI:28694 + + copper atom + + + + + CAS:7440-50-8 + ChemIDplus + + + + + CAS:7440-50-8 + KEGG COMPOUND + + + + + Gmelin:16269 + Gmelin + + + + + copper + IUPAC + + + + + + 29Cu + IUPAC + + + + + Copper + KEGG_COMPOUND + + + + + Cu + ChEBI + + + + + Cu + IUPAC + + + + + Kupfer + ChEBI + + + + + cobre + ChEBI + + + + + copper + ChEBI + + + + + cuivre + ChEBI + + + + + cuprum + IUPAC + + + + + + + + + + 0 + Al + InChI=1S/Al + XAGFODPZIPBFFR-UHFFFAOYSA-N + 26.98154 + 26.98154 + [Al] + CHEBI:22471 + CHEBI:2616 + CAS:7429-90-5 + DrugBank:DB01370 + Gmelin:16248 + KEGG:C06264 + WebElements:Al + aluminium + chebi_ontology + 13Al + Al + Aluminium + aluminio + aluminium + aluminum + CHEBI:28984 + + aluminium atom + + + + + CAS:7429-90-5 + ChemIDplus + + + + + CAS:7429-90-5 + KEGG COMPOUND + + + + + Gmelin:16248 + Gmelin + + + + + aluminium + IUPAC + + + + + + 13Al + IUPAC + + + + + Al + IUPAC + + + + + Al + KEGG_COMPOUND + + + + + Aluminium + ChEBI + + + + + Aluminium + KEGG_COMPOUND + + + + + aluminio + ChEBI + + + + + aluminium + ChEBI + + + + + aluminum + NIST_Chemistry_WebBook + + + + + + + + + The stable isotope of hydrogen with relative atomic mass 1.007825 and a natural abundance of 99.9885 atom percent (from Greek pirhoomegatauomicronsigma, first). + 0 + [1H] + InChI=1S/H/i1+0 + YZCKVEUIGOORGS-IGMARMGPSA-N + 1.008 + 1.00783 + [1H] + protium + chebi_ontology + (1)1H + (1)H + hydrogen-1 + protio + protium + CHEBI:29236 + + protium atom + + + + + protium + IUPAC + + + + + + (1)1H + IUPAC + + + + + (1)H + IUPAC + + + + + hydrogen-1 + ChEBI + + + + + protio + ChEBI + + + + + protium + ChEBI + + + + + + + + + The stable isotope of hydrogen with relative atomic mass 2.014102 and a natural abundance of 0.0115 atom percent (from Greek deltaepsilonupsilontauepsilonrhoomicronnu, second). + 0 + D + InChI=1S/H2/h1H/i1+1 + UFHFLCQGNIYNRP-OUBTZVSYSA-N + 2.014 + 2.01410 + [2H] + deuterium + chebi_ontology + (2)1H + (2)H + D + Deuterium + deuterio + deuterium + heavy hydrogen + hidrogeno pesado + hydrogen-2 + schwerer Wasserstoff + CHEBI:29237 + + deuterium atom + + + + + deuterium + IUPAC + + + + + + (2)1H + IUPAC + + + + + (2)H + IUPAC + + + + + D + IUPAC + + + + + Deuterium + ChEBI + + + + + deuterio + ChEBI + + + + + deuterium + ChEBI + + + + + heavy hydrogen + ChEBI + + + + + hidrogeno pesado + ChEBI + + + + + hydrogen-2 + ChEBI + + + + + schwerer Wasserstoff + ChEBI + + + + + + + + + The radioactive isotope of hydrogen with relative atomic mass 3.016049 and half-life of 12.33 years (from Greek taurhoiotatauomicronsigma, third). + 0 + T + InChI=1S/H2/h1H/i1+2 + UFHFLCQGNIYNRP-NJFSPNSNSA-N + 3.016 + 3.01605 + [3H] + tritium + chebi_ontology + (3)1H + (3)H + T + hydrogen-3 + tritio + tritium + ueberschwerer Wasserstoff + CHEBI:29238 + + tritium atom + + + + + tritium + IUPAC + + + + + + (3)1H + IUPAC + + + + + (3)H + IUPAC + + + + + T + IUPAC + + + + + hydrogen-3 + ChEBI + + + + + tritio + ChEBI + + + + + tritium + ChEBI + + + + + ueberschwerer Wasserstoff + ChEBI + + + + + + + + + 0 + Au + InChI=1S/Au + PCHJSUWPFVWCPO-UHFFFAOYSA-N + 196.96655 + 196.96657 + [Au] + CAS:7440-57-5 + WebElements:Au + gold + chebi_ontology + 79Au + Au + Gold + aurum + gold + or + oro + CHEBI:29287 + + gold atom + + + + + CAS:7440-57-5 + ChemIDplus + + + + + gold + IUPAC + + + + + + 79Au + IUPAC + + + + + Au + IUPAC + + + + + Gold + ChEBI + + + + + aurum + IUPAC + + + + + gold + ChEBI + + + + + or + ChEBI + + + + + oro + ChEBI + + + + + + + + + 0 + Li + InChI=1S/Li + WHXSMMKQMYFTQS-UHFFFAOYSA-N + 6.94100 + 7.01600 + [Li] + CAS:7439-93-2 + WebElements:Li + lithium + chebi_ontology + 3Li + Li + Lithium + lithium + litio + CHEBI:30145 + + lithium atom + + + + + CAS:7439-93-2 + NIST Chemistry WebBook + + + + + lithium + IUPAC + + + + + + 3Li + IUPAC + + + + + Li + IUPAC + + + + + Lithium + ChEBI + + + + + lithium + ChEBI + + + + + litio + ChEBI + + + + + + + + + + 0 + He + InChI=1S/He + SWQJXJOGLNCZEY-UHFFFAOYSA-N + 4.00260 + 4.00260 + [He] + CAS:7440-59-7 + Drug_Central:4262 + Gmelin:16294 + WebElements:He + helium + chebi_ontology + 2He + He + Helium + helio + helium + CHEBI:30217 + + helium atom + + + + + CAS:7440-59-7 + NIST Chemistry WebBook + + + + + Drug_Central:4262 + DrugCentral + + + + + Gmelin:16294 + Gmelin + + + + + helium + IUPAC + + + + + + 2He + IUPAC + + + + + He + IUPAC + + + + + Helium + ChEBI + + + + + helio + ChEBI + + + + + helium + ChEBI + + + + + + + + + The stable isotope of helium with relative atomic mass 3.016029. The least abundant (0.000137 atom percent) isotope of naturally occurring helium. + 0 + [3He] + InChI=1S/He/i1-1 + SWQJXJOGLNCZEY-BJUDXGSMSA-N + 3.016 + 3.01603 + [3He] + CAS:14762-55-1 + Gmelin:14208 + helium-3 + chebi_ontology + (3)2He + (3)He + (3He)helium + helium, isotope of mass 3 + helium-3 + CHEBI:30218 + + helium-3 atom + + + + + CAS:14762-55-1 + ChemIDplus + + + + + Gmelin:14208 + Gmelin + + + + + helium-3 + IUPAC + + + + + + (3)2He + IUPAC + + + + + (3)He + IUPAC + + + + + (3He)helium + ChemIDplus + + + + + helium, isotope of mass 3 + ChemIDplus + + + + + helium-3 + ChEBI + + + + + + + + + The stable isotope of helium with relative atomic mass 4.002603. The most abundant (99.99 atom percent) isotope of naturally occurring helium. + 0 + [4He] + InChI=1S/He/i1+0 + SWQJXJOGLNCZEY-IGMARMGPSA-N + 4.003 + 4.00260 + [4He] + Gmelin:14207 + helium-4 + chebi_ontology + (4)2He + (4)He + helium-4 + CHEBI:30219 + + helium-4 atom + + + + + Gmelin:14207 + Gmelin + + + + + helium-4 + IUPAC + + + + + + (4)2He + IUPAC + + + + + (4)He + IUPAC + + + + + helium-4 + ChEBI + + + + + + + + + 0 + At + InChI=1S/At + RYXHOMYVWAEKHL-UHFFFAOYSA-N + 210.00000 + 210.00000 + [At] + CAS:7440-68-8 + Gmelin:40440 + WebElements:At + astatine + chebi_ontology + 85At + Astat + At + astate + astatine + astato + CHEBI:30415 + + astatine atom + + + + + CAS:7440-68-8 + ChemIDplus + + + + + CAS:7440-68-8 + NIST Chemistry WebBook + + + + + Gmelin:40440 + Gmelin + + + + + astatine + IUPAC + + + + + + 85At + IUPAC + + + + + Astat + ChEBI + + + + + At + IUPAC + + + + + astate + ChEBI + + + + + astatine + ChEBI + + + + + astato + ChEBI + + + + + + + + + A metallic element first identified and named from the brilliant indigo (Latin indicum) blue line in its flame spectrum. + 0 + In + InChI=1S/In + APFVFJFRJDLVQX-UHFFFAOYSA-N + 114.81800 + 114.90388 + [In] + CAS:7440-74-6 + Gmelin:16297 + WebElements:In + indium + chebi_ontology + 49In + In + Indium + indio + indium + CHEBI:30430 + + indium atom + + + + + CAS:7440-74-6 + ChemIDplus + + + + + CAS:7440-74-6 + NIST Chemistry WebBook + + + + + Gmelin:16297 + Gmelin + + + + + indium + IUPAC + + + + + + 49In + IUPAC + + + + + In + IUPAC + + + + + Indium + ChEBI + + + + + indio + ChEBI + + + + + indium + ChEBI + + + + + + + + + A metallic element first identified and named from the brilliant green line in its flame spectrum (from Greek thetaalphalambdalambdaomicronsigma, a green shoot). + 0 + Tl + InChI=1S/Tl + BKVIYDNLLOSFOA-UHFFFAOYSA-N + 204.38330 + 204.97443 + [Tl] + CAS:7440-28-0 + Gmelin:16308 + WebElements:Tl + thallium + chebi_ontology + 81Tl + Tl + talio + CHEBI:30440 + + thallium + + + + + CAS:7440-28-0 + ChemIDplus + + + + + CAS:7440-28-0 + NIST Chemistry WebBook + + + + + Gmelin:16308 + Gmelin + + + + + thallium + IUPAC + + + + + + 81Tl + IUPAC + + + + + Tl + IUPAC + + + + + talio + ChEBI + + + + + + + + + + + 0 + Ge + InChI=1S/Ge + GNPVGFCGXDBREM-UHFFFAOYSA-N + 72.61000 + 73.92118 + [Ge] + CAS:7440-56-4 + WebElements:Ge + germanium + chebi_ontology + 32Ge + Ge + germanio + germanium + CHEBI:30441 + + germanium atom + + + + + CAS:7440-56-4 + ChemIDplus + + + + + CAS:7440-56-4 + NIST Chemistry WebBook + + + + + germanium + IUPAC + + + + + + 32Ge + IUPAC + + + + + Ge + IUPAC + + + + + germanio + ChEBI + + + + + germanium + ChEBI + + + + + + + + + + 0 + Te + InChI=1S/Te + PORWMNRCUJJQNO-UHFFFAOYSA-N + 127.60000 + 129.90622 + [Te] + CAS:13494-80-9 + Gmelin:16309 + WebElements:Te + tellurium + chebi_ontology + 52Te + Te + Tellur + tellure + tellurium + teluro + CHEBI:30452 + + tellurium atom + + + + + CAS:13494-80-9 + ChemIDplus + + + + + CAS:13494-80-9 + NIST Chemistry WebBook + + + + + Gmelin:16309 + Gmelin + + + + + tellurium + IUPAC + + + + + + 52Te + IUPAC + + + + + Te + IUPAC + + + + + Tellur + ChEBI + + + + + tellure + ChEBI + + + + + tellurium + ChEBI + + + + + teluro + ChEBI + + + + + + + + + + Alkaline earth metal atom with atomic number 4. + 0 + Be + InChI=1S/Be + ATBAMAFKBVZNFJ-UHFFFAOYSA-N + 9.01218 + 9.01218 + [Be] + CAS:7440-41-7 + Gmelin:16265 + PMID:10858219 + PMID:11897645 + PMID:14643414 + PMID:16951350 + PMID:18250483 + PMID:18768897 + PMID:24912188 + Reaxys:14617151 + WebElements:Be + beryllium + chebi_ontology + 4Be + Be + Beryllium + berilio + beryllium + CHEBI:30501 + + beryllium atom + + + + + CAS:7440-41-7 + ChemIDplus + + + + + CAS:7440-41-7 + NIST Chemistry WebBook + + + + + Gmelin:16265 + Gmelin + + + + + PMID:10858219 + Europe PMC + + + + + PMID:11897645 + Europe PMC + + + + + PMID:14643414 + Europe PMC + + + + + PMID:16951350 + Europe PMC + + + + + PMID:18250483 + Europe PMC + + + + + PMID:18768897 + Europe PMC + + + + + PMID:24912188 + Europe PMC + + + + + Reaxys:14617151 + Reaxys + + + + + beryllium + IUPAC + + + + + + 4Be + IUPAC + + + + + Be + IUPAC + + + + + Beryllium + ChEBI + + + + + berilio + ChEBI + + + + + beryllium + ChEBI + + + + + + + + + 0 + Ag + InChI=1S/Ag + BQCADISMDOOEFD-UHFFFAOYSA-N + 107.86820 + 106.90509 + [Ag] + CAS:7440-22-4 + WebElements:Ag + silver + chebi_ontology + 47Ag + Ag + Silber + argent + argentum + plata + silver + CHEBI:30512 + + silver atom + + + + + CAS:7440-22-4 + ChemIDplus + + + + + silver + IUPAC + + + + + + 47Ag + IUPAC + + + + + Ag + IUPAC + + + + + Silber + ChemIDplus + + + + + argent + ChEBI + + + + + argentum + IUPAC + + + + + plata + ChEBI + + + + + silver + ChEBI + + + + + + + + + + 0 + Sb + InChI=1S/Sb + WATWJIUSRGPENY-UHFFFAOYSA-N + 121.76000 + 120.90381 + [Sb] + WebElements:Sb + antimony + chebi_ontology + 51Sb + Antimon + Sb + antimoine + antimonio + antimony + stibium + CHEBI:30513 + + antimony atom + + + + + antimony + IUPAC + + + + + + 51Sb + IUPAC + + + + + Antimon + ChEBI + + + + + Sb + IUPAC + + + + + antimoine + ChEBI + + + + + antimonio + ChEBI + + + + + antimony + ChEBI + + + + + stibium + IUPAC + + + + + + + + + 0 + Cs + InChI=1S/Cs + TVFDJXOCXUVLDH-UHFFFAOYSA-N + 132.90545 + 132.90545 + [Cs] + WebElements:Cs + caesium + chebi_ontology + 55Cs + Caesium + Cs + Zaesium + caesium + cesio + cesium + CHEBI:30514 + + caesium atom + + + + + caesium + IUPAC + + + + + + 55Cs + IUPAC + + + + + Caesium + ChEBI + + + + + Cs + IUPAC + + + + + Zaesium + ChEBI + + + + + caesium + ChEBI + + + + + cesio + ChEBI + + + + + cesium + ChEBI + + + + + cesium + IUPAC + + + + + + + + + + 0 + Ru + InChI=1S/Ru + KJTLSVCANCCWHF-UHFFFAOYSA-N + 101.07000 + 101.90434 + [Ru] + CAS:7440-18-8 + WebElements:Ru + ruthenium + chebi_ontology + 44Ru + Ru + Ruthenium + rutenio + ruthenium + CHEBI:30682 + + ruthenium atom + + + + + CAS:7440-18-8 + ChemIDplus + + + + + CAS:7440-18-8 + NIST Chemistry WebBook + + + + + ruthenium + IUPAC + + + + + + 44Ru + IUPAC + + + + + Ru + IUPAC + + + + + Ruthenium + ChEBI + + + + + rutenio + ChEBI + + + + + ruthenium + ChEBI + + + + + + + + + + 0 + Os + InChI=1S/Os + SYQBFIAQOQZEGI-UHFFFAOYSA-N + 190.23000 + 191.96148 + [Os] + CAS:7440-04-2 + Gmelin:16234 + WebElements:Os + osmium + chebi_ontology + 76Os + Os + osmio + osmium + CHEBI:30687 + + osmium atom + + + + + CAS:7440-04-2 + ChemIDplus + + + + + CAS:7440-04-2 + NIST Chemistry WebBook + + + + + Gmelin:16234 + Gmelin + + + + + osmium + IUPAC + + + + + + 76Os + IUPAC + + + + + Os + IUPAC + + + + + osmio + ChEBI + + + + + osmium + ChEBI + + + + + + + + + 0 + Ba + InChI=1S/Ba + DSAJWYNOEDNPEQ-UHFFFAOYSA-N + 137.32700 + 137.90525 + [Ba] + WebElements:Ba + barium + chebi_ontology + 56Ba + Ba + Barium + bario + barium + baryum + CHEBI:32594 + + barium atom + + + + + barium + IUPAC + + + + + + 56Ba + IUPAC + + + + + Ba + IUPAC + + + + + Barium + ChEBI + + + + + bario + ChEBI + + + + + barium + ChEBI + + + + + baryum + ChEBI + + + + + + + + + + 0 + Eu + InChI=1S/Eu + OGPBJKLSAFTDLK-UHFFFAOYSA-N + 151.96400 + 152.92124 + [Eu] + CAS:7440-53-1 + Gmelin:16279 + WebElements:Eu + europium + chebi_ontology + 63Eu + Eu + europio + europium + CHEBI:32999 + + europium atom + + + + + CAS:7440-53-1 + ChemIDplus + + + + + Gmelin:16279 + Gmelin + + + + + europium + IUPAC + + + + + + 63Eu + IUPAC + + + + + Eu + IUPAC + + + + + europio + ChEBI + + + + + europium + ChEBI + + + + + + + + A chemical entity constituting the smallest component of an element having the chemical properties of the element. + CHEBI:22671 + CHEBI:23907 + atom + chebi_ontology + atome + atomo + atoms + atomus + element + elements + CHEBI:33250 + + atom + + + + + atom + IUPAC + + + + + + atome + IUPAC + + + + + atomo + IUPAC + + + + + atoms + ChEBI + + + + + atomus + ChEBI + + + + + element + ChEBI + + + + + elements + ChEBI + + + + + + + + + Any p-block element atom that is in group 15 of the periodic table: nitrogen, phosphorus, arsenic, antimony and bismuth. + pnictogens + chebi_ontology + group 15 elements + group V elements + nitrogenoideos + nitrogenoides + pnictogene + pnictogenes + CHEBI:33300 + + pnictogen + + + + + pnictogens + IUPAC + + + + + + group 15 elements + ChEBI + + + + + group V elements + ChEBI + + + + + nitrogenoideos + ChEBI + + + + + nitrogenoides + ChEBI + + + + + pnictogene + ChEBI + + + + + pnictogenes + ChEBI + + + + + + + + + + 0 + Bi + InChI=1S/Bi + JCXGWMGPZLAOME-UHFFFAOYSA-N + 208.98038 + 208.98040 + [Bi] + CAS:7440-69-9 + WebElements:Bi + bismuth + chebi_ontology + 83Bi + Bi + Bismut + Wismut + bismuth + bismuto + CHEBI:33301 + + bismuth atom + + + + + CAS:7440-69-9 + ChemIDplus + + + + + bismuth + IUPAC + + + + + + 83Bi + IUPAC + + + + + Bi + IUPAC + + + + + Bismut + ChEBI + + + + + Wismut + ChEBI + + + + + bismuth + ChEBI + + + + + bismuto + ChEBI + + + + + + + + + Any p-block element belonging to the group 16 family of the periodic table. + PMID:17084588 + chalcogen + chalcogens + chebi_ontology + Chalkogen + Chalkogene + anfigeno + anfigenos + calcogeno + calcogenos + chalcogene + chalcogenes + group 16 elements + group VI elements + CHEBI:33303 + + chalcogen + + + + + PMID:17084588 + Europe PMC + + + + + chalcogen + IUPAC + + + + + + chalcogens + IUPAC + + + + + + Chalkogen + ChEBI + + + + + Chalkogene + ChEBI + + + + + anfigeno + ChEBI + + + + + anfigenos + ChEBI + + + + + calcogeno + ChEBI + + + + + calcogenos + ChEBI + + + + + chalcogene + ChEBI + + + + + chalcogenes + ChEBI + + + + + group 16 elements + ChEBI + + + + + group VI elements + ChEBI + + + + + + + + + group 14 elements + chebi_ontology + carbon group element + carbon group elements + carbonoides + cristallogene + cristallogenes + group IV elements + CHEBI:33306 + + carbon group element atom + + + + + group 14 elements + IUPAC + + + + + + carbon group element + ChEBI + + + + + carbon group elements + ChEBI + + + + + carbonoides + ChEBI + + + + + cristallogene + ChEBI + + + + + cristallogenes + ChEBI + + + + + group IV elements + ChEBI + + + + + + + + + + noble gas + noble gases + chebi_ontology + Edelgas + Edelgase + gas noble + gases nobles + gaz noble + gaz nobles + group 18 elements + group VIII elements + inert gases + noble gas + rare gases + CHEBI:33309 + + noble gas atom + + + + + noble gas + IUPAC + + + + + + noble gases + IUPAC + + + + + + Edelgas + ChEBI + + + + + Edelgase + ChEBI + + + + + gas noble + ChEBI + + + + + gases nobles + ChEBI + + + + + gaz noble + ChEBI + + + + + gaz nobles + ChEBI + + + + + group 18 elements + IUPAC + + + + + group VIII elements + ChEBI + + + + + inert gases + ChEBI + + + + + noble gas + ChEBI + + + + + rare gases + ChEBI + + + + + + + + + + 0 + Ne + InChI=1S/Ne + GKAOGPIIYCISHV-UHFFFAOYSA-N + 20.17970 + 19.99244 + [Ne] + CAS:7440-01-9 + WebElements:Ne + neon + chebi_ontology + 10Ne + Ne + Neon + neon + CHEBI:33310 + + neon atom + + + + + CAS:7440-01-9 + ChemIDplus + + + + + neon + IUPAC + + + + + + 10Ne + IUPAC + + + + + Ne + ChEBI + + + + + Neon + ChEBI + + + + + neon + ChEBI + + + + + + + + + + A radioactive metallic element discovered in 1898 by Marie Sklodowska Curie and named after her home country, Poland (Latin Polonia). + 0 + Po + InChI=1S/Po + HZEBHPIOVYHPMT-UHFFFAOYSA-N + 209.00000 + 209.00000 + [Po] + CAS:7440-08-6 + Gmelin:40435 + WebElements:Po + polonium + chebi_ontology + 84Po + Po + polonio + polonium + CHEBI:33313 + + polonium atom + + + + + CAS:7440-08-6 + ChemIDplus + + + + + CAS:7440-08-6 + NIST Chemistry WebBook + + + + + Gmelin:40435 + Gmelin + + + + + polonium + IUPAC + + + + + + 84Po + IUPAC + + + + + Po + IUPAC + + + + + polonio + ChEBI + + + + + polonium + ChEBI + + + + + + + + + + 0 + Rn + InChI=1S/Rn + SYUHGPGVQRZVTB-UHFFFAOYSA-N + 222.00000 + 222.00000 + [Rn] + CAS:10043-92-2 + Gmelin:16242 + WebElements:Rn + radon + chebi_ontology + 86Rn + Rn + niton + radium emanation + radon + CHEBI:33314 + + radon atom + + + + + CAS:10043-92-2 + ChemIDplus + + + + + CAS:10043-92-2 + NIST Chemistry WebBook + + + + + Gmelin:16242 + Gmelin + + + + + radon + IUPAC + + + + + + 86Rn + IUPAC + + + + + Rn + IUPAC + + + + + niton + ChemIDplus + + + + + radium emanation + ChemIDplus + + + + + radon + ChEBI + + + + + + + + + group 13 elements + chebi_ontology + Element der Borgruppe + boron group element + boron group elements + group III elements + CHEBI:33317 + + boron group element atom + + + + + group 13 elements + IUPAC + + + + + + Element der Borgruppe + ChEBI + + + + + boron group element + ChEBI + + + + + boron group elements + ChEBI + + + + + group III elements + ChEBI + + + + + + + + + An atom belonging to one of the main groups (found in the s- and p- blocks) of the periodic table. + main group elements + chebi_ontology + Hauptgruppenelement + Hauptgruppenelemente + main group element + CHEBI:33318 + + main group element atom + + + + + main group elements + IUPAC + + + + + + Hauptgruppenelement + ChEBI + + + + + Hauptgruppenelemente + ChEBI + + + + + main group element + ChEBI + + + + + + + + + lanthanoids + chebi_ontology + Lanthanoid + Lanthanoide + Lanthanoidengruppe + Lanthanoidenreiche + Ln + lanthanide + lanthanides + lanthanoid + CHEBI:33319 + + lanthanoid atom + + + + + lanthanoids + IUPAC + + + + + + Lanthanoid + ChEBI + + + + + Lanthanoide + ChEBI + + + + + Lanthanoidengruppe + ChEBI + + + + + Lanthanoidenreiche + ChEBI + + + + + Ln + ChEBI + + + + + lanthanide + ChEBI + + + + + lanthanides + ChEBI + + + + + lanthanoid + ChEBI + + + + + + + + + actinoids + chebi_ontology + Actinoid + Actinoide + Actinoidenelemente + Actinoidengruppe + Aktinoide + Aktinoidenelemente + An + actinide + actinides + actinoid + CHEBI:33320 + + actinoid atom + + + + + actinoids + IUPAC + + + + + + Actinoid + ChEBI + + + + + Actinoide + ChEBI + + + + + Actinoidenelemente + ChEBI + + + + + Actinoidengruppe + ChEBI + + + + + Aktinoide + ChEBI + + + + + Aktinoidenelemente + ChEBI + + + + + An + ChEBI + + + + + actinide + ChEBI + + + + + actinides + ChEBI + + + + + actinoid + ChEBI + + + + + + + + + rare earth metals + chebi_ontology + rare earth metal + CHEBI:33321 + + rare earth metal atom + + + + + rare earth metals + IUPAC + + + + + + rare earth metal + ChEBI + + + + + + + + + 0 + Rb + InChI=1S/Rb + IGLNJRXAVVLDKE-UHFFFAOYSA-N + 85.46780 + 84.91179 + [Rb] + CAS:7440-17-7 + DrugBank:DB06749 + Gmelin:16244 + WebElements:Rb + rubidium + chebi_ontology + 37Rb + Rb + rubidio + rubidium + CHEBI:33322 + + rubidium atom + + + + + CAS:7440-17-7 + ChemIDplus + + + + + CAS:7440-17-7 + NIST Chemistry WebBook + + + + + Gmelin:16244 + Gmelin + + + + + rubidium + IUPAC + + + + + + 37Rb + IUPAC + + + + + Rb + IUPAC + + + + + rubidio + ChEBI + + + + + rubidium + ChEBI + + + + + + + + + 0 + Fr + InChI=1S/Fr + KLMCZVJOEAUDNE-UHFFFAOYSA-N + 223.00000 + 223.00000 + [Fr] + CAS:7440-73-5 + Gmelin:40458 + WebElements:Fr + francium + chebi_ontology + 87Fr + Fr + Franzium + francio + francium + CHEBI:33323 + + francium atom + + + + + CAS:7440-73-5 + ChemIDplus + + + + + CAS:7440-73-5 + NIST Chemistry WebBook + + + + + Gmelin:40458 + Gmelin + + + + + francium + IUPAC + + + + + + 87Fr + IUPAC + + + + + Fr + IUPAC + + + + + Franzium + ChEBI + + + + + francio + ChEBI + + + + + francium + ChEBI + + + + + + + + + 0 + Sr + InChI=1S/Sr + CIOAGBVUUVVLOB-UHFFFAOYSA-N + 87.62000 + 87.90561 + [Sr] + CAS:7440-24-6 + WebElements:Sr + strontium + chebi_ontology + 38Sr + Sr + estroncio + strontium + CHEBI:33324 + + strontium atom + + + + + CAS:7440-24-6 + ChemIDplus + + + + + CAS:7440-24-6 + NIST Chemistry WebBook + + + + + strontium + IUPAC + + + + + + 38Sr + IUPAC + + + + + Sr + IUPAC + + + + + estroncio + ChEBI + + + + + strontium + ChEBI + + + + + + + + + 0 + Ra + InChI=1S/Ra + HCWPIIXVSYCSAN-UHFFFAOYSA-N + 226.00000 + 226.00000 + [Ra] + CAS:7440-14-4 + WebElements:Ra + radium + chebi_ontology + 88Ra + Ra + radio + radium + CHEBI:33325 + + radium atom + + + + + CAS:7440-14-4 + ChemIDplus + + + + + CAS:7440-14-4 + NIST Chemistry WebBook + + + + + radium + IUPAC + + + + + + 88Ra + IUPAC + + + + + Ra + IUPAC + + + + + radio + ChEBI + + + + + radium + ChEBI + + + + + + + + + + + 0 + Sc + InChI=1S/Sc + SIXSYDAISGFNSX-UHFFFAOYSA-N + 44.95591 + 44.95591 + [Sc] + CAS:7440-20-2 + WebElements:Sc + scandium + chebi_ontology + 21Sc + Sc + Skandium + escandio + scandium + CHEBI:33330 + + scandium atom + + + + + CAS:7440-20-2 + ChemIDplus + + + + + CAS:7440-20-2 + NIST Chemistry WebBook + + + + + scandium + IUPAC + + + + + + 21Sc + IUPAC + + + + + Sc + IUPAC + + + + + Skandium + ChEBI + + + + + escandio + ChEBI + + + + + scandium + ChEBI + + + + + + + + + + + 0 + Y + InChI=1S/Y + VWQVUPCCIRVNHF-UHFFFAOYSA-N + 88.90585 + 88.90584 + [Y] + CAS:7440-65-5 + Gmelin:16319 + WebElements:Y + yttrium + chebi_ontology + 39Y + Y + ytrio + yttrium + CHEBI:33331 + + yttrium atom + + + + + CAS:7440-65-5 + ChemIDplus + + + + + CAS:7440-65-5 + NIST Chemistry WebBook + + + + + Gmelin:16319 + Gmelin + + + + + yttrium + IUPAC + + + + + + 39Y + IUPAC + + + + + Y + ChEBI + + + + + ytrio + ChEBI + + + + + yttrium + ChEBI + + + + + + + + + group 3 elements + chebi_ontology + scandium group element + scandium group elements + CHEBI:33335 + + scandium group element atom + + + + + group 3 elements + IUPAC + + + + + + scandium group element + ChEBI + + + + + scandium group elements + ChEBI + + + + + + + + + + + 0 + La + InChI=1S/La + FZLIPJUXYLNCLC-UHFFFAOYSA-N + 138.90550 + 138.90636 + [La] + CAS:7439-91-0 + Gmelin:16203 + WebElements:La + lanthanum + chebi_ontology + 57La + La + Lanthan + lantano + lanthane + lanthanum + CHEBI:33336 + + lanthanum atom + + + + + lanthanum + ChEBI + + + + + CAS:7439-91-0 + ChemIDplus + + + + + CAS:7439-91-0 + NIST Chemistry WebBook + + + + + Gmelin:16203 + Gmelin + + + + + lanthanum + IUPAC + + + + + + 57La + IUPAC + + + + + La + ChEBI + + + + + Lanthan + ChEBI + + + + + lantano + ChEBI + + + + + lanthane + ChEBI + + + + + + + + + + + 0 + Ac + InChI=1S/Ac + QQINRWTZWGJFDB-UHFFFAOYSA-N + 227.00000 + 227.00000 + [Ac] + CAS:7440-34-8 + WebElements:Ac + actinium + chebi_ontology + 89Ac + Ac + Aktinium + actinio + actinium + CHEBI:33337 + + actinium atom + + + + + CAS:7440-34-8 + ChemIDplus + + + + + CAS:7440-34-8 + NIST Chemistry WebBook + + + + + actinium + IUPAC + + + + + + 89Ac + IUPAC + + + + + Ac + IUPAC + + + + + Aktinium + ChEBI + + + + + actinio + ChEBI + + + + + actinium + ChEBI + + + + + + + + + group 12 elements + chebi_ontology + zinc group element + zinc group elements + CHEBI:33340 + + zinc group element atom + + + + + group 12 elements + IUPAC + + + + + + zinc group element + ChEBI + + + + + zinc group elements + ChEBI + + + + + + + + + 0 + Ti + InChI=1S/Ti + RTAQQCXQSZGOHL-UHFFFAOYSA-N + 47.86700 + 47.94794 + [Ti] + CAS:7440-32-6 + WebElements:Ti + titanium + chebi_ontology + 22Ti + Ti + Titan + titane + titanio + titanium + CHEBI:33341 + + titanium atom + + + + + CAS:7440-32-6 + ChemIDplus + + + + + CAS:7440-32-6 + NIST Chemistry WebBook + + + + + titanium + IUPAC + + + + + + 22Ti + IUPAC + + + + + Ti + IUPAC + + + + + Titan + ChEBI + + + + + titane + ChEBI + + + + + titanio + ChEBI + + + + + titanium + ChEBI + + + + + + + + + 0 + Zr + InChI=1S/Zr + QCWXUUIWCKQGHC-UHFFFAOYSA-N + 91.22400 + 89.90470 + [Zr] + CAS:7440-67-7 + WebElements:Zr + zirconium + chebi_ontology + 40Zr + Zirkonium + Zr + circonio + zirconio + zirconium + CHEBI:33342 + + zirconium atom + + + + + CAS:7440-67-7 + ChemIDplus + + + + + CAS:7440-67-7 + NIST Chemistry WebBook + + + + + zirconium + IUPAC + + + + + + 40Zr + IUPAC + + + + + Zirkonium + ChEBI + + + + + Zr + IUPAC + + + + + circonio + ChEBI + + + + + zirconio + ChEBI + + + + + zirconium + ChEBI + + + + + + + + + 0 + Hf + InChI=1S/Hf + VBJZVLUMGGDVMO-UHFFFAOYSA-N + 178.49000 + 179.94656 + [Hf] + CAS:7440-58-6 + WebElements:Hf + hafnium + chebi_ontology + 72Hf + Hf + hafnio + hafnium + CHEBI:33343 + + hafnium atom + + + + + CAS:7440-58-6 + ChemIDplus + + + + + CAS:7440-58-6 + NIST Chemistry WebBook + + + + + hafnium + IUPAC + + + + + + 72Hf + IUPAC + + + + + Hf + IUPAC + + + + + hafnio + ChEBI + + + + + hafnium + ChEBI + + + + + + + + + 0 + Nb + InChI=1S/Nb + GUCVJGMIXFAOAE-UHFFFAOYSA-N + 92.90638 + 92.90637 + [Nb] + CAS:7440-03-1 + WebElements:Nb + niobium + chebi_ontology + 41Nb + Nb + Niob + columbio + columbium + niobio + niobium + CHEBI:33344 + + niobium atom + + + + + CAS:7440-03-1 + ChemIDplus + + + + + CAS:7440-03-1 + NIST Chemistry WebBook + + + + + niobium + IUPAC + + + + + + 41Nb + IUPAC + + + + + Nb + IUPAC + + + + + Niob + ChEBI + + + + + columbio + ChEBI + + + + + columbium + NIST_Chemistry_WebBook + + + + + niobio + ChEBI + + + + + niobium + ChEBI + + + + + + + + + + group 4 elements + chebi_ontology + titanium group element + titanium group elements + CHEBI:33345 + + titanium group element atom + + + + + group 4 elements + IUPAC + + + + + + titanium group element + ChEBI + + + + + titanium group elements + ChEBI + + + + + + + + + 0 + Rf + InChI=1S/Rf + YGPLJIIQQIDVFJ-UHFFFAOYSA-N + 261.00000 + 267.00000 + [Rf] + WebElements:Rf + rutherfordium + chebi_ontology + 104Rf + Ku + Rf + Unq + kurchatovium + rutherfordio + rutherfordium + unnilquadium + CHEBI:33346 + + rutherfordium atom + + + + + rutherfordium + IUPAC + + + + + + 104Rf + IUPAC + + + + + Ku + ChEBI + + + + + Rf + IUPAC + + + + + Unq + IUPAC + + + + + kurchatovium + ChEBI + + + + + rutherfordio + ChEBI + + + + + rutherfordium + ChEBI + + + + + unnilquadium + IUPAC + + + + + + + + + + group 5 elements + chebi_ontology + vanadium group element + vanadium group elements + CHEBI:33347 + + vanadium group element atom + + + + + group 5 elements + IUPAC + + + + + + vanadium group element + ChEBI + + + + + vanadium group elements + ChEBI + + + + + + + + + 0 + Ta + InChI=1S/Ta + GUVRBAGPIYLISA-UHFFFAOYSA-N + 180.94790 + 180.94800 + [Ta] + CAS:7440-25-7 + WebElements:Ta + tantalum + chebi_ontology + 73Ta + Ta + Tantal + tantale + tantalo + tantalum + CHEBI:33348 + + tantalum atom + + + + + CAS:7440-25-7 + ChemIDplus + + + + + CAS:7440-25-7 + NIST Chemistry WebBook + + + + + tantalum + IUPAC + + + + + + 73Ta + IUPAC + + + + + Ta + IUPAC + + + + + Tantal + ChEBI + + + + + tantale + ChEBI + + + + + tantalo + ChEBI + + + + + tantalum + ChEBI + + + + + + + + + 0 + Db + 262.00000 + 270.00000 + [Db] + WebElements:Db + dubnium + chebi_ontology + 105Db + Db + Ha + Ns + Unp + dubnio + dubnium + hahnium + nielsbohrium + unnilpentium + CHEBI:33349 + + dubnium atom + + + + + dubnium + IUPAC + + + + + + 105Db + IUPAC + + + + + Db + IUPAC + + + + + Ha + ChEBI + + + + + Ns + ChEBI + + + + + Unp + IUPAC + + + + + dubnio + ChEBI + + + + + dubnium + ChEBI + + + + + hahnium + ChEBI + + + + + nielsbohrium + ChEBI + + + + + unnilpentium + IUPAC + + + + + + + + + + group 6 elements + chebi_ontology + chromium group element + chromium group elements + CHEBI:33350 + + chromium group element atom + + + + + group 6 elements + IUPAC + + + + + + chromium group element + ChEBI + + + + + chromium group elements + ChEBI + + + + + + + + + 0 + Sg + 263.00000 + 271.00000 + [Sg] + WebElements:Sg + seaborgium + chebi_ontology + 106Sg + Sg + Unh + seaborgio + seaborgium + unnilhexium + CHEBI:33351 + + seaborgium atom + + + + + seaborgium + IUPAC + + + + + + 106Sg + IUPAC + + + + + Sg + IUPAC + + + + + Unh + ChEBI + + + + + seaborgio + ChEBI + + + + + seaborgium + ChEBI + + + + + unnilhexium + IUPAC + + + + + + + + + + group 7 elements + chebi_ontology + manganese group element + manganese group elements + CHEBI:33352 + + manganese group element atom + + + + + group 7 elements + IUPAC + + + + + + manganese group element + ChEBI + + + + + manganese group elements + ChEBI + + + + + + + + + 0 + Tc + InChI=1S/Tc + GKLVYJBZJHMRIY-UHFFFAOYSA-N + 98.00000 + 97.00000 + [Tc] + CAS:7440-26-8 + Gmelin:16310 + WebElements:Tc + technetium + chebi_ontology + 43Tc + Tc + Technetium + technetium + tecnecio + CHEBI:33353 + + technetium atom + + + + + CAS:7440-26-8 + ChemIDplus + + + + + CAS:7440-26-8 + NIST Chemistry WebBook + + + + + Gmelin:16310 + Gmelin + + + + + technetium + IUPAC + + + + + + 43Tc + IUPAC + + + + + Tc + IUPAC + + + + + Technetium + ChEBI + + + + + technetium + ChEBI + + + + + tecnecio + ChEBI + + + + + + + + + 0 + Bh + 264.00000 + 270.00000 + [Bh] + WebElements:Bh + bohrium + chebi_ontology + 107Bh + Bh + Ns + Uns + bohrio + bohrium + nielsbohrium + unnilseptium + CHEBI:33355 + + bohrium atom + + + + + bohrium + IUPAC + + + + + + 107Bh + IUPAC + + + + + Bh + IUPAC + + + + + Ns + ChEBI + + + + + Uns + IUPAC + + + + + bohrio + ChEBI + + + + + bohrium + ChEBI + + + + + nielsbohrium + ChEBI + + + + + unnilseptium + IUPAC + + + + + + + + + + group 8 elements + chebi_ontology + iron group element + iron group elements + CHEBI:33356 + + iron group element atom + + + + + group 8 elements + IUPAC + + + + + + iron group element + ChEBI + + + + + iron group elements + ChEBI + + + + + + + + + 0 + Hs + 265.00000 + 277.00000 + [Hs] + WebElements:Hs + hassium + chebi_ontology + 108Hs + Ha + Hs + Uno + hahnium + hassio + hassium + unniloctium + CHEBI:33357 + + hassium atom + + + + + hassium + IUPAC + + + + + + 108Hs + IUPAC + + + + + Ha + ChEBI + + + + + Hs + IUPAC + + + + + Uno + IUPAC + + + + + hahnium + ChEBI + + + + + hassio + ChEBI + + + + + hassium + ChEBI + + + + + unniloctium + IUPAC + + + + + + + + + + group 9 elements + chebi_ontology + cobalt group element + cobalt group elements + CHEBI:33358 + + cobalt group element atom + + + + + group 9 elements + IUPAC + + + + + + cobalt group element + ChEBI + + + + + cobalt group elements + ChEBI + + + + + + + + + A cobalt group element atom of atomic number 45. + 0 + Rh + InChI=1S/Rh + MHOVAHRLVXNVSD-UHFFFAOYSA-N + 102.90550 + 102.90550 + [Rh] + CAS:7440-16-6 + PMID:2936374 + WebElements:Rh + Wikipedia:Rhodium + rhodium + chebi_ontology + 45Rh + Rh + rhodium + rodio + CHEBI:33359 + + rhodium atom + + + + + CAS:7440-16-6 + ChemIDplus + + + + + CAS:7440-16-6 + NIST Chemistry WebBook + + + + + PMID:2936374 + Europe PMC + + + + + rhodium + IUPAC + + + + + + 45Rh + IUPAC + + + + + Rh + ChEBI + + + + + rhodium + ChEBI + + + + + rodio + ChEBI + + + + + + + + + 0 + Mt + 0.00000 + 0.00000 + [Mt] + WebElements:Mt + meitnerium + chebi_ontology + 109Mt + Mt + Une + meitnerio + meitnerium + unnilennium + CHEBI:33361 + + meitnerium atom + + + + + meitnerium + IUPAC + + + + + + 109Mt + IUPAC + + + + + Mt + IUPAC + + + + + Une + IUPAC + + + + + meitnerio + ChEBI + + + + + meitnerium + ChEBI + + + + + unnilennium + IUPAC + + + + + + + + + + group 10 elements + chebi_ontology + nickel group element + nickel group elements + CHEBI:33362 + + nickel group element atom + + + + + group 10 elements + IUPAC + + + + + + nickel group element + ChEBI + + + + + nickel group elements + ChEBI + + + + + + + + + + + Chemical element (nickel group element atom) with atomic number 46. + 0 + Pd + InChI=1S/Pd + KDLHZDBZIXYQEI-UHFFFAOYSA-N + 106.42000 + 105.90348 + [Pd] + CAS:7440-05-3 + PMID:25097477 + Reaxys:4937491 + WebElements:Pd + Wikipedia:Palladium + palladium + chebi_ontology + 46Pd + Pd + paladio + CHEBI:33363 + + palladium + + + + + CAS:7440-05-3 + ChemIDplus + + + + + CAS:7440-05-3 + NIST Chemistry WebBook + + + + + PMID:25097477 + Europe PMC + + + + + Reaxys:4937491 + Reaxys + + + + + palladium + IUPAC + + + + + + 46Pd + IUPAC + + + + + Pd + IUPAC + + + + + paladio + ChEBI + + + + + + + + + + 0 + Pt + InChI=1S/Pt + BASFCYQUMIYNBI-UHFFFAOYSA-N + 195.078 + 194.96479 + [Pt] + CAS:7440-06-4 + WebElements:Pt + platinum + chebi_ontology + 78Pt + Platin + Pt + platine + platino + CHEBI:33364 + + platinum + + + + + CAS:7440-06-4 + ChemIDplus + + + + + CAS:7440-06-4 + NIST Chemistry WebBook + + + + + platinum + IUPAC + + + + + + 78Pt + IUPAC + + + + + Platin + ChEBI + + + + + Pt + IUPAC + + + + + platine + ChEBI + + + + + platino + ChEBI + + + + + + + + + chebi_ontology + PGM + Platinmetalle + Platinoide + platinoid + platinum group metal + platinum group metals + platinum metals + CHEBI:33365 + + platinum group metal atom + + + + + PGM + ChEBI + + + + + Platinmetalle + ChEBI + + + + + Platinoide + ChEBI + + + + + platinoid + ChEBI + + + + + platinum group metal + ChEBI + + + + + platinum group metals + ChEBI + + + + + platinum metals + ChEBI + + + + + + + + + + group 11 elements + chebi_ontology + coinage metals + copper group element + copper group elements + CHEBI:33366 + + copper group element atom + + + + + group 11 elements + IUPAC + + + + + + coinage metals + ChEBI + + + + + copper group element + ChEBI + + + + + copper group elements + ChEBI + + + + + + + + + 0 + Ds + InChI=1S/Ds + NCBMSFCPDGXTHD-UHFFFAOYSA-N + 0.00000 + 0.00000 + [Ds] + WebElements:Ds + darmstadtium + chebi_ontology + 110Ds + Ds + Uun + darmstadtio + ununnilium + CHEBI:33367 + + darmstadtium + + + + + darmstadtium + IUPAC + + + + + + 110Ds + IUPAC + + + + + Ds + IUPAC + + + + + Uun + IUPAC + + + + + darmstadtio + ChEBI + + + + + ununnilium + IUPAC + + + + + + + + + A copper group element atom with atomic number 111. The the ninth member of the 6d series of transition metals, it is an extremely radioactive, synthetic element. Average mass is around 281. + 0 + Rg + InChI=1S/Rg + LJROPTGWFUZRDB-UHFFFAOYSA-N + 0.000 + 0.00000 + [Rg] + WebElements:Rg + Wikipedia:Roentgenium + roentgenium + chebi_ontology + 111Rg + Rg + Roentgenium + Uuu + roentgenio + roentgenium + unununium + CHEBI:33368 + + roentgenium atom + + + + + roentgenium + IUPAC + + + + + + 111Rg + IUPAC + + + + + Rg + IUPAC + + + + + Roentgenium + ChEBI + + + + + Uuu + ChEBI + + + + + roentgenio + ChEBI + + + + + roentgenium + ChEBI + + + + + unununium + ChEBI + + + + + + + + + + 0 + Ce + InChI=1S/Ce + GWXLDORMOJMVQZ-UHFFFAOYSA-N + 140.11600 + 139.90544 + [Ce] + CAS:7440-45-1 + Gmelin:16275 + WebElements:Ce + cerium + chebi_ontology + 58Ce + Ce + Cer + Zer + cerio + CHEBI:33369 + + cerium + + + + + CAS:7440-45-1 + ChemIDplus + + + + + CAS:7440-45-1 + NIST Chemistry WebBook + + + + + Gmelin:16275 + Gmelin + + + + + cerium + ChEBI + + + + + cerium + IUPAC + + + + + + 58Ce + IUPAC + + + + + Ce + IUPAC + + + + + Cer + ChEBI + + + + + Zer + ChEBI + + + + + cerio + ChEBI + + + + + + + + + 0 + [99Tc] + InChI=1S/Tc/i1+1 + GKLVYJBZJHMRIY-OUBTZVSYSA-N + 98.906 + 98.90625 + [99Tc] + CAS:14133-76-7 + Gmelin:41657 + technetium-99 + chebi_ontology + (99)43Tc + (99)Tc + technetium, isotope of mass 99 + CHEBI:33371 + + technetium-99 + + + + + CAS:14133-76-7 + ChemIDplus + + + + + Gmelin:41657 + Gmelin + + + + + technetium-99 + IUPAC + + + + + + (99)43Tc + IUPAC + + + + + (99)Tc + IUPAC + + + + + technetium, isotope of mass 99 + ChemIDplus + + + + + + + + + + 0 + Nd + InChI=1S/Nd + QEFYFXOXNSNQGX-UHFFFAOYSA-N + 144.24000 + 141.90773 + [Nd] + CAS:7440-00-8 + Gmelin:16212 + WebElements:Nd + neodymium + chebi_ontology + 60Nd + Nd + Neodym + neodimio + neodyme + neodymium + CHEBI:33372 + + neodymium atom + + + + + CAS:7440-00-8 + ChemIDplus + + + + + CAS:7440-00-8 + NIST Chemistry WebBook + + + + + Gmelin:16212 + Gmelin + + + + + neodymium + IUPAC + + + + + + 60Nd + IUPAC + + + + + Nd + IUPAC + + + + + Neodym + ChEBI + + + + + neodimio + ChEBI + + + + + neodyme + ChEBI + + + + + neodymium + ChEBI + + + + + + + + + + 0 + Pm + InChI=1S/Pm + VQMWBBYLQSCNPO-UHFFFAOYSA-N + 145.00000 + 145.00000 + [Pm] + CAS:7440-12-2 + Gmelin:16237 + WebElements:Pm + promethium + chebi_ontology + 61Pm + Pm + Promethium + promethium + prometio + CHEBI:33373 + + promethium atom + + + + + CAS:7440-12-2 + ChemIDplus + + + + + CAS:7440-12-2 + NIST Chemistry WebBook + + + + + Gmelin:16237 + Gmelin + + + + + promethium + IUPAC + + + + + + 61Pm + IUPAC + + + + + Pm + IUPAC + + + + + Promethium + ChEBI + + + + + promethium + ChEBI + + + + + prometio + ChEBI + + + + + + + + + + 0 + Sm + InChI=1S/Sm + KZUNJOHGWZRPMI-UHFFFAOYSA-N + 150.36000 + 151.91974 + [Sm] + CAS:7440-19-9 + Gmelin:16301 + WebElements:Sm + samarium + chebi_ontology + 62Sm + Sm + samario + samarium + CHEBI:33374 + + samarium atom + + + + + CAS:7440-19-9 + ChemIDplus + + + + + CAS:7440-19-9 + NIST Chemistry WebBook + + + + + Gmelin:16301 + Gmelin + + + + + samarium + IUPAC + + + + + + 62Sm + IUPAC + + + + + Sm + IUPAC + + + + + samario + ChEBI + + + + + samarium + ChEBI + + + + + + + + + + 0 + Gd + InChI=1S/Gd + UIWYJDYFSGRHKR-UHFFFAOYSA-N + 157.25000 + 157.92411 + [Gd] + CAS:7440-54-2 + Gmelin:16286 + WebElements:Gd + gadolinium + chebi_ontology + 64Gd + Gd + gadolinio + gadolinium + CHEBI:33375 + + gadolinium atom + + + + + CAS:7440-54-2 + ChemIDplus + + + + + CAS:7440-54-2 + NIST Chemistry WebBook + + + + + Gmelin:16286 + Gmelin + + + + + gadolinium + IUPAC + + + + + + 64Gd + IUPAC + + + + + Gd + IUPAC + + + + + gadolinio + ChEBI + + + + + gadolinium + ChEBI + + + + + + + + + + 0 + Tb + InChI=1S/Tb + GZCRRIHWUXGPOV-UHFFFAOYSA-N + 158.92534 + 158.92535 + [Tb] + CAS:7440-27-9 + Gmelin:16311 + WebElements:Tb + terbium + chebi_ontology + 65Tb + Tb + terbio + terbium + CHEBI:33376 + + terbium atom + + + + + CAS:7440-27-9 + ChemIDplus + + + + + CAS:7440-27-9 + NIST Chemistry WebBook + + + + + Gmelin:16311 + Gmelin + + + + + terbium + IUPAC + + + + + + 65Tb + IUPAC + + + + + Tb + IUPAC + + + + + terbio + ChEBI + + + + + terbium + ChEBI + + + + + + + + + + 0 + Dy + InChI=1S/Dy + KBQHZAAAGSGFKK-UHFFFAOYSA-N + 162.50000 + 163.92918 + [Dy] + CAS:7429-91-6 + Gmelin:16278 + WebElements:Dy + dysprosium + chebi_ontology + 66Dy + Dy + disprosio + dysprosium + CHEBI:33377 + + dysprosium atom + + + + + CAS:7429-91-6 + ChemIDplus + + + + + CAS:7429-91-6 + NIST Chemistry WebBook + + + + + Gmelin:16278 + Gmelin + + + + + dysprosium + IUPAC + + + + + + 66Dy + IUPAC + + + + + Dy + IUPAC + + + + + disprosio + ChEBI + + + + + dysprosium + ChEBI + + + + + + + + + + 0 + Er + InChI=1S/Er + UYAHIZSMUZPPFV-UHFFFAOYSA-N + 167.26000 + 165.93030 + [Er] + CAS:7440-52-0 + Gmelin:16280 + WebElements:Er + erbium + chebi_ontology + 68Er + Er + erbio + CHEBI:33379 + + erbium + + + + + CAS:7440-52-0 + ChemIDplus + + + + + CAS:7440-52-0 + NIST Chemistry WebBook + + + + + Gmelin:16280 + Gmelin + + + + + erbium + IUPAC + + + + + + 68Er + IUPAC + + + + + Er + IUPAC + + + + + erbio + ChEBI + + + + + + + + + + 0 + Tm + InChI=1S/Tm + FRNOGLGSGLTDKL-UHFFFAOYSA-N + 168.93421 + 168.93422 + [Tm] + CAS:7440-30-4 + Gmelin:16307 + WebElements:Tm + thulium + chebi_ontology + 69Tm + Tm + thulium + tulio + CHEBI:33380 + + thulium atom + + + + + CAS:7440-30-4 + ChemIDplus + + + + + CAS:7440-30-4 + NIST Chemistry WebBook + + + + + Gmelin:16307 + Gmelin + + + + + thulium + IUPAC + + + + + + 69Tm + IUPAC + + + + + Tm + ChEBI + + + + + thulium + ChEBI + + + + + tulio + ChEBI + + + + + + + + + + 0 + Yb + InChI=1S/Yb + NAWDYIZEMPQZHO-UHFFFAOYSA-N + 173.04000 + 173.93887 + [Yb] + CAS:7440-64-4 + Gmelin:16320 + WebElements:Yb + ytterbium + chebi_ontology + 70Yb + Yb + yterbio + CHEBI:33381 + + ytterbium + + + + + CAS:7440-64-4 + ChemIDplus + + + + + CAS:7440-64-4 + NIST Chemistry WebBook + + + + + Gmelin:16320 + Gmelin + + + + + ytterbium + IUPAC + + + + + + 70Yb + IUPAC + + + + + Yb + IUPAC + + + + + yterbio + ChEBI + + + + + + + + + + 0 + Lu + InChI=1S/Lu + OHSVLFRHMCKCQY-UHFFFAOYSA-N + 174.96700 + 174.94078 + [Lu] + CAS:7439-94-3 + Gmelin:16202 + WebElements:Lu + lutetium + chebi_ontology + 71Lu + Cassiopeium + Lu + Lutetium + cassiopium + lutecio + lutecium + lutetium + CHEBI:33382 + + lutetium atom + + + + + CAS:7439-94-3 + ChemIDplus + + + + + CAS:7439-94-3 + NIST Chemistry WebBook + + + + + Gmelin:16202 + Gmelin + + + + + lutetium + IUPAC + + + + + + 71Lu + IUPAC + + + + + Cassiopeium + ChEBI + + + + + Lu + IUPAC + + + + + Lutetium + ChEBI + + + + + cassiopium + ChEBI + + + + + lutecio + ChEBI + + + + + lutecium + ChEBI + + + + + lutetium + ChEBI + + + + + + + + + + 0 + Th + InChI=1S/Th + ZSLUVFAKFWKJRC-UHFFFAOYSA-N + 232.03810 + 232.03806 + [Th] + CAS:7440-29-1 + KEGG:C19157 + WebElements:Th + thorium + chebi_ontology + 90Th + Th + torio + CHEBI:33385 + + thorium + + + + + CAS:7440-29-1 + ChemIDplus + + + + + CAS:7440-29-1 + KEGG COMPOUND + + + + + CAS:7440-29-1 + NIST Chemistry WebBook + + + + + thorium + IUPAC + + + + + + 90Th + IUPAC + + + + + Th + IUPAC + + + + + torio + ChEBI + + + + + + + + + + 0 + Pa + InChI=1S/Pa + XLROVYAPLOFLNU-UHFFFAOYSA-N + 231.03588 + 231.03589 + [Pa] + CAS:7440-13-3 + WebElements:Pa + protactinium + chebi_ontology + 91Pa + Pa + brevium + protactinio + protactinium + protoactinium + CHEBI:33386 + + protactinium atom + + + + + CAS:7440-13-3 + ChemIDplus + + + + + CAS:7440-13-3 + NIST Chemistry WebBook + + + + + protactinium + IUPAC + + + + + + 91Pa + IUPAC + + + + + Pa + IUPAC + + + + + brevium + ChEBI + + + + + protactinio + ChEBI + + + + + protactinium + ChEBI + + + + + protoactinium + NIST_Chemistry_WebBook + + + + + + + + + + 0 + Np + InChI=1S/Np + LFNLGNPSGWYGGD-UHFFFAOYSA-N + 237.00000 + 237.00000 + [Np] + CAS:7439-99-8 + WebElements:Np + neptunium + chebi_ontology + 93Np + Np + neptunio + neptunium + CHEBI:33387 + + neptunium atom + + + + + CAS:7439-99-8 + ChemIDplus + + + + + CAS:7439-99-8 + NIST Chemistry WebBook + + + + + neptunium + IUPAC + + + + + + 93Np + IUPAC + + + + + Np + IUPAC + + + + + neptunio + ChEBI + + + + + neptunium + ChEBI + + + + + + + + + + 0 + Pu + InChI=1S/Pu + OYEHPCDNVJXUIW-UHFFFAOYSA-N + 244.00000 + 244.00000 + [Pu] + CAS:7440-07-5 + KEGG:C19159 + WebElements:Pu + plutonium + chebi_ontology + 94Pu + Pu + plutonio + plutonium + CHEBI:33388 + + plutonium atom + + + + + CAS:7440-07-5 + ChemIDplus + + + + + CAS:7440-07-5 + KEGG COMPOUND + + + + + CAS:7440-07-5 + NIST Chemistry WebBook + + + + + plutonium + IUPAC + + + + + + 94Pu + IUPAC + + + + + Pu + ChEBI + + + + + plutonio + ChEBI + + + + + plutonium + ChEBI + + + + + + + + + + 0 + Am + InChI=1S/Am + LXQXZNRPTYVCNG-UHFFFAOYSA-N + 243.00000 + 243.00000 + [Am] + CAS:7440-35-9 + WebElements:Am + americium + chebi_ontology + 95Am + Am + Americium + Amerizium + americio + americium + CHEBI:33389 + + americium atom + + + + + CAS:7440-35-9 + ChemIDplus + + + + + CAS:7440-35-9 + NIST Chemistry WebBook + + + + + americium + IUPAC + + + + + + 95Am + IUPAC + + + + + Am + IUPAC + + + + + Americium + ChEBI + + + + + Amerizium + ChEBI + + + + + americio + ChEBI + + + + + americium + ChEBI + + + + + + + + + + 0 + Cm + InChI=1S/Cm + NIWWFAAXEMMFMS-UHFFFAOYSA-N + 247.00000 + 247.00000 + [Cm] + CAS:7440-51-9 + WebElements:Cm + curium + chebi_ontology + 96Cm + Cm + curio + curium + CHEBI:33390 + + curium atom + + + + + CAS:7440-51-9 + ChemIDplus + + + + + CAS:7440-51-9 + NIST Chemistry WebBook + + + + + curium + IUPAC + + + + + + 96Cm + IUPAC + + + + + Cm + IUPAC + + + + + curio + ChEBI + + + + + curium + ChEBI + + + + + + + + + + 0 + Bk + InChI=1S/Bk + PWVKJRSRVJTHTR-UHFFFAOYSA-N + 247.00000 + 247.00000 + [Bk] + CAS:7440-40-6 + WebElements:Bk + berkelium + chebi_ontology + 97Bk + Berkelium + Bk + berkelio + berkelium + CHEBI:33391 + + berkelium atom + + + + + CAS:7440-40-6 + ChemIDplus + + + + + CAS:7440-40-6 + NIST Chemistry WebBook + + + + + berkelium + IUPAC + + + + + + 97Bk + IUPAC + + + + + Berkelium + ChEBI + + + + + Bk + ChEBI + + + + + berkelio + ChEBI + + + + + berkelium + ChEBI + + + + + + + + + + 0 + Cf + InChI=1S/Cf + HGLDOAKPQXAFKI-UHFFFAOYSA-N + 251.00000 + 251.00000 + [Cf] + CAS:7440-71-3 + WebElements:Cf + californium + chebi_ontology + 98Cf + Cf + Kalifornium + californio + californium + CHEBI:33392 + + californium atom + + + + + CAS:7440-71-3 + ChemIDplus + + + + + CAS:7440-71-3 + NIST Chemistry WebBook + + + + + californium + IUPAC + + + + + + 98Cf + ChEBI + + + + + Cf + IUPAC + + + + + Kalifornium + ChEBI + + + + + californio + ChEBI + + + + + californium + ChEBI + + + + + + + + + + 0 + Es + InChI=1S/Es + CKBRQZNRCSJHFT-UHFFFAOYSA-N + 252.00000 + 252.00000 + [Es] + CAS:7429-92-7 + WebElements:Es + einsteinium + chebi_ontology + 99Es + Es + einsteinio + einsteinium + CHEBI:33393 + + einsteinium atom + + + + + CAS:7429-92-7 + ChemIDplus + + + + + CAS:7429-92-7 + NIST Chemistry WebBook + + + + + einsteinium + IUPAC + + + + + + 99Es + IUPAC + + + + + Es + IUPAC + + + + + einsteinio + ChEBI + + + + + einsteinium + ChEBI + + + + + + + + + + 0 + Fm + InChI=1S/Fm + MIORUQGGZCBUGO-UHFFFAOYSA-N + 257.00000 + 257.00000 + [Fm] + CAS:7440-72-4 + WebElements:Fm + fermium + chebi_ontology + 100Fm + Fm + fermio + CHEBI:33394 + + fermium + + + + + CAS:7440-72-4 + ChemIDplus + + + + + CAS:7440-72-4 + NIST Chemistry WebBook + + + + + fermium + IUPAC + + + + + + 100Fm + IUPAC + + + + + Fm + IUPAC + + + + + fermio + ChEBI + + + + + + + + + + 0 + Md + InChI=1S/Md + MQVSLOYRCXQRPM-UHFFFAOYSA-N + 258.00000 + 258.00000 + [Md] + CAS:7440-11-1 + WebElements:Md + mendelevium + chebi_ontology + 101Md + Md + Mendelevium + Unu + mendelevio + mendelevium + unnilunium + CHEBI:33395 + + mendelevium atom + + + + + CAS:7440-11-1 + ChemIDplus + + + + + CAS:7440-11-1 + NIST Chemistry WebBook + + + + + mendelevium + IUPAC + + + + + + 101Md + IUPAC + + + + + Md + IUPAC + + + + + Mendelevium + ChEBI + + + + + Unu + IUPAC + + + + + mendelevio + ChEBI + + + + + mendelevium + ChEBI + + + + + unnilunium + IUPAC + + + + + + + + + + 0 + No + InChI=1S/No + ORQBXQOJMQIAOY-UHFFFAOYSA-N + 259.00000 + 259.00000 + [No] + CAS:10028-14-5 + WebElements:No + Nobelium + nobelium + chebi_ontology + 102No + No + Unb + nobelio + unnilbium + CHEBI:33396 + + nobelium + + + + + CAS:10028-14-5 + ChemIDplus + + + + + CAS:10028-14-5 + NIST Chemistry WebBook + + + + + Nobelium + ChEBI + + + + + nobelium + ChEBI + + + + + nobelium + IUPAC + + + + + + 102No + IUPAC + + + + + No + IUPAC + + + + + Unb + IUPAC + + + + + nobelio + ChEBI + + + + + unnilbium + IUPAC + + + + + + + + + + 0 + Lr + InChI=1S/Lr + CNQCVBJFEGMYDW-UHFFFAOYSA-N + 262.00000 + 262.00000 + [Lr] + CAS:22537-19-5 + WebElements:Lr + lawrencium + chebi_ontology + 103Lr + Lr + Unt + laurencio + lawrencio + lawrencium + unniltrium + CHEBI:33397 + + lawrencium atom + + + + + CAS:22537-19-5 + ChemIDplus + + + + + lawrencium + IUPAC + + + + + + 103Lr + IUPAC + + + + + Lr + IUPAC + + + + + Unt + IUPAC + + + + + laurencio + ChEBI + + + + + lawrencio + ChEBI + + + + + lawrencium + ChEBI + + + + + unniltrium + IUPAC + + + + + + + + + 0 + [220Rn] + InChI=1S/Rn/i1-2 + SYUHGPGVQRZVTB-YPZZEJLDSA-N + 220.011 + 220.01138 + [220Rn] + CAS:22481-48-7 + Gmelin:297037 + radon-220 + chebi_ontology + (220)86Rn + (220)Rn + Tn + radon, isotope of mass 220 + radon-220 + thoron + CHEBI:33491 + + radon-220 atom + + + + + CAS:22481-48-7 + ChemIDplus + + + + + Gmelin:297037 + Gmelin + + + + + radon-220 + IUPAC + + + + + + (220)86Rn + IUPAC + + + + + (220)Rn + IUPAC + + + + + Tn + ChEBI + + + + + radon, isotope of mass 220 + ChemIDplus + + + + + radon-220 + ChEBI + + + + + thoron + ChemIDplus + + + + + + + + + 0 + [222Rn] + InChI=1S/Rn/i1+0 + SYUHGPGVQRZVTB-IGMARMGPSA-N + 222.018 + 222.01757 + [222Rn] + CAS:14859-67-7 + radon-222 + chebi_ontology + (222)86Rn + (222)Rn + radon, isotope of mass 222 + radon-222 + CHEBI:33492 + + radon-222 atom + + + + + CAS:14859-67-7 + ChemIDplus + + + + + radon-222 + IUPAC + + + + + + (222)86Rn + IUPAC + + + + + (222)Rn + IUPAC + + + + + radon, isotope of mass 222 + ChemIDplus + + + + + radon-222 + ChEBI + + + + + + + + + 0 + [219Rn] + InChI=1S/Rn/i1-3 + SYUHGPGVQRZVTB-OIOBTWANSA-N + 219.009 + 219.00947 + [219Rn] + CAS:14835-02-0 + Gmelin:297039 + radon-219 + chebi_ontology + (219)86Rn + (219)Rn + An + actinon + radon, isotope of mass 219 + radon-219 + CHEBI:33493 + + radon-219 atom + + + + + CAS:14835-02-0 + ChemIDplus + + + + + Gmelin:297039 + Gmelin + + + + + radon-219 + IUPAC + + + + + + (219)86Rn + IUPAC + + + + + (219)Rn + IUPAC + + + + + An + ChEBI + + + + + actinon + ChEBI + + + + + radon, isotope of mass 219 + ChemIDplus + + + + + radon-219 + ChEBI + + + + + + + + + A zinc group element atom with a symbol Cn and atomic number 112. All its isotopes are intensely radioactive. Prior to its discovery, it had the placeholder name ununbium (in accordance with IUPAC recommendations). Following its discovery (in Darmstadt, 1996) and subsequent confirmation, the name copernicium was adopted in 2010. + 0 + Cn + InChI=1S/Cn + NOTIIDSZELDPOP-UHFFFAOYSA-N + NaN + 0.00000 + [Cn] + Wikipedia:Copernicium + copernicium + chebi_ontology + 112Cn + 112Cp + 112Uub + Cn + Uub + ununbium + CHEBI:33517 + + copernicium atom + + + + + copernicium + IUPAC + + + + + + 112Cn + ChEBI + + + + + 112Cp + IUPAC + + + + + 112Uub + IUPAC + + + + + Cn + IUPAC + + + + + Uub + IUPAC + + + + + ununbium + ChEBI + + + + + ununbium + IUPAC + + + + + + + + + An atom of an element that exhibits typical metallic properties, being typically shiny, with high electrical and thermal conductivity. + CHEBI:25217 + CHEBI:6788 + KEGG:C00050 + PMID:21784043 + Wikipedia:Metal + chebi_ontology + elemental metal + elemental metals + metal element + metal elements + metals + CHEBI:33521 + + metal atom + + + + + PMID:21784043 + Europe PMC + + + + + elemental metal + ChEBI + + + + + elemental metals + ChEBI + + + + + metal element + ChEBI + + + + + metal elements + ChEBI + + + + + metals + ChEBI + + + + + + + + + chebi_ontology + s-block element + s-block elements + CHEBI:33559 + + s-block element atom + + + + + s-block element + ChEBI + + + + + s-block elements + ChEBI + + + + + + + + + Any main group element atom belonging to the p-block of the periodic table. + chebi_ontology + p-block element + p-block elements + CHEBI:33560 + + p-block element atom + + + + + p-block element + ChEBI + + + + + p-block elements + ChEBI + + + + + + + + + + chebi_ontology + d-block element + d-block elements + CHEBI:33561 + + d-block element atom + + + + + d-block element + ChEBI + + + + + d-block elements + ChEBI + + + + + + + + + chebi_ontology + f-block element + f-block elements + CHEBI:33562 + + f-block element atom + + + + + f-block element + ChEBI + + + + + f-block elements + ChEBI + + + + + + + + + The stable isotope of oxygen with relative atomic mass 17.999160 and 0.205 atom percent natural abundance. + 0 + [18O] + InChI=1S/O/i1+2 + QVGXLLKOCUKJST-NJFSPNSNSA-N + 17.999 + 17.99916 + [18O] + CAS:14797-71-8 + Gmelin:17562 + oxygen-18 + chebi_ontology + (18)8O + (18)O + heavy oxygen + oxygen, isotope of mass 18 + oxygen-18 + schwerer Sauerstoff + CHEBI:33815 + + oxygen-18 atom + + + + + CAS:14797-71-8 + ChemIDplus + + + + + Gmelin:17562 + Gmelin + + + + + oxygen-18 + IUPAC + + + + + + (18)8O + IUPAC + + + + + (18)O + IUPAC + + + + + heavy oxygen + ChEBI + + + + + oxygen, isotope of mass 18 + ChemIDplus + + + + + oxygen-18 + ChEBI + + + + + schwerer Sauerstoff + ChEBI + + + + + + + + + The stable isotope of oxygen with relative atomic mass 15.994914. The most abundant (99.76 atom percent) isotope of naturally occurring oxygen. + 0 + [16O] + InChI=1S/O/i1+0 + QVGXLLKOCUKJST-IGMARMGPSA-N + 15.995 + 15.99491 + [16O] + Gmelin:17560 + oxygen-16 + chebi_ontology + (16)8O + (16)O + oxygen-16 + CHEBI:33818 + + oxygen-16 atom + + + + + Gmelin:17560 + Gmelin + + + + + oxygen-16 + IUPAC + + + + + + (16)8O + IUPAC + + + + + (16)O + IUPAC + + + + + oxygen-16 + ChEBI + + + + + + + + + The stable isotope of oxygen with relative atomic mass 16.999131. The least abundant (0.038 atom percent) isotope of naturally occurring oxygen. + 0 + [17O] + InChI=1S/O/i1+1 + QVGXLLKOCUKJST-OUBTZVSYSA-N + 16.999 + 16.99913 + [17O] + CAS:13968-48-4 + Gmelin:17561 + oxygen-17 + chebi_ontology + (17)8O + (17)O + oxygen, isotope of mass 17 + oxygen-17 + CHEBI:33819 + + oxygen-17 atom + + + + + CAS:13968-48-4 + ChemIDplus + + + + + Gmelin:17561 + Gmelin + + + + + oxygen-17 + IUPAC + + + + + + (17)8O + IUPAC + + + + + (17)O + IUPAC + + + + + oxygen, isotope of mass 17 + ChemIDplus + + + + + oxygen-17 + ChEBI + + + + + + + + + 0 + [14C] + InChI=1S/C/i1+2 + OKTJSMMVPCPJKN-NJFSPNSNSA-N + 14.003 + 14.00324 + [14C] + CAS:14762-75-5 + Wikipedia:Carbon-14 + carbon-14 + chebi_ontology + (14)6C + (14)C + carbon, isotope of mass 14 + carbon-14 + CHEBI:36927 + + carbon-14 atom + + + + + CAS:14762-75-5 + ChemIDplus + + + + + carbon-14 + IUPAC + + + + + + (14)6C + IUPAC + + + + + (14)C + IUPAC + + + + + carbon, isotope of mass 14 + ChemIDplus + + + + + carbon-14 + ChEBI + + + + + + + + + 0 + [13C] + InChI=1S/C/i1+1 + OKTJSMMVPCPJKN-OUBTZVSYSA-N + 13.003 + 13.00335 + [13C] + CAS:14762-74-4 + carbon-13 + carbon-13 atom + chebi_ontology + (13)6C + (13)C + carbon, isotope of mass 13 + carbon-13 + CHEBI:36928 + + carbon-13 atom + + + + + CAS:14762-74-4 + ChemIDplus + + + + + carbon-13 + IUPAC + + + + + + carbon-13 atom + ChemIDplus + + + + + (13)6C + IUPAC + + + + + (13)C + IUPAC + + + + + carbon, isotope of mass 13 + ChemIDplus + + + + + carbon-13 + ChEBI + + + + + + + + + 0 + [11C] + InChI=1S/C/i1-1 + OKTJSMMVPCPJKN-BJUDXGSMSA-N + 11.011 + 11.01143 + [11C] + CAS:14333-33-6 + carbon-11 + chebi_ontology + (11)6C + (11)C + carbon, isotope of mass 11 + carbon-11 + CHEBI:36929 + + carbon-11 atom + + + + + CAS:14333-33-6 + ChemIDplus + + + + + carbon-11 + IUPAC + + + + + + (11)6C + IUPAC + + + + + (11)C + IUPAC + + + + + carbon, isotope of mass 11 + ChemIDplus + + + + + carbon-11 + ChEBI + + + + + + + + + 0 + [10C] + InChI=1S/C/i1-2 + OKTJSMMVPCPJKN-YPZZEJLDSA-N + 10.017 + 10.01685 + [10C] + CAS:15578-68-4 + carbon-10 + chebi_ontology + (10)6C + (10)C + carbon, isotope of mass 10 + carbon-10 + CHEBI:36930 + + carbon-10 atom + + + + + CAS:15578-68-4 + ChemIDplus + + + + + carbon-10 + IUPAC + + + + + + (10)6C + IUPAC + + + + + (10)C + IUPAC + + + + + carbon, isotope of mass 10 + ChemIDplus + + + + + carbon-10 + ChEBI + + + + + + + + + 0 + [12C] + InChI=1S/C/i1+0 + OKTJSMMVPCPJKN-IGMARMGPSA-N + 12.000 + 12.00000 + [12C] + carbon-12 + chebi_ontology + (12)6C + (12)C + carbon-12 + CHEBI:36931 + + carbon-12 atom + + + + + carbon-12 + IUPAC + + + + + + (12)6C + IUPAC + + + + + (12)C + IUPAC + + + + + carbon-12 + ChEBI + + + + + + + + + The radioactive isotope of oxygen with relative atomic mass 15.003065. The longest-lived oxygen radionuclide with half-life of 122.2 s. + 0 + [15O] + InChI=1S/O/i1-1 + QVGXLLKOCUKJST-BJUDXGSMSA-N + 15.003 + 15.00307 + [15O] + CAS:13982-43-9 + Gmelin:316575 + oxygen-15 + chebi_ontology + (15)8O + (15)O + oxygen, isotope of mass 15 + oxygen-15 + CHEBI:36932 + + oxygen-15 atom + + + + + CAS:13982-43-9 + ChemIDplus + + + + + Gmelin:316575 + Gmelin + + + + + oxygen-15 + IUPAC + + + + + + (15)8O + IUPAC + + + + + (15)O + IUPAC + + + + + oxygen, isotope of mass 15 + ChemIDplus + + + + + oxygen-15 + ChEBI + + + + + + + + + 0 + [19O] + InChI=1S/O/i1+3 + QVGXLLKOCUKJST-AKLPVKDBSA-N + 19.004 + 19.00358 + [19O] + CAS:13982-18-8 + oxygen-19 + chebi_ontology + (19)8O + (19)O + oxygen-19 + CHEBI:36933 + + oxygen-19 atom + + + + + CAS:13982-18-8 + ChemIDplus + + + + + oxygen-19 + IUPAC + + + + + + (19)8O + IUPAC + + + + + (19)O + IUPAC + + + + + oxygen-19 + ChEBI + + + + + + + + + The stable isotope of nitrogen with relative atomic mass 15.000109. The least abundant (0.368 atom percent) isotope of naturally occurring nitrogen. + 0 + N + 14.007 + 14.00307 + CAS:14390-96-6 + nitrogen-15 + chebi_ontology + (15)7N + (15)N + nitrogen, isotope of mass 15 + nitrogen-15 + CHEBI:36934 + + nitrogen-15 atom + + + + + CAS:14390-96-6 + ChemIDplus + + + + + nitrogen-15 + IUPAC + + + + + + (15)7N + IUPAC + + + + + (15)N + IUPAC + + + + + nitrogen, isotope of mass 15 + ChemIDplus + + + + + nitrogen-15 + ChEBI + + + + + + + + + The radioactive isotope of nitrogen with relative atomic mass 13.0057386. The longest-lived nitrogen radionuclide with half-life of 9.965 min. + 0 + N + 14.007 + 14.00307 + CAS:13981-22-1 + nitrogen-13 + chebi_ontology + (13)7N + (13)N + nitrogen, isotope of mass 13 + nitrogen-13 + CHEBI:36935 + + nitrogen-13 atom + + + + + CAS:13981-22-1 + ChemIDplus + + + + + nitrogen-13 + IUPAC + + + + + + (13)7N + IUPAC + + + + + (13)N + IUPAC + + + + + nitrogen, isotope of mass 13 + ChemIDplus + + + + + nitrogen-13 + ChEBI + + + + + + + + + 0 + N + 14.007 + 14.00307 + CAS:13981-62-9 + nitrogen-16 + chebi_ontology + (16)7N + (16)N + nitrogen, isotope of mass 16 + nitrogen-16 + CHEBI:36936 + + nitrogen-16 atom + + + + + CAS:13981-62-9 + ChemIDplus + + + + + nitrogen-16 + IUPAC + + + + + + (16)7N + IUPAC + + + + + (16)N + IUPAC + + + + + nitrogen, isotope of mass 16 + ChemIDplus + + + + + nitrogen-16 + ChEBI + + + + + + + + + 0 + N + 14.007 + 14.00307 + CAS:14914-35-3 + nitrogen-17 + chebi_ontology + (17)7N + (17)N + nitrogen-17 + CHEBI:36937 + + nitrogen-17 atom + + + + + CAS:14914-35-3 + ChemIDplus + + + + + nitrogen-17 + IUPAC + + + + + + (17)7N + IUPAC + + + + + (17)N + ChEBI + + + + + nitrogen-17 + ChEBI + + + + + + + + + The stable isotope of nitrogen with relative atomic mass 14.003074. The most abundant (99.63 atom percent) isotope of naturally occurring nitrogen. + 0 + N + 14.007 + 14.00307 + nitrogen-14 + chebi_ontology + (14)7N + (14)N + nitrogen-14 + CHEBI:36938 + + nitrogen-14 atom + + + + + nitrogen-14 + IUPAC + + + + + + (14)7N + IUPAC + + + + + (14)N + IUPAC + + + + + nitrogen-14 + ChEBI + + + + + + + + + The radioactive isotope of fluorine with relative atomic mass 18.000938. The longest-lived fluorine radionuclide with half-life of 109.77 min. + 0 + [18F] + InChI=1S/F/i1-1 + YCKRFDGAMUMZLT-BJUDXGSMSA-N + 18.001 + 18.00094 + [18F] + CAS:13981-56-1 + DrugBank:DB13134 + Wikipedia:Fluorine-18 + fluorine-18 + chebi_ontology + (18)9F + (18)F + fluorine, isotope of mass 18 + fluorine-18 + CHEBI:36939 + + fluorine-18 atom + + + + + CAS:13981-56-1 + ChemIDplus + + + + + fluorine-18 + IUPAC + + + + + + (18)9F + IUPAC + + + + + (18)F + IUPAC + + + + + fluorine, isotope of mass 18 + ChemIDplus + + + + + fluorine-18 + ChEBI + + + + + + + + + The stable isotope of fluorine with relative atomic mass 18.998403 and nuclear spin (1)/2. + 0 + [19F] + InChI=1S/F/i1+0 + YCKRFDGAMUMZLT-IGMARMGPSA-N + 18.998 + 18.99840 + [19F] + fluorine-19 + chebi_ontology + (19)9F + (19)F + fluorine-19 + CHEBI:36940 + + fluorine-19 atom + + + + + fluorine-19 + IUPAC + + + + + + (19)9F + IUPAC + + + + + (19)F + ChEBI + + + + + fluorine-19 + ChEBI + + + + + + + + + The radioactive isotope of helium with relative atomic mass 6.01889 and half-life of 806.7 ms. + 0 + [6He] + InChI=1S/He/i1+2 + SWQJXJOGLNCZEY-NJFSPNSNSA-N + 6.019 + 6.01889 + [6He] + helium-6 + chebi_ontology + (6)2He + (6)He + helium-6 + CHEBI:37003 + + helium-6 atom + + + + + helium-6 + IUPAC + + + + + + (6)2He + IUPAC + + + + + (6)He + IUPAC + + + + + helium-6 + ChEBI + + + + + + + + + The radioactive isotope of helium with relative atomic mass 8.03392 and half-life of 119.0 ms. + 0 + [8He] + InChI=1S/He/i1+4 + SWQJXJOGLNCZEY-RNFDNDRNSA-N + 8.034 + 8.03392 + [8He] + helium-8 + chebi_ontology + (8)2He + (8)He + helium-8 + CHEBI:37004 + + helium-8 atom + + + + + helium-8 + IUPAC + + + + + + (8)2He + IUPAC + + + + + (8)He + IUPAC + + + + + helium-8 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 209.98286 and half-life of 138.376 days; the only naturally occurring isotope of polonium. + 0 + [210Po] + InChI=1S/Po/i1+1 + HZEBHPIOVYHPMT-OUBTZVSYSA-N + 209.983 + 209.98286 + [210Po] + CAS:13981-52-7 + Gmelin:76756 + polonium-210 + chebi_ontology + (210)84Po + (210)Po + polonium, isotope of mass 210 + polonium-210 + CHEBI:37340 + + polonium-210 atom + + + + + CAS:13981-52-7 + ChemIDplus + + + + + Gmelin:76756 + Gmelin + + + + + polonium-210 + IUPAC + + + + + + (210)84Po + IUPAC + + + + + (210)Po + IUPAC + + + + + polonium, isotope of mass 210 + ChemIDplus + + + + + polonium-210 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 210.986637 and half-life of 0.516 s. + 0 + [211Po] + InChI=1S/Po/i1+2 + HZEBHPIOVYHPMT-NJFSPNSNSA-N + 210.987 + 210.98664 + [211Po] + CAS:15735-83-8 + Gmelin:41683 + polonium-211 + chebi_ontology + (211)84Po + (211)Po + polonium, isotope of mass 211 + polonium-211 + CHEBI:37341 + + polonium-211 atom + + + + + CAS:15735-83-8 + ChemIDplus + + + + + Gmelin:41683 + Gmelin + + + + + polonium-211 + IUPAC + + + + + + (211)84Po + IUPAC + + + + + (211)Po + IUPAC + + + + + polonium, isotope of mass 211 + ChemIDplus + + + + + polonium-211 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 211.988852 and half-life of 0.299 mus. + 0 + [212Po] + InChI=1S/Po/i1+3 + HZEBHPIOVYHPMT-AKLPVKDBSA-N + 211.989 + 211.98885 + [212Po] + CAS:15389-34-1 + Gmelin:41677 + polonium-212 + chebi_ontology + (212)84Po + (212)Po + polonium, isotope of mass 212 + polonium-212 + CHEBI:37342 + + polonium-212 atom + + + + + CAS:15389-34-1 + ChemIDplus + + + + + Gmelin:41677 + Gmelin + + + + + polonium-212 + IUPAC + + + + + + (212)84Po + IUPAC + + + + + (212)Po + IUPAC + + + + + polonium, isotope of mass 212 + ChemIDplus + + + + + polonium-212 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 212.9928425 and half-life of 4.2 mus. + 0 + [213Po] + InChI=1S/Po/i1+4 + HZEBHPIOVYHPMT-RNFDNDRNSA-N + 212.993 + 212.99284 + [213Po] + CAS:15756-57-7 + polonium-213 + chebi_ontology + (213)84Po + (213)Po + polonium, isotope of mass 213 + polonium-213 + CHEBI:37343 + + polonium-213 atom + + + + + CAS:15756-57-7 + ChemIDplus + + + + + polonium-213 + IUPAC + + + + + + (213)84Po + IUPAC + + + + + (213)Po + IUPAC + + + + + polonium, isotope of mass 213 + ChemIDplus + + + + + polonium-213 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 213.995186 and half-life of 164.3 mus. + 0 + [214Po] + InChI=1S/Po/i1+5 + HZEBHPIOVYHPMT-BKFZFHPZSA-N + 213.995 + 213.99519 + [214Po] + CAS:15735-67-8 + Gmelin:41679 + polonium-214 + chebi_ontology + (214)84Po + (214)Po + polonium, isotope of mass 214 + polonium-214 + CHEBI:37344 + + polonium-214 atom + + + + + CAS:15735-67-8 + ChemIDplus + + + + + Gmelin:41679 + Gmelin + + + + + polonium-214 + IUPAC + + + + + + (214)84Po + IUPAC + + + + + (214)Po + IUPAC + + + + + polonium, isotope of mass 214 + ChemIDplus + + + + + polonium-214 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 214.999415 and half-life of 1.781 ms. + 0 + [215Po] + InChI=1S/Po/i1+6 + HZEBHPIOVYHPMT-LZFNBGRKSA-N + 214.999 + 214.99941 + [215Po] + CAS:15706-52-2 + Gmelin:41680 + polonium-215 + chebi_ontology + (215)84Po + (215)Po + polonium, isotope of mass 215 + polonium-215 + CHEBI:37345 + + polonium-215 atom + + + + + CAS:15706-52-2 + ChemIDplus + + + + + Gmelin:41680 + Gmelin + + + + + polonium-215 + IUPAC + + + + + + (215)84Po + IUPAC + + + + + (215)Po + IUPAC + + + + + polonium, isotope of mass 215 + ChemIDplus + + + + + polonium-215 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 216.001905 and half-life of 0.145 s. + 0 + [216Po] + InChI=1S/Po/i1+7 + HZEBHPIOVYHPMT-RKEGKUSMSA-N + 216.002 + 216.00191 + [216Po] + CAS:15756-58-8 + Gmelin:41684 + polonium-216 + chebi_ontology + (216)84Po + (216)Po + polonium, isotope of mass 216 + polonium-216 + CHEBI:37346 + + polonium-216 atom + + + + + CAS:15756-58-8 + ChemIDplus + + + + + Gmelin:41684 + Gmelin + + + + + polonium-216 + IUPAC + + + + + + (216)84Po + IUPAC + + + + + (216)Po + IUPAC + + + + + polonium, isotope of mass 216 + ChemIDplus + + + + + polonium-216 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 217.006253 and half-life of < 10 s. + 0 + [217Po] + InChI=1S/Po/i1+8 + HZEBHPIOVYHPMT-CONNIKPHSA-N + 217.006 + 217.00625 + [217Po] + polonium-217 + chebi_ontology + (217)84Po + (217)Po + polonium-217 + CHEBI:37347 + + polonium-217 atom + + + + + polonium-217 + IUPAC + + + + + + (217)84Po + IUPAC + + + + + (217)Po + IUPAC + + + + + polonium-217 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 218.008966 and half-life of 3.10 min. + 0 + [218Po] + InChI=1S/Po/i1+9 + HZEBHPIOVYHPMT-KUYOKYOWSA-N + 218.009 + 218.00897 + [218Po] + CAS:15422-74-9 + Gmelin:41685 + polonium-218 + chebi_ontology + (218)84Po + (218)Po + polonium, isotope of mass 218 + polonium-218 + CHEBI:37348 + + polonium-218 atom + + + + + CAS:15422-74-9 + ChemIDplus + + + + + Gmelin:41685 + Gmelin + + + + + polonium-218 + IUPAC + + + + + + (218)84Po + IUPAC + + + + + (218)Po + IUPAC + + + + + polonium, isotope of mass 218 + ChemIDplus + + + + + polonium-218 + ChEBI + + + + + + + + + 0 + [190Po] + InChI=1S/Po/i1-19 + HZEBHPIOVYHPMT-BTCYYSDASA-N + 189.994 + 189.99429 + [190Po] + polonium-190 + chebi_ontology + (190)84Po + (190)Po + polonium-190 + CHEBI:37350 + + polonium-190 atom + + + + + polonium-190 + IUPAC + + + + + + (190)84Po + IUPAC + + + + + (190)Po + IUPAC + + + + + polonium-190 + ChEBI + + + + + + + + + 0 + [191Po] + InChI=1S/Po/i1-18 + HZEBHPIOVYHPMT-ZWLOOBQPSA-N + 190.995 + 190.99465 + [191Po] + polonium-191 + chebi_ontology + (191)84Po + (191)Po + polonium-191 + CHEBI:37351 + + polonium-191 atom + + + + + polonium-191 + IUPAC + + + + + + (191)84Po + IUPAC + + + + + (191)Po + IUPAC + + + + + polonium-191 + ChEBI + + + + + + + + + 0 + [192Po] + InChI=1S/Po/i1-17 + HZEBHPIOVYHPMT-MEAORNGASA-N + 191.990 + 191.99033 + [192Po] + polonium-192 + chebi_ontology + (192)84Po + (192)Po + polonium-192 + CHEBI:37352 + + polonium-192 atom + + + + + polonium-192 + IUPAC + + + + + + (192)84Po + IUPAC + + + + + (192)Po + IUPAC + + + + + polonium-192 + ChEBI + + + + + + + + + 0 + [193Po] + InChI=1S/Po/i1-16 + HZEBHPIOVYHPMT-KLOSUXQXSA-N + 192.991 + 192.99110 + [193Po] + polonium-193 + chebi_ontology + (193)84Po + (193)Po + polonium-193 + CHEBI:37353 + + polonium-193 atom + + + + + polonium-193 + IUPAC + + + + + + (193)84Po + IUPAC + + + + + (193)Po + IUPAC + + + + + polonium-193 + ChEBI + + + + + + + + + 0 + [194Po] + InChI=1S/Po/i1-15 + HZEBHPIOVYHPMT-LPJXZZDMSA-N + 193.988 + 193.98828 + [194Po] + polonium-194 + chebi_ontology + (194)84Po + (194)Po + polonium-194 + CHEBI:37354 + + polonium-194 atom + + + + + polonium-194 + IUPAC + + + + + + (194)84Po + IUPAC + + + + + (194)Po + IUPAC + + + + + polonium-194 + ChEBI + + + + + + + + + 0 + [195Po] + InChI=1S/Po/i1-14 + HZEBHPIOVYHPMT-DWTUDRKQSA-N + 194.988 + 194.98804 + [195Po] + polonium-195 + chebi_ontology + (195)84Po + (195)Po + polonium-195 + CHEBI:37355 + + polonium-195 atom + + + + + polonium-195 + IUPAC + + + + + + (195)84Po + IUPAC + + + + + (195)Po + IUPAC + + + + + polonium-195 + ChEBI + + + + + + + + + 0 + [196Po] + InChI=1S/Po/i1-13 + HZEBHPIOVYHPMT-QAPNMCNYSA-N + 195.985 + 195.98547 + [196Po] + polonium-196 + chebi_ontology + (196)84Po + (196)Po + polonium-196 + CHEBI:37356 + + polonium-196 atom + + + + + polonium-196 + IUPAC + + + + + + (196)84Po + IUPAC + + + + + (196)Po + IUPAC + + + + + polonium-196 + ChEBI + + + + + + + + + 0 + [197Po] + InChI=1S/Po/i1-12 + HZEBHPIOVYHPMT-DFNMHJECSA-N + 196.986 + 196.98557 + [197Po] + polonium-197 + chebi_ontology + (197)84Po + (197)Po + polonium-197 + CHEBI:37357 + + polonium-197 atom + + + + + polonium-197 + IUPAC + + + + + + (197)84Po + ChEBI + + + + + (197)Po + ChEBI + + + + + polonium-197 + ChEBI + + + + + + + + + 0 + [198Po] + InChI=1S/Po/i1-11 + HZEBHPIOVYHPMT-DSSHQIQSSA-N + 197.984 + 197.98402 + [198Po] + polonium-198 + chebi_ontology + (198)84Po + (198)Po + polonium-198 + CHEBI:37358 + + polonium-198 atom + + + + + polonium-198 + IUPAC + + + + + + (198)84Po + IUPAC + + + + + (198)Po + IUPAC + + + + + polonium-198 + ChEBI + + + + + + + + + 0 + [199Po] + InChI=1S/Po/i1-10 + HZEBHPIOVYHPMT-CBESVEIWSA-N + 198.985 + 198.98504 + [199Po] + polonium-199 + chebi_ontology + (199)84Po + (199)Po + polonium-199 + CHEBI:37359 + + polonium-199 atom + + + + + polonium-199 + IUPAC + + + + + + (199)84Po + IUPAC + + + + + (199)Po + IUPAC + + + + + polonium-199 + ChEBI + + + + + + + + + 0 + [200Po] + InChI=1S/Po/i1-9 + HZEBHPIOVYHPMT-DBXDQKISSA-N + 199.982 + 199.98173 + [200Po] + polonium-200 + chebi_ontology + (200)84Po + (200)Po + polonium-200 + CHEBI:37360 + + polonium-200 atom + + + + + polonium-200 + IUPAC + + + + + + (200)84Po + IUPAC + + + + + (200)Po + IUPAC + + + + + polonium-200 + ChEBI + + + + + + + + + 0 + [201Po] + InChI=1S/Po/i1-8 + HZEBHPIOVYHPMT-QQVBLGSISA-N + 200.982 + 200.98221 + [201Po] + polonium-201 + chebi_ontology + (201)84Po + (201)Po + polonium-201 + CHEBI:37361 + + polonium-201 atom + + + + + polonium-201 + IUPAC + + + + + + (201)84Po + IUPAC + + + + + (201)Po + IUPAC + + + + + polonium-201 + ChEBI + + + + + + + + + 0 + [202Po] + InChI=1S/Po/i1-7 + HZEBHPIOVYHPMT-NOHWODKXSA-N + 201.981 + 201.98070 + [202Po] + polonium-202 + chebi_ontology + (202)84Po + (202)Po + polonium-202 + CHEBI:37362 + + polonium-202 atom + + + + + polonium-202 + IUPAC + + + + + + (202)84Po + IUPAC + + + + + (202)Po + IUPAC + + + + + polonium-202 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 202.981413 and half-life of 36.7 min. + 0 + [203Po] + InChI=1S/Po/i1-6 + HZEBHPIOVYHPMT-VENIDDJXSA-N + 202.981 + 202.98141 + [203Po] + CAS:16729-74-1 + polonium-203 + chebi_ontology + (203)84Po + (203)Po + polonium, isotope of mass 203 + polonium-203 + CHEBI:37363 + + polonium-203 atom + + + + + CAS:16729-74-1 + ChemIDplus + + + + + polonium-203 + IUPAC + + + + + + (203)84Po + IUPAC + + + + + (203)Po + IUPAC + + + + + polonium, isotope of mass 203 + ChemIDplus + + + + + polonium-203 + ChEBI + + + + + + + + + 0 + [204Po] + InChI=1S/Po/i1-5 + HZEBHPIOVYHPMT-FTXFMUIASA-N + 203.980 + 203.98031 + [204Po] + polonium-204 + chebi_ontology + (204)84Po + (204)Po + polonium-204 + CHEBI:37364 + + polonium-204 atom + + + + + polonium-204 + IUPAC + + + + + + (204)84Po + IUPAC + + + + + (204)Po + IUPAC + + + + + polonium-204 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 204.981165 and half-life of 1.66 h. + 0 + [205Po] + InChI=1S/Po/i1-4 + HZEBHPIOVYHPMT-AHCXROLUSA-N + 204.981 + 204.98117 + [205Po] + CAS:16729-76-3 + polonium-205 + chebi_ontology + (205)84Po + (205)Po + polonium, isotope of mass 205 + polonium-205 + CHEBI:37365 + + polonium-205 atom + + + + + CAS:16729-76-3 + ChemIDplus + + + + + polonium-205 + IUPAC + + + + + + (205)84Po + IUPAC + + + + + (205)Po + IUPAC + + + + + polonium, isotope of mass 205 + ChemIDplus + + + + + polonium-205 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 205.98047 and half-life of 8.8 days. + 0 + [206Po] + InChI=1S/Po/i1-3 + HZEBHPIOVYHPMT-OIOBTWANSA-N + 205.980 + 205.98047 + [206Po] + polonium-206 + chebi_ontology + (206)84Po + (206)Po + polonium-206 + CHEBI:37366 + + polonium-206 atom + + + + + polonium-206 + IUPAC + + + + + + (206)84Po + IUPAC + + + + + (206)Po + IUPAC + + + + + polonium-206 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 206.981578 and half-life of 5.80 h. + 0 + [207Po] + InChI=1S/Po/i1-2 + HZEBHPIOVYHPMT-YPZZEJLDSA-N + 206.982 + 206.98158 + [207Po] + CAS:15720-45-3 + polonium-207 + chebi_ontology + (207)84Po + (207)Po + polonium, isotope of mass 207 + polonium-207 + CHEBI:37367 + + polonium-207 atom + + + + + CAS:15720-45-3 + ChemIDplus + + + + + polonium-207 + IUPAC + + + + + + (207)84Po + IUPAC + + + + + (207)Po + IUPAC + + + + + polonium, isotope of mass 207 + ChemIDplus + + + + + polonium-207 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 207.98123 and half-life of 2.898 years. + 0 + [208Po] + InChI=1S/Po/i1-1 + HZEBHPIOVYHPMT-BJUDXGSMSA-N + 207.981 + 207.98123 + [208Po] + polonium-208 + chebi_ontology + (208)84Po + (208)Po + polonium-208 + CHEBI:37368 + + polonium-208 atom + + + + + polonium-208 + IUPAC + + + + + + (208)84Po + IUPAC + + + + + (208)Po + IUPAC + + + + + polonium-208 + ChEBI + + + + + + + + + The radioactive isotope of polonium with relative atomic mass 208.982404 and half-life of 102 years. + 0 + [209Po] + InChI=1S/Po/i1+0 + HZEBHPIOVYHPMT-IGMARMGPSA-N + 208.982 + 208.98242 + [209Po] + polonium-209 + chebi_ontology + (209)84Po + (209)Po + polonium-209 + CHEBI:37369 + + polonium-209 atom + + + + + polonium-209 + IUPAC + + + + + + (209)84Po + IUPAC + + + + + (209)Po + IUPAC + + + + + polonium-209 + ChEBI + + + + + + + + + The stable isotope of thallium with relative atomic mass 202.9723. The least abundant (29.524 atom percent) isotope of naturally occurring thallium. + 0 + [203Tl] + InChI=1S/Tl/i1-1 + BKVIYDNLLOSFOA-BJUDXGSMSA-N + 202.972 + 202.97234 + [203Tl] + CAS:14280-48-9 + thallium-203 + chebi_ontology + (203)81Tl + (203)Tl + thallium, isotope of mass 203 + CHEBI:37802 + + thallium-203 + + + + + CAS:14280-48-9 + ChemIDplus + + + + + thallium-203 + IUPAC + + + + + + (203)81Tl + IUPAC + + + + + (203)Tl + IUPAC + + + + + thallium, isotope of mass 203 + ChemIDplus + + + + + + + + + The stable isotope of thallium with relative atomic mass 204.9744. The most abundant (70.476 atom percent) isotope of naturally occurring thallium. + 0 + [205Tl] + InChI=1S/Tl/i1+1 + BKVIYDNLLOSFOA-OUBTZVSYSA-N + 204.974 + 204.97443 + [205Tl] + CAS:14280-49-0 + Gmelin:557319 + thallium-205 + chebi_ontology + (205)81Tl + (205)Tl + thallium, isotope of mass 205 + CHEBI:37803 + + thallium-205 + + + + + CAS:14280-49-0 + ChemIDplus + + + + + Gmelin:557319 + Gmelin + + + + + thallium-205 + IUPAC + + + + + + (205)81Tl + IUPAC + + + + + (205)Tl + IUPAC + + + + + thallium, isotope of mass 205 + ChemIDplus + + + + + + + + + The radioactive isotope of thallium with relative atomic mass 200.9708 and half-life of 72.912 hours. + 0 + [201Tl] + InChI=1S/Tl/i1-3 + BKVIYDNLLOSFOA-OIOBTWANSA-N + 200.971 + 200.97080 + [201Tl] + CAS:15064-65-0 + thallium-201 + chebi_ontology + (201)81Tl + (201)Tl + thallium, isotope of mass 201 + CHEBI:37804 + + thallium-201 + + + + + CAS:15064-65-0 + ChemIDplus + + + + + thallium-201 + IUPAC + + + + + + (201)81Tl + IUPAC + + + + + (201)Tl + IUPAC + + + + + thallium, isotope of mass 201 + ChemIDplus + + + + + + + + + The radioactive isotope of thallium with relative atomic mass 198.9698 and half-life of 7.42 hours. + 0 + [199Tl] + InChI=1S/Tl/i1-5 + BKVIYDNLLOSFOA-FTXFMUIASA-N + 198.970 + 198.96981 + [199Tl] + CAS:15064-66-1 + Gmelin:1491863 + thallium-199 + chebi_ontology + (199)81Tl + (199)Tl + thallium, isotope of mass 199 + CHEBI:37805 + + thallium-199 + + + + + CAS:15064-66-1 + ChemIDplus + + + + + Gmelin:1491863 + Gmelin + + + + + thallium-199 + IUPAC + + + + + + (199)81Tl + IUPAC + + + + + (199)Tl + IUPAC + + + + + thallium, isotope of mass 199 + ChemIDplus + + + + + + + + + The stable isotope of aluminium with relative atomic mass 26.98153 and nuclear spin (5)/2. + 0 + [27Al] + InChI=1S/Al/i1+0 + XAGFODPZIPBFFR-IGMARMGPSA-N + 26.982 + 26.98154 + [27Al] + aluminium-27 + chebi_ontology + (27)13Al + (27)Al + aluminium-27 + aluminum, isotope of mass 27 + aluminum-27 + CHEBI:37968 + + aluminium-27 atom + + + + + aluminium-27 + IUPAC + + + + + + (27)13Al + IUPAC + + + + + (27)Al + IUPAC + + + + + aluminium-27 + ChEBI + + + + + aluminum, isotope of mass 27 + ChEBI + + + + + aluminum-27 + ChEBI + + + + + + + + + The radioactive isotope of aluminium with relative atomic mass 25.986892 and half-life of 717,000 years. + 0 + [26Al] + InChI=1S/Al/i1-1 + XAGFODPZIPBFFR-BJUDXGSMSA-N + 25.987 + 25.98689 + [26Al] + CAS:14682-66-7 + aluminium-26 + chebi_ontology + (26)13Al + (26)Al + aluminium-26 + aluminum, isotope of mass 26 + aluminum-26 + CHEBI:37969 + + aluminium-26 atom + + + + + CAS:14682-66-7 + ChemIDplus + + + + + aluminium-26 + IUPAC + + + + + + (26)13Al + IUPAC + + + + + (26)Al + IUPAC + + + + + aluminium-26 + ChEBI + + + + + aluminum, isotope of mass 26 + ChemIDplus + + + + + aluminum-26 + ChemIDplus + + + + + + + + + The radioactive isotope of aluminium with relative atomic mass 27.981910 and half-life of 2.25 min. + 0 + [28Al] + InChI=1S/Al/i1+1 + XAGFODPZIPBFFR-OUBTZVSYSA-N + 27.982 + 27.98191 + [28Al] + CAS:14999-04-3 + aluminium-28 + chebi_ontology + (28)13Al + (28)Al + aluminium-28 + aluminum, isotope of mass 28 + aluminum-28 + CHEBI:37970 + + aluminium-28 atom + + + + + CAS:14999-04-3 + ChemIDplus + + + + + aluminium-28 + IUPAC + + + + + + (28)13Al + IUPAC + + + + + (28)Al + IUPAC + + + + + aluminium-28 + ChEBI + + + + + aluminum, isotope of mass 28 + ChemIDplus + + + + + aluminum-28 + ChemIDplus + + + + + + + + + The stable isotope of phosphorus with relative atomic mass 30.973762 and nuclear spin (1)/2. + 0 + [31P] + InChI=1S/P/i1+0 + OAICVXFJPJFONN-IGMARMGPSA-N + 30.974 + 30.97376 + [31P] + phosphorus-31 + chebi_ontology + (31)15P + (31)P + phosphorus-31 + CHEBI:37971 + + phosphorus-31 atom + + + + + phosphorus-31 + IUPAC + + + + + + (31)15P + IUPAC + + + + + (31)P + IUPAC + + + + + phosphorus-31 + ChEBI + + + + + + + + + The radioactive isotope of phosphorus with relative atomic mass 31.973907 and half-life of 14.26 days. + 0 + [32P] + InChI=1S/P/i1+1 + OAICVXFJPJFONN-OUBTZVSYSA-N + 31.974 + 31.97391 + [32P] + CAS:14596-37-3 + KEGG:C19162 + phosphorus-32 + chebi_ontology + (32)15P + (32)P + Phosphorus, isotope of mass 32 + phosphorus, isotope of mass 32 + phosphorus-32 + CHEBI:37972 + + phosphorus-32 atom + + + + + CAS:14596-37-3 + ChemIDplus + + + + + CAS:14596-37-3 + KEGG COMPOUND + + + + + phosphorus-32 + IUPAC + + + + + + (32)15P + IUPAC + + + + + (32)P + IUPAC + + + + + Phosphorus, isotope of mass 32 + KEGG_COMPOUND + + + + + phosphorus, isotope of mass 32 + ChemIDplus + + + + + phosphorus-32 + ChEBI + + + + + + + + + The radioactive isotope of phosphorus with relative atomic mass 32.971725, half-life of 25.34 days and nuclear spin (1)/2. + 0 + [33P] + InChI=1S/P/i1+2 + OAICVXFJPJFONN-NJFSPNSNSA-N + 32.972 + 32.97173 + [33P] + CAS:15749-66-3 + phosphorus-33 + chebi_ontology + (33)15P + (33)P + phosphorus, isotope of mass 33 + phosphorus-33 + CHEBI:37973 + + phosphorus-33 atom + + + + + CAS:15749-66-3 + ChemIDplus + + + + + phosphorus-33 + IUPAC + + + + + + (33)15P + IUPAC + + + + + (33)P + IUPAC + + + + + phosphorus, isotope of mass 33 + ChemIDplus + + + + + phosphorus-33 + ChEBI + + + + + + + + + The stable isotope of silicon with relative atomic mass 28.9764947, 4.683 atom percent natural abundancy, and nuclear spin (1)/2. + 0 + [29Si] + InChI=1S/Si/i1+1 + XUIMIQQOPSSXEZ-OUBTZVSYSA-N + 28.976 + 28.97649 + [29Si] + silicon-29 + chebi_ontology + (29)14Si + (29)Si + silicon-29 + CHEBI:37974 + + silicon-29 atom + + + + + silicon-29 + IUPAC + + + + + + (29)14Si + IUPAC + + + + + (29)Si + IUPAC + + + + + silicon-29 + ChEBI + + + + + + + + + The stable isotope of silicon with relative atomic mass 27.9769265. The most abundant (92.23 atom percent) isotope of naturally occurring silicon. + 0 + [28Si] + InChI=1S/Si/i1+0 + XUIMIQQOPSSXEZ-IGMARMGPSA-N + 27.977 + 27.97693 + [28Si] + silicon-28 + chebi_ontology + (28)14Si + (28)Si + silicon-28 + CHEBI:37975 + + silicon-28 atom + + + + + silicon-28 + IUPAC + + + + + + (28)14Si + IUPAC + + + + + (28)Si + IUPAC + + + + + silicon-28 + ChEBI + + + + + + + + + The stable isotope of silicon with relative atomic mass 29.9737702. The least abundant (3.09 atom percent) isotope of naturally occurring silicon. + 0 + [30Si] + InChI=1S/Si/i1+2 + XUIMIQQOPSSXEZ-NJFSPNSNSA-N + 29.974 + 29.97377 + [30Si] + silicon-30 + chebi_ontology + (30)14Si + (30)Si + silicon-30 + CHEBI:37976 + + silicon-30 atom + + + + + silicon-30 + IUPAC + + + + + + (30)14Si + IUPAC + + + + + (30)Si + IUPAC + + + + + silicon-30 + ChEBI + + + + + + + + + The radioactive isotope of silicon with relative atomic mass 30.975363, half-life of 2.62 hours and nuclear spin (3)/2. + 0 + [31Si] + InChI=1S/Si/i1+3 + XUIMIQQOPSSXEZ-AKLPVKDBSA-N + 30.975 + 30.97536 + [31Si] + CAS:14276-49-4 + silicon-31 + chebi_ontology + (31)14Si + (31)Si + silicon, isotope of mass 31 + silicon-31 + CHEBI:37977 + + silicon-31 atom + + + + + CAS:14276-49-4 + ChemIDplus + + + + + silicon-31 + IUPAC + + + + + + (31)14Si + IUPAC + + + + + (31)Si + IUPAC + + + + + silicon, isotope of mass 31 + ChemIDplus + + + + + silicon-31 + ChEBI + + + + + + + + + The radioactive isotope of silicon with relative atomic mass 31.974148. The longest-lived silicon radionuclide with half-life of 172 years. + 0 + [32Si] + InChI=1S/Si/i1+4 + XUIMIQQOPSSXEZ-RNFDNDRNSA-N + 31.974 + 31.97415 + [32Si] + CAS:15092-72-5 + silicon-32 + chebi_ontology + (32)14Si + (32)Si + silicon, isotope of mass 32 + silicon-32 + CHEBI:37978 + + silicon-32 atom + + + + + CAS:15092-72-5 + ChemIDplus + + + + + silicon-32 + IUPAC + + + + + + (32)14Si + IUPAC + + + + + (32)Si + IUPAC + + + + + silicon, isotope of mass 32 + ChemIDplus + + + + + silicon-32 + ChEBI + + + + + + + + + The stable isotope of sulfur with relative atomic mass 31.972071. The most abundant (95.02 atom percent) isotope of naturally occurring sulfur. + 0 + [32S] + InChI=1S/S/i1+0 + NINIDFKCEFEMDL-IGMARMGPSA-N + 31.972 + 31.97207 + [32S] + CAS:13981-57-2 + sulfur-32 + chebi_ontology + (32)16S + (32)S + sulfur, isotope of mass 32 + sulfur-32 + sulphur-32 + CHEBI:37979 + + sulfur-32 atom + + + + + CAS:13981-57-2 + ChemIDplus + + + + + sulfur-32 + IUPAC + + + + + + (32)16S + IUPAC + + + + + (32)S + IUPAC + + + + + sulfur, isotope of mass 32 + ChemIDplus + + + + + sulfur-32 + ChEBI + + + + + sulphur-32 + ChEBI + + + + + + + + + The stable isotope of sulfur with relative atomic mass 32.9714585, 0.75 atom percent natural abundance, and nuclear spin (3)/2. + 0 + [33S] + InChI=1S/S/i1+1 + NINIDFKCEFEMDL-OUBTZVSYSA-N + 32.971 + 32.97146 + [33S] + CAS:14257-58-0 + sulfur-33 + chebi_ontology + (33)16S + (33)S + sulfur, isotope of mass 33 + sulfur-33 + sulphur-33 + CHEBI:37980 + + sulfur-33 atom + + + + + CAS:14257-58-0 + ChemIDplus + + + + + sulfur-33 + IUPAC + + + + + + (33)16S + IUPAC + + + + + (33)S + IUPAC + + + + + sulfur, isotope of mass 33 + ChemIDplus + + + + + sulfur-33 + ChEBI + + + + + sulphur-33 + ChEBI + + + + + + + + + The stable isotope of sulfur with relative atomic mass 33.9678668 and 4.21 atom percent natural abundance. + 0 + [34S] + InChI=1S/S/i1+2 + NINIDFKCEFEMDL-NJFSPNSNSA-N + 33.968 + 33.96787 + [34S] + CAS:13965-97-4 + sulfur-34 + chebi_ontology + (34)16S + (34)S + sulfur, isotope of mass 34 + sulfur-34 + sulphur-34 + CHEBI:37981 + + sulfur-34 atom + + + + + CAS:13965-97-4 + ChemIDplus + + + + + sulfur-34 + IUPAC + + + + + + (34)16S + IUPAC + + + + + (34)S + IUPAC + + + + + sulfur, isotope of mass 34 + ChemIDplus + + + + + sulfur-34 + ChEBI + + + + + sulphur-34 + ChEBI + + + + + + + + + The stable isotope of sulfur with relative atomic mass 35.9670809. The least abundant (0.02 atom percent) isotope of naturally occurring sulfur. + 0 + [36S] + InChI=1S/S/i1+4 + NINIDFKCEFEMDL-RNFDNDRNSA-N + 35.967 + 35.96708 + [36S] + CAS:14682-80-5 + sulfur-36 + chebi_ontology + (36)16S + (36)S + sulfur, isotope of mass 36 + sulfur-36 + sulphur-36 + CHEBI:37982 + + sulfur-36 atom + + + + + CAS:14682-80-5 + ChemIDplus + + + + + sulfur-36 + IUPAC + + + + + + (36)16S + IUPAC + + + + + (36)S + IUPAC + + + + + sulfur, isotope of mass 36 + ChemIDplus + + + + + sulfur-36 + ChEBI + + + + + sulphur-36 + ChEBI + + + + + + + + + The radioactive isotope of sulfur with relative atomic mass 34.9690322 and nuclear spin (3)/2. The longest-lived sulfur radionuclide with half-life of 87.5 days. + 0 + [35S] + InChI=1S/S/i1+3 + NINIDFKCEFEMDL-AKLPVKDBSA-N + 34.969 + 34.96903 + [35S] + CAS:15117-53-0 + sulfur-35 + chebi_ontology + (35)16S + (35)S + sulfur, isotope of mass 35 + sulfur-35 + sulphur-35 + CHEBI:37983 + + sulfur-35 atom + + + + + CAS:15117-53-0 + ChemIDplus + + + + + sulfur-35 + IUPAC + + + + + + (35)16S + IUPAC + + + + + (35)S + IUPAC + + + + + sulfur, isotope of mass 35 + ChemIDplus + + + + + sulfur-35 + ChEBI + + + + + sulphur-35 + ChEBI + + + + + + + + + The radioactive isotope of sulfur with relative atomic mass 36.9711257 and half-life of 5.05 min. + 0 + [37S] + InChI=1S/S/i1+5 + NINIDFKCEFEMDL-BKFZFHPZSA-N + 36.971 + 36.97113 + [37S] + CAS:15753-06-7 + sulfur-37 + chebi_ontology + (37)16S + (37)S + sulfur, isotope of mass 37 + sulfur-37 + sulphur-37 + CHEBI:37984 + + sulfur-37 atom + + + + + CAS:15753-06-7 + ChemIDplus + + + + + sulfur-37 + IUPAC + + + + + + (37)16S + IUPAC + + + + + (37)S + IUPAC + + + + + sulfur, isotope of mass 37 + ChemIDplus + + + + + sulfur-37 + ChEBI + + + + + sulphur-37 + ChEBI + + + + + + + + + The radioactive isotope of sulfur with relative atomic mass 37.97116 and half-life of 170.3 min. + 0 + [38S] + InChI=1S/S/i1+6 + NINIDFKCEFEMDL-LZFNBGRKSA-N + 37.971 + 37.97116 + [38S] + CAS:15759-21-4 + sulfur-38 + chebi_ontology + (38)16S + (38)S + sulfur, isotope of mass 38 + sulfur-38 + sulphur-38 + CHEBI:37985 + + sulfur-38 atom + + + + + CAS:15759-21-4 + ChemIDplus + + + + + sulfur-38 + IUPAC + + + + + + (38)16S + IUPAC + + + + + (38)S + IUPAC + + + + + sulfur, isotope of mass 38 + ChemIDplus + + + + + sulfur-38 + ChEBI + + + + + sulphur-38 + ChEBI + + + + + + + + + + 0 + Ar + InChI=1S/Ar + XKRFYHLGVUSROY-UHFFFAOYSA-N + 39.94800 + 39.96238 + [Ar] + CHEBI:33311 + CAS:7440-37-1 + WebElements:Ar + argon + chebi_ontology + 18Ar + Ar + argon + CHEBI:49475 + + argon atom + + + + + CAS:7440-37-1 + ChemIDplus + + + + + argon + IUPAC + + + + + + 18Ar + IUPAC + + + + + Ar + IUPAC + + + + + argon + ChEBI + + + + + + + + + A metallic element predicted as eka-aluminium by Mendeleev in 1870 and discovered by Paul-Emile Lecoq de Boisbaudran in 1875. Named in honour of France (Latin Gallia) and perhaps also from the Latin gallus cock, a translation of Lecoq. + 0 + Ga + InChI=1S/Ga + GYHNNYVSQQEPJS-UHFFFAOYSA-N + 69.72300 + 68.92557 + [Ga] + CHEBI:33326 + CHEBI:49630 + CAS:7440-55-3 + WebElements:Ga + gallium + chebi_ontology + 31Ga + Ga + galio + gallium + CHEBI:49631 + + gallium atom + + + + + CAS:7440-55-3 + ChemIDplus + + + + + CAS:7440-55-3 + NIST Chemistry WebBook + + + + + gallium + IUPAC + + + + + + 31Ga + IUPAC + + + + + Ga + IUPAC + + + + + galio + ChEBI + + + + + gallium + ChEBI + + + + + + + + + + 0 + H + InChI=1S/H + YZCKVEUIGOORGS-UHFFFAOYSA-N + 1.00794 + 1.00783 + [H] + CHEBI:24634 + CHEBI:49636 + WebElements:H + hydrogen + chebi_ontology + 1H + H + Wasserstoff + hidrogeno + hydrogen + hydrogene + CHEBI:49637 + + hydrogen atom + + + + + hydrogen + IUPAC + + + + + + 1H + IUPAC + + + + + H + IUPAC + + + + + Wasserstoff + ChEBI + + + + + hidrogeno + ChEBI + + + + + hydrogen + ChEBI + + + + + hydrogene + ChEBI + + + + + + + + + + 0 + Ho + InChI=1S/Ho + KJZYNXUDTRRSPN-UHFFFAOYSA-N + 164.93032 + 164.93033 + [Ho] + CHEBI:33378 + CHEBI:49647 + CAS:7440-60-0 + Gmelin:16291 + WebElements:Ho + holmium + chebi_ontology + 67Ho + Ho + holmio + holmium + CHEBI:49648 + + holmium atom + + + + + CAS:7440-60-0 + ChemIDplus + + + + + CAS:7440-60-0 + NIST Chemistry WebBook + + + + + Gmelin:16291 + Gmelin + + + + + holmium + IUPAC + + + + + + 67Ho + IUPAC + + + + + Ho + IUPAC + + + + + holmio + ChEBI + + + + + holmium + ChEBI + + + + + + + + + + 0 + Ir + InChI=1S/Ir + GKOZUEZYRPOHIO-UHFFFAOYSA-N + 192.21700 + 192.96292 + [Ir] + CHEBI:33360 + CHEBI:49665 + CAS:7439-88-5 + WebElements:Ir + iridium + chebi_ontology + 77Ir + Ir + iridio + iridium + CHEBI:49666 + + iridium atom + + + + + CAS:7439-88-5 + ChemIDplus + + + + + CAS:7439-88-5 + NIST Chemistry WebBook + + + + + iridium + IUPAC + + + + + + 77Ir + IUPAC + + + + + Ir + IUPAC + + + + + iridio + ChEBI + + + + + iridium + ChEBI + + + + + + + + + + 0 + Kr + InChI=1S/Kr + DNNSSWSSYDEUBZ-UHFFFAOYSA-N + 83.80000 + 83.91150 + [Kr] + CHEBI:33312 + CAS:7439-90-9 + WebElements:Kr + krypton + chebi_ontology + 36Kr + Kr + cripton + kripton + krypton + CHEBI:49696 + + krypton atom + + + + + CAS:7439-90-9 + ChemIDplus + + + + + CAS:7439-90-9 + NIST Chemistry WebBook + + + + + krypton + IUPAC + + + + + + 36Kr + IUPAC + + + + + Kr + IUPAC + + + + + cripton + ChEBI + + + + + kripton + ChEBI + + + + + krypton + ChEBI + + + + + + + + + + 0 + Pr + InChI=1S/Pr + PUDIUYLPXJFUGB-UHFFFAOYSA-N + 140.90765 + 140.90766 + [Pr] + CHEBI:33370 + CHEBI:49827 + CAS:7440-10-0 + WebElements:Pr + praseodymium + chebi_ontology + 59Pr + Pr + Praseodym + praseodimio + praseodyme + praseodymium + CHEBI:49828 + + praseodymium atom + + + + + CAS:7440-10-0 + ChemIDplus + + + + + CAS:7440-10-0 + NIST Chemistry WebBook + + + + + praseodymium + IUPAC + + + + + + 59Pr + IUPAC + + + + + Pr + IUPAC + + + + + Praseodym + ChEBI + + + + + praseodimio + ChEBI + + + + + praseodyme + ChEBI + + + + + praseodymium + ChEBI + + + + + + + + + 0 + Re + InChI=1S/Re + WUAPFZMCVAUBPE-UHFFFAOYSA-N + 186.20700 + 186.95575 + [Re] + CHEBI:33354 + CHEBI:49879 + CAS:7440-15-5 + WebElements:Re + rhenium + chebi_ontology + 75Re + Re + Rhenium + renio + rhenium + CHEBI:49882 + + rhenium atom + + + + + CAS:7440-15-5 + ChemIDplus + + + + + CAS:7440-15-5 + NIST Chemistry WebBook + + + + + rhenium + IUPAC + + + + + + 75Re + IUPAC + + + + + Re + ChEBI + + + + + Rhenium + ChEBI + + + + + renio + ChEBI + + + + + rhenium + ChEBI + + + + + + + + + + 0 + Xe + InChI=1S/Xe + FHNFHKCVQCLJFQ-UHFFFAOYSA-N + 131.29000 + 131.90416 + [Xe] + CHEBI:32305 + CAS:7440-63-3 + Gmelin:16318 + KEGG:C13373 + WebElements:Xe + xenon + chebi_ontology + 54Xe + Xe + Xenon + xenon + CHEBI:49957 + + xenon atom + + + + + CAS:7440-63-3 + ChemIDplus + + + + + CAS:7440-63-3 + KEGG COMPOUND + + + + + CAS:7440-63-3 + NIST Chemistry WebBook + + + + + Gmelin:16318 + Gmelin + + + + + xenon + IUPAC + + + + + + 54Xe + IUPAC + + + + + Xe + IUPAC + + + + + Xenon + ChEBI + + + + + Xenon + KEGG_COMPOUND + + + + + xenon + ChEBI + + + + + + + + + A synthetic radioactive isotope of chromium having a half-life of 27.7 days and decaying by electron capture with emission of gamma rays (0.32 MeV); it is used to label red blood cells for measurement of mass or volume, survival time, and sequestration studies, for the diagnosis of gastrointestinal bleeding, and to label platelets to study their survival. + 0 + [51Cr] + InChI=1S/Cr/i1-1 + VYZAMTAEIAYCRO-BJUDXGSMSA-N + 50.945 + 50.94477 + [51Cr] + CAS:14392-02-0 + chromium-51 + chebi_ontology + (51)24Cr + (51)Cr + 51Cr + Chromium, isotope of mass 51 + CHEBI:50076 + + chromium-51 + + + + + CAS:14392-02-0 + ChemIDplus + + + + + chromium-51 + IUPAC + + + + + + (51)24Cr + IUPAC + + + + + (51)Cr + IUPAC + + + + + 51Cr + ChemIDplus + + + + + Chromium, isotope of mass 51 + ChemIDplus + + + + + + + + + The stable isotope of tin with relative atomic mass 118.903311, 8.59 atom percent natural abundance and nuclear spin (1)/2. + 0 + [119Sn] + InChI=1S/Sn/i1+0 + ATJFFYVFTNAWJD-IGMARMGPSA-N + 118.903 + 118.90331 + [119Sn] + tin-119 + chebi_ontology + (119)50Sn + (119)Sn + tin-119 + CHEBI:52230 + + tin-119 atom + + + + + tin-119 + IUPAC + + + + + + (119)50Sn + IUPAC + + + + + (119)Sn + IUPAC + + + + + tin-119 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 119.902199 and 32.58 atom percent natural abundance. + 0 + [120Sn] + InChI=1S/Sn/i1+1 + ATJFFYVFTNAWJD-OUBTZVSYSA-N + 119.902 + 119.90220 + [120Sn] + tin-120 + chebi_ontology + (120)50Sn + (120)Sn + tin-120 + CHEBI:52231 + + tin-120 atom + + + + + tin-120 + IUPAC + + + + + + (120)50Sn + IUPAC + + + + + (120)Sn + IUPAC + + + + + tin-120 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 117.901609 and 24.22 atom percent natural abundance. + 0 + [118Sn] + InChI=1S/Sn/i1-1 + ATJFFYVFTNAWJD-BJUDXGSMSA-N + 117.902 + 117.90161 + [118Sn] + tin-118 + chebi_ontology + (118)50Sn + (118)Sn + tin-118 + CHEBI:52232 + + tin-118 atom + + + + + tin-118 + IUPAC + + + + + + (118)50Sn + IUPAC + + + + + (118)Sn + IUPAC + + + + + tin-118 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 115.901747 and 14.54 atom percent natural abundance. + 0 + [116Sn] + InChI=1S/Sn/i1-3 + ATJFFYVFTNAWJD-OIOBTWANSA-N + 115.902 + 115.90174 + [116Sn] + tin-116 + chebi_ontology + (116)50Sn + (116)Sn + tin-116 + CHEBI:52233 + + tin-116 atom + + + + + tin-116 + IUPAC + + + + + + (116)50Sn + IUPAC + + + + + (116)Sn + IUPAC + + + + + tin-116 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 116.902956, 7.68 atom percent natural abundance and nuclear spin (1)/2. + 0 + [117Sn] + InChI=1S/Sn/i1-2 + ATJFFYVFTNAWJD-YPZZEJLDSA-N + 116.903 + 116.90295 + [117Sn] + tin-117 + chebi_ontology + (117)50Sn + (117)Sn + tin-117 + CHEBI:52234 + + tin-117 atom + + + + + tin-117 + IUPAC + + + + + + (117)50Sn + IUPAC + + + + + (117)Sn + IUPAC + + + + + tin-117 + ChEBI + + + + + + + + + The stable isotope of tin with relative atomic mass 114.903348, 0.34 atom percent natural abundance and nuclear spin (1)/2. + 0 + [115Sn] + InChI=1S/Sn/i1-4 + ATJFFYVFTNAWJD-AHCXROLUSA-N + 114.903 + 114.90334 + [115Sn] + tin-115 + chebi_ontology + (115)50Sn + (115)Sn + tin-115 + CHEBI:52235 + + tin-115 atom + + + + + tin-115 + IUPAC + + + + + + (115)50Sn + IUPAC + + + + + (115)Sn + IUPAC + + + + + tin-115 + ChEBI + + + + + + + + + The stable isotope of boron with relative atomic mass 11.009306, 80.1 atom percent natural abundance and nuclear spin 3/2. + 0 + [11B] + InChI=1S/B/i1+0 + ZOXJGFHDIHLPTG-IGMARMGPSA-N + 11.009 + 11.00930 + [11B] + boron-11 + chebi_ontology + (11)5B + (11)B + CHEBI:52451 + + boron-11 atom + + + + + boron-11 + IUPAC + + + + + + (11)5B + IUPAC + + + + + (11)B + IUPAC + + + + + + + + + The stable isotope of tellurium with relative atomic mass 124.904425, 71.4 atom percent natural abundance and nuclear spin 1/2. + 0 + [125Te] + InChI=1S/Te/i1-3 + PORWMNRCUJJQNO-OIOBTWANSA-N + 124.904 + 124.90443 + [125Te] + tellurium-125 + chebi_ontology + (125)52Te + (125)Te + tellurium-125 + CHEBI:52452 + + tellurium-125 atom + + + + + tellurium-125 + IUPAC + + + + + + (125)52Te + IUPAC + + + + + (125)Te + IUPAC + + + + + tellurium-125 + ChEBI + + + + + + + + + The stable isotope of xenon with relative atomic mass 128.904780, 26.4 atom percent natural abundance and nuclear spin 1/2. + 0 + [129Xe] + InChI=1S/Xe/i1-2 + FHNFHKCVQCLJFQ-YPZZEJLDSA-N + 128.905 + 128.90478 + [129Xe] + xenon-129 + chebi_ontology + (129)54Xe + (129)Xe + xenon-129 + CHEBI:52453 + + xenon-129 atom + + + + + xenon-129 + IUPAC + + + + + + (129)54Xe + IUPAC + + + + + (129)Xe + IUPAC + + + + + xenon-129 + ChEBI + + + + + + + + + A stable isotope of selenium with relative atomic mass 76.919915, 7.60 atom percent natural abundance and nuclear spin 1/2. + 0 + [77Se] + InChI=1S/Se/i1-2 + BUGBHKTXTAQXES-YPZZEJLDSA-N + 76.920 + 76.91991 + [77Se] + Chemspider:9507361 + PMID:16158304 + PMID:23159557 + PMID:25848959 + PMID:25923042 + PMID:27129100 + PMID:30828921 + PMID:32453871 + PMID:34153173 + ((77)Se)selenium + chebi_ontology + (77)34Se + (77)Se + Se-77 + selenium, isotope of mass 77 + selenium-(77)Se + selenium-77 + CHEBI:52457 + + selenium-77 atom + + + + + PMID:16158304 + Europe PMC + + + + + PMID:23159557 + Europe PMC + + + + + PMID:25848959 + Europe PMC + + + + + PMID:25923042 + Europe PMC + + + + + PMID:27129100 + Europe PMC + + + + + PMID:30828921 + Europe PMC + + + + + PMID:32453871 + Europe PMC + + + + + PMID:34153173 + Europe PMC + + + + + ((77)Se)selenium + IUPAC + + + + + + (77)34Se + IUPAC + + + + + (77)Se + IUPAC + + + + + Se-77 + ChEBI + + + + + selenium, isotope of mass 77 + ChEBI + + + + + selenium-(77)Se + ChEBI + + + + + selenium-77 + ChEBI + + + + + + + + + The stable isotope of lithium with relative atomic mass 7.016004, 92.5 atom percent natural abundance and nuclear spin 3/2. + 0 + [7Li] + InChI=1S/Li/i1+0 + WHXSMMKQMYFTQS-IGMARMGPSA-N + 7.016 + 7.01600 + [7Li] + lithium-7 + chebi_ontology + (7)3Li + (7)Li + lithium-7 + CHEBI:52458 + + lithium-7 atom + + + + + lithium-7 + IUPAC + + + + + + (7)3Li + IUPAC + + + + + (7)Li + IUPAC + + + + + lithium-7 + ChEBI + + + + + + + + + The stable isotope of rubidium with relative atomic mass 86.909184, 27.9 atom percent natural abundance and nuclear spin 3/2. + 0 + [87Rb] + InChI=1S/Rb/i1+2 + IGLNJRXAVVLDKE-NJFSPNSNSA-N + 86.909 + 86.90918 + [87Rb] + rubidium-87 + chebi_ontology + (87)37Rb + (87)Rb + rubidium-87 + CHEBI:52459 + + rubidium-87 atom + + + + + rubidium-87 + IUPAC + + + + + + (87)37Rb + IUPAC + + + + + (87)Rb + IUPAC + + + + + rubidium-87 + ChEBI + + + + + + + + + The stable isotope of niobium with relative atomic mass 92.906378, 100 atom percent natural abundance and nuclear spin 9/2. + 0 + [93Nb] + InChI=1S/Nb/i1+0 + GUCVJGMIXFAOAE-IGMARMGPSA-N + 92.906 + 92.90637 + [93Nb] + niobium-93 + chebi_ontology + (93)41Nb + (93)Nb + niobium-93 + CHEBI:52460 + + niobium-93 atom + + + + + niobium-93 + IUPAC + + + + + + (93)41Nb + IUPAC + + + + + (93)Nb + IUPAC + + + + + niobium-93 + ChEBI + + + + + + + + + The stable isotope of niobium with relative atomic mass 182.950225, 14.3 atom percent natural abundance and nuclear spin 1/2. + 0 + [183W] + InChI=1S/W/i1-1 + WFKWXMTUELFFGS-BJUDXGSMSA-N + 182.950 + 182.95022 + [183W] + tungsten-183 + chebi_ontology + (183)74W + (183)W + CHEBI:52462 + + tungsten-183 + + + + + tungsten-183 + IUPAC + + + + + + (183)74W + IUPAC + + + + + (183)W + IUPAC + + + + + + + + + The stable isotope of cadmium with relative atomic mass 110.904182, 12.8 atom percent natural abundance and nuclear spin 1/2. + 0 + [111Cd] + InChI=1S/Cd/i1-1 + BDOSMKKIYDKNTQ-BJUDXGSMSA-N + 110.904 + 110.90418 + [111Cd] + cadmium-111 + chebi_ontology + (111)48Cd + (111)Cd + CHEBI:52619 + + cadmium-111 + + + + + cadmium-111 + IUPAC + + + + + + (111)48Cd + IUPAC + + + + + (111)Cd + IUPAC + + + + + + + + + The isotope of cadmium with relative atomic mass 112.904401, 12.2 atom percent natural abundance and nuclear spin 1/2. + 0 + [113Cd] + InChI=1S/Cd/i1+1 + BDOSMKKIYDKNTQ-OUBTZVSYSA-N + 112.904 + 112.90441 + [113Cd] + cadmium-113 + chebi_ontology + (113)48Cd + (113)Cd + CHEBI:52620 + + cadmium-113 + + + + + cadmium-113 + IUPAC + + + + + + (113)48Cd + IUPAC + + + + + (113)Cd + IUPAC + + + + + + + + + The stable isotope of lithium with relative atomic mass 6.015122, 7.5 atom percent natural abundance and nuclear spin 1. + 0 + [6Li] + InChI=1S/Li/i1-1 + WHXSMMKQMYFTQS-BJUDXGSMSA-N + 6.015 + 6.01512 + [6Li] + lithium-6 + chebi_ontology + (6)3Li + (6)Li + lithium-6 + CHEBI:52621 + + lithium-6 atom + + + + + lithium-6 + IUPAC + + + + + + (6)3Li + IUPAC + + + + + (6)Li + IUPAC + + + + + lithium-6 + ChEBI + + + + + + + + + The stable isotope of yttrium with relative atomic mass 88.905848, 100 atom percent natural abundance and nuclear spin 1/2. + 0 + [89Y] + InChI=1S/Y/i1+0 + VWQVUPCCIRVNHF-IGMARMGPSA-N + 88.906 + 88.90584 + [89Y] + yttrium-89 + chebi_ontology + (89)39Y + (89)Y + yttrium-89 + CHEBI:52622 + + yttrium-89 atom + + + + + yttrium-89 + IUPAC + + + + + + (89)39Y + IUPAC + + + + + (89)Y + IUPAC + + + + + yttrium-89 + ChEBI + + + + + + + + + The stable isotope of iron with relative atomic mass 56.935399, 2.1 atom percent natural abundance and nuclear spin 1/2. + 0 + [57Fe] + InChI=1S/Fe/i1+1 + XEEYBQQBJWHFJM-OUBTZVSYSA-N + 56.935 + 56.93539 + [57Fe] + iron-57 + chebi_ontology + (57)26Fe + (57)Fe + CHEBI:52623 + + iron-57 atom + + + + + iron-57 + IUPAC + + + + + + (57)26Fe + IUPAC + + + + + (57)Fe + IUPAC + + + + + + + + + The stable isotope of antimony with relative atomic mass 120.903818, 57.2 atom percent natural abundance and nuclear spin 5/2. + 0 + [121Sb] + InChI=1S/Sb/i1-1 + WATWJIUSRGPENY-BJUDXGSMSA-N + 120.904 + 120.90381 + [121Sb] + antimony-121 + chebi_ontology + (121)51Sb + (121)Sb + antimony-121 + CHEBI:52624 + + antimony-121 atom + + + + + antimony-121 + IUPAC + + + + + + (121)51Sb + IUPAC + + + + + (121)Sb + IUPAC + + + + + antimony-121 + ChEBI + + + + + + + + + The stable isotope of antimony with relative atomic mass 122.904216, 42.8 atom percent natural abundance and nuclear spin 7/2. + 0 + [123Sb] + InChI=1S/Sb/i1+1 + WATWJIUSRGPENY-OUBTZVSYSA-N + 122.904 + 122.90421 + [123Sb] + antimony-123 + chebi_ontology + (123)51Sb + (123)Sb + antimony-123 + CHEBI:52626 + + antimony-123 atom + + + + + antimony-123 + IUPAC + + + + + + (123)51Sb + IUPAC + + + + + (123)Sb + IUPAC + + + + + antimony-123 + ChEBI + + + + + + + + + The stable isotope of lanthanum with relative atomic mass 138.906348, 99.9 atom percent natural abundance and nuclear spin 7/2. + 0 + [139La] + InChI=1S/La/i1+0 + FZLIPJUXYLNCLC-IGMARMGPSA-N + 138.906 + 138.90636 + [139La] + lanthanum-139 + chebi_ontology + (139)57La + (139)La + lanthanum-139 + CHEBI:52627 + + lanthanum-139 atom + + + + + lanthanum-139 + IUPAC + + + + + + (139)57La + IUPAC + + + + + (139)La + IUPAC + + + + + lanthanum-139 + ChEBI + + + + + + + + + The stable isotope of iodine with relative atomic mass 126.904468, 100 atom percent natural abundance and nuclear spin 5/2. + 0 + [127I] + InChI=1S/I/i1+0 + ZCYVEMRRCGMTRW-IGMARMGPSA-N + 126.904 + 126.90447 + [127I] + iodine-127 + chebi_ontology + (127)53I + (127)I + iodine-127 + CHEBI:52631 + + iodine-127 atom + + + + + iodine-127 + IUPAC + + + + + + (127)53I + IUPAC + + + + + (127)I + IUPAC + + + + + iodine-127 + ChEBI + + + + + + + + + The stable isotope of potassium with relative atomic mass 38.963707, 93.3 atom percent natural abundance and nuclear spin 3/2. + 0 + [39K] + InChI=1S/K/i1+0 + ZLMJMSJWJFRBEC-IGMARMGPSA-N + 38.964 + 38.96371 + [39K] + potassium-39 + chebi_ontology + (39)19K + (39)K + potassium-39 + CHEBI:52632 + + potassium-39 atom + + + + + potassium-39 + IUPAC + + + + + + (39)19K + IUPAC + + + + + (39)K + IUPAC + + + + + potassium-39 + ChEBI + + + + + + + + + The stable isotope of molybdenum with relative atomic mass 94.905842, 15.9 atom percent natural abundance and nuclear spin 5/2. + 0 + [95Mo] + InChI=1S/Mo/i1-1 + ZOKXTWBITQBERF-BJUDXGSMSA-N + 94.906 + 94.90584 + [95Mo] + molybdenum-95 + chebi_ontology + (95)42Mo + (95)Mo + CHEBI:52633 + + molybdenum-95 + + + + + molybdenum-95 + IUPAC + + + + + + (95)42Mo + IUPAC + + + + + (95)Mo + IUPAC + + + + + + + + + The stable isotope of sodium with relative atomic mass 22.989770, 100 atom percent natural abundance and nuclear spin 3/2. + 0 + [23Na] + InChI=1S/Na/i1+0 + KEAYESYHFKHZAL-IGMARMGPSA-N + 22.990 + 22.98977 + [23Na] + sodium-23 + chebi_ontology + (23)11Na + (23)Na + sodium-23 + CHEBI:52634 + + sodium-23 atom + + + + + sodium-23 + IUPAC + + + + + + (23)11Na + IUPAC + + + + + (23)Na + IUPAC + + + + + sodium-23 + ChEBI + + + + + + + + + The stable isotope of scandium with relative atomic mass 44.955910, 100 atom percent natural abundance and nuclear spin 7/2. + 0 + [45Sc] + InChI=1S/Sc/i1+0 + SIXSYDAISGFNSX-IGMARMGPSA-N + 44.956 + 44.95591 + [45Sc] + scandium-45 + chebi_ontology + (45)21Sc + (45)Sc + scandium-45 + CHEBI:52635 + + scandium-45 atom + + + + + scandium-45 + IUPAC + + + + + + (45)21Sc + IUPAC + + + + + (45)Sc + IUPAC + + + + + scandium-45 + ChEBI + + + + + + + + + The isotope of iodine with relative atomic mass 128.904988, and nuclear spin 7/2. + 0 + [129I] + InChI=1S/I/i1+2 + ZCYVEMRRCGMTRW-NJFSPNSNSA-N + 128.905 + 128.90499 + [129I] + iodine-129 + chebi_ontology + (129)53I + (129)I + iodine-129 + CHEBI:52636 + + iodine-129 atom + + + + + iodine-129 + IUPAC + + + + + + (129)53I + IUPAC + + + + + (129)I + IUPAC + + + + + iodine-129 + ChEBI + + + + + + + + + The stable isotope of europium with relative atomic mass 150.919846, 47.8 atom percent natural abundance and nuclear spin 5/2. + 0 + [151Eu] + InChI=1S/Eu/i1-1 + OGPBJKLSAFTDLK-BJUDXGSMSA-N + 150.920 + 150.91986 + [151Eu] + europium-151 + chebi_ontology + (151)63Eu + (151)Eu + europium-151 + CHEBI:52637 + + europium-151 atom + + + + + europium-151 + IUPAC + + + + + + (151)63Eu + IUPAC + + + + + (151)Eu + IUPAC + + + + + europium-151 + ChEBI + + + + + + + + + The stable isotope of bromine with relative atomic mass 78.918338, 50.69 atom percent natural abundance and nuclear spin 3/2. + 0 + [79Br] + InChI=1S/Br/i1-1 + WKBOTKDWSSQWDR-BJUDXGSMSA-N + 78.918 + 78.91834 + [79Br] + chebi_ontology + (79)35Br + (79)Br + bromine-79 + CHEBI:52743 + + bromine-79 atom + + + + + (79)35Br + IUPAC + + + + + (79)Br + IUPAC + + + + + bromine-79 + ChEBI + + + + + + + + + The stable isotope of germanium with relative atomic mass 72.923459, 7.73 atom percent natural abundance and nuclear spin 9/2. + 0 + [73Ge] + InChI=1S/Ge/i1+0 + GNPVGFCGXDBREM-IGMARMGPSA-N + 72.923 + 72.92346 + [73Ge] + chebi_ontology + (73)32Ge + (73)Ge + germanium-73 + CHEBI:52758 + + germanium-73 atom + + + + + (73)32Ge + IUPAC + + + + + (73)Ge + IUPAC + + + + + germanium-73 + ChEBI + + + + + + + + + The stable isotope of magnesium with relative atomic mass 24.985837, 10.0 atom percent natural abundance and nuclear spin 5/2. + 0 + [25Mg] + InChI=1S/Mg/i1+1 + FYYHWMGAXLPEAU-OUBTZVSYSA-N + 24.986 + 24.98584 + [25Mg] + chebi_ontology + (25)12Mg + (25)Mg + magnesium-25 + CHEBI:52763 + + magnesium-25 atom + + + + + (25)12Mg + IUPAC + + + + + (25)Mg + IUPAC + + + + + magnesium-25 + ChEBI + + + + + + + + + Any metal that is characterized by its rather high atomic mass and density. Although typically occurring in low concentrations, they can be found all throughout the Earth's crust (Commonly, a density of at least 5 g cm(3) is used to define a heavy metal and to differentiate it from other, ''light'' metals). + Wikipedia:Heavy_metals + chebi_ontology + heavy metals + CHEBI:5631 + + heavy metal + + + + + heavy metals + ChEBI + + + + + + + + + A stable isotope of boron with relative atomic mass 10.0129370, 19.9 atom percent natural abundance and nuclear spin 3+. + 0 + [10B] + InChI=1S/B/i1-1 + ZOXJGFHDIHLPTG-BJUDXGSMSA-N + 10.013 + 10.01294 + [10B] + boron-10 + chebi_ontology + (10)B + CHEBI:77014 + + boron-10 atom + + + + + boron-10 + IUPAC + + + + + + (10)B + SUBMITTER + + + + + + + + + A zinc atom in which the nucleus contains 35 neutrons. It has a half-life of 244 days, decaying by emission of a positron (beta(+) decay), and is the most abundant and stable of the 25 known radioisotopes of zinc. + 0 + [65Zn] + InChI=1S/Zn/i1+0 + HCHKCACWOHOZIP-IGMARMGPSA-N + 64.929 + 64.92925 + [65Zn] + CAS:13982-39-3 + PMID:11431342 + PMID:13615323 + PMID:13694484 + PMID:13734409 + PMID:13744376 + PMID:13783426 + PMID:13841044 + PMID:14425466 + PMID:1682403 + PMID:17807441 + PMID:19448268 + ((65)Zn)zinc + chebi_ontology + (65)30Zn + (65)Zn + Zn-65 + zinc, isotope of mass 65 + zinc-65 + CHEBI:82623 + + zinc-65 atom + + + + + CAS:13982-39-3 + ChemIDplus + + + + + PMID:11431342 + Europe PMC + + + + + PMID:13615323 + Europe PMC + + + + + PMID:13694484 + Europe PMC + + + + + PMID:13734409 + Europe PMC + + + + + PMID:13744376 + Europe PMC + + + + + PMID:13783426 + Europe PMC + + + + + PMID:13841044 + Europe PMC + + + + + PMID:14425466 + Europe PMC + + + + + PMID:1682403 + Europe PMC + + + + + PMID:17807441 + Europe PMC + + + + + PMID:19448268 + Europe PMC + + + + + ((65)Zn)zinc + IUPAC + + + + + + (65)30Zn + IUPAC + + + + + (65)Zn + IUPAC + + + + + Zn-65 + ChEBI + + + + + zinc, isotope of mass 65 + ChemIDplus + + + + + zinc-65 + ChemIDplus + + + + + + + + + Any metal which causes the onset of an allergic reaction. + chebi_ontology + allergenic metal + allergenic metals + metal allergens + CHEBI:88184 + + metal allergen + + + + + allergenic metal + ChEBI + + + + + allergenic metals + ChEBI + + + + + metal allergens + ChEBI + + + + + + + diff --git a/src/ontology/imports/obi_import.owl b/src/ontology/imports/obi_import.owl index 5ecc1b7..0bdbf1d 100644 --- a/src/ontology/imports/obi_import.owl +++ b/src/ontology/imports/obi_import.owl @@ -11,9 +11,9 @@ xmlns:terms="http://purl.org/dc/terms/" xmlns:oboInOwl="http://www.geneontology.org/formats/oboInOwl#"> - + - 2022-10-05 + 2023-07-06 diff --git a/src/ontology/imports/obi_terms.txt b/src/ontology/imports/obi_terms.txt index 8e7a66f..9195d7a 100644 --- a/src/ontology/imports/obi_terms.txt +++ b/src/ontology/imports/obi_terms.txt @@ -9,4 +9,4 @@ obo:OBI_0000272 # protocol obo:OBI_0002983 # altitude measurement datum obo:OBI_0001138 # x-ray machine http://purl.obolibrary.org/obo/OBI_0302889 # irradiation - +http://purl.obolibrary.org/obo/OBI_0000299 # has specified output diff --git a/src/ontology/rbo-edit.owl b/src/ontology/rbo-edit.owl index dce54d4..9640f11 100644 --- a/src/ontology/rbo-edit.owl +++ b/src/ontology/rbo-edit.owl @@ -18,6 +18,7 @@ Import() Import() Import() Import() +Import() Import() Import() Import() @@ -79,6 +80,10 @@ SubClassOf(obo:BFO_0000023 obo:BFO_0000017) SubClassOf(obo:CHEBI_33252 ObjectSomeValuesFrom(obo:RO_0002493 obo:RBO_00002118)) +# Class: obo:CHEBI_36080 (protein) + +SubClassOf(obo:CHEBI_36080 obo:CHEBI_33695) + # Class: obo:CHEBI_50906 (role) SubClassOf(obo:CHEBI_50906 obo:BFO_0000017) @@ -87,6 +92,18 @@ SubClassOf(obo:CHEBI_50906 obo:BFO_0000017) SubClassOf(obo:CL_0000000 obo:BFO_0000040) +# Class: obo:CL_0017502 (acidophilic cytoplasm) + +SubClassOf(obo:CL_0017502 obo:GO_0005737) + +# Class: obo:CL_0017503 (basophilic cytoplasm) + +SubClassOf(obo:CL_0017503 obo:GO_0005737) + +# Class: obo:CL_0017504 (polychromatophilic cytoplasm) + +SubClassOf(obo:CL_0017504 obo:GO_0005737) + # Class: obo:DOID_4 (disease) SubClassOf(obo:DOID_4 obo:BFO_0000016) @@ -109,7 +126,6 @@ SubClassOf(obo:PO_0009012 obo:BFO_0000015) # Class: obo:RBO_00002118 (Radioactive decay) -# change to the 115 radiation new thing concept SubClassOf(obo:RBO_00002118 ObjectSomeValuesFrom(obo:OBI_0000299 obo:RBO_00015000)) SubClassOf(obo:RBO_00002118 ObjectMinCardinality(1 obo:OBI_0000293 obo:CHEBI_33252)) @@ -121,16 +137,18 @@ SubClassOf(obo:RBO_00002122 ObjectSomeValuesFrom(obo:RO_0002234 obo:RBO_010016)) SubClassOf(obo:RBO_00005068 ObjectAllValuesFrom(obo:RO_0002404 obo:ENVO_01001023)) -# Class: obo:UBERON_0000000 (processual entity) +# Class: obo:RBO_00015022 (track formation) -SubClassOf(obo:UBERON_0000000 obo:BFO_0000003) +EquivalentClasses(obo:RBO_00015022 ObjectSomeValuesFrom(obo:OBI_0000299 obo:RBO_00015023)) +EquivalentClasses(obo:RBO_00015009 ObjectSomeValuesFrom(obo:RO_0000086 obo:RBO_00015011)) -SubClassOf(obo:CL_0017502 obo:GO_0005737) -SubClassOf(obo:CL_0017503 obo:GO_0005737) -SubClassOf(obo:CL_0017504 obo:GO_0005737) +# Class: obo:SO_0000704 (gene) SubClassOf(obo:SO_0000704 obo:BFO_0000040) -SubClassOf(obo:CHEBI_36080 obo:CHEBI_33695) + +# Class: obo:UBERON_0000000 (processual entity) + +SubClassOf(obo:UBERON_0000000 obo:BFO_0000003) AnnotationAssertion(oboInOwl:hasExactSynonym obo:UO_0000160 "micromole per square meter per second") diff --git a/src/ontology/rbo.Makefile b/src/ontology/rbo.Makefile index ff76146..21d4dcf 100644 --- a/src/ontology/rbo.Makefile +++ b/src/ontology/rbo.Makefile @@ -7,7 +7,11 @@ ##################### CUSTOM IMPORTS######### imports/chebi_import.owl: mirror/chebi.owl imports/chebi_terms_combined.txt - if [ $(IMP) = true ]; then $(ROBOT) extract -i $< -T imports/chebi_terms_combined.txt --force true --method BOT \ + if [ $(IMP) = true ]; then $(ROBOT) extract -i $< -T imports/chebi_terms_combined.txt --force true --method STAR \ + annotate --ontology-iri $(ONTBASE)/$@ $(ANNOTATE_ONTOLOGY_VERSION) --output $@.tmp.owl && mv $@.tmp.owl $@; fi + +imports/chebi_top_import.owl: mirror/chebi.owl + if [ $(IMP) = true ]; then $(ROBOT) extract -i $< --branch-from-terms imports/chebi_terms_top.txt --force true --method MIREOT \ annotate --ontology-iri $(ONTBASE)/$@ $(ANNOTATE_ONTOLOGY_VERSION) --output $@.tmp.owl && mv $@.tmp.owl $@; fi imports/chmo_import.owl: mirror/chmo.owl imports/chmo_terms_combined.txt diff --git a/src/templates/RBO_classes.owl b/src/templates/RBO_classes.owl index 001f625..655bb67 100644 --- a/src/templates/RBO_classes.owl +++ b/src/templates/RBO_classes.owl @@ -202,6 +202,12 @@ + + + + + + @@ -388,11 +394,10 @@ - mixed radiation The samples were exposed to a mixed radiation field consisting of several ions at different energies. The process of exposing the same sample to more than one type and/or energy of radiation, in sequence or simultaneously. - mixed field|mixed radiation - mixed radiation field + mixed field|mixed radiation field + mixed radiation @@ -914,6 +919,7 @@ A study of the impact of radiation on the composition of or processes within the natural or anthropogenic environment. environmental study + A owl:deprecated @@ -1258,7 +1264,7 @@ - + charged particle Charged particles with kinetic energy imparted by natural or artificial means (such as by a particle accelerator) charged particle @@ -1399,10 +1405,10 @@ - Unplanned exposure to naturally occurring radiation (NORM) of any type in any environment . + Exposure to naturally occurring radiation (NORM) of any type in any environment . 0000-0002-5111-7263 Environmental irradiation - Naturally occurring radiation exposure (NORM) + Exposure to naturally ocurring radioactive material @@ -1484,6 +1490,7 @@ Incidental exposure to naturally occurring radiation in a natural or anthropogenic environment, such as geographical areas with high background levels of radiation or specific locations such as Uranium mines. 0000-0002-5111-7263 Unplanned naturally occurring radiation exposure + TRUE @@ -1505,7 +1512,7 @@ Studies relating to human society and the interrelation of social and educational factors with individual thought and behaviour including mental illness. 0000-0002-5111-7263 - Social and psychosocial studies + Social and psychosocial study @@ -1595,7 +1602,7 @@ Studies of the presence of radiation of any type in the natural or anthropogenic environment and its impact on animals, plants, and microorganisms. This includes studies measuring nuclide transfer in the environment, and interaction with meteorological phenomena. This excludes occupational exposure and the human working environment. 0000-0002-5111-7263 - Environmental studies + Environmental study @@ -2153,7 +2160,7 @@ Study of radiation levels and effects in the natural environment. 0000-0002-5111-7263 - Natural environment studies + Natural environment study @@ -2384,7 +2391,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or regulation of the nuclear industries. 0000-0002-5111-7263 - Attitudinal studies nuclear industry risk perception + Attitudinal study of nuclear industry risk perception @@ -2395,7 +2402,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ecological integrity towards natural or anthropogenic ionising radiation in the environment. 0000-0002-5111-7263 - Attitudinal studies towards ionising radiation in the environment + Attitudinal study towards ionising radiation in the environment @@ -2406,7 +2413,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ecological integrity towards natural or anthropogenic non-ionising radiation in the natural environment. 0000-0002-5111-7263 - Attitudinal studies towards non-ionising radiation in the environment + Attitudinal study towards non-ionising radiation in the environment @@ -2417,7 +2424,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety and efficacy in a clinical context where radiation is used for diagnostic or therapeutic procedures.. 0000-0002-5111-7263 - Attitudinal studies towards medical radiation procedures + Attitudinal study towards medical radiation procedures @@ -2428,7 +2435,7 @@ Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety towards natural or anthropogenic non-ionising radiation in the occupational environment. 0000-0002-5111-7263 - Attitudinal studies towards radiation in the occupational environment + Attitudinal study towards radiation in the occupational environment @@ -2694,7 +2701,7 @@ Unplanned irradiation that is non-anthropogenic in origin - Unplanned non-anthropogenic irradiation + Unplanned naturally occurring radiation exposure @@ -2857,7 +2864,7 @@ sham irradiation - A protocol in which a sample is kept under conditions identical to irradiated samples, without exposure + Sham irradiation refers to a procedure in which participants or subjects in an experiment are exposed to simulated radiation, mimicking precisely the conditions of actual irradiation. The purpose of using sham irradiation is to create a control group that experiences the non-specific effects of the experimental setup, while excluding the specific effects associated with radiation exposure. Jack Miller sham sham irradiation @@ -3117,10 +3124,11 @@ HZE - Fully ionized atomic nuclei with 2 or more protons and energies in excess of tens of MeV per nucleon + Fully ionized atomic nucleus with 2 or more protons and energies in excess of tens of MeV per nucleon Jack Miller HZE - highly charged energetic nuclei + highly charged energetic nuclei + highly charged energetic nucleus @@ -3396,7 +3404,7 @@ - + The path of a particle in matter, delineated by sites where the particle deposits energy. particle track @@ -3464,6 +3472,83 @@ + + + + + Sham irradiation in which an identical irradiation protocol (with the exception of the administration of the radiation exposure) is not followed in every respect. + Use approximate sham irradiation when at least one aspect of the irradiation (with the exception of the administration of the radiation exposure) is not followed precisely. For example, Not placing an organism or sample in a beam line for the same length of time as the irradiated organism(s) or sample(s) were left in the beam. + approximate sham irradiation + + + + + + + + + Experimental internal radiation exposure of rodents to radon gas through inhalation. + Exposure to an inhaled, ingested, injected or implanted source of radiation of any origin as part of a planned or accidental process. + internal radiation exposure + + + + + + + + + Mice exposed to external radiation from a Sr source. + Exposure to an external source of radiation of any origin or type. + https://orcid.org/0000-0002-5111-7263 + external radiation exposure + + + + + + + + + Sham irradiation in which an identical irradiation protocol is followed in every respect, with the exception of the administration of the radiation exposure. + Use complete sham irradiation when all steps of an irradiation protocol are followed for sham control group (with the exception of administration of the radiation exposure). + complete sham irradiation + + + + + + + + + + Planned exposure of an entity to radiation of any type, for example as part of a medical or experimental procedure with the intention of exposing the entity to radiation energy internally by the ingestion, inhalation or implantation of a source of radiation. + https://orcid.org/0000-0002-5111-7263 + Research subjects participating in a clinical trial using an internally implanted radiation source have an internal experimental radiation exposure + internal experimental radiation exposure + + + + + + + + + The direct or indirect transfer of energy from radiation to a medium through ionisation or excitation of the atoms of the medium. + energy deposition event + + + + + + + + + track formation + + + + diff --git a/src/templates/RBO_classes.tsv b/src/templates/RBO_classes.tsv index f599992..d4b25a2 100644 --- a/src/templates/RBO_classes.tsv +++ b/src/templates/RBO_classes.tsv @@ -9,7 +9,7 @@ obo:RBO_00000011 active dosimeter A radiation measuring device which records obo:RBO_00000012 passive dosimeter A radiation measuring device which integrates the amount of radiation to which it is exposed. Passive detectors are interrogated at a later time to determine the dose. Thermoluminescent dosimeters and plastic nuclear track detectors are passive detectors. obo:RBO_00000115 obo:RBO_00000013 background ionizing radiation The amount of ionizing radiation to which a member of the population on Earth is exposed from natural sources, such as terrestrial radiation from naturally-occurring radionuclides in the soil, cosmic radiation originating in outer space, and naturally-occurring ra obo:RBO_00015000 obo:RBO_00000014 effective dose The sum of the equivalent doses to all organs in the body, each adjusted to account for the sensitivity of the organ to radiation. Effective dose is calculated for the whole body. Effective dose is expressed in millisieverts (mSv). The effective dose was calculated to be 300 mSv. radiation dose -obo:RBO_00000015 mixed radiation field mixed radiation The process of exposing the same sample to more than one type and/or energy of radiation, in sequence or simultaneously. The samples were exposed to a mixed radiation field consisting of several ions at different energies. particle accelerator radiation mixed field|mixed radiation +obo:RBO_00000015 mixed radiation The process of exposing the same sample to more than one type and/or energy of radiation, in sequence or simultaneously. The samples were exposed to a mixed radiation field consisting of several ions at different energies. particle accelerator radiation mixed field|mixed radiation field obo:RBO_00000016 radiation environment Radiation classified by where the exposure to the radiation is occurring. ENVO:01000254 obo:RBO_00000017 Earth surface That part of the Earth exposed to the Earth atmosphere. radiation environment obo:RBO_00000018 Earth atmosphere The region between the Earth's surface and an altitude of approximately 100 km radiation environment @@ -57,7 +57,7 @@ obo:RBO_00000080 dentist medical professional obo:RBO_00000081 radiologist medical professional obo:RBO_00000082 radiobiology study type The theme or modality of an experimental, theoretical, critical or summative study involving radiation, radioactive materials including their impacts on orgnisms and society. OBI:0000011 obo:RBO_00000083 epidemiological study An epidemiological study is the study (scientific, systematic, and data-driven) of the distribution (frequency, pattern) and determinants (causes, risk factors) of health-related states and events (not just diseases) in specified populations (neighborhood, school, city, state, country, global) https://www.cdc.gov/csels/dsepd/ss1978/lesson1/section1.html radiobiology study type -obo:RBO_00000084 environmental study A study of the impact of radiation on the composition of or processes within the natural or anthropogenic environment. radiobiology study type +obo:RBO_00000084 environmental study A study of the impact of radiation on the composition of or processes within the natural or anthropogenic environment. radiobiology study type A owl:deprecated obo:RBO_00000085 lifespan study A study who endpoint is the lifespan of the organism under investifgation. radiobiology study type obo:RBO_00000086 carcinogenesis study A study of the effect of agents including radiation, seperately or together, on the incidence or type of neoplasia or pre-neoplasia. radiobiology study type obo:RBO_00000087 tissue damage study A study in which the structural or processual damage to normal tissue caused by radiation is assessed. Often by histopathology or molecular profiling. radiobiology study type @@ -77,7 +77,7 @@ obo:RBO_00000100 gene expression study A study of the effects of radiation on obo:RBO_00000101 proteomics study A study of the effects of radiation on the proteome or individual proteins. radiobiology study type obo:RBO_00000102 marker discovery study A study that aims at the discovery of protein, RNA or other molecular entities or modifcations that can act as reliable surrogates for the prediction or measurement of the effects of radiation or the response of the organism to radiation. radiobiology study type obo:RBO_00000103 therapeutics study A study that aims at the discovery, development or assessment of efficacy of therapeutic agents or processes designed to mitigate or cure the effects of radiation exposure. radiobiology study type A owl:deprecated -obo:RBO_00000104 survival study A study that uses survival as an endpoint. Generally applicable to animal studies rather than human studies which would use the "lifespan" measure (RBO:00000085) radiobiology study type +obo:RBO_00000104 survival study "A study that uses survival as an endpoint. Generally applicable to animal studies rather than human studies which would use the ""lifespan"" measure (RBO:00000085)" radiobiology study type obo:RBO_00000105 metabolomics study A study of the effects of radiation on the metabolome or individual metabolites. radiobiology study type obo:RBO_00000106 nuclear accident study A study of the contributing factors consequences and prevention of nuclear accidents radiobiology study type A owl:deprecated obo:RBO_00000107 toxicity study A study of the toxicity of chemical or biological agents on cells or whole organisms. radiobiology study type @@ -90,7 +90,7 @@ obo:RBO_00000113 low linear energy transfer radiation X and gamma rays or lig obo:RBO_00000114 ionizing electromagnetic radiation Electromagnetic radiation having sufficient energy to remove one or more electrons from an atom obo:RBO_00000116 obo:RBO_00000115 radiation dosimeter device radiation dosimeter radiation dosimeter A device that is used to measure the amount of ionizing radiation exposure or absorption. NCIT OBI:0000968 dosimeter NCIT:C150121 obo:RBO_00000116 ionizing radiation ionising radiation Particle or electromagnetic radiation with sufficient energy to liberate one or more electrons from an atom. obo:RBO_00015000 ionising radiation NCIT:C17052 -obo:RBO_00000117 charged particle radiation charged particle charged particle Charged particles with kinetic energy imparted by natural or artificial means (such as by a particle accelerator) obo:RBO_00000116 NCIT:C18982 +obo:RBO_00000117 charged particle radiation charged particle charged particle Charged particles with kinetic energy imparted by natural or artificial means (such as by a particle accelerator) obo:RBO_00015000 NCIT:C18982 obo:RBO_00000118 risk estimate OBI:0001909 NCIT:C19015 obo:RBO_00000119 lifetime risk estimate obo:RBO_00000118 NCIT:C19662 obo:RBO_00000120 gamma radiation electromagnetic radiation with photon energies greater than approximately 100 keV http://son.nasa.gov/tass/content/electrospectrum.htm obo:RBO_00000114 NCIT:C44386 @@ -116,7 +116,7 @@ obo:RBO_010012 heavy ion An atomic nucleus, fully stripped of its orbital ele obo:RBO_010013 linear energy transfer LET The energy deposited by an ionizing charged particle or photon in any medium per unit path length. NCRP Glossary (https://ncrponline.org/wp-content/themes/ncrp/PDFs/NCRP-Composite-Glossary.pdf) Biological effects are a function of LET. Jack Miller IAO:0000109 LET obo:RBO_010014 organ dose The mean absorbed radiation dose in a specified tissue or organ of the human body. NCRP Glossary (https://ncrponline.org/wp-content/themes/ncrp/PDFs/NCRP-Composite-Glossary.pdf) Radiation protection standards take into account organ dose as well as whole body dose. Jack Miller radiation dose obo:RBO_010015 quality factor Dimensionless factor developed for purposes of radiation protection and assessing health risks in general terms that accounts for the relative biological effectiveness of different radiations in producing stochastic effects and is used to relate absorbed NCRP Glossary (https://ncrponline.org/wp-content/themes/ncrp/PDFs/NCRP-Composite-Glossary.pdf) Neutrons have a high quality factor compared to photons. Jack Miller OBI:0001909 -obo:RBO_010016 radiation dose A measurement datum of the quantity of radiation absorbed by a substance or organism. The term "radiation dose" may for example refer to absorbed dose, organ dose, dose equivalent or equivalent dose, depending upon context and weighting factor(s). The samples received a dose of 1 Gy. (The use of the gray unit implies that "dose" refers to a measured quantity, typically absorbed dose or organ dose.)|The samples received a dose of 1 Sv. (The use of the sievert unit implies that "dose" refers to a der Jack Miller OBI:0000984 +obo:RBO_010016 radiation dose "A measurement datum of the quantity of radiation absorbed by a substance or organism. The term ""radiation dose"" may for example refer to absorbed dose, organ dose, dose equivalent or equivalent dose, depending upon context and weighting factor(s)." "The samples received a dose of 1 Gy. (The use of the gray unit implies that ""dose"" refers to a measured quantity, typically absorbed dose or organ dose.)|The samples received a dose of 1 Sv. (The use of the sievert unit implies that ""dose"" refers to a der" Jack Miller OBI:0000984 obo:RBO_010017 radiation quality Is a quality of radiation that reflects the fluence spectrum of charged and neutral particles within the material or medium where dose is being deposited. NCRP Glossary (https://ncrponline.org/wp-content/themes/ncrp/PDFs/NCRP-Composite-Glossary.pdf) and see https://melodi-online.eu/wp-content/uploads/2021/04/02-What-is-radiation-quality-Goodhead.pdf Radiation quality is often expressed in terms of the linear energy transfer of the ionising particles that deliver the absorbed dose. Rossi, Harald H. Specification of Radiation Quality. Radiation Research, vol. 10, no. 5, Radiation Research Society, 1959, pp. 522 31, https://doi.org/10.2307/3570787. But this is an over simplification. Jack Miller PATO:0001018 TRUE obo:RBO_010018 radiation weighting factor A factor used to allow for differences in the biological effectiveness between different radiations when calculating equivalent dose (H_T) (see equivalent dose). These factors are independent of the tissue or organ irradiated. NCRP Glossary (https://ncrponline.org/wp-content/themes/ncrp/PDFs/NCRP-Composite-Glossary.pdf) Radiation weighting factors may change as more data on biological effects are obtained. Jack Miller OBI:0001909 obo:RBO_010019 relative biological effectiveness RBE Factor used to compare the biological effectiveness of absorbed doses from different types of ionizing radiation, determined experimentally. RBE is the ratio of the absorbed dose of a reference radiation to the absorbed dose of the radiation in question r NCRP Glossary (https://ncrponline.org/wp-content/themes/ncrp/PDFs/NCRP-Composite-Glossary.pdf) Neutrons have been found to have a higher RBE than electrons. Jack Miller IAO:0000109 RBE @@ -126,7 +126,7 @@ obo:RBO_00005011 absorbed radiation dose rate The amount of energy from any t obo:RBO_00005012 ionizing radiation energy The kinetic energy carried by a particle or photon of ionizing radiation. Jack Miller obo:RBO_00000116 obo:RBO_00005013 x-ray radiation x-ray x-ray Electromagnetic radiation with photon energies approximately between 0.1 and 120 keV. The upper end of the x-ray spectrum overlaps with the lower end of the gamma ray spectrum. http://son.nasa.gov/tass/content/electrospectrum.htm Jack Miller obo:RBO_00000114 obo:RBO_00005014 radiation source A material entity which emits radiation Jack Miller material entity -obo:RBO_00005015 sham irradiation sham irradiation sham A protocol in which a sample is kept under conditions identical to irradiated samples, without exposure Jack Miller obo:OBI_0000272 +obo:RBO_00005015 sham irradiation sham irradiation sham Sham irradiation refers to a procedure in which participants or subjects in an experiment are exposed to simulated radiation, mimicking precisely the conditions of actual irradiation. The purpose of using sham irradiation is to create a control group that experiences the non-specific effects of the experimental setup, while excluding the specific effects associated with radiation exposure. Jack Miller obo:OBI_0000272 obo:RBO_00005016 radiation fractionation protocol fractionation protocol fractionation protocol A protocol for administering a total radiation dose in two or more increments separated by a specified time interval Jack Miller obo:IAO_0000104 obo:RBO_00005017 cis-lunar space cis-lunar space The region of space between the Earth and the Moon Jack Miller obo:RBO_00000016 obo:RBO_00005018 lunar orbit lunar orbit A region of space defined by a regular, repeating path of a specified object about Earth's moon Jack Miller obo:RBO_00000016 @@ -143,11 +143,11 @@ obo:RBO_00005028 irradiation protocol irradiation protocol A protocol for admi obo:RBO_00005029 radiation fraction radiation fraction fraction One of the series of individual doses administered to a sample in a fractionated irradiation. Jack Miller dose fraction obo:RBO_00005030 radiation fraction interval radiation fraction interval Time between fractions in a fractionated irradiation. Jack Miller dose rate obo:RBO_00005031 high altitude high altitude The region of the atmosphere above 8000 feet above sea level. Altitudes above 12000 feet are sometimes referred to as very high altitude, and above 18000 feet as extremely high altitude. https://www.medicinenet.com/high_altitude/definition.htm Jack Miller OBI:0002983 -obo:RBO_00005032 sham-irradiated sham A quality of a biotic or abiotic sample or individual which is part of an experiment that tests the effects of radiation on organisms or materials by isolating variables as dictated by the scientific method in order to make a conclusion about the effect of such variables. In sham irradiation the precise treatment of the sample must be identical to that of the experimental samples and should be made explicit in the description of the method. The class should be used in cases where it is clear that the control sample was treated in precisely the same way as the experimental samples or sham irradiation is specified. It is therefore a more restricted quality definition than "non-irradiated". It is likely to be used more often with external radiation exposure or exposure to a beam, and with a biological rather than abiotic sample. Jack Miller non-irradiated +obo:RBO_00005032 sham-irradiated sham A quality of a biotic or abiotic sample or individual which is part of an experiment that tests the effects of radiation on organisms or materials by isolating variables as dictated by the scientific method in order to make a conclusion about the effect of such variables. In sham irradiation the precise treatment of the sample must be identical to that of the experimental samples and should be made explicit in the description of the method. "The class should be used in cases where it is clear that the control sample was treated in precisely the same way as the experimental samples or sham irradiation is specified. It is therefore a more restricted quality definition than ""non-irradiated"". It is likely to be used more often with external radiation exposure or exposure to a beam, and with a biological rather than abiotic sample." Jack Miller non-irradiated obo:RBO_00005033 parabolic flight aircraft parabolic flight Vomit Comet An aircraft which flies a series of parabolic arcs to simulate micrgravity. Jack Miller ENVO:01001488 obo:RBO_00005034 high altitude research aircraft An aircraft which flies at altitudes greater than commercial aircraft altitudes for research purposes. Jack Miller ENVO:01001488 obo:RBO_00005035 uncrewed aerial vehicle UAV UAV An research aircraft designed to operate without crew members, either autonomously or under control from a ground station Jack Miller ENVO:01001488 -obo:RBO_00005036 highly charged energetic nuclei HZE HZE Fully ionized atomic nuclei with 2 or more protons and energies in excess of tens of MeV per nucleon Jack Miller CHEBI:36347 +obo:RBO_00005036 highly charged energetic nucleus HZE HZE|highly charged energetic nuclei Fully ionized atomic nucleus with 2 or more protons and energies in excess of tens of MeV per nucleon Jack Miller CHEBI:36347 obo:RBO_00005037 adaptive radiation response study adaptive A study of a response to radiation conditioned by prior administration of radiation of a different type and/or at a different dose or dose rate Jack Miller obo:RBO_00000082 obo:RBO_00005038 average fractionated dose rate The total dose administered in a series of radiation fractions divided by the elapsed time between the beginning of the first exposure fraction and the end of the last exposure fraction Jack Miller dose rate obo:RBO_00005039 gamma irradiator A device which exposes samples to gamma radiation. Jack Miller radiation source @@ -168,15 +168,15 @@ obo:RBO_00002001 Accidental radiation exposure Accidental irradiation Unplanne obo:RBO_00002007 Anthropogenic radiation exposure Exposure to human generated radiation Exposure to ionising radiation created by a man-made machine or exposure to a fixed source. For example a cobalt source, an X ray machine, an acceleratororf a nucler weapon. 0000-0002-5111-7263 Radiation exposure obo:RBO_00002002 Planned radiation exposure Planned irradiation Planned exposure of an entity to radiation of any type, for example as part of a medical or experimental procedure with the intention of exposing the entity to radiation energy internally or externally. 0000-0002-5111-7263 Anthropogenic radiation exposure|planned process obo:RBO_00002003 Medical diagnostic radiation exposure Diagnostic irradiation Planned exposure of an organism to radiation of any type, internally or externally, with the intention to effect a diagnosis of disease. 0000-0002-5111-7263 Planned anthropogenic radiation exposure -obo:RBO_00002004 Naturally occurring radiation exposure (NORM) Environmental irradiation Unplanned exposure to naturally occurring radiation (NORM) of any type in any environment . 0000-0002-5111-7263 Radiation exposure +obo:RBO_00002004 Exposure to naturally ocurring radioactive material Environmental irradiation Exposure to naturally occurring radiation (NORM) of any type in any environment . 0000-0002-5111-7263 Radiation exposure obo:RBO_00002005 Medical therapeutic radiation exposure Therapeutic irradiation Planned exposure of an organism to radiation of any type, internally or externally, with the intention to effect a cure or mitigation of disease. 0000-0002-5111-7263 Planned anthropogenic radiation exposure obo:RBO_00002006 Accidental non-medical anthropogenic radiation exposure Accidental man-made radiation exposure Unplanned exposure to anthropogenic radiation of any type in any environment ; for example radiation from nuclear waste, nuclear industry discharge or weapons. 0000-0002-5111-7263 Accidental anthropogenic radiation exposure obo:RBO_00002008 Planned anthropogenic radiation exposure Planned exposure to radiation generated through a device or exposure to a source emitting ionising radiation 0000-0002-5111-7263 planned process|Anthropogenic radiation exposure obo:RBO_00002009 Accidental anthropogenic radiation exposure Accidental or incidental exposure to radiation from a man made process or machine. Covers both radiation accidents and routine occupational exposure. 0000-0002-5111-7263 Anthropogenic radiation exposure obo:RBO_00002010 Accidental medical anthropogenic radiation exposure Accidental exposure occurring during medical therapy or diagnostics, for example medical radiation accidents or overdoses. 0000-0002-5111-7263 Accidental anthropogenic radiation exposure -obo:RBO_00002011 Unplanned naturally occurring radiation exposure Incidental exposure to naturally occurring radiation in a natural or anthropogenic environment, such as geographical areas with high background levels of radiation or specific locations such as Uranium mines. 0000-0002-5111-7263 obo:RBO_00002004 +obo:RBO_00002011 Unplanned naturally occurring radiation exposure Incidental exposure to naturally occurring radiation in a natural or anthropogenic environment, such as geographical areas with high background levels of radiation or specific locations such as Uranium mines. 0000-0002-5111-7263 obo:RBO_00002004 TRUE obo:RBO_00002012 Planned naturally occurring radiation exposure Deliberate or knowing exposure to naturally occurring radiation in a natural or anthropogenic environment, such as a radon spa. 0000-0002-5111-7263 obo:RBO_00002004 -obo:RBO_00002013 Social and psychosocial studies Studies relating to human society and the interrelation of social and educational factors with individual thought and behaviour including mental illness. 0000-0002-5111-7263 radiobiology study type +obo:RBO_00002013 Social and psychosocial study Studies relating to human society and the interrelation of social and educational factors with individual thought and behaviour including mental illness. 0000-0002-5111-7263 radiobiology study type obo:RBO_00002015 Mass media study Studies on the distribution of information or opinion by technological means of communication that reach large numbers of people. 0000-0002-5111-7263 radiobiology study type http://purl.biolontology.org/ontology/CSP/1580-0981 obo:RBO_00002016 Preparedness study Studies on the civil, legal, and political preparedness for accidental or deliberate release of radioactive materials or radiation into the environment. 0000-0002-5111-7263 radiobiology study type obo:RBO_00002017 Clinical study Studies in which research is conducted with human subjects or on material of human origin in which the investigator directly interacts with human subjects, including the dveelopment of new technologies, understanding of the mechanisms of disease, therapy, clinical trials, epidemiology behaviousrand health services research. 0000-0002-5111-7263 radiobiology study type http://purl.bioontology.org/ontology/CSP/4006-0105 @@ -184,23 +184,23 @@ obo:RBO_00002018 Legal and governance study Study of the laws, statutes, ordi obo:RBO_00002019 Security and law enforcement study Studies relating to organisations and processes concerned with freedom from or resilience towards potential harm caused by hostile intent or circumstances (for example terrorism and illegal release of radioactive substances or radiation) towards the natural environment or human population, and the enforcement of relevant laws and international treaties. 0000-0002-5111-7263 radiobiology study type obo:RBO_00002020 Cancer study A study whose intention is to discover knowledge concerning the origins, nature diagnosis or therapy for neoplastic disease and cancer. This includes studies in humans, model organisms, the laboratory and in silico. This class includes experimental and epidemiological studies specifically aimed at cancer. 0000-0002-5111-7263 radiobiology study type obo:RBO_00002021 Study modality The specific manner, characteristic, pattern of application, or the employment of any technology, approach or formal procedure to implement the study plan to generate a study type. 0000-0002-5111-7263 radiobiology study type -obo:RBO_00002022 Environmental studies Studies of the presence of radiation of any type in the natural or anthropogenic environment and its impact on animals, plants, and microorganisms. This includes studies measuring nuclide transfer in the environment, and interaction with meteorological phenomena. This excludes occupational exposure and the human working environment. 0000-0002-5111-7263 radiobiology study type +obo:RBO_00002022 Environmental study Studies of the presence of radiation of any type in the natural or anthropogenic environment and its impact on animals, plants, and microorganisms. This includes studies measuring nuclide transfer in the environment, and interaction with meteorological phenomena. This excludes occupational exposure and the human working environment. 0000-0002-5111-7263 radiobiology study type obo:RBO_00002023 Nuclear industry study Studies concerned with the regulation, monitoring and operation of the nuclear industry. For example nuclear power station and reprocessing plants, isotope purification and manufactore, weapons manufacture and testing. This includes occupation health studies, impact of accidental or deliberate release on the natural or man made environment and impact on organisms specifically affected directly or indirectly by contamination. 0000-0002-5111-7263 radiobiology study type obo:RBO_00002024 Laboratory study Research done in a laboratory. A laboratory study may use special equipment and cells or animals to investigate the effects of an experimental perturbation, discover fundamental molecular mechanisms, assay biological substances, or find out if a drug, procedure, or treatment is likely to be useful in humans. A laboratory investigation is often characterised by a hypothesis and is carried out with controls. 0000-0002-5111-7263 radiobiology study type http://ncicb.nci.nih.gov/xml/owl/EVS/Thesaurus.owl#C28278 -obo:RBO_00002025 Attitudinal study Study of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ethicolegal constructs surrounding radiation and radiation safety and regulation. 0000-0002-5111-7263 Social and psychosocial studies http://purl.bioontology.org/ontology/CSP/2482-9501 -obo:RBO_00002026 Communication study Study concerning exchange or transmission of thoughts, messages, or information between people or between authorities and the general public (for example educational information, risk communication, safety communication) concerning exposure to and use of radiation. 0000-0002-5111-7263 Social and psychosocial studies -obo:RBO_00002027 Community study A study focussed on a set of people with some shared characteristic. The substance of shared element varies widely, from geography to a situation to interest to lives and values. The term is widely used to evoke sense of collectivity. For example communities collectively exposed to radioactive environmental contamination. 0000-0002-5111-7263 Social and psychosocial studies -obo:RBO_00002028 Political and psephological study The study of political involvement in radiation and nuclear regulation, military use, and safety as shown by inclusion in political manifestos and messaging by established or informal groups and its impact on voting patterns and democracy. 0000-0002-5111-7263 Social and psychosocial studies -obo:RBO_00002029 Psychometric study A study measuring "psychological" aspects of a person such as knowledge, skills, abilities, attitudes, or personality using defined scales. 0000-0002-5111-7263 Social and psychosocial studies -obo:RBO_00002030 Behavioural study A study of human or animal activity, in terms of motivation, direction, result, emotion, perception, or etiology. 0000-0002-5111-7263 Social and psychosocial studies -obo:RBO_00002031 Sociological study A study dealing with group relationships, patterns of collective behavior, and social organization. 0000-0002-5111-7263 Social and psychosocial studies -obo:RBO_00002032 Social science and humanities study Studies involving fields of inquiry into human constructs and concerns as opposed to natural processes . These are traditionally the study of literature, philosophy, and religion. Included in this definition are sociological studies, especially those concerned with the social impact of the humanities. 0000-0002-5111-7263 Social and psychosocial studies -obo:RBO_00002033 Perceptions, expectations and behaviours study Specifically an attitudinal study looking at how perception, for example of risk, and expectations affect behaviour. 0000-0002-5111-7263 Social and psychosocial studies -obo:RBO_00002034 Holistic approaches to governance study Sociological, attitudinal, ethocolegal and regulatory approaches to governance of radiation and radioactive substance use. 0000-0002-5111-7263 Social and psychosocial studies -obo:RBO_00002035 Responsible research and innovation study Studies on policy concerning socially and ethically responsible research and innovation 0000-0002-5111-7263 Social and psychosocial studies -obo:RBO_00002036 Stakeholder engagement study Studies of the engagement between an organisational entity and those groups or individuals potentially or actually impacted by the actions of that entity over a range of activities and approaches. 0000-0002-5111-7263 Social and psychosocial studies -obo:RBO_00002037 Risk and health communication study Study concerning the modes, efficacy and response to communication of risk and health impacts of radiation in all aspects. 0000-0002-5111-7263 Social and psychosocial studies -obo:RBO_00002038 Radiological protection culture study Studies concenring the attitudes to and practices of radiological protection in defined groups of people. For example the nuclear industry of a country or within a specific laboratory. 0000-0002-5111-7263 Social and psychosocial studies +obo:RBO_00002025 Attitudinal study Study of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ethicolegal constructs surrounding radiation and radiation safety and regulation. 0000-0002-5111-7263 Social and psychosocial study http://purl.bioontology.org/ontology/CSP/2482-9501 +obo:RBO_00002026 Communication study Study concerning exchange or transmission of thoughts, messages, or information between people or between authorities and the general public (for example educational information, risk communication, safety communication) concerning exposure to and use of radiation. 0000-0002-5111-7263 Social and psychosocial study +obo:RBO_00002027 Community study A study focussed on a set of people with some shared characteristic. The substance of shared element varies widely, from geography to a situation to interest to lives and values. The term is widely used to evoke sense of collectivity. For example communities collectively exposed to radioactive environmental contamination. 0000-0002-5111-7263 Social and psychosocial study +obo:RBO_00002028 Political and psephological study The study of political involvement in radiation and nuclear regulation, military use, and safety as shown by inclusion in political manifestos and messaging by established or informal groups and its impact on voting patterns and democracy. 0000-0002-5111-7263 Social and psychosocial study +obo:RBO_00002029 Psychometric study "A study measuring ""psychological"" aspects of a person such as knowledge, skills, abilities, attitudes, or personality using defined scales." 0000-0002-5111-7263 Social and psychosocial study +obo:RBO_00002030 Behavioural study A study of human or animal activity, in terms of motivation, direction, result, emotion, perception, or etiology. 0000-0002-5111-7263 Social and psychosocial study +obo:RBO_00002031 Sociological study A study dealing with group relationships, patterns of collective behavior, and social organization. 0000-0002-5111-7263 Social and psychosocial study +obo:RBO_00002032 Social science and humanities study Studies involving fields of inquiry into human constructs and concerns as opposed to natural processes . These are traditionally the study of literature, philosophy, and religion. Included in this definition are sociological studies, especially those concerned with the social impact of the humanities. 0000-0002-5111-7263 Social and psychosocial study +obo:RBO_00002033 Perceptions, expectations and behaviours study Specifically an attitudinal study looking at how perception, for example of risk, and expectations affect behaviour. 0000-0002-5111-7263 Social and psychosocial study +obo:RBO_00002034 Holistic approaches to governance study Sociological, attitudinal, ethocolegal and regulatory approaches to governance of radiation and radioactive substance use. 0000-0002-5111-7263 Social and psychosocial study +obo:RBO_00002035 Responsible research and innovation study Studies on policy concerning socially and ethically responsible research and innovation 0000-0002-5111-7263 Social and psychosocial study +obo:RBO_00002036 Stakeholder engagement study Studies of the engagement between an organisational entity and those groups or individuals potentially or actually impacted by the actions of that entity over a range of activities and approaches. 0000-0002-5111-7263 Social and psychosocial study +obo:RBO_00002037 Risk and health communication study Study concerning the modes, efficacy and response to communication of risk and health impacts of radiation in all aspects. 0000-0002-5111-7263 Social and psychosocial study +obo:RBO_00002038 Radiological protection culture study Studies concenring the attitudes to and practices of radiological protection in defined groups of people. For example the nuclear industry of a country or within a specific laboratory. 0000-0002-5111-7263 Social and psychosocial study obo:RBO_00002039 Genetic population study Genetic study done at the population level or among population groups, generally to find the cause, incidence or spread of a disease or to see the response to a treatment, nutrition or environment. 0000-0002-5111-7263 epidemiological study http://ncicb.nci.nih.gov/xml/owl/EVS/Thesaurus.owl#C16160 obo:RBO_00002040 Prospective study A type of study in which participants are enrolled into the study before they develop the disease or outcome in question. 0000-0002-5111-7263 epidemiological study http://ncicb.nci.nih.gov/xml/owl/EVS/Thesaurus.owl#C142646 obo:RBO_00002041 Registry study Observational studies which include an organized system that uses observational methods to collect uniform data (clinical and other) prospectively for a population defined by a particular disorder/disease, condition (including susceptibility to a disorder), or exposure (including products, health care services, and/or procedures) and that serves a predetermined scientific, clinical, or policy purpose. Patient registries may be single purpose or on-going data collection programs that address one or more questions. (AHRQ) An observational study that is also considered to be a Patient Registry. 0000-0002-5111-7263 epidemiological study http://purl.obolibrary.org/obo/NCIT_C129000 @@ -233,16 +233,16 @@ obo:RBO_00002067 Monitoring technologies and metrology study Study concerning obo:RBO_00002068 Radiochemistry study Study of the chemistry of radioactive materials including radioactive tracer studies of metabolic processes 0000-0002-5111-7263 Study modality obo:RBO_00002069 Policy development study Study of the development and implementation of public policy towards issues involving radiation 0000-0002-5111-7263 Study modality obo:RBO_00002070 Acoustic radiation study Study of the effects of acoustic radiation on cellular and organismal physiology and the effects of acoustic radiation emitted in response to exposure to ionising radiation. 0000-0002-5111-7263 Study modality -obo:RBO_00002071 Environmental study_ Abiotic_anthropogenic Study of radiation levels and effects in the human built environment. 0000-0002-5111-7263 Environmental studies -obo:RBO_00002072 Natural environment studies Study of radiation levels and effects in the natural environment. 0000-0002-5111-7263 Environmental studies -obo:RBO_00002073 Ecological population modelling study The development and use of mathematical models and systems analysis for the description of naturally occurring non-human populations, and applications to measuring the effects of radiological contamination. 0000-0002-5111-7263 Environmental studies -obo:RBO_00002074 Ecotoxicology study The study of environmental contamination with radiation and radioactive substances and the toxic effects on the ecosystem either through chemical toxicity or radiation exposure. 0000-0002-5111-7263 Environmental studies -obo:RBO_00002075 Environmental Radon study The study of environmental contamination with radon and the toxic effects on biota including humans. Both natural and anthropogenic environments. Includes radiometrics, safety policies and mitigation technologies. 0000-0002-5111-7263 Environmental studies -obo:RBO_00002076 Radionuclide dispersal modelling study Mathematical modelling of radionuclide transfer and dispersal processes in water, earth or air, either directly or through the mediation of biota. 0000-0002-5111-7263 Environmental studies -obo:RBO_00002077 Naturally occurring radioactive materials study Study of the ocurrence, levels and effects of naturally occurring radioactive materials such as Radon. 0000-0002-5111-7263 Environmental studies -obo:RBO_00002078 Environmental radiation monitoring study Study involving the measurement of radiation levels, or concentration of radionuclides, in the natural or man made environment. Usually in a time series. 0000-0002-5111-7263 Environmental studies -obo:RBO_00002079 Environmental radionuclide transfer study Study concerned with the measurement of transfer of radionuclides to biota from the environment. 0000-0002-5111-7263 Environmental studies -obo:RBO_00002080 Non ionising electromagnetic radiation study Any study concenrd with the prevalence or effects on non-ionising radiations such as UV, acoustic, or RF. 0000-0002-5111-7263 Environmental studies +obo:RBO_00002071 Environmental study_ Abiotic_anthropogenic Study of radiation levels and effects in the human built environment. 0000-0002-5111-7263 Environmental study +obo:RBO_00002072 Natural environment study Study of radiation levels and effects in the natural environment. 0000-0002-5111-7263 Environmental study +obo:RBO_00002073 Ecological population modelling study The development and use of mathematical models and systems analysis for the description of naturally occurring non-human populations, and applications to measuring the effects of radiological contamination. 0000-0002-5111-7263 Environmental study +obo:RBO_00002074 Ecotoxicology study The study of environmental contamination with radiation and radioactive substances and the toxic effects on the ecosystem either through chemical toxicity or radiation exposure. 0000-0002-5111-7263 Environmental study +obo:RBO_00002075 Environmental Radon study The study of environmental contamination with radon and the toxic effects on biota including humans. Both natural and anthropogenic environments. Includes radiometrics, safety policies and mitigation technologies. 0000-0002-5111-7263 Environmental study +obo:RBO_00002076 Radionuclide dispersal modelling study Mathematical modelling of radionuclide transfer and dispersal processes in water, earth or air, either directly or through the mediation of biota. 0000-0002-5111-7263 Environmental study +obo:RBO_00002077 Naturally occurring radioactive materials study Study of the ocurrence, levels and effects of naturally occurring radioactive materials such as Radon. 0000-0002-5111-7263 Environmental study +obo:RBO_00002078 Environmental radiation monitoring study Study involving the measurement of radiation levels, or concentration of radionuclides, in the natural or man made environment. Usually in a time series. 0000-0002-5111-7263 Environmental study +obo:RBO_00002079 Environmental radionuclide transfer study Study concerned with the measurement of transfer of radionuclides to biota from the environment. 0000-0002-5111-7263 Environmental study +obo:RBO_00002080 Non ionising electromagnetic radiation study Any study concenrd with the prevalence or effects on non-ionising radiations such as UV, acoustic, or RF. 0000-0002-5111-7263 Environmental study obo:RBO_00002081 Nuclear installation study Study concerning the safety, regulation, activities and engineering of nuclear installations including power stations, waste processing plant, radionuclide generation and purification plant, and military nuclear establishments. May include occupational health studies if broader than just occupationaal health in scope. 0000-0002-5111-7263 Nuclear industry study obo:RBO_00002082 Nuclear waste study Study of the process of generation of nuclear waste, its monitoring, regulation, disposal and inadvertent discharge. 0000-0002-5111-7263 Nuclear industry study obo:RBO_00002083 Nuclear engineering study Study of the engineering of nuclear installations such as power plants. 0000-0002-5111-7263 Nuclear industry study @@ -255,11 +255,11 @@ obo:RBO_00002089 Whole organism study A study using an intact organism, plant obo:RBO_00002090 Bystander effect study Study of the cellular phenomenon which radiation energy is not been directly deposited in cells by transfer of medium, proximity/justaposition, or other means, but results in their behaving as if they had been irradiated. 0000-0002-5111-7263 Laboratory study obo:RBO_00002091 Epigenetic study A study of heritable phenotype changes that do not involve alterations in the DNA sequence. This may be in intact organisms or in cells and includes population analysis of epigenetic phenomena and molecular analysis of gene expression and epigenetic modifications of chromatin such as DNA methylation and histone acetylation. 0000-0002-5111-7263 Laboratory study obo:RBO_00002092 Mutagenesis study Study of the frequency of induction , nature and consequences of the production of genetic or epigenetic alterations by any technique, including chemicals, radiation, recombination, or other molecular biology methods. 0000-0002-5111-7263 Laboratory study -obo:RBO_00002093 Attitudinal studies nuclear industry risk perception Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or regulation of the nuclear industries. 0000-0002-5111-7263 Attitudinal study -obo:RBO_00002094 Attitudinal studies towards ionising radiation in the environment Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ecological integrity towards natural or anthropogenic ionising radiation in the environment. 0000-0002-5111-7263 Attitudinal study -obo:RBO_00002095 Attitudinal studies towards non-ionising radiation in the environment Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ecological integrity towards natural or anthropogenic non-ionising radiation in the natural environment. 0000-0002-5111-7263 Attitudinal study -obo:RBO_00002096 Attitudinal studies towards medical radiation procedures Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety and efficacy in a clinical context where radiation is used for diagnostic or therapeutic procedures.. 0000-0002-5111-7263 Attitudinal study -obo:RBO_00002097 Attitudinal studies towards radiation in the occupational environment Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety towards natural or anthropogenic non-ionising radiation in the occupational environment. 0000-0002-5111-7263 Attitudinal study +obo:RBO_00002093 Attitudinal study of nuclear industry risk perception Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or regulation of the nuclear industries. 0000-0002-5111-7263 Attitudinal study +obo:RBO_00002094 Attitudinal study towards ionising radiation in the environment Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ecological integrity towards natural or anthropogenic ionising radiation in the environment. 0000-0002-5111-7263 Attitudinal study +obo:RBO_00002095 Attitudinal study towards non-ionising radiation in the environment Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety or ecological integrity towards natural or anthropogenic non-ionising radiation in the natural environment. 0000-0002-5111-7263 Attitudinal study +obo:RBO_00002096 Attitudinal study towards medical radiation procedures Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety and efficacy in a clinical context where radiation is used for diagnostic or therapeutic procedures.. 0000-0002-5111-7263 Attitudinal study +obo:RBO_00002097 Attitudinal study towards radiation in the occupational environment Studies of the status or origins of a mental position, feeling or emotion toward a fact or state with respect to information or experience concerning radiation, radiation safety towards natural or anthropogenic non-ionising radiation in the occupational environment. 0000-0002-5111-7263 Attitudinal study obo:RBO_00002098 Authority trust study Study of social and individual trust in the position and activities of legal or other competent advisory or regulatory authorities. 0000-0002-5111-7263 Attitudinal study obo:RBO_00002099 Risk communication study Study on the modality, efficacy and responses to communcation of information or advice to populations or individuals, on the safety and risks of exposure to ionising radiation in any context. 0000-0002-5111-7263 Communication study obo:RBO_00002100 Public communication study Study on the modality, efficacy and responses to communication of information or advice to populations or individuals, on the safety and risks of exposure to ionising radiation in any context. 0000-0002-5111-7263 Communication study @@ -272,10 +272,10 @@ obo:RBO_00002106 Population behaviour study A study concerned with human or a obo:RBO_00002107 Radiotherapeutic modelling study Mathematical modelling for theraputic regime optimisation and for optimal tumor response, for example modelling spatiotemporal dynamics of tumor and blood volume fraction, and predicting response to radiation therapy. Also studies for beam modelling and multiimaging techniques. 0000-0002-5111-7263 Therapeutics study obo:RBO_00002108 Building materials radiological safety study Study of the radiolonuclide components and emissions from building materials 0000-0002-5111-7263 Environmental study_ Abiotic_anthropogenic obo:RBO_00002109 Building radiological safety study Studies on radiological safety within buildings. Primary purpose os for buildings not specifially designed to hold radioactive materials but anaylyis and mitigation of risks from radioactive exposure from the local environment or materials. 0000-0002-5111-7263 Environmental study_ Abiotic_anthropogenic -obo:RBO_00002110 Meteorology study Study of the weather and atmospheric dynamics mainly with respect to dissemination of radionuclides. 0000-0002-5111-7263 Natural environment studies -obo:RBO_00002111 Environmental study_Abiotic Study of non-living objects in the environment, such as soils or rocks. 0000-0002-5111-7263 Natural environment studies -obo:RBO_00002112 Environmental study_Biota ( non human) Study of non-human biota in the natural environment. 0000-0002-5111-7263 Natural environment studies -obo:RBO_00002113 Environmental study_Panbiota (all) Study which may include human and non-human biota in the environment. 0000-0002-5111-7263 Natural environment studies +obo:RBO_00002110 Meteorology study Study of the weather and atmospheric dynamics mainly with respect to dissemination of radionuclides. 0000-0002-5111-7263 Natural environment study +obo:RBO_00002111 Environmental study_Abiotic Study of non-living objects in the environment, such as soils or rocks. 0000-0002-5111-7263 Natural environment study +obo:RBO_00002112 Environmental study_Biota ( non human) Study of non-human biota in the natural environment. 0000-0002-5111-7263 Natural environment study +obo:RBO_00002113 Environmental study_Panbiota (all) Study which may include human and non-human biota in the environment. 0000-0002-5111-7263 Natural environment study obo:RBO_00002114 Wireless communication radiation study Study of the measurement, effects and regulation of wireless communication signals, for example mobile phone radiation and microwave communication. 0000-0002-5111-7263 Non ionising electromagnetic radiation study obo:RBO_00002115 Gamma ray photon Photons having energies that are greater than tens of thousands of electron volts (eV). Britannica.com The sample was irradiated with Cs-137 gamma ray photons. CHEBI:30212 obo:RBO_00002116 X-ray photon A photon with energies from about 100 eV (electron volts) to 1 MeV (million electron volts). Britannica.com The sample was irradiated with x-ray photons. CHEBI:30212 @@ -284,7 +284,7 @@ http://purl.obolibrary.org/obo/OBI_0302889 obo:RBO_00002117 obo:RBO_00002118 Radioactive decay A process involving the emission of energy from an atomic nucleus resulting in change in the character of the nucleus obo:RBO_00015006 obo:RBO_00002119 Unplanned irradiation Irradiation that is not the result of a planned process obo:RBO_00002000 obo:RBO_00002120 Unplanned anthropogenic irradiation Unplanned irradiation that is of anthropogenic origin obo:RBO_00002119 -obo:RBO_00002121 Unplanned non-anthropogenic irradiation Unplanned irradiation that is non-anthropogenic in origin obo:RBO_00002119 +obo:RBO_00002121 Unplanned naturally occurring radiation exposure Unplanned irradiation that is non-anthropogenic in origin obo:RBO_00002119 obo:RBO_00002122 Environmental radiation monitoring Environmental monitoring that includes continual assay for radiation dose or quality. http://purl.obolibrary.org/obo/ENVO_02500041 obo:RBO_00002123 Natural environment monitoring Monitoring within an environment which was not man-made. http://purl.obolibrary.org/obo/ENVO_02500041 obo:RBO_00002124 Anthropogenic environment monitoring Monitoring within a man-made or constructed environment http://purl.obolibrary.org/obo/ENVO_02500041 @@ -299,10 +299,17 @@ obo:RBO_00015005 beta decay Radioactive decay in which a beta particle is emi obo:RBO_00015006 subatomic process Processes in which electrons or components of the atomic nucleus are participants. BFO:0000015 obo:RBO_00015007 nanodosimetric measurement datum Measurement of the pattern (frequency and spatial distribution) of ionization events produced by energy deposition in time and space in a substance characterized by linear dimensions of the order of 1-100 nanometers obo:RBO_010016 obo:RBO_00015008 specific energy measurement datum In microdosimetry the specific energy, z, is the energy deposited by radiation ( in one or more deposition events) in a specified micrometric (or smaller) site divided my the mass of the site. Measured in Gy. obo:RBO_010016 -obo:RBO_00015009 particle track The path of a particle in matter, delineated by sites where the particle deposits energy. BFO:0000015 +obo:RBO_00015009 particle track The path of a particle in matter, delineated by sites where the particle deposits energy. obo:IAO_0000030 obo:RBO_00015010 nanodosimetry A pattern (frequency and spatial distribution) of ionization events produced by energy deposition in time and space in a substance characterized by linear dimensions of the order of 1-100 nanometers. PATO:0001241 obo:RBO_00015011 particle track structure The complete set of spatial coordinates of energy deposition events along a particle track in matter PATO:0001236 obo:RBO_00015012 ionization cluster A group of ionization events closely related in time and space, occurring in a specified target volume and originating from a single primary ionizing particle. UBERON:0000000 obo:RBO_00015013 microdosimetric measurement datum Measurement of the pattern (frequency and spatial distribution) of ionization events produced by energy deposition in time and space in a substance characterized by linear dimensions of the order of 1-100 micrometers. obo:RBO_010016 -obo:RBO_00015014 micrometric volume A volume of matter characterised by linear dimensions of the order of 0.5- 10's of microns, referred to as the "site" in microdosimetry. PATO:0001241 +obo:RBO_00015014 micrometric volume "A volume of matter characterised by linear dimensions of the order of 0.5- 10's of microns, referred to as the ""site"" in microdosimetry." PATO:0001241 obo:RBO_00015015 control specimen role A control specimen role of a biotic or abiotic sample or individual describes a specimen by its purpose, and therefore treatment, within a planned experimental process that tests hypotheses by isolating variables as dictated by the scientific method in order to make a conclusion about the effect of such variables. The quality of control inhering in the sample role exists as a result of the historical treatment of the sample. In a controlled experiment, two or more virtually identical experiments are conducted, but the factor being tested is varied in only one of them. This serves to isolate any causal phenomena. A control may have been subject to treatments during the experiment that might alter its state or behaviour and is therefore distinguishable from the sample as initial input into the experiment. However such treatments should in all cases but that of the variable under scrutiny, be the same as the experimental sample. OBI:0000112 http://ncicb.nci.nih.gov/xml/owl/EVS/Thesaurus.owl#C64355 +obo:RBO_00015016 approximate sham irradiation Sham irradiation in which an identical irradiation protocol (with the exception of the administration of the radiation exposure) is not followed in every respect. Use approximate sham irradiation when at least one aspect of the irradiation (with the exception of the administration of the radiation exposure) is not followed precisely. For example, Not placing an organism or sample in a beam line for the same length of time as the irradiated organism(s) or sample(s) were left in the beam. obo:RBO_00005015 +obo:RBO_00015017 internal radiation exposure Exposure to an inhaled, ingested, injected or implanted source of radiation of any origin as part of a planned or accidental process. Experimental internal radiation exposure of rodents to radon gas through inhalation. obo:RBO_00002000 +obo:RBO_00015018 external radiation exposure Exposure to an external source of radiation of any origin or type. Mice exposed to external radiation from a Sr source. https://orcid.org/0000-0002-5111-7263 obo:RBO_00002000 +obo:RBO_00015019 complete sham irradiation Sham irradiation in which an identical irradiation protocol is followed in every respect, with the exception of the administration of the radiation exposure. Use complete sham irradiation when all steps of an irradiation protocol are followed for sham control group (with the exception of administration of the radiation exposure). obo:RBO_00005015 +obo:RBO_00015020 internal experimental radiation exposure Planned exposure of an entity to radiation of any type, for example as part of a medical or experimental procedure with the intention of exposing the entity to radiation energy internally by the ingestion, inhalation or implantation of a source of radiation. https://orcid.org/0000-0002-5111-7263 Research subjects participating in a clinical trial using an internally implanted radiation source have an internal experimental radiation exposure obo:RBO_00002008|obo:RBO_00015017 +obo:RBO_00015021 energy deposition event The direct or indirect transfer of energy from radiation to a medium through ionisation or excitation of the atoms of the medium. obo:RBO_00015006 +obo:RBO_00015022 track formation http://purl.obolibrary.org/obo/BFO_0000015 diff --git a/src/templates/RBO_individuals.tsv b/src/templates/RBO_individuals.tsv index a1af81d..efa58c8 100644 --- a/src/templates/RBO_individuals.tsv +++ b/src/templates/RBO_individuals.tsv @@ -14,11 +14,11 @@ obo:RBO_00000041 ISS-Japanese Experiment Module JEM "A Japanese science module obo:RBO_00000042 ISS-Columbus Columbus "An instance of a module on the International Space Station, operated by the European Space Agency." Wikipedia The experiment was conducted on the Columbus module on the ISS individual International Space Station module Columbus laboratory obo:RBO_00000043 ISS-Zvezda Zvezda "An instance of a module on the International Space Station, operated by the Russian Space Agency." Wikipedia The experiment was conducted in the Zvezda module of the ISS. individual International Space Station module Russian Service Module obo:RBO_00000048 SIS18 "An particle accelerator located at the GSI Helmholtz Centre for Heavy Ion Research, Darmstadt, Germay." The experiment was carried out at the SIS-18 accelerator. individual obo:RBO_00000121 -obo:RBO_00000053 NSRL Solar Particle Event Simulation NSRL SPESim "The NSRL SPE simulatoris based on the fluence of the August 1972 event, with an energy spectrum similar to the March 1989 event. The majority of the protons are at very low energies, below 1 MeV, and pose little to no risk to astronauts in a space craft or space suit. The SPESim begins with 50 MeV protons, which amounts to 91.66% of the total dose. Then the beam energy increments in steps of 10 MeV up to 150 MeV where 0.14% of the total dose is delivered." The samples were irradiated using the NSRL Solar Particle Event Simulation. individual mixed radiation field NSRL SPESim +obo:RBO_00000053 NSRL Solar Particle Event Simulation NSRL SPESim "The NSRL SPE simulatoris based on the fluence of the August 1972 event, with an energy spectrum similar to the March 1989 event. The majority of the protons are at very low energies, below 1 MeV, and pose little to no risk to astronauts in a space craft or space suit. The SPESim begins with 50 MeV protons, which amounts to 91.66% of the total dose. Then the beam energy increments in steps of 10 MeV up to 150 MeV where 0.14% of the total dose is delivered." The samples were irradiated using the NSRL Solar Particle Event Simulation. individual mixed radiation NSRL SPESim obo:RBO_00000056 Kyoto University Research Reactor-Heavy Water Neutron Irradiation Facility KUR-HWNIF "A heavy water tank of approximately 2 m3 adjacent to the core of the Kyoto University Research Reactor (KUR), a light-water moderated tank-type reactor." The samples were irradiated with thermal neutrons at the KUR-HWNIF individual nuclear reactor KUR-HWNIF obo:RBO_00000057 Hiroshima University Radiobiological Research Accelerator HIRRAC "A neutron generator at the Research Institute for Radiation Biology and Medicine, Hiroshima University (RIRBM). Monoenergetic neutrons of which energy is less than 1.3 MeV are generated by the 7Li(p,n)7 Be reaction at proton energies up to 3 MeV." The samples were irradiated with fast neutrons at the HIRRAC. individual obo:RBO_00000121 HIRRAC obo:RBO_00000059 Brookhaven National Laboratory Gamma Radiation Source Facility BNL GRSF "The Gamma Radiation Facility known as GRSF houses a cesium-137 gamma ray source which can provide gamma rays at a variety of dose rates. The gamma source is an industry standar dJ.L. Shepherd Mark I Model 68A 137Cs ? Irradiator. The photon energy from the source is 662 keV, with a Lineal Energy Transfer (LET) in water of approximately 0.8 keV/um. (https://www.bnl.gov/nsrl/grsf/)" Jack Miller individual obo:RBO_00005039 BNL GRSF -obo:RBO_00000054 NSRL Simplified Galactic Cosmic Ray Simulation NSRL SimGCRSim The NSRL Simplified Galactic Cosmic Ray Simulation uses 6 beams and 5 different ions including protons at two different energies. https://www.bnl.gov/nsrl/userguide/SimGCRSim.php The samples were irradiated using the NSRL Simplified Galactic Cosmic Ray Simulation. individual mixed radiation field NSRL SimGCRSim +obo:RBO_00000054 NSRL Simplified Galactic Cosmic Ray Simulation NSRL SimGCRSim The NSRL Simplified Galactic Cosmic Ray Simulation uses 6 beams and 5 different ions including protons at two different energies. https://www.bnl.gov/nsrl/userguide/SimGCRSim.php The samples were irradiated using the NSRL Simplified Galactic Cosmic Ray Simulation. individual mixed radiation NSRL SimGCRSim obo:RBO_00005073 Gammacell 40 http://www.theratronics.ca/PDFs/GC40_BTMB_8008GC40E_2_v112013_webSECURE.pdf individual obo:RBO_00005039 obo:RBO_00005075 RARAF 5.5 MV microbeam https://www.crr.columbia.edu/services/ion-beam-and-neutron-core-facility individual obo:RBO_00005042 obo:RBO_00005076 Swift HALE https://www.nasa.gov/feature/ames/nasa-small-business-partnership-prepares-drone-for-30-day-science-flights individual obo:RBO_00005035